Log In
Unterweißenbach, Freistadt District, Upper Austria, Austriai
| Regional Level Types | |
|---|---|
| Unterweißenbach | Municipality |
| Freistadt District | District |
| Upper Austria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Unterweissenbach | 887 (2018) |
| Mötlas | 188 (2018) |
| Landshut | 174 (2018) |
| Hinterberg | 118 (2018) |
| Obermühl | 113 (2018) |
Other Languages:
French:
Unterweißenbach, District de Freistadt, Haute-Autriche, Autriche
German:
Unterweißenbach, Freistadt, Oberösterreich, Österreich
Italian:
Unterweißenbach, distretto di Freistadt, Alta Austria, Austria
Russian:
Унтервайсенбах, Фрайштадт, Верхняя Австрия, Австрия
Simplified Chinese:
下魏森巴赫, 弗赖施塔特县, 上奧地利州, 奥地利
Spanish:
Unterweißenbach, Distrito de Freistadt, Estado de Alta Austria, Austria
Cebuano:
Unterweissenbach, Politischer Bezirk Freistadt, Oberösterreich, Awstriya
Czech:
Unterweißenbach, Okres Freistadt, Horní Rakousy, Rakousko
Dutch:
Unterweißenbach, Freistadt, Opper-Oostenrijk, Oostenrijk
Farsi/Persian:
آنتروایسنباخ, ناحیه فرایشتات, اوبراسترایش, اتریش
Hungarian:
Unterweißenbach, Freistadti járás, Felső-Ausztria, Ausztria
Kazakh (Cyrillic Script):
Унтервайсенбах, Аустрия
Polish:
Unterweißenbach, Powiat Freistadt, Górna Austria, Austria
Portuguese:
Unterweißenbach, Freistadt, Alta Áustria, Áustria
Slovak:
Unterweißenbach, Freistadt, Horné Rakúsko, Rakúsko
Swedish:
Unterweissenbach, Freistadt , Oberösterreich, Österrike
Uzbek (Latin Script):
Unterweißenbach, Freistadt, Avstriya
Vietnamese:
Unterweißenbach, Freistadt, Oberösterreich, Áo
Volapük:
Unterweißenbach, Lösterän
Waray:
Unterweißenbach, Freistadt, Uruigbaw nga Austria, Austrya
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities8 valid minerals.
Detailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ 'Feldspar Group' |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Triplite Formula: Mn2+2(PO4)F References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon ? Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| Group 9 - Silicates | |||
| ⓘ | Zircon ? | 9.AD.30 | Zr(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mn | Manganese | |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Unterwei%C3%9Fenbach |
|---|---|
| Wikidata ID: | Q684884 |
| GeoNames ID: | 2762559 |
Localities in this Region
- Upper Austria
- Freistadt District
- Unterweißenbach
- Freistadt District
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Katzensilbergrube, Unterweißenbach, Freistadt District, Upper Austria, Austria