Log In
Bugle, Treverbyn, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Bugle | Village |
| Treverbyn | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 23' 46'' North , 4° 47' 36'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Bugle | 2,873 (2017) | 0.1km |
| Roche | 2,517 (2017) | 3.1km |
| Luxulian | 388 (2017) | 3.6km |
| Lanivet | 989 (2017) | 5.6km |
| St Austell | 25,447 (2017) | 6.1km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| British Micromount Society, Devon and Cornwall Branch Meetings | Liskeard, Cornwall | 24km |
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities21 valid minerals.
Detailed Mineral List:
| ⓘ Aheylite ? Formula: (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Cassiterite Formula: SnO2 Localities: Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK Rocks Tin Mine, Rocks and Treverbyn United Tin Mines, Bugle, Treverbyn, Cornwall, England, UK Imperial Goonbarrow China Clay Works, Bugle, Treverbyn, Cornwall, England, UK Old Beam Mine (Great Beam Mine), Bugle, Treverbyn, Cornwall, England, UK Wheal Henry China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK |
| ⓘ Chalcocite Formula: Cu2S Description: Reported from tin lodes in the deepest part of the mine, together with olivenite (Smyth, Reeks & Rudler, 1864). |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'Limonite' |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Description: Reported from tin lodes in the deepest part of the mine, together with chalcocite (Smyth, Reeks & Rudler, 1864). References: |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-CT Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O References: |
| ⓘ 'Pig's Egg' References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stannite Formula: Cu2FeSnS4 References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 References: |
| ⓘ Tenorite Formula: CuO References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: |
| ⓘ 'Tourmaline var. Achroite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O References: |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Opal-CT | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Aheylite ? | 8.DD.15 | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Tourmaline var. Achroite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Pig's Egg' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Opal var. Opal-CT | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Fe | Iron | |
| Fe | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Cu | Copper | |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tenorite | CuO |
| Zn | Zinc | |
| Zn | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Localities in this Region
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornwall
- St Austell Mining DistrictMining District
- Devon and Cornwall metalliferous mining districtMining District
- Cornwall
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Goonbarrow China Clay Pit, Bugle, Treverbyn, Cornwall, England, UK