Log In
La Viquita pegmatite, Sierra de la Estanzuela, Chacabuco Department, San Luis Province, Argentinai
| Regional Level Types | |
|---|---|
| La Viquita pegmatite | Pegmatite |
| Sierra de la Estanzuela | Sierra |
| Chacabuco Department | Department |
| San Luis Province | Province |
| Argentina | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Latitude & Longitude (WGS84):
32° 51' 0'' South , 65° 5' 59'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
300m away from the San Elías pegmatite.
A rare-element, complex, spodumene-subtype pegmatite.
The La Viquita pegmatite is discordantly emplaced in dark grey, NNE-striking and moderately to steeply ESE-dipping quartz-biotite-muscovite-plagioclase schists with sporadic porphyroblasts of staurolite and garnet. In the exocontact, the schist recrystallized to tourmaline- and muscovite-bearing assemblages to a distance of ~20 cm from the pegmatite. The pegmatite has a roughly lenticular shape, with maximum dimensions of 40 by 190 m in the surface exposure; it strikes N42°E and dips 31°NW in the hanging wall and 60°NW in the footwall. The internal structure, based on a detailed description made by Martínez & Galliski (2000), displays a symmetrical zoning. The fine-grained quartz + muscovite border zone is less than 7 cm wide. The wall zone is ≤1 m wide, medium- to fine-grained (5 mm in apatite to 20 cm in muscovite), and it consists of K feldspar (40%), quartz (40%), albite (10%), and muscovite (10%), with accessory garnet, tourmaline, beryl, columbite-group minerals, apatite, and secondary Fe-oxides. The intermediate zone is subdivided into three different units: outer, middle, and inner, all of them coarse-grained. The outer unit is composed of K feldspar (70–80%), quartz (25–20%), some muscovite and albite ± tourmaline. Until 1962, the systematic mining of La Viquita produced approximately 30 t of beryl, 55 t of spodumene, 80 t of amblygonite–montebrasite, 600 t of K feldspar, and 1 t of tantalum ore.
A rare-element, complex, spodumene-subtype pegmatite.
The La Viquita pegmatite is discordantly emplaced in dark grey, NNE-striking and moderately to steeply ESE-dipping quartz-biotite-muscovite-plagioclase schists with sporadic porphyroblasts of staurolite and garnet. In the exocontact, the schist recrystallized to tourmaline- and muscovite-bearing assemblages to a distance of ~20 cm from the pegmatite. The pegmatite has a roughly lenticular shape, with maximum dimensions of 40 by 190 m in the surface exposure; it strikes N42°E and dips 31°NW in the hanging wall and 60°NW in the footwall. The internal structure, based on a detailed description made by Martínez & Galliski (2000), displays a symmetrical zoning. The fine-grained quartz + muscovite border zone is less than 7 cm wide. The wall zone is ≤1 m wide, medium- to fine-grained (5 mm in apatite to 20 cm in muscovite), and it consists of K feldspar (40%), quartz (40%), albite (10%), and muscovite (10%), with accessory garnet, tourmaline, beryl, columbite-group minerals, apatite, and secondary Fe-oxides. The intermediate zone is subdivided into three different units: outer, middle, and inner, all of them coarse-grained. The outer unit is composed of K feldspar (70–80%), quartz (25–20%), some muscovite and albite ± tourmaline. Until 1962, the systematic mining of La Viquita produced approximately 30 t of beryl, 55 t of spodumene, 80 t of amblygonite–montebrasite, 600 t of K feldspar, and 1 t of tantalum ore.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
41 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Tapiolite-(Fe) | 4.DB.10 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Ferrowodginite | 4.DB.40 | Fe2+Sn4+Ta2O8 |
| ⓘ | Titanowodginite | 4.DB.40 | Mn2+TiTa2O8 |
| ⓘ | Wodginite | 4.DB.40 | Mn2+Sn4+Ta2O8 |
| ⓘ | Ferrotitanowodginite (TL) | 4.DB.40 | Fe2+TiTa2O8 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triphylite var. Ferrisicklerite | 8.AB.10 | Li1-x(Fe3+xFe2+1-x)PO4 |
| ⓘ | Heterosite | 8.AB.10 | Fe3+(PO4) |
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Purpurite | 8.AB.10 | Mn3+(PO4) |
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Augelite | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Childrenite | 8.DD.20 | Fe2+Al(PO4)(OH)2 · H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Ernstite | 8.DD.20 | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| ⓘ | Jahnsite-(CaMnFe) | 8.DH.15 | {Ca}{Mn2+}{Fe2+2}{Fe3+2}(PO4)4(OH)2 · 8H2O |
| ⓘ | Kingsmountite | 8.DH.25 | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Hafnian Zircon | 9.AD.30 | (Zr,Hf)SiO4 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| O | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Heterosite | Fe3+(PO4) |
| O | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Purpurite | Mn3+(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Titanowodginite | Mn2+TiTa2O8 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Ferrotitanowodginite | Fe2+TiTa2O8 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| P | Phosphorus | |
| P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| P | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Heterosite | Fe3+(PO4) |
| P | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| P | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Purpurite | Mn3+(PO4) |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Ca | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Titanowodginite | Mn2+TiTa2O8 |
| Ti | ⓘ Ferrotitanowodginite | Fe2+TiTa2O8 |
| Mn | Manganese | |
| Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| Mn | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Mn | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Purpurite | Mn3+(PO4) |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Titanowodginite | Mn2+TiTa2O8 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Childrenite | Fe2+Al(PO4)(OH)2 · H2O |
| Fe | ⓘ Ernstite | (Mn2+,Fe3+)Al(PO4)(OH,O)2 · H2O |
| Fe | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
| Fe | ⓘ Heterosite | Fe3+(PO4) |
| Fe | ⓘ Jahnsite-(CaMnFe) | {Ca}{Mn2+}{Fe22+}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Fe | ⓘ Kingsmountite | Ca3Mn2+FeAl4(PO4)6(OH)4 · 12H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Ferrotitanowodginite | Fe2+TiTa2O8 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
| Sn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Hf | Hafnium | |
| Hf | ⓘ Zircon var. Hafnian Zircon | (Zr,Hf)SiO4 |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Ferrowodginite | Fe2+Sn4+Ta2O8 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | ⓘ Titanowodginite | Mn2+TiTa2O8 |
| Ta | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Ta | ⓘ Ferrotitanowodginite | Fe2+TiTa2O8 |
Other Regions, Features and Areas containing this locality
South AmericaContinent
South America PlateTectonic Plate
- Familina ProvinceGeologic Province
- Sierras PampeanasWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Galliski, Miguel Angel; Černý, Petr; Márquez-Zavalía, María Florencia; Chapman, Ron (1999) Ferrotitanowodginite, Fe2+TiTa2O8, a new mineral of the wodginite group from the San Elias pegmatite, San Luis, Argentina. American Mineralogist, 84. p.773-777.
[1]Galliski, M. A., Marquez-Zavalia, M. F., Cerny, P., Martinez, V. A., Chapman, R. (2008) THE Ta-Nb-Sn-Ti OXIDE-MINERAL PARAGENESIS FROM LA VIQUITA, A SPODUMENE-BEARING RARE-ELEMENT GRANITIC PEGMATITE, SAN LUIS, ARGENTINA. The Canadian Mineralogist, 46 (2) 379-393 doi:10.3749/canmin.46.2.379
La Viquita pegmatite, Sierra de la Estanzuela, Chacabuco Department, San Luis Province, Argentina