Towong Shire, Victoria, Australiai
| Regional Level Types | |
|---|---|
| Towong Shire | Shire |
| Victoria | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
comté de Towong, Victoria, Australie
German:
Towong Shire, Victoria, Australien
Italian:
contea di Towong, Victoria, Australia
Russian:
Товонг, Виктория, Австралия
Spanish:
Condado de Towong, Victoria, Australia
Cebuano:
Towong, State of Victoria
Dutch:
Towong Shire, Victoria, Australië
Sardinian:
contea de Towong
Swedish:
Towong, Victoria, Australien
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities62 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 Description: Poorly-crystalline bismite containing tellurium. |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Eulytine Formula: Bi4(SiO4)3 References: |
| ⓘ 'Feldspar Group' |
| ⓘ Formula: FeWO4 Locality: Womobi Mine, Thologolong, Towong Shire, Victoria, Australia - erroneously reported References: |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 7 localities in this region. |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Description: "Gypsum is quite common throughout the aggregates occurring as colourless prismatic crystals up to 2 mm long that may occur individually or form interlocking crusts and sprays. In some samples, a thin crust of gypsum occurs directly on the matrix granite and may be overlain by any of the three manganese sulfates." |
| ⓘ Hechtsbergite Formula: Bi2(VO4)O(OH) References: |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hübnerite Formula: MnWO4 References: |
| ⓘ Ilesite Formula: Mn2+(SO4) · 4H2O Description: "This mineral is very similar to szmikite in appearance and habit, although it tends to be finer-grained and more glistening on broken surfaces of the crusts. It is also slightly harder and more compact. It can also form more open intergrowths of roughly spherical aggregates which appear to have partly dissolved. SEM examination of samples identified as ilesite by XRD does not show any consistent textural features, suggesting it has replaced another sulphate." |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jôkokuite Formula: MnSO4 · 5H2O Description: "Jokokuite tends to be the more transparent and vitreous of the three manganese sulfates, and is more irregular in form and slightly harder. It occurs either as interlocking open crusts, or as isolated shapeless grains enclosed in ilesite. The colour ranges from cream to very pale blue, the latter colour being caused by traces of copper. It is likely that bladed crystals showing varying degrees of dissolution are jokokuite, although some may have been pseudomorphed by szmikite or ilesite." |
| ⓘ Joséite-A Formula: Bi4TeS2 |
| ⓘ 'K Feldspar' |
| ⓘ Koechlinite Formula: Bi2MoO6 References: |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganoblödite Formula: Na2Mn(SO4)2 · 4H2O Description: "Manganoblodite from the Womobi mine occurs as blocky pale-pink crystals up to 60 micron on edge and have been found on a specimen of szmikite that has replaced jokokuite." |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Mrázekite Formula: Bi2Cu3(PO4)2O2(OH)2 · H2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Namibite Formula: Cu(BiO)2(VO4)(OH) Habit: isolated hemispheres and coatings of very thin tabular xls Colour: pistachio-green to black References: Frost, Ray L., Henry, Dermot A., Weier, Matt L., Martens, Wayde (2006) Raman spectroscopy of three polymorphs of BiVO4: clinobisvanite, dreyerite and pucherite, with comparisons to (VO4)3-bearing minerals: namibite, pottsite and schumacherite. Journal of Raman Spectroscopy, 37 (7). 722-732 doi:10.1002/jrs.1499 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Pucherite Formula: Bi(VO4) References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Russellite Formula: Bi2WO6 References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Saléeite Formula: Mg(UO2)2(PO4)2 · 10H2O References: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schumacherite Formula: Bi3(VO4)2O(OH) References: Frost, Ray L., Henry, Dermot A., Weier, Matt L., Martens, Wayde (2006) Raman spectroscopy of three polymorphs of BiVO4: clinobisvanite, dreyerite and pucherite, with comparisons to (VO4)3-bearing minerals: namibite, pottsite and schumacherite. Journal of Raman Spectroscopy, 37 (7). 722-732 doi:10.1002/jrs.1499 |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Sulphotsumoite Formula: Bi3Te2S |
| ⓘ Szmikite Formula: MnSO4 · H2O Description: "Szmikite is often in contact with the granite matrix. It forms white to very pale pink, opaque globular masses, which resemble billowing cumulus clouds under the microscope, although they tend to be dull and earthy appearance. Outlines of crystal faces seen on the surfaces of the roughly spherical aggregates making up the crusts may represent an earlier more hydrated sulphate, such as jokokuite. On some specimens, aggregates of well-formed tabular monoclinic crystals up to about 50 micron across can be detected by SEM." |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ Thorianite Formula: ThO2 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tsumoite Formula: BiTe |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | Joséite-A | 2.DC.05 | Bi4TeS2 |
| ⓘ | Sulphotsumoite | 2.DC.05 | Bi3Te2S |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite ? | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Koechlinite | 4.DE.15 | Bi2MoO6 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Manganoblödite | 7.00. | Na2Mn(SO4)2 · 4H2O |
| ⓘ | Szmikite | 7.CB.05 | MnSO4 · H2O |
| ⓘ | Ilesite | 7.CB.15 | Mn2+(SO4) · 4H2O |
| ⓘ | Jôkokuite | 7.CB.20 | MnSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pucherite | 8.AD.40 | Bi(VO4) |
| ⓘ | Namibite | 8.BB.50 | Cu(BiO)2(VO4)(OH) |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Schumacherite | 8.BO.10 | Bi3(VO4)2O(OH) |
| ⓘ | Hechtsbergite | 8.BO.15 | Bi2(VO4)O(OH) |
| ⓘ | Mrázekite | 8.DJ.40 | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| ⓘ | Saléeite | 8.EB.05 | Mg(UO2)2(PO4)2 · 10H2O |
| Group 9 - Silicates | |||
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Ilesite | Mn2+(SO4) · 4H2O |
| H | ⓘ Jôkokuite | MnSO4 · 5H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Szmikite | MnSO4 · H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| H | ⓘ Manganoblödite | Na2Mn(SO4)2 · 4H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Ilesite | Mn2+(SO4) · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jôkokuite | MnSO4 · 5H2O |
| O | ⓘ Koechlinite | Bi2MoO6 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pucherite | Bi(VO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Russellite | Bi2WO6 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Szmikite | MnSO4 · H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Manganoblödite | Na2Mn(SO4)2 · 4H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Manganoblödite | Na2Mn(SO4)2 · 4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Ilesite | Mn2+(SO4) · 4H2O |
| S | ⓘ Jôkokuite | MnSO4 · 5H2O |
| S | ⓘ Joséite-A | Bi4TeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Sulphotsumoite | Bi3Te2S |
| S | ⓘ Szmikite | MnSO4 · H2O |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Manganoblödite | Na2Mn(SO4)2 · 4H2O |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| V | Vanadium | |
| V | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| V | ⓘ Pucherite | Bi(VO4) |
| V | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| V | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Ilesite | Mn2+(SO4) · 4H2O |
| Mn | ⓘ Jôkokuite | MnSO4 · 5H2O |
| Mn | ⓘ Szmikite | MnSO4 · H2O |
| Mn | ⓘ Manganoblödite | Na2Mn(SO4)2 · 4H2O |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| Cu | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Koechlinite | Bi2MoO6 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Te | Tellurium | |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Joséite-A | Bi4TeS2 |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Sulphotsumoite | Bi3Te2S |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Tsumoite | BiTe |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Russellite | Bi2WO6 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Joséite-A | Bi4TeS2 |
| Bi | ⓘ Koechlinite | Bi2MoO6 |
| Bi | ⓘ Mrázekite | Bi2Cu3(PO4)2O2(OH)2 · H2O |
| Bi | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Bi | ⓘ Pucherite | Bi(VO4) |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Russellite | Bi2WO6 |
| Bi | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| Bi | ⓘ Sulphotsumoite | Bi3Te2S |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Tsumoite | BiTe |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| Th | Thorium | |
| Th | ⓘ Thorianite | ThO2 |
| U | Uranium | |
| U | ⓘ Saléeite | Mg(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Uraninite | UO2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Shire_of_Towong |
|---|---|
| Wikidata ID: | Q646200 |
| GeoNames ID: | 7839828 |
Localities in this Region
- Victoria
- Towong Shire
Other Regions, Features and Areas that Intersect
Australia
- Great Dividing RangeMountain Range
- Lachlan OrogenOrogen
- Central NSW - Omeo ProvinceGeologic Province
- Victoria
- Alpine National ParkNational Park
- Dorchap Dyke SwarmDike swarm
Australian PlateTectonic Plate
- Lachlan Fold BeltOrogenic Belt
- Wagga-Omeo Metamorphic ComplexOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Wombat Hole prospect, Morass Creek gorge, Dartmouth, Towong Shire, Victoria, Australia