Log In
Langenwang, Bruck-Mürzzuschlag District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Langenwang | Municipality |
| Bruck-Mürzzuschlag District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Langenwang | 3,119 (2018) |
| Mitterberg | 123 (2018) |
| Feistritzberg | 117 (2018) |
Other Languages:
French:
Langenwang, district de Bruck-Mürzzuschlag, Styrie, Autriche
German:
Langenwang, Bezirk Bruck-Mürzzuschlag, Steiermark, Österreich
Italian:
Langenwang, distretto di Bruck-Mürzzuschlag, Stiria, Austria
Russian:
Лангенванг, Брук-Мюрцушлаг, Штирия, Австрия
Simplified Chinese:
朗根旺, 施泰爾馬克州, 奥地利
Spanish:
Langenwang, Distrito de Bruck-Mürzzuschlag, Estado de Estiria, Austria
Catalan:
Langenwang, Estíria, Àustria
Cebuano:
Langenwang, Steiermark, Awstriya
Czech:
Langenwang, Okres Bruck-Mürzzuschlag, Štýrsko, Rakousko
Dutch:
Langenwang, Bruck-Mürzzuschlag, Stiermarken, Oostenrijk
Esperanto:
Langenwang, Distrikto Bruck-Mürzzuschlag, Stirio, Aŭstrio
Farsi/Persian:
لانگنوانگ, بروک مورتسوچلاگ, اشتایرمارک, اتریش
Hungarian:
Langenwang, Bruck-mürzzuschlagi járás, Stájerország, Ausztria
Latin:
Langenwang, Styria, Austria
Polish:
Langenwang, Powiat Bruck-Mürzzuschlag, Styria, Austria
Slovak:
Langenwang, Bruck-Mürzzuschlag, Štajersko, Rakúsko
Swedish:
Langenwang, Bruck-Mürzzuschlag, Steiermark, Österrike
Ukrainian:
Лангенванг, Брук-Мюрццушлаг, Штирія, Австрія
Uzbek (Latin Script):
Langenwang, Avstriya
Vietnamese:
Langenwang, Steiermark, Áo
Volapük:
Langenwang, Lösterän
Waray:
Langenwang, Styria, Austrya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities30 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Description: rock forming mineral |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Hirnriegel, Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Amundsenhöhe, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Fürstenbauer, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria |
| ⓘ Augelite Formula: Al2(PO4)(OH)3 Localities: Colour: white Description: cm-sized, round aggregates in lazulite |
| ✪ Bearthite Formula: Ca2Al(PO4)2(OH) Habit: subhedral to anhedral, partly broken crystals in quartz Colour: slighly yellowish to light grey Fluorescence: none Description: molar Ca/(Ca+Sr) > 0.95 - 0.90. References: |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ 'Chlorite Group' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Corundum Formula: Al2O3 Description: accessory mineral |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Localities: Description: fills narrow cracks in lazulite, with goyazite |
| ⓘ Diaspore ? Formula: AlO(OH) Description: alteration product of corundum, could be also another AlO(OH) mineral |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ Florencite-(La) Formula: LaAl3(PO4)2(OH)6 Description: Tiny grains (<< 0.1 mm) in apatite. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: C.Auer (2025)Identified by Christian Auer: SEM-EDS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 Localities: Description: filling narrow cracks in lazulite, with crandallite |
| ⓘ Hematite Formula: Fe2O3 Description: dm-sized, granular and platy masses with quartz |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kyanite Formula: Al2(SiO4)O Description: with grey apatite filling cracks in lazulite |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 Localities: Fürstenbauer, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Grablbauer, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Amundsenhöhe, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Colour: pale blue, pale green Description: dm-sized masses with quartz, muscovite, apatite |
| ⓘ 'Limonite' References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Hirnriegel, Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Amundsenhöhe, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Fürstenbauer, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Pretulite Formula: Sc(PO4) Localities: Description: grains up to 0.1 mm large in lazulite; pretulite was first recognized as a new mineral species in material from Fürstenbauer-NW at 4.1.1996. Type locality of pretulite, however, is Höllkogel. |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Strengite Formula: FePO4 · 2H2O References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Description: tourmaline-quartz veinlet in garnet-albite-schist |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Diaspore ? | 4.FD.10 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Pretulite | 8.AD.35 | Sc(PO4) |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Augelite | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Bearthite | 8.BG.05 | Ca2Al(PO4)2(OH) |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Florencite-(La) | 8.BL.13 | LaAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Pretulite | Sc(PO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Pretulite | Sc(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Sc | Scandium | |
| Sc | ⓘ Pretulite | Sc(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| La | Lanthanum | |
| La | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Ce | Cerium | |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Langenwang |
|---|---|
| Wikidata ID: | Q695639 |
| GeoNames ID: | 7872458 |
Localities in this Region
- Styria
- Bruck-Mürzzuschlag District
- Langenwang
- Bruck-Mürzzuschlag District
- Styria
- Bruck-Mürzzuschlag District
- Langenwang
- Bruck-Mürzzuschlag District
Other Regions, Features and Areas that Intersect
Austria
- Styria
- Fischbach AlpsMountain Range
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
- Panonian BasinWide Rift
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fürstenbauer, Pretulgraben, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria