Västanå Iron Mine (Westanå Mine), Näsum, Bromölla, Skåne County, Swedeni
| Regional Level Types | |
|---|---|
| Västanå Iron Mine (Westanå Mine) | Mine |
| Näsum | Village |
| Bromölla | Municipality |
| Skåne County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
56° 11' 42'' North , 14° 27' 43'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other Languages:
Swedish:
Västanågruvan (Västanå järnmalmsgruva), Näsum, Bromölla kommun, Skåne län, Sverige
Small iron mine, active from 1804 to 1916. The ore consisted of specular hematite in quartzite. Belongs to the same deformation zone as Hålsjöberg, Värmland and Hökensås, Västergötland. The mine is the type locality for the minerals attakolite, augelite, berlinite, and trolleite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
34 valid minerals. 4 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Andalusite Formula: Al2(SiO4)O Colour: Brown to red Description: Occucrs together with pyrophyllite.
Note: the green manganese-rich variety Viridine does not oocurs at the mine, but in the Northwestern part of the Västanåfield |
| ✪ 'Apatite' Formula: Ca5(PO4)3A Habit: Longprismatic Colour: Snow white Description: Found together with yellowish transparant perfect crystals of svanbergite chloritoid and lazulite in quartz. |
| ⓘ Attakolite (TL) Formula: CaMn2+Al4(SiO3OH)(PO4)3(OH)4 Type Locality: Colour: white to pale red (salmonred) Description: As masses together with other phosphates. It is distinguished by its intense pearly lustre on cleavages. References: |
| ⓘ Augelite (TL) Formula: Al2(PO4)(OH)3 Type Locality: |
| ⓘ Bearthite Formula: Ca2Al(PO4)2(OH) Colour: yellow Description: Occurs together with lazulite. |
| ⓘ Berlinite (TL) Formula: AlPO4 Type Locality: Colour: Colorless; pale pinkish red; greyish Description: Difficult to distinguish from quartz. Occurs in masses together with other phosphates rimmed by lazulite. References: |
| ⓘ Bjarebyite Formula: (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 Colour: darkgreen to grassgreen Description: Grains in phospate-nodules |
| ⓘ Childrenite Formula: Fe2+Al(PO4)(OH)2 · H2O Colour: brown Description: As a mm broad rim of brown crystals (< 0,5mm) together with millisite around a trolleite nodule in one phospatenodule measuring 7 x 4 cm found in 1977. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Habit: Flaky Colour: Dark green Description: At the mine the Chloritoid is usually changed into a reddish mess. See photo. References: |
| ⓘ Cirrolite Formula: Ca3Al2(PO4)3(OH)3 (?) Description: Described as Kirrolit (Blomstrand 1886). Probably a mixture of bearthite, kyanite and lazulite. References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Masses and veins Colour: Dark brown and orange ( in mica shist) Description: Huge boulder of dark brown dravite together with quartz and rutile has been found. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: massive; mm-sized small crystals Colour: yellowgreen; Bluegrey; pinkishwhite Description: Analyzes by Weibull (1886, 1898) shows Ca:Mn = 19:2. |
| ⓘ Fluorapatite var. Manganese-bearing Fluorapatite Formula: (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) Habit: massive; mm-sized small crystals Colour: yellowgreen; Bluegrey; pinkishwhite Description: Analyzes by Weibull (1886, 1898) shows Ca:Mn = 19:2. |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 |
| ⓘ Hurlbutite Formula: CaBe2(PO4)2 Colour: Yellowish to white |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kyanite Formula: Al2(SiO4)O References: |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 Description: Masses up to 5 x 3 cm |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Description: Found in a conglomerate. |
| ⓘ Millisite Formula: (Na,K)CaAl6(PO4)4(OH)9 · 3H2O Description: Found in one phosphatenodule (measuring 7 x 4 cm found in 1977) together with childrenite forming a rim around a trolleite nodule |
| ⓘ 'Monazite Group' ? Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Damourite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Ottrélite Formula: Mn2+Al2O(SiO4)(OH)2 Colour: black |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Habit: Singel crystals Colour: Cherry red Description: As finegrained masses in micashist. References: |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Description: Observed microscopic in polished sections |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ✪ Svanbergite Formula: SrAl3(PO4)(SO4)(OH)6 Habit: Singel crystals Colour: Redbrown and rarely yellowish References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Trolleite (TL) Formula: Al4(PO4)3(OH)3 Type Locality: Colour: pale green to blue Description: As small masses and veins References: |
| ⓘ Woodhouseite ? Formula: CaAl3(PO4)(SO4)(OH)6 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Berlinite (TL) | 8.AA.05 | AlPO4 |
| ⓘ | Hurlbutite | 8.AA.15 | CaBe2(PO4)2 |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Trolleite (TL) | 8.BB.45 | Al4(PO4)3(OH)3 |
| ⓘ | Augelite (TL) | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Bearthite | 8.BG.05 | Ca2Al(PO4)2(OH) |
| ⓘ | Bjarebyite | 8.BH.20 | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| ⓘ | Cirrolite | 8.BH.20 | Ca3Al2(PO4)3(OH)3 (?) |
| ⓘ | Attakolite (TL) | 8.BH.60 | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Svanbergite | 8.BL.05 | SrAl3(PO4)(SO4)(OH)6 |
| ⓘ | Woodhouseite ? | 8.BL.05 | CaAl3(PO4)(SO4)(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ | Millisite | 8.DL.10 | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Ottrélite | 9.AF.85 | Mn2+Al2O(SiO4)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Monazite Group' ? | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| H | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Cirrolite | Ca3Al2(PO4)3(OH)3 (?) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| H | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Hurlbutite | CaBe2(PO4)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| O | ⓘ Berlinite | AlPO4 |
| O | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Cirrolite | Ca3Al2(PO4)3(OH)3 (?) |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hurlbutite | CaBe2(PO4)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| O | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Mg | Magnesium | |
| Mg | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Al | ⓘ Berlinite | AlPO4 |
| Al | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Cirrolite | Ca3Al2(PO4)3(OH)3 (?) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| Al | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| P | ⓘ Berlinite | AlPO4 |
| P | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Cirrolite | Ca3Al2(PO4)3(OH)3 (?) |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Hurlbutite | CaBe2(PO4)2 |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| P | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| P | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Cl | Chlorine | |
| Cl | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| K | Potassium | |
| K | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| Ca | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Ca | ⓘ Cirrolite | Ca3Al2(PO4)3(OH)3 (?) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hurlbutite | CaBe2(PO4)2 |
| Ca | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | ⓘ Millisite | (Na,K)CaAl6(PO4)4(OH)9 · 3H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Attakolite | CaMn2+Al4(SiO3OH)(PO4)3(OH)4 |
| Mn | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Mn | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Fe | Iron | |
| Fe | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Sr | Strontium | |
| Sr | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Sr | ⓘ Svanbergite | SrAl3(PO4)(SO4)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Bjarebyite | (Ba,Sr)(Mn2+,Fe2+,Mg)2Al2(PO4)3(OH)3 |
| Ce | Cerium | |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Pb | Lead | |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Transscandinavian Igneous BeltMagmatic Province
EuropeContinent
ScandinaviaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Weibull, Mats (1886) Om manganapatit från Vestanå jemte nägra anmärkningar öfver apatitens sammansättning. Geologiska Föreningen i Stockholm Förhandlingar, 8 (7) 492-495 doi:10.1080/11035898609442435
Weibull, Mats (1898) Om några Vestanåmineral. Geologiska Föreningen i Stockholm Förhandlingar, 20 (2) 57-66 doi:10.1080/11035899809453973
Palache, Charles; Berman, Harry; Frondel, Clifford (1951) The System of Mineralogy (7th ed.) Vol. 2 - Halides, Nitrates, Borates, Carbonates, Sulfates, Phosphates, Arsenates, Tungstates, Molybdates, Etc. John Wiley and Sons.pages 845, 872, 910, 911, 1006
Gallagher, M. J., Gerards, J. F. (1963) Berlinite from Rwanda. Mineralogical Magazine and Journal of the Mineralogical Society, 33 (262) 613-615 doi:10.1180/minmag.1963.033.262.09 referring to augelite, attakolite and berlinite from the type locality
Hansen, Staffan, Landa‐Cánovas, Angel (1994) Childrenite and millisite from Västanå Iron Mine, Skåne, Sweden. GFF, 116 (2) 92 doi:10.1080/11035899409546164
Västanå Iron Mine, Näsum, Bromölla, Skåne County, Sweden