Log In
Kumage District, Kagoshima Prefecture, Japani
| Regional Level Types | |
|---|---|
| Kumage District | District |
| Kagoshima Prefecture | Prefecture |
| Japan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
district de Kumage, Kagoshima, Japon
German:
Kumage Bezirk, Präfektur Kagoshima, Japan
Italian:
Distretto di Kumage, prefettura di Kagoshima, Giappone
Russian:
Округ Кумаге, Кагосима, Япония
Simplified Chinese:
熊毛郡, 鹿儿岛县, 日本
Spanish:
Distrito de Kumage, prefectura de Kagoshima, Japón
Arabic:
مقاطعة كوماج, كاغوشيما, اليابان
Dutch:
Kumage District, Kagoshima, Japan
Japanese:
熊毛郡, 鹿児島県, 日本
Korean:
구마게군, 가고시마현, 일본
Portuguese:
Distrito de Kumagr, Kagoshima, Japão
Traditional Chinese:
熊毛郡, 鹿兒島縣, 日本
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities24 valid minerals.
Detailed Mineral List:
| ⓘ Alum-(K) ? Formula: KAl(SO4)2 · 12H2O Description: ID by taste, appearance and associations; not analyzed. |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Bismite Formula: Bi2O3 References: |
| ⓘ Bismoclite ? Formula: BiOCl References: |
| ⓘ Bismuth Formula: Bi References: |
| ⓘ Bismuthinite Formula: Bi2S3 References: |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Eulytine Formula: Bi4(SiO4)3 References: |
| ⓘ Gold Formula: Au References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Description: Crystal crusts in alteration zone around dead solfataras. |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) |
| ⓘ Hydrokenoelsmoreite var. Ferritungstite Formula: ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ 'Joséite' Formula: Bi4TeS2 |
| ⓘ 'Limonite' |
| ⓘ Molybdenite Formula: MoS2 References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) Description: Carlsbad-law twins. References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS References: |
| ⓘ Quartz Formula: SiO2 Localities: Miyanoura mine, Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan Nitta mine (Hayasaki mine), Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan Baikei mine, Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan Tabukawa mine, Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan Yakushima mine (Nitta-Yakushima mine), Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O References: |
| ⓘ Sillénite Formula: Bi12SiO20 References: |
| ⓘ Sulphur Formula: S8 |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z References: |
| ⓘ 'Wolframite Group' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| ⓘ | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Bismoclite ? | 3.DC.25 | BiOCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Sillénite | 4.CB.70 | Bi12SiO20 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Hydrokenoelsmoreite var. Ferritungstite | 4.DH.15 | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ | 4.DH.15 | ◻2W2O6(H2O) | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Alum-(K) ? | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismoclite | BiOCl |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Sillénite | Bi12SiO20 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Na | Sodium | |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Al | Aluminium | |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillénite | Bi12SiO20 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Bismoclite | BiOCl |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Ca | Calcium | |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Te | Tellurium | |
| Te | ⓘ Joséite | Bi4TeS2 |
| W | Tungsten | |
| W | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismoclite | BiOCl |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Bi | ⓘ Sillénite | Bi12SiO20 |
Fossils
There are 13 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 208 |
|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) |
| Oldest Fossil Listed | 23.0 Ma (Miocene) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 13 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Kumage_District,_Kagoshima |
|---|---|
| Wikidata ID: | Q1132154 |
| GeoNames ID: | 8714932 |
Localities in this Region
- Kagoshima Prefecture
- Kumage District
- Kagoshima Prefecture
- Kumage District
- Yakushima
- Kumage District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Miyanoura mine, Yakushima Island, Yakushima, Kumage District, Kagoshima Prefecture, Japan