Log In
Oberdorf mining district, Rennweg am Katschberg, Spittal an der Drau District, Carinthia, Austriai
| Regional Level Types | |
|---|---|
| Oberdorf mining district | Mining District |
| Rennweg am Katschberg | Municipality |
| Spittal an der Drau District | District |
| Carinthia | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 1' 56'' North , 13° 34' 45'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Name(s) in local language(s):
Oberdorf, Rennweg, Hafnergruppe, Hohe Tauern, Kärnten, Österreich
Larger historic (?-1927, "Tiroler Montanwerke Ges.m.b.H.") gold mining area near Oberdorf.
Pichler (2009) divides it into Oberdorf-West and Oberdorf-South.
West: old prospects at an alt. of 1320-1330 m.
South: several adits: Stollen (alt. 1380 m), Nikolaistollen (1350 m, last mining activities 1927), Nikolaistollen-Förderstrecke (1340 m), Zubaustollen (1300 m), Stollen (1275 m), Sebastian Schurfstollen (1265 m), mining buildings (1240 m).
Note: coordinates are very approximate.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Altaite Formula: PbTe References: |
| ⓘ Boulangerite Formula: Pb5Sb4S11 References: |
| ⓘ Bournonite Formula: PbCuSbS3 References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Cubanite Formula: CuFe2S3 References: |
| ⓘ Galena Formula: PbS References: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Mackinawite Formula: FeS References: |
| ⓘ Molybdenite Formula: MoS2 References: |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | Oxygen | |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
Austria
- Ankogel GroupMountain Range
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
- Hohe Tauern (High Tauern)Mountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
