Log In
Tabataud quarry, Nontron, Nontron, Dordogne, Nouvelle-Aquitaine, Francei
| Regional Level Types | |
|---|---|
| Tabataud quarry | Quarry |
| Nontron | Commune |
| Nontron | Arrondissement |
| Dordogne | Department |
| Nouvelle-Aquitaine | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 31' 32'' North , 0° 40' 28'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Nontron | 3,778 (2016) | 1.0km |
| Saint-Martial-de-Valette | 830 (2016) | 2.2km |
| Savignac-de-Nontron | 196 (2016) | 4.1km |
| Sceau-Saint-Angel | 125 (2016) | 4.9km |
| Saint-Martin-le-Pin | 322 (2016) | 5.5km |
Other/historical names associated with this locality:
Aquitaine
Name(s) in local language(s):
Carrière Tabataud, Nontron, Dordogne, Aquitaine, France
The Tabataud granodiorite quarry, located near Nontron, Dordogne department, has yielded a rich lead mineralisation. Among this paragenesis, galena is certainly the most interesting.
The quarry was abadoned in 2003 and is now flooded.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Galena Formula: PbS References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ 'Ozocerite' ? References: |
| ⓘ 'Petroleum var. Bitumen' References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Wulfenite Formula: Pb(MoO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Ozocerite' ? | - | |
| ⓘ | 'Petroleum var. Bitumen' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Wulfenite | Pb(MoO4) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Fe | Iron | |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
Other Databases
| Link to Bureau de Recherches Géologiques et Minières: | 07344X0014/CAR |
|---|
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Tabataud quarry, Nontron, Nontron, Dordogne, Nouvelle-Aquitaine, France