Log In
Gällivare, Norrbotten County, Swedeni
| Regional Level Types | |
|---|---|
| Gällivare | Municipality |
| Norrbotten County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
863 km2
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Gällivare | 10,362 (2017) |
| Malmberget | 6,017 (2014) |
| Koskullskulle | 818 (2017) |
| Hakkas | 374 (2017) |
| Ullatti | 230 (2012) |
Other Languages:
French:
Gällivare, Comté de Norrbotten, Suède
German:
Gällivare, Norrbottens län, Schweden
Italian:
Gällivare, Contea di Norrbotten, Svezia
Russian:
Елливаре, Норрботтен, Швеция
Simplified Chinese:
耶利瓦勒市, 北博滕省, 瑞典
Swedish:
Gällivare kommun, Norrbottens län, Sverige
Arabic:
بلدية ياليفاره, محافظة نوربوتن, السويد
Asturian:
Gällivare, Provincia de Norrbotten, Suecia
Basque:
Gällivare udalerria, Norrbottengo konderria, Suedia
Belarusian:
Еліварэ, Нарботэн, Швецыя
Bulgarian:
Йеливаре, Норботен, Швеция
Catalan:
Municipi de Gällivare, Comtat de Norrbotten, Suècia
Cebuano:
Gällivare Kommun, Norrbottens län, Suwesya
Czech:
Gällivare, Norrbotten, Švédsko
Danish:
Gällivare kommun, Norrbottens län, Sverige
Dutch:
Gällivare, Norrbottens län, Zweden
Estonian:
Gällivare vald, Norrbotteni lään, Rootsi
Faroese:
Gällivare kommuna, Norrbottens län, Svøríki
Farsi/Persian:
بخش جلیواره, شهرستان نوربوتن, سوئد
Finnish:
Jällivaaran kunta, Norrbottenin lääni, Ruotsi
Hungarian:
Gällivare község, Norrbotten megye, Svédország
Korean:
옐릴리바레 시, 노르보텐주, 스웨덴
Limburgian:
Gällivare, Norrbottens län, Zwede
Lithuanian:
Jevlivarė, Norbotenas, Švedija
Low Saxon/Low German:
Kommun Gällivare, Lehn Norrbotten, Sweden
Minnan / Hokkien-Taiwanese:
Gällivare Chū-tī-chhī, Sūi-tián
Norwegian:
Gällivare, Norrbottens län, Sverige
Norwegian (Nynorsk):
Gällivare kommun, Norrbottens län, Sverige
Polish:
Gmina Gällivare, Norrbotten, Szwecja
Portuguese:
Gällivare, Norrbotten, Suécia
Romanian:
Comuna Gällivare, Norrbottens län, Suedia
Serbo-Croatian:
Gällivare, Norrbotten, Švedska
Traditional Chinese:
耶利瓦勒市, 瑞典
Ukrainian:
Єлліваре, Норрботтен, Швеція
Vietnamese:
Gällivare, Norrbotten, Thụy Điển
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities77 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Reported from at least 19 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ 'Asbestos' |
| ⓘ Aurostibite Formula: AuSb2 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ✪ Bismutotantalite Formula: BiTaO4 Description: Black elongated well developed crystals up to 1 cm size associated to colored tourmaline, albite, trilithionite et.c. |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 17 localities in this region. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ 'Chabazite' Localities: Reported from at least 9 localities in this region. |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 8 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 7 localities in this region. |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluor-elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F Description: The pink coloured tourmalines found at the locality has been found being fluor-elbaite. Analyzed by Andreas Karlsson, Swedish Museum of Natural History, specimen no. 20180261 and more specimens. |
| ⓘ Fluorite Formula: CaF2 Localities: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 10 localities in this region. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O References: |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Hydrokenomicrolite Formula: (◻,H2O)2Ta2(O,OH)6(H2O) |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' Localities: Reported from at least 7 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ 'Lepidolite' |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 23 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ 'Native Molybdenum' Formula: Mo References: |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Reported from at least 6 localities in this region. |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Description: Found in the Open pit (Dagbrottet) at about 230 m |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrosmalite-(Fe) Formula: Fe2+8Si6O15(OH,Cl)10 Description: Found at the Gråbergstippen dump |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 References: |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Localities: Description: Found at the Gråbergstippen dump |
| ⓘ 'Scapolite' Localities: Reported from at least 12 localities in this region. |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Description: Found in a pegmatite dike |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stellerite Formula: Ca4(Si28Al8)O72 · 28H2O |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O Localities: Description: Occur as very thin, milky white needles forming a "blanket" on gypsum specimens (AÖ coll) and stilbite specimens (NRM collection-Stockholm) |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Tourmaline var. Rubellite' |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Trilithionite Formula: K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 Description: Purple coloured flakes up to around 5 cm in size. |
| ⓘ Tschermakite Formula: ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ 'Zeolite Group' |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | 'Native Molybdenum' | 1.AE.05 | Mo |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Aurostibite | 2.EB.05a | AuSb2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz var. Chalcedony | 4.00.05 | SiO2 |
| ⓘ | 4.00.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.00.05 | SiO2 |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Bismutotantalite | 4.DE.30 | BiTaO4 |
| ⓘ | Hydrokenomicrolite | 4.DH.15 | (◻,H2O)2Ta2(O,OH)6(H2O) |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Fluor-elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Tschermakite | 9.DE.10 | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Trilithionite | 9.EC.20 | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Pyrosmalite-(Fe) | 9.EE.10 | Fe2+8Si6O15(OH,Cl)10 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | 'Zeolite Group' | 9.G0. | |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Stellerite | 9.GE.15 | Ca4(Si28Al8)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline var. Rubellite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| H | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Li | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Rubellite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismutotantalite | BiTaO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| O | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| F | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Fluor-elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| Cl | Chlorine | |
| Cl | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tschermakite | ◻Ca2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Native Molybdenum | Mo |
| Ag | Silver | |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Aurostibite | AuSb2 |
| Te | Tellurium | |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Bismutotantalite | BiTaO4 |
| Ta | ⓘ Hydrokenomicrolite | (◻,H2O)2Ta2(O,OH)6(H2O) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Aurostibite | AuSb2 |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Bi | Bismuth | |
| Bi | ⓘ Bismutotantalite | BiTaO4 |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/G%C3%A4llivare_Municipality |
|---|---|
| Wikidata ID: | Q493815 |
| GeoNames ID: | 606084 |
Localities in this Region
- Norrbotten County
- Norrbotten County
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Central Finland Arc ComplexVolcanic Arc
- Karelia CratonCraton
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Gällivare, Norrbotten County, Sweden