Log In
Neuensalz, Vogtlandkreis, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Neuensalz | Municipality |
| Vogtlandkreis | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Neuensalz | 2,400 (2014) |
Other Languages:
French:
Neuensalz, Vogtland, Saxe (Land), Allemagne
German:
Neuensalz, Vogtlandkreis, Sachsen, Deutschland
Italian:
Neuensalz, circondario del Vogtland, Sassonia, Germania
Russian:
Нойензальц, Фогтланд, Саксония (земля), Германия
Simplified Chinese:
新萨尔茨, 福格特兰县, 萨克森自由州, 德国
Spanish:
Neuensalz, Vogtlandkreis, Sajonia, Alemania
Afrikaans:
Neuensalz, Sakse, Duitsland
Aragonese:
Neuensalz, Saxonia, Alemanya
Asturian:
Neuensalz, Saxonia, Alemaña
Bashkir:
Нойензальц, Саксония, Германия
Basque:
Neuensalz, Saxonia, Alemania
Bavarian:
Neuensalz, Saggsn, Deitschland
Breton:
Neuensalz, Saks, Alamagn
Catalan:
Neuensalz, Saxònia, Alemanya
Corsican:
Neuensalz, Sassonia, Germania
Croatian:
Neuensalz, Saska (pokrajina), Njemačka
Czech:
Neuensalz, Zemský okres Vogtland, Sasko, Německo
Danish:
Neuensalz, Sachsen, Tyskland
Dutch:
Neuensalz, Vogtlandkreis, Saksen (deelstaat), Duitsland
Dutch Low Saxon:
Neuensalz, Saksen (dailstoat), Duutslaand
Esperanto:
Neuensalz, Distrikto Vogtland, Saksio, Germanio
Estonian:
Neuensalz, Vogtlandi kreis, Saksimaa, Saksamaa
Farsi/Persian:
نوینزالتس, فوگتلاندكرايس, زاکسن, آلمان
Finnish:
Neuensalz, Saksi (osavaltio), Saksa
Franco-Provençal:
Neuensalz, Alemagne
Friulian:
Neuensalz, Gjermanie
Galician:
Neuensalz, Saxonia, Alemaña
Hungarian:
Neuensalz, Szászország, Németország
Icelandic:
Neuensalz, Saxland, Þýskaland
Ido:
Neuensalz, Saxonia, Germania
Indonesian:
Neuensalz, Vogtlandkreis, Sachsen, Jerman
Interlingua:
Neuensalz, Saxonia, Germania
Interlingue:
Neuensalz, Vogtlandkreis, Saxonia, Germania
Irish Gaelic:
Neuensalz, An tSacsain, An Ghearmáin
Kazakh (Cyrillic Script):
Нойензальц, Фогтланд, Саксония еркін мемлекеті, Германия
Kongo:
Neuensalz, Sachsen, Alemanyi
Kyrgyz:
Нойензальц, Германия
Ligurian:
Neuensalz, Sassonia, Germania
Limburgian:
Neuensalz, Sakse (Bundesland), Duitsland
Low Saxon/Low German:
Neuensalz, Sassen (Bundsland), Düütschland
Luxembourgish:
Neuensalz, Sachsen, Däitschland
Macedonian:
Нојензалц, Фогтланд , Саксонија, Германија
Malagasy:
Neuensalz, Alemaina
Malay:
Neuensalz, Vogtlandkreis, Sachsen, Jerman
Minangkabau:
Neuensalz, Jerman
Narom:
Neuensalz, Allemangne
Neapolitan:
Neuensalz, Sassonia, Germania
Norwegian:
Neuensalz, Vogtlandkreis, Sachsen, Tyskland
Norwegian (Nynorsk):
Neuensalz, Sachsen, Tyskland
Occitan:
Neuensalz, Saxònia (land), Alemanha
Picard:
Neuensalz, Alemanne
Piedmontese:
Neuensalz, Sassònia, Almagna
Polish:
Neuensalz, Powiat Vogtland, Saksonia, Niemcy
Portuguese:
Neuensalz, Vogtlandkreis, Saxônia, Alemanha
Romanian:
Neuensalz, Vogtlandkreis, Saxonia, Germania
Romansh:
Neuensalz, Saxonia, Germania
Sardinian:
Neuensalz, Germania
Scots:
Neuensalz, Vogtlandkreis, Saxony, Germany
Scottish Gaelic:
Neuensalz, Sagsainn, A' Ghearmailt
Serbian:
Нојензалц, Саксонија, Њемачка
Serbo-Croatian:
Neuensalz, Saksonija, Njemačka
Sicilian:
Neuensalz, Girmania
Slovak:
Neuensalz, Sasko, Nemecko
Slovenian:
Neuensalz, Saška, Nemčija
Swahili:
Neuensalz, Saksonia, Ujerumani
Swedish:
Neuensalz, Vogtlandkreis, Sachsen, Tyskland
Ukrainian:
Ноєнзальц, Фогтланд, Саксонія, Німеччина
Uzbek (Latin Script):
Neuensalz, Vogtlandkreis, Saksoniya, Germaniya
Venetian:
Neuensalz, Sassonia, Germania
Vietnamese:
Neuensalz, Vogtland, Sachsen, Đức
Volapük:
Neuensalz, Saxän, Deutän
Walloon:
Neuensalz, Almagne
Waray:
Neuensalz, Vogtlandkreis, Sachsen, Alemanya
Welsh:
Neuensalz, Sachsen, Yr Almaen
West Flemish:
Neuensalz, Duutsland
Wolof:
Neuensalz, Almaañ
Zulu:
Neuensalz, IJalimani
Neuensalz is a municipality in the Vogtlandkreis district, in Saxony, Germany.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities40 valid minerals.
Detailed Mineral List:
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bergenite Formula: Ca2Ba4(UO2)9(PO4)6O6 · 16H2O References: |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Eulytine Formula: Bi4(SiO4)3 |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gladite Formula: CuPbBi5S9 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Nickeline Formula: NiAs References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ Nickelskutterudite Formula: NiAs3 References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O References: |
| ⓘ Phurcalite Formula: Ca2(UO2)3(PO4)2O2 · 7H2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 References: Dr. Günter Grundmann collectionIdentified by Dr. Günter Grundmann: Polarised-light microscopy |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranocircite Formula: Ba(UO2)2(PO4)2 · 10H2O References: |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Gladite | 2.HB.05a | CuPbBi5S9 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Uranocircite | 8.EB.05 | Ba(UO2)2(PO4)2 · 10H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ | Phurcalite | 8.EC.35 | Ca2(UO2)3(PO4)2O2 · 7H2O |
| ⓘ | Bergenite | 8.EC.40 | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | Silicon | |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Gladite | CuPbBi5S9 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ni | Nickel | |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Gladite | CuPbBi5S9 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Rammelsbergite | NiAs2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Ba | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Gladite | CuPbBi5S9 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Gladite | CuPbBi5S9 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Phurcalite | Ca2(UO2)3(PO4)2O2 · 7H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranocircite | Ba(UO2)2(PO4)2 · 10H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Neuensalz |
|---|---|
| Wikidata ID: | Q46773 |
| GeoNames ID: | 6547465 |
Localities in this Region
- Saxony
- Vogtlandkreis
- Neuensalz
- Vogtlandkreis
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
- Bohemian MassifMassif
Germany
- Saxony
- Vogtlandkreis
- Zobes-Bergen mining districtMining District
- Vogtlandkreis
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Shaft 362, Mechelgrün, Neuensalz, Vogtlandkreis, Saxony, Germany