Log In
Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne), St Agnes, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne) | Mine |
| St Agnes | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 19' 3'' North , 5° 11' 53'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
SW726509
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Saint Agnes | 2,820 (2014) | 0.7km |
| Mount Hawke | 1,511 (2017) | 4.0km |
| Perranporth | 3,210 (2017) | 4.2km |
| Chacewater | 1,226 (2017) | 7.4km |
| North Country | 773 (2017) | 8.0km |
Wheal Kitty is mentioned by Borlase in 1758 and Goonlaze and Pink by Price in 1778.
Worked for a time after 1917 as Kitty and Penhalls United.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities16 valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | var. Toad's Eye Tin | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline var. Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Cassiterite var. Toad's Eye Tin | SnO2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| Sn | ⓘ Cassiterite var. Toad's Eye Tin | SnO2 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Localities in this Region
- England
- Cornwall
- St Agnes
- Wheal Kitty (Kitty and Penhalls United Mine; incl. Goonlaze Mine; Wheal Osborne)
- St Agnes
- Cornwall
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornwall
- St Agnes Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Wheal Kitty, St Agnes, Cornwall, England, UK