Log In
Warsak Intrusions, Mohmand District, Khyber Pakhtunkhwa Province, Pakistani
| Regional Level Types | |
|---|---|
| Warsak Intrusions | Group of Intrusions |
| Mohmand District | District |
| Khyber Pakhtunkhwa Province | Province |
| Pakistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
34° 9' 57'' North , 71° 21' 29'' East
Latitude & Longitude (decimal):
Type:
Group of Intrusions
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Shabqadar | 66,541 (2015) | 18.9km |
| Landi Kotal | 2,223 (2015) | 21.3km |
| Shinpokh | 1,111 (2015) | 24.5km |
| Peshawar | 1,218,773 (2017) | 26.8km |
| Tangi | 29,444 (2015) | 30.9km |
Other/historical names associated with this locality:
Warzak
Located near Zagi mountain.
Several sill-like intrusions of granite and microgranite, much of which is peralkaline situated in the vicinity of town Warsak. There are also several sills of gabbro and dolerite which are intruded into metasediments. The whole sequence is folded and the basic rocks in particular are metamorphosed.
The WC has two varieties, distinguished as brownish and white. The brownish type shows significant iron staining due to oxidation, which is indicative of secondary alteration. Both varieties are calcite-dominated (>95%) with biotite (2%–5%), pyroxene (aegirine; 1%–2%), and accessory apatite.
Several sill-like intrusions of granite and microgranite, much of which is peralkaline situated in the vicinity of town Warsak. There are also several sills of gabbro and dolerite which are intruded into metasediments. The whole sequence is folded and the basic rocks in particular are metamorphosed.
The WC has two varieties, distinguished as brownish and white. The brownish type shows significant iron staining due to oxidation, which is indicative of secondary alteration. Both varieties are calcite-dominated (>95%) with biotite (2%–5%), pyroxene (aegirine; 1%–2%), and accessory apatite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities30 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Colour: from colorless to dark lead, with pink, blue, purple hues, some dichroic Description: Most of the cristals are gemmy and included with dark green to black needles or hairs. |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH References: |
| ⓘ 'Axinite Group' References: |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Chlorite Group' |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 References: Jose Zendrera CollectionIdentification: Visual Identification |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Formula: NaBSi3O8 Locality: Ganadao, Warsak Intrusions, Mohmand District, Khyber Pakhtunkhwa Province, Pakistan - erroneously reported Description: Turned out to be pink albite. |
| ⓘ Riebeckite Formula: ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ Rutile Formula: TiO2 References: MIM Museum collectionIdentified by Kevin Conroy: Visual Identification |
| ⓘ 'Scapolite' |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tschermakite Formula: ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Reedmergnerite ? | 9.FA.35 | NaBSi3O8 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Reedmergnerite | NaBSi3O8 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Reedmergnerite | NaBSi3O8 |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Reedmergnerite | NaBSi3O8 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Reedmergnerite | NaBSi3O8 |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
Geochronology
Mineralization age: Eocene : 43.5 ± 5 Ma to 41 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||||||||
| Cenozoic | |||||||||||||
| Paleogene | |||||||||||||
| Eocene |
| ||||||||||||
Localities in this Region
- Khyber Pakhtunkhwa Province
- Mohmand District
- Warsak Intrusions
- Mohmand District
Other Regions, Features and Areas containing this locality
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
Eurasian PlateTectonic Plate
Indian Plate
- Pakistan Fold and Thrust BeltOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Kempe, D. R. C. (1973) The petrology of the Warsak alkaline granites, Pakistan, and their relationship to other alkaline rocks of the region. Geological Magazine, 110 (5) 385-404 doi:10.1017/s0016756800036189
Warsak Intrusions, Mohmand District, Khyber Pakhtunkhwa Province, Pakistan