Log In
Bridgewater, Windsor County, Vermont, USAi
| Regional Level Types | |
|---|---|
| Bridgewater | Town |
| Windsor County | County |
| Vermont | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Bridgewater is a town, chartered in 1761.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities12 valid minerals.
Detailed Mineral List:
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Native Gold Formula: Au |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 9 - Silicates | |||
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Si | Silicon | |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Ca | Calcium | |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Bridgewater,_Vermont |
|---|---|
| Wikidata ID: | Q3447795 |
| GeoNames ID: | 5234162 |
Localities in this Region
- Vermont
- Windsor County
- Bridgewater
- Windsor County
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Laurentides DomainPassive Margin
- Piedmontia DomainDomain
- Taconic ArcVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
