Log In
David Mosiah claim, Cerro Huañaquina, Yocalla Municipality, Tomás Frías Province, Potosí, Boliviai
| Regional Level Types | |
|---|---|
| David Mosiah claim | Claim |
| Cerro Huañaquina | Mountain |
| Yocalla Municipality | Municipality |
| Tomás Frías Province | Province |
| Potosí | Department |
| Bolivia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Magnetite-feldspar-apatite veins in dacitic volcanic rock. Located 20-25 km from Potosi city.
Most apatite specimens have come from the David Mosiah prospect, but magnetite specimens have come from at least 4 places on the mountain.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ 'Feldspar Group' References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hematite var. Martite Formula: Fe2O3 References: |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) References: |
| ✪ Hydroxylapatite var. Carbonate-rich Hydroxylapatite Formula: Ca5(PO4,CO3)3(OH,O) References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: |
| ⓘ 'Limonite' References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ 'Mica Group' References: |
| ⓘ Perovskite Formula: CaTiO3 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Rutile Formula: TiO2 References: |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Titanite Formula: CaTi(SiO4)O References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Hydroxylapatite var. Carbonate-rich Hydroxylapatite | 8.BN.05 | Ca5(PO4,CO3)3(OH,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3(OH) | |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Mica Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | Oxygen | |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| P | Phosphorus | |
| P | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| Ca | Calcium | |
| Ca | ⓘ Hydroxylapatite var. Carbonate-rich Hydroxylapatite | Ca5(PO4,CO3)3(OH,O) |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
David Mosiah claim, Cerro Huañaquina, Yocalla Municipality, Tomás Frías Province, Potosí, Bolivia