Montebras Mines, Montebras, Soumans, Aubusson, Creuse, Nouvelle-Aquitaine, Francei
| Regional Level Types | |
|---|---|
| Montebras Mines | Group of Mines |
| Montebras | Village |
| Soumans | Commune |
| Aubusson | Arrondissement |
| Creuse | Department |
| Nouvelle-Aquitaine | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 19' 17'' North , 2° 17' 48'' East
Latitude & Longitude (decimal):
Type:
Group of Mines
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Lavaufranche | 240 (2016) | 1.9km |
| Soumans | 547 (2016) | 2.8km |
| Leyrat | 173 (2016) | 4.5km |
| Treignat | 480 (2016) | 4.5km |
| Saint-Silvain-Bas-le-Roc | 503 (2016) | 5.3km |
Other/historical names associated with this locality:
Montebras pegmatite; Limousin
Name(s) in local language(s):
Mines de Montebras, Montebras, Soumans, Creuse, Limousin, France
Located 1 km west of Montebras and around 7 km SE of Boussac.
Translation of the French Wikipedia page:
Translation of the French Wikipedia page:
The mines of Montebras are located next to the village of the same name in the commune of Soumans, in the department of Creuse, in France. The area, very rich in minerals, has been exploited from Antiquity to the present day.
Tin mine
During Antiquity, first the Celts and then the Romans exploited tin mines. The discovery of tinning is attributed to the Bituriges Gauls, who lived in the region.
In 1858, the deposit was rediscovered by mining engineer François Ernest Mallard. This discovery revived the exploitation of tin. The "Société des mines d'étain de Montebras" ("Montebras Tin Mining Company") was created in April 1867 by Henri Poisson. Mining, carried out from 1865 to 1877, resumed around 1891 and again in 1908, spread between 1868 and 1942. 300 tonnes of tin were produced during this period. The Montebras site still contains a small reserve of tin estimated at 1,000 tonnes.
The vein system, in which tin occurs, constitutes an irregular and heterogeneous network of about fifty veins embedded either in the porphyroid granulite or, especially in its vicinity, in the pinite granite. Its importance was exaggerated when the mine opened, according to geologists.
Lithine mine
In the twentieth century, amblygonite and montebrasite were exploited to extract lithine, also known as lithium hydroxide. Montebrasite takes its name from the Montebras mine.
Feldspar quarry
Since 1965, the site has again been open for the extraction of feldspar. It is no longer a question of underground mines but of an open-pit quarry forming a huge crater of pure white. The "Société des feldspath du Morvan" ("Morvan Feldspath Company"), which operates the site, exports the production to Italy, where it is used in the ceramics industry. The "Felspath du Morvan" company ceased its activity at the end of 1997.
The site is currently operated by the company Imerys Ceramics France, a subsidiary of the Imerys group.
Tin mine
During Antiquity, first the Celts and then the Romans exploited tin mines. The discovery of tinning is attributed to the Bituriges Gauls, who lived in the region.
In 1858, the deposit was rediscovered by mining engineer François Ernest Mallard. This discovery revived the exploitation of tin. The "Société des mines d'étain de Montebras" ("Montebras Tin Mining Company") was created in April 1867 by Henri Poisson. Mining, carried out from 1865 to 1877, resumed around 1891 and again in 1908, spread between 1868 and 1942. 300 tonnes of tin were produced during this period. The Montebras site still contains a small reserve of tin estimated at 1,000 tonnes.
The vein system, in which tin occurs, constitutes an irregular and heterogeneous network of about fifty veins embedded either in the porphyroid granulite or, especially in its vicinity, in the pinite granite. Its importance was exaggerated when the mine opened, according to geologists.
Lithine mine
In the twentieth century, amblygonite and montebrasite were exploited to extract lithine, also known as lithium hydroxide. Montebrasite takes its name from the Montebras mine.
Feldspar quarry
Since 1965, the site has again been open for the extraction of feldspar. It is no longer a question of underground mines but of an open-pit quarry forming a huge crater of pure white. The "Société des feldspath du Morvan" ("Morvan Feldspath Company"), which operates the site, exports the production to Italy, where it is used in the ceramics industry. The "Felspath du Morvan" company ceased its activity at the end of 1997.
The site is currently operated by the company Imerys Ceramics France, a subsidiary of the Imerys group.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
79 valid minerals. 2 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite ? Formula: Ag2S References: |
| ⓘ Albite Formula: Na(AlSi3O8) Description: found in the granite |
| ⓘ Amblygonite Formula: LiAl(PO4)F |
| ⓘ 'Amblygonite-Montebrasite Series' |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS Description: Patureau et al. (2011): "¨Present in the wolframite veins, but often so degraded that only relicts remain. Alters mainly to scorodite and bariopharmacosiderite. The presence of associated uranium in these phases of alteration is occasionally responsible for the formation of the minerals of the series kahlerite-uranospinite-zeunerite." |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| ⓘ Bariopharmacosiderite ? Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O Habit: pseudocubic Colour: green to yellow Description: Patureau et al. (2011): "Its presence is anecdotal and it has been observed in classic association with scorodite." |
| ⓘ 'Barrandite' |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Bornite ? Formula: Cu5FeS4 References: |
| ⓘ Cacoxenite ? Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite ? Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O Description: Found on the dumps of (des haldes) du Communal. |
| ⓘ 'Chlorite Group' |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Corrensite Formula: (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| ⓘ Covellite Formula: CuS |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Curite ? Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ Dufrénite ? Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Elbaite ? Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Eosphorite Formula: Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Manganapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Manganese-bearing Fluorapatite Formula: (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hübnerite Formula: MnWO4 References: |
| ⓘ 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Lacroixite Formula: NaAl(PO4)F |
| ⓘ Lepidocrocite ? Formula: Fe3+O(OH) References: |
| ⓘ 'Lepidolite' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 References: |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Montebrasite (TL) Formula: LiAl(PO4)(OH) Type Locality: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Morinite (TL) Formula: NaCa2Al2(PO4)2(OH)F4 · 2H2O Type Locality: Description: alteration product of amblygonite/montebrasite References: Lacroix, A. (1910) Minéralogie de la France et de ses colonies Vol. 4. Library Polytechnique, Paris. p.923 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Damourite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 Colour: White nacreous Description: discovered near entrance old mine. References: |
| ⓘ Natanite Formula: Fe2+[Sn(OH)6] |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O References: |
| ⓘ 'Plumbogummite Group' Description: Listed as "crandallite group". |
| ⓘ Posnjakite ? Formula: Cu4(SO4)(OH)6 · H2O References: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Qitianlingite Formula: (Fe,Mn)2(Nb,Ta)2WO10 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Ramsdellite Formula: Mn4+O2 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Schorl var. Magnesium-bearing Schorl Formula: Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) Description: EDS analysed at "Laboratoire Magmas et Volcans, Clermont-Ferrand References: |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stannoidite Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Symplesite ? Formula: Fe2+3(AsO4)2 · 8H2O References: |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Varlamoffite Formula: Sn1-xFexO2-x(OH) References: |
| ⓘ Viitaniemiite Formula: Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| ⓘ Wardite Formula: NaAl3(PO4)2(OH)4 · 2H2O Habit: striated quadratic bipyramids [111] [Patureau et al., 2011]
centimetre-sized crusts in cavities at the contact between quartz and amblygonite [Patureau et al., 2011]
truncated by the prism {100} [Lacroix, 1910]
Colour: colourless to white Description: A material called "Soumansite," and an alteration product of amblygonite/montebrasite. Crystals usually very small (1-2mm). References: Lacroix, A. (1910) Minéralogie de la France et de ses colonies Vol. 4. Library Polytechnique, Paris. p.541 |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Habit: crusts of acicular crystals; fibrous-radiating globular aggregates; isolated crystals (striated along the c axis) Colour: colourless, white to yellowish-grey Fluorescence: green (UV of unspecified wavelength according to Bariand et al., 2006) Description: acicular crusts alternating with clay minerals, probably due to groundwater level fluctuations. |
| ⓘ 'Wolframite Group' References: |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite ? | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite ? | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' | 4.. | |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Varlamoffite | 4.DB.05 | Sn1-xFexO2-x(OH) |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Qitianlingite | 4.DB.35 | (Fe,Mn)2(Nb,Ta)2WO10 |
| ⓘ | Natanite | 4.FC.10 | Fe2+[Sn(OH)6] |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Lepidocrocite ? | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Curite ? | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Posnjakite ? | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite (TL) | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Lacroixite | 8.BH.10 | NaAl(PO4)F |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Viitaniemiite | 8.BL.15 | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| ⓘ | var. Manganapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Symplesite ? | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Cacoxenite ? | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| ⓘ | Chalcophyllite ? | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Bariopharmacosiderite ? | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite ? | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ | Morinite (TL) | 8.DM.05 | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite ? | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | var. Magnesium-bearing Schorl | 9.CK.05 | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Damourite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Corrensite | 9.EC.60 | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Barrandite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Amblygonite-Montebrasite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Plumbogummite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Natanite | Fe2+[Sn(OH)6] |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| H | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Amblygonite-Montebrasite Series | |
| H | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Amblygonite-Montebrasite Series | |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Lacroixite | NaAl(PO4)F |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Natanite | Fe2+[Sn(OH)6] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| O | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Amblygonite-Montebrasite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Lacroixite | NaAl(PO4)F |
| F | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| F | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| F | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| F | ⓘ Amblygonite-Montebrasite Series | |
| F | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Lacroixite | NaAl(PO4)F |
| Na | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Lacroixite | NaAl(PO4)F |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Amblygonite-Montebrasite Series | |
| Al | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Lacroixite | NaAl(PO4)F |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Amblygonite-Montebrasite Series | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Damourite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | ⓘ Morinite | NaCa2Al2(PO4)2(OH)F4 · 2H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Fluorapatite var. Manganapatite | Ca5(PO4)3F |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Mn | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Corrensite | (Mg,Fe)9((Si,Al)8O20)(OH)10 · nH2O |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Natanite | Fe2+[Sn(OH)6] |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Schorl var. Magnesium-bearing Schorl | Na((Fe2+,Mg)3)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Natanite | Fe2+[Sn(OH)6] |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Ta | Tantalum | |
| Ta | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Ta | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Qitianlingite | (Fe,Mn)2(Nb,Ta)2WO10 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Other Databases
| Wikipedia: | https://fr.wikipedia.org/wiki/Mine_de_Montebras |
|---|---|
| Wikidata ID: | Q3314844 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Massif CentralHighland Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Lacroix, A. (1910) Minéralogie de la France et de ses colonies Vol. 4. Library Polytechnique, Paris. p.923 - Morinite from the type locality
Pirard, C., Hatert, F., Fransolet, A.-M. (2007) Alteration sequences of aluminium phosphates from Montebras Pegmatite, Massif Central, France. Granitic Pegmatites: The State of the Art - International Symposium. 06th - 12th May 2007, Porto, Portugal.
www.bsgf.fr (n.d.) https://www.bsgf.fr/fr/articles/bsgf/full_html/2021/01/bsgf200012/bsgf200012.html
Montebras Mines, Montebras, Soumans, Aubusson, Creuse, Nouvelle-Aquitaine, France