Log In
Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Ornavasso | Commune |
| Verbano-Cusio-Ossola Province | Province |
| Piedmont | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Urnafasch
Other Languages:
French:
Ornavasso, Province du Verbano-Cusio-Ossola, Piémont, Italie
German:
Ornavasso, Provinz Verbano-Cusio-Ossola, Piemont, Italien
Italian:
Ornavasso, Provincia del Verbano-Cusio-Ossola, Piemonte, Italia
Russian:
Орнавассо, Провинция Вербано-Кузио-Оссола, Пьемонт, Италия
Simplified Chinese:
奥尔纳瓦索, 韋爾巴諾-庫西亞-奧索拉省, 皮埃蒙特, 意大利
Spanish:
Ornavasso, Provincia de Verbano-Cusio-Ossola, Piamonte, Italia
Alemannic:
Ornavasso, Provinz Verbano-Cusio-Ossola, Piemont, Italie
Armenian:
Օրնավասո, Վերբանիո-Կուզիո-Օսոլա, Պիեմոնտ, Իտալիա
Basque:
Ornavasso, Verbano-Cusio-Ossolako probintzia, Piemonte, Italia
Bavarian:
Ornavasso, Provinz Verbano-Cusio-Ossola, Italien (Walsch; Belischelant; Balschlònt)
Belarusian:
Арнаваса, правінцыя Вербана-Кузья-Асола, П’емонт, Італія
Bulgarian:
Орнавасо, Вербано-Кузио-Осола, Пиемонт, Италия
Catalan:
Ornavasso, Província de Verbano-Cusio-Ossola, Piemont, Itàlia
Cebuano:
Ornavasso, Provincia Verbano-Cusio-Ossola, Piemonte, Italya
Czech:
Ornavasso, Provincie Verbano-Cusio-Ossola, Piemont, Itálie
Danish:
Ornavasso, Verbano-Cusio-Ossola, Piemonte, Italien
Dutch:
Ornavasso, Verbano-Cusio-Ossola, Piëmont, Italië
Esperanto:
Ornavasso, Provinco Verbano-Cusio-Ossola, Piemonto, Italio
Farsi/Persian:
اورناواسو, استان وربانو-کوزیو-اوسولا, پیمونت, ایتالیا
Finnish:
Ornavasso, Verbano-Cusio-Ossolan maakunta, Piemonte, Italia
Hungarian:
Ornavasso, Verbano-Cusio-Ossola megye, Piemont, Olaszország
Japanese:
オルナヴァッソ, ヴェルバーノ・クジオ・オッソラ県, ピエモンテ州, イタリア
Kazakh (Cyrillic Script):
Орнавассо, Пьемонт, Италия
Latin:
Ornavasium, Provincia Verbanensis Cusiana Oscelensis, Pedemontium, Italia
Lombard:
Urnavass, Pruvincia del Verban-Cüsi-Ossula (Provincia del Verban-Cusi-Ossola), Piemont (Piemunt), Italia
Malay:
Ornavasso, Wilayah Verbano-Cusio-Ossola, Piemonte, Itali
Minnan / Hokkien-Taiwanese:
Ornavasso, Verbano-Cusio-Ossola Séng, Piemonte, Italia
Neapolitan:
Ornavasso, Pruvincia 'e Verbano Cusio Ossola, Piemunte, Italia
Occitan:
Ornavasso, Província del Verbano-Cusio-Ossola, Piemont, Itàlia
Piedmontese:
Ornavass, Provincia dël Verban-Cusi-Òssola, Piemont, Italia
Polish:
Ornavasso, Prowincja Cusio Ossola, Piemont, Włochy
Portuguese:
Ornavasso, Verbano Cusio Ossola, Piemonte, Itália
Romanian:
Ornavasso, Provincia Verbano-Cusio-Ossola, Piemont, Italia
Serbian:
Орнавасо, Вербано-Кузио-Осола, Пијемонт, Италија
Serbo-Croatian:
Ornavasso, Verbano-Cusio-Ossola, Pijemont, Italija
Sicilian:
Ornavasso, Pruvincia dô Virbanu-Cusiu-Ossula, Piemunti, Italia
South Azerbaijani:
اورناواسو, وربانو-کوزیو-اوسولا اوستانی, ایتالیا
Tagalog:
Ornavasso, Verbano Cusio Ossola, Piemonte, Italya
Tarantino:
Ornavasso, Provinge d'u Verbano-Cusio-Ossola, Piemonte, Itaglie
Ukrainian:
Орнавассо, Вербано-Кузіо-Оссола , П'ємонт, Італія
Uzbek (Latin Script):
Ornavasso, Verbano-Cusio-Ossola, Italiya
Vietnamese:
Ornavasso, Verbano-Cusio-Ossola, Piemonte, Ý
Volapük:
Ornavasso, Piemonte, Litaliyän
Waray:
Ornavasso, Verbano-Cusio-Ossola, Piemonte, Italya
All municipal territory of Ornavasso, that since 1928 includes also the territory of the former Migiandone municipality, consists of variably migmatized metasedimentary schists (garnet, biotite, plagioclase, quartz, sillimanite, and muscovite), known as the Kinzigite Formation (Ivrea-Verbano Zone), in which are included various layers and lenses of marble, quartzite, amphibolite, and pegmatites.
The rocks of the Kinzigite Formation host also some Fe-Cu-(Ni) ore mineralisations. Beside the well-known Migiandone mine, located SW of Migiandone village on the left side of Rio Blet, other two copper mines were opened in the second half of the XIX century (Jervis, 1873 and 1881) along the flanks of Punta Fenore:
- Ornavasso mine in the area Val Buona (Val Bona)-Kin, WNW of Ornavasso;
- Xixi mine in the area of Alpe Xixi (or Alpe Sichsi according to the modern spelling), SE of Migiandone mine.
Already exploited during antiquity, since the end of the 14th century the Ornavasso marble was used as building stone (together with the more valuable Candoglia marble) in the Milan Cathedral and in other famous monuments [see: http://www.mindat.org/loc-265614.html].
Large crystals of 'hornblende', the typical mineral of amphibolites included in the Kinzigite Formation, are known from the area Monte Massone-Eyehorn (Mattioli, 1979). A particular cummingtonite-bearing amphibolite can be observed in Val Buona (Boriani, 1965).
Various pegmatite bodies are known in the territory around Ornavasso. The most known is the Ornavasso pegmatite (Punt Sass pegmatite), exploited in the past for feldspar. Other interesting pegmatites have been observed in proximity of the Sactuary of Madonna del Boden: in a rocky spur above the road (schorl and muscovite are the main minerals; Natale, 1979), about 500 m before the sanctuary, and at the beginning of the road to the pastures of the area Monte Massone-Eyehorn (plagioclase crystals up to 20 cm in length, Mattioli, 1979).
The rocks of the Kinzigite Formation host also some Fe-Cu-(Ni) ore mineralisations. Beside the well-known Migiandone mine, located SW of Migiandone village on the left side of Rio Blet, other two copper mines were opened in the second half of the XIX century (Jervis, 1873 and 1881) along the flanks of Punta Fenore:
- Ornavasso mine in the area Val Buona (Val Bona)-Kin, WNW of Ornavasso;
- Xixi mine in the area of Alpe Xixi (or Alpe Sichsi according to the modern spelling), SE of Migiandone mine.
Already exploited during antiquity, since the end of the 14th century the Ornavasso marble was used as building stone (together with the more valuable Candoglia marble) in the Milan Cathedral and in other famous monuments [see: http://www.mindat.org/loc-265614.html].
Large crystals of 'hornblende', the typical mineral of amphibolites included in the Kinzigite Formation, are known from the area Monte Massone-Eyehorn (Mattioli, 1979). A particular cummingtonite-bearing amphibolite can be observed in Val Buona (Boriani, 1965).
Various pegmatite bodies are known in the territory around Ornavasso. The most known is the Ornavasso pegmatite (Punt Sass pegmatite), exploited in the past for feldspar. Other interesting pegmatites have been observed in proximity of the Sactuary of Madonna del Boden: in a rocky spur above the road (schorl and muscovite are the main minerals; Natale, 1979), about 500 m before the sanctuary, and at the beginning of the road to the pastures of the area Monte Massone-Eyehorn (plagioclase crystals up to 20 cm in length, Mattioli, 1979).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities50 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Aragonite Formula: CaCO3 References: |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Formula: Mn2+Al2(Si2O6)(OH)4 Locality: Ornavasso pegmatite, Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy - erroneously reported Description: The carpholite from Ornavasso is a Mn-bearing variety of dumortierite. |
| ⓘ 'Chabazite' |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' |
| ⓘ Gahnite Formula: ZnAl2O4 References: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hübnerite Formula: MnWO4 Habit: lamellar xls Colour: black Description: xls to several cm. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Copper Formula: Cu |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 References: |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 References: Franco Luca Bonino's collectionIdentified by Franco Luca Bonino: Visual Identification |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Ornavasso marble quarries, Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy Val Buona (Val Bona), Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy Migiandone Mine (Miggiandone), Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 References: |
| ⓘ 'Scapolite' |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Spinel Formula: MgAl2O4 References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Valleriite Formula: (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Valleriite | 2.FD.30 | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Carpholite ? | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Valleriite | (Fe2+,Cu)4(Mg,Al)3S4(OH,O)6 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Ornavasso |
|---|---|
| Wikidata ID: | Q23665 |
| GeoNames ID: | 6541403 |
Localities in this Region
- Piedmont
- Verbano-Cusio-Ossola Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
- Ivrea ZoneTerrane
Italy
- Piedmont
- Verbano-Cusio-Ossola Province
- Ossola ValleyValley
- Verbano-Cusio-Ossola Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Ornavasso, Verbano-Cusio-Ossola Province, Piedmont, Italy