Prijeđi na sadržaj

Lesopitron

Izvor: Wikipedija
Lesopitron
(IUPAC) ime
24-[4-(4-hloro-1H-pirazol-1-il)butil]piperazin-1-il
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

pirimidin

| image = Lesopitron.png | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = Nije kontrolisana supstanca | routes_of_administration = Oralno

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  DaY | CAS_number = 132449-46-8 | ATC_prefix = none | ATC_suffix = | PubChem = 60813 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 54801 | UNII_Ref =  DaY | UNII = H1CGM4755H

| C=15 | H=21 | Cl=1 | N=6 | molecular_weight = 320,82 g/mol | smiles = Clc1cn(nc1)CCCCN3CCN(c2ncccn2)CC3 | InChI = | InChIKey = | StdInChI_Ref =  DaY | StdInChI = 1S/C15H21ClN6/c16-14-12-19-22(13-14)7-2-1-6-20-8-10-21(11-9-20)15-17-4-3-5-18-15/h3-5,12-13H,1-2,6-11H2 | StdInChIKey_Ref =  DaY | StdInChIKey = AHCPKWJUALHOPH-UHFFFAOYSA-N }}

Lesopitron (E-4424) je selektivni pun agonist 5-HT1A receptora koji je strukturno srodan sa azapironima.[1] On je bio u razvoju kao anksiolitik za tretman generalizovanog anksioznog poremećaja.[2][3] Dospeo je do faze II kliničkih ispitivanja, ali je razvoj prekinut.[2][3]

Reference

[uredi | uredi kod]
  1. ↑ Haj-Dahmane S, Jolas T, Laporte AM, et al. (April 1994). „Interactions of lesopitron (E-4424) with central 5-HT1A receptors: in vitro and in vivo studies in the rat”. European Journal of Pharmacology 255 (1-3): 185–96. DOI:10.1016/0014-2999(94)90097-3. PMID 8026543.
  2. 1 2 Micheli F (February 2001). „Lesopitron (Esteve)”. IDrugs : the Investigational Drugs Journal 4 (2): 218–24. PMID 16032484.
  3. 1 2 Fresquet A, Sust M, Lloret A, et al. (February 2000). „Efficacy and safety of lesopitron in outpatients with generalized anxiety disorder”. The Annals of Pharmacotherapy 34 (2): 147–53. PMID 10676820.[mrtav link] Greška u referenci: Neispravna oznaka <ref>; naziv "pmid10676820" je zadan više puta s različitim sadržajem

Povezano

[uredi | uredi kod]

Vanjske veze

[uredi | uredi kod]
Izvor: https://sh.wikipedia.org/w/index.php?title=Lesopitron&oldid=42673904