Tonopah-Belmont Mine, Belmont Mountain, Tonopah, Osborn Mining District, Maricopa County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Tonopah-Belmont Mine | Mine |
| Belmont Mountain | Mountain |
| Tonopah | Unincorporated Community |
| Osborn Mining District | Mining District |
| Maricopa County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 38' 52'' North , 112° 55' 55'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Wintersburg | 136 (2011) | 25.5km |
| Morristown | 227 (2017) | 36.8km |
| Arlington | 194 (2011) | 39.1km |
| Aguila | 798 (2011) | 39.7km |
| Wittmann | 763 (2011) | 40.0km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Wickenburg Gem and Mineral Society | Wickenburg, Arizona | 40km |
| West Valley Rock & Mineral Club | Buckeye, Arizona | 45km |
Other/historical names associated with this locality:
East Vulture Mine; Belmont-McNeil Mine; Economy Mining Co. Mine
A former underground Ag-Au-Pb-Cu mine located in the W 1/2 sec. 36, T.4N., R.W. (Belmont Mountains 15 minute topo map), North of Tonopah and about 20 miles (ca. 32 km) SW of Wickenburg on Belmont Mountain, a craggy, thin peak.
Mineralization involves veins cutting andesite in the Big Horn Mountains. These mountains are made up of a basement of Precambrian schist and gneiss, intruded, and partly covered by the Tertiary andesites.
Workings include a 500 feet (ca. 152 m) deep shaft with levels at 100 feet (ca. 30 m), 250 feet (ca. 76 m), 400 feet (ca. 122 m), and 500 feet (ca. 152 m).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
70 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Arsendescloizite Formula: PbZn(AsO4)(OH) |
| ⓘ Arsentsumebite Formula: Pb2Cu(AsO4)(SO4)(OH) References: |
| ⓘ Ashburtonite Formula: Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 References: |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ Bechererite (TL) Formula: Zn7Cu(OH)13[(SiO(OH)3(SO4)] Type Locality: |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Botallackite Formula: Cu2(OH)3Cl References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 Habit: Crystals to 2mm Colour: Pale blue References: |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O Habit: Striated rhombohedra to 1.5mm References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl References: |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 Description: Botryoidal incrustations. References: |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Creaseyite Formula: Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O Habit: Acicular crystals to 0.8 mm long Colour: Pale green References: |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 References: |
| ⓘ Cumengeite Formula: Pb21Cu20Cl42(OH)40 · 6H2O |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) References: |
| ⓘ Diaboleite Formula: Pb2CuCl2(OH)4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| ⓘ 'Feldspar Group' References: |
| ⓘ Galena Formula: PbS |
| ⓘ Gerhardtite Formula: Cu2(NO3)(OH)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Herbertsmithite Formula: Cu3Zn(OH)6Cl2 References: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 Description: Crystal crusts and coatings on cerussite. References: |
| ⓘ 'Limonite' References: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 References: |
| ⓘ Litharge Formula: PbO Colour: Pink Description: Replacements of cerussite as micro-crystals. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ Massicot Formula: PbO |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl References: |
| ⓘ Minium Formula: Pb3O4 |
| ⓘ Molybdofornacite Formula: Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) References: |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 References: |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Paralaurionite Formula: PbCl(OH) |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 References: |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 References: |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl Colour: colorless tapering prisms |
| ⓘ Plattnerite Formula: PbO2 References: |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 References: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 Description: Balls of acicular crystals to 4 mm diameter. References: |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O Description: Occurs as smears along fractures in vein quartz. |
| ⓘ Schmiederite ? Formula: Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 Description: Reported from the main vein, but some "schmiederite" from here has on reanalysis proven to be munakataite, and more analyses need to be done to prove whether true schmiederite in fact exists here. |
| ⓘ Shannonite Formula: Pb2O(CO3) Description: Occurred in the main entrance of the mine, the result of a mine fire. |
| ⓘ Smithsonite Formula: ZnCO3 References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl References: |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) Habit: Crystakls to 2 mm Colour: Greenish-brown to brown References: |
| ⓘ Willemite Formula: Zn2SiO4 References: |
| ⓘ Wulfenite Formula: Pb(MoO4) References: |
| ⓘ Zincite Formula: ZnO Colour: Red-brown Description: Dull, earthy crusts formed from sphalerite-bearing ores by a mine fire. |
| ⓘ Zircon Formula: Zr(SiO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Herbertsmithite | 3.DA.10c | Cu3Zn(OH)6Cl2 |
| ⓘ | Diaboleite | 3.DB.05 | Pb2CuCl2(OH)4 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Cumengeite | 3.DB.20 | Pb21Cu20Cl42(OH)40 · 6H2O |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| ⓘ | Paralaurionite | 3.DC.05 | PbCl(OH) |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Zincite | 4.AB.20 | ZnO |
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Shannonite | 5.BE.05 | Pb2O(CO3) |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Gerhardtite | 5.NB.05 | Cu2(NO3)(OH)3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Schmiederite ? | 7.BC.65 | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Bechererite (TL) | 7.DD.55 | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Molybdofornacite | 7.FC.10 | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Arsentsumebite | 8.BG.05 | Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ | Arsendescloizite | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Ashburtonite | 9.CF.05 | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Creaseyite | 9.HH.15 | Pb2Cu2Fe3+2(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| H | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gerhardtite | Cu2(NO3)(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| H | ⓘ Paralaurionite | PbCl(OH) |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Cumengeite | Pb21Cu20Cl42(OH)40 · 6H2O |
| H | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| C | Carbon | |
| C | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Shannonite | Pb2O(CO3) |
| C | ⓘ Smithsonite | ZnCO3 |
| N | Nitrogen | |
| N | ⓘ Gerhardtite | Cu2(NO3)(OH)3 |
| O | Oxygen | |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| O | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Gerhardtite | Cu2(NO3)(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Litharge | PbO |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Paralaurionite | PbCl(OH) |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| O | ⓘ Shannonite | Pb2O(CO3) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Cumengeite | Pb21Cu20Cl42(OH)40 · 6H2O |
| O | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Mg | Magnesium | |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| Si | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cl | Chlorine | |
| Cl | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Paralaurionite | PbCl(OH) |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Cumengeite | Pb21Cu20Cl42(OH)40 · 6H2O |
| Cl | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Cu | Copper | |
| Cu | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Cu | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Cu | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cu | ⓘ Gerhardtite | Cu2(NO3)(OH)3 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Cu | ⓘ Cumengeite | Pb21Cu20Cl42(OH)40 · 6H2O |
| Cu | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Zn | Zinc | |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Bechererite | Zn7Cu(OH)13[(SiO(OH)3(SO4)] |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| As | Arsenic | |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Se | Selenium | |
| Se | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Pb | ⓘ Ashburtonite | Pb4Cu4(Si4O12)(HCO3)4(OH)3Cl · H2O |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Creaseyite | Pb2Cu2Fe23+(Si4.67Al0.33)O15.33(OH)3 · H2O |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Paralaurionite | PbCl(OH) |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Schmiederite | Pb2Cu2(Se6+O4)(Se4+O3)(OH)4 |
| Pb | ⓘ Shannonite | Pb2O(CO3) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Cumengeite | Pb21Cu20Cl42(OH)40 · 6H2O |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
Other Databases
| GeoNames ID: | 5317746 |
|---|---|
| Link to USGS MRDS: | 10062455 |
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mojave DomainDomain
- Southern Basin and RangeWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Robbins, Manuel (1988) Fluorescent Forum: Willemite Part II. Rocks & Minerals, 63 (4). p.327-329. doi:10.1080/00357529.1988.11761859
Robbins, Manuel (1989) Fluorescent Forum: Willemite Part III. Rocks & Minerals, 64 (1). p.57-59. doi:10.1080/00357529.1989.11761732
Tonopah-Belmont Mine, Belmont Mountain, Tonopah, Osborn Mining District, Maricopa County, Arizona, USA