Log In
Levant Mine, Trewellard, St Just, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Levant Mine | Mine (Tourist Attraction) |
| Trewellard | Village |
| St Just | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 9' 5'' North , 5° 41' 4'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
SW368345
Type:
Mine (Tourist Attraction) - last checked 2020
Köppen climate type:
The Levant Mine is located on cliffs near Boscaswell in west Cornwall and was worked discontinuously between 1793 and 1930. The mine is host to the classic, spatially zoned Cu-Sn mineralisation, well-described from Cornwall, which led to the early workings being directed at the exploitation of copper, later followed by tin.
Primary hydrothermal Cu-Sn mineralisation at Levant is structurally controlled in a series of veins and wall-rock alteration zones, with the hydrothermal fluids interpreted to have emanated from the Land’s End Pluton, a large body of Permian S-type granite.
Although the granite hosts some mineralisation at Levant, the bulk of the exploited ore was hosted in veins and replacements of wall rock metasediments and greenstones within the aureole of the granite. The mineralised zone exploited by the mine was a volume measuring approximately 2000 × 800 × 200 m, with the ore shoots plunging 10-20° to the north-west, under the present-day seafloor. Some stopes were so close to the seafloor that boulders could apparently be heard tumbling on the seafloor during storms from the underground workings.
An extensive history of the mine is given in LEVANT by Cyril Noall.
Note on the mineral list: The reference to danalite occurring at the Levant Mine is a Kingsbury (1961) citation. Given the doubts about the provenance of other Kingsbury specimens (Ryback et al. 1998, 2001), further confirmation is required.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities45 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 References: |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Botallackite Formula: Cu2(OH)3Cl |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Cassiterite Formula: SnO2 References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Description: Exceptional specimen in NHM, London 7.1 x 6.3 cm, xx 4.5 cm year 1899 [see Bancroft, Peter (1973) The World's Finest Minerals and Crystals]. [https://www.mindat.org/photo-275651.html] |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Chalcopyrite var. Blistered Copper Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ 'Chlorite Group' |
| ⓘ Clinoatacamite Formula: Cu2(OH)3Cl References: |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Danalite ? Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O References: |
| ⓘ Helvine ? Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ 'K Feldspar' |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ 'Limonite' |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ Nantokite Formula: CuCl |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu References: |
| ⓘ Native Silver Formula: Ag References: |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Scheelite Formula: Ca(WO4) References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Wittichenite Formula: Cu3BiS3 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | var. Blistered Copper | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Nantokite | 3.AA.05 | CuCl |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Clinoatacamite | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Danalite ? | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Helvine ? | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Be | Beryllium | |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Chalcopyrite var. Blistered Copper | CuFeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Nantokite | CuCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| K | Potassium | |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Chalcopyrite var. Blistered Copper | CuFeS2 |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Clinoatacamite | Cu2(OH)3Cl |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Nantokite | CuCl |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Chalcopyrite var. Blistered Copper | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Ag | Silver | |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
Geochronology
Mineralization age: Late/Upper Triassic : 212 ± 4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Mesozoic | ||||||||||||||||||||||
| Triassic | ||||||||||||||||||||||
| Late/Upper Triassic |
| |||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Levant_Mine_and_Beam_Engine |
|---|---|
| Wikidata ID: | Q1821720 |
Localities in this Region
- England
- Cornwall
- St Just
- Trewellard
- Levant Mine
- Trewellard
- St Just
- Cornwall
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
UK
- England
- Cornubian mining districtMining District
- Cornwall
- St Just Mining DistrictMining District
- ⭔St Just Mining RegionRegion
- Cornwall National LandscapeNational Landscape
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Russell, Arthur (1920) On the occurrence of Phenacite and Scheelite at Wheal Cock, St. Just, Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 19 (88) 19-22 doi:10.1180/minmag.1920.019.88.06lists scheelite from Levant mine
Symes, R. F. (1977) Datolite and apophyllite from the Mendips. Mineralogical Magazine, 41 (319) 410-411 doi:10.1180/minmag.1977.041.319.22 refers to apophyllite from Levant
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyOther DatabasesLocalities in RegionOther RegionsReferences
Levant Mine, Trewellard, St Just, Cornwall, England, UK