Andrianampy, Sahatany Valley, Ibity, Antsirabe II District, Vakinankaratra, Madagascari
| Regional Level Types | |
|---|---|
| Andrianampy | Quarry |
| Sahatany Valley | Valley |
| Ibity | Commune |
| Antsirabe II District | Rural District |
| Vakinankaratra | Region |
| Madagascar | Country |
Andrianampy, Sahatany Valley, Sahatany Pegmatite Field (Mt Ibity area), Madagascar
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
20° 3' 2'' South , 46° 59' 20'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Antsirabe | 186,253 (2018) | 21.0km |
| Betafo | 29,785 (2018) | 28.2km |
| Soanindrariny | 21,000 (2018) | 30.5km |
| Fandriana | 31,437 (2018) | 45.9km |
| Antanifotsy | 70,626 (2018) | 56.2km |
Other/historical names associated with this locality:
Sahatany pegmatite field
Other Languages:
Malagasy:
Andrianampy, Lohasahan'i Sahatany, Kaominin' Alatsinainy Ibity, Distrikan' Antsirabe II, Vakinankaratra, Madagasikara
Old pegmatite quarry situated about 1 km N of the cement plant near Mt. Ibity.
An LCT pegmatite dike about 40 m long and 6-8 m wide has been worked mostly for gemmy red tourmaline. The pegmatite is hosted in mica schist and is heavily altered and kaolinized.
Raktoarison (1964) locality nr 20.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
8 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Beryl Formula: Be3Al2(Si6O18) Colour: blue-green |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'Lepidolite' References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n |
| ⓘ 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' Formula: (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Colour: Red, black,rose, green |
| ⓘ 'Tourmaline var. Rubellite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Pyrochlore Supergroup var. Betafite (of Hogarth 1977)' | - | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| F | Fluorine | |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ti | Titanium | |
| Ti | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Pyrochlore Supergroup var. Betafite (of Hogarth 1977) | (Ca,Na,U)2(Ti, Nb,Ta)2O6Z(OH) |
Other Regions, Features and Areas containing this locality
AfricaContinent
African Plate
- Antenanarivo BlockOrogenic Belt
Madagascar
- Ankaratra Volcanic RangeVolcanic Range
- ⭔Antananarivo ProvinceProvince
- Sahatany Pegmatite Field (Mt Ibity area)Pegmatite Field
Somali PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Andrianampy, Sahatany Valley, Ibity, Antsirabe II District, Vakinankaratra, Madagascar