Pueblina Mine, Caracoles, Tocopilla Province, Antofagasta, Chilei
| Regional Level Types | |
|---|---|
| Pueblina Mine | Mine |
| Caracoles | - not defined - |
| Tocopilla Province | Province |
| Antofagasta | Region |
| Chile | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude:
22° South , 69° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~117km
Type:
Name(s) in local language(s):
Mina Pueblina
An abandoned old Ag-Pb mine, within the famous Caracoles district, that has produced a fortune in chilean silver age (during late 1800).
Ref.:
Peebles F./Ruiz Fuller C. (1988): "Yacimientos metalíferos de Chile", Fondecyt, Stgo.de Chile, Chile.
(Special thanks must be given to Dr. Jochen Schluter, Curator of the Hamburg Mineral Museum, Germany, for it's invaluable help in identifying the minerals).
Dini M. ref.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Galena Formula: PbS |
| ⓘ Hemihedrite Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ Iranite Formula: Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Hemihedrite | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Iranite | 7.FC.15 | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| C | Carbon | |
| C | ⓘ Cerussite | PbCO3 |
| O | Oxygen | |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| Si | Silicon | |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Cr | Chromium | |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Cu | Copper | |
| Cu | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Zn | Zinc | |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Proustite | Ag3AsS3 |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Sb | Antimony | |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Pb | Lead | |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
Other Regions, Features and Areas containing this locality
Chile
- Atacama DesertDesert
South AmericaContinent
- AndesMountain Range
South America PlateTectonic Plate
- Arequipa ProvinceAccretionary Complex
- Atacama basinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.




Pueblina Mine, Caracoles, Tocopilla Province, Antofagasta, Chile