Log In
Jokkmokk, Norrbotten County, Swedeni
| Regional Level Types | |
|---|---|
| Jokkmokk | Municipality |
| Norrbotten County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Area:
19,334 km2
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Lappland
Other Languages:
French:
Jokkmokk, Comté de Norrbotten, Suède
German:
Jokkmokk, Norrbottens län, Schweden
Italian:
Jokkmokk, Contea di Norrbotten, Svezia
Russian:
Йокмокк, Норрботтен, Швеция
Simplified Chinese:
约克莫克市, 北博滕省, 瑞典
Swedish:
Jokkmokks kommun, Norrbottens län, Sverige
Asturian:
Jokkmokks, Provincia de Norrbotten, Suecia
Bashkir:
Йокмокк , Швеция
Basque:
Jokkmokk udalerria, Norrbottengo konderria, Suedia
Belarusian:
Ёкмак, Нарботэн, Швецыя
Bulgarian:
Йокмок, Норботен, Швеция
Catalan:
Jokkmokk, Comtat de Norrbotten, Suècia
Czech:
Jokkmokk, Norrbotten, Švédsko
Danish:
Jokkmokks kommun, Norrbottens län, Sverige
Dutch:
Jokkmokk, Norrbottens län, Zweden
Estonian:
Jokkmoki vald, Norrbotteni lään, Rootsi
Faroese:
Jokkmokks kommuna, Norrbottens län, Svøríki
Farsi/Persian:
بخش یوکموک, شهرستان نوربوتن, سوئد
Finnish:
Jokimukan kunta, Norrbottenin lääni, Ruotsi
Hungarian:
Jokkmokk község, Norrbotten megye, Svédország
Japanese:
ヨックモック , ノールボッテン県, スウェーデン
Korean:
요크모크 시, 노르보텐주, 스웨덴
Limburgian:
Jokkmokk, Norrbottens län, Zwede
Low Saxon/Low German:
Kommun Jokkmokk, Lehn Norrbotten, Sweden
Minnan / Hokkien-Taiwanese:
Jokkmokk Chū-tī-chhī, Sūi-tián
Northern Sami:
Johkamohki gielda, Norrbottena leatna, Ruoŧŧa
Norwegian:
Jokkmokk, Norrbottens län, Sverige
Norwegian (Nynorsk):
Jokkmokk, Norrbottens län, Sverige
Polish:
Gmina Jokkmokk, Norrbotten, Szwecja
Portuguese:
Jokkmokk, Norrbotten, Suécia
Romanian:
Comuna Jokkmokk, Norrbottens län, Suedia
Traditional Chinese:
約克莫克市, 瑞典
Ukrainian:
Йоккмокк, Норрботтен, Швеція
Vietnamese:
Jokkmokk, Norrbotten, Thụy Điển
West Frisian:
Jokkmokk, Norrbottens län, Sweden
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities87 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Allanite-(Y) Formula: (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andalusite var. Viridine Formula: (Al,Mn3+)2SiO4O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Colour: Reddish-brown References: |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 References: Vandall Thomas King CollectionIdentified by Vandall Thomas King: Visual Identification Van KingIdentified by Vandall Thomas King: Visual Identification |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ 'Asbestos' |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bixbyite-(Mn) Formula: Mn3+2O3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cerianite-(Ce) Formula: Ce4+O2 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ Clinozoisite ? Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Description: No ref. |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ 'Fergusonite' |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Ferrihollandite Formula: Ba(Mn4+6Fe3+2)O16 |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Gadolinite' |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 |
| ⓘ Galena Formula: PbS Localities: |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Localities: Murjek, Jokkmokk, Norrbotten County, Sweden |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ ' Locality: Ruoutevare, Kvikkjokk, Jokkmokk, Norrbotten County, Sweden - erroneously reported Description: According to the revised the revised nomenclature of högbomite, nigerite, and taaffeite (Armbruster 2002) the "högbomite" described by Gavelin (1916) should be named Magnesiohögbomite-2N2S. |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Lokkaite-(Y) Formula: Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| ⓘ Magnesiohögbomite-2N2S (TL) Formula: [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 Type Locality: References: |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnesite var. Breunnerite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Alurgite Formula: K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Parauranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Petalite Formula: LiAl(Si4O10) |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Powellite var. Tungsten-powellite Formula: Ca(Mo,W)O4 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrite var. Bravoite Formula: (Fe,Ni)S2 |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Alkavare, Sarek National Park, Jokkmokk, Norrbotten County, Sweden Ruoutevare, Jokkmokk, Norrbotten County, Sweden Vaikijaur Cu-Mo-(Au) deposit, Jokkmokk, Norrbotten County, Sweden Silpatjåkko (Kedkevare), Padjelanta National Park, Jokkmokk, Norrbotten County, Sweden Flakaberget, Jokkmokk, Norrbotten County, Sweden |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rowlandite-(Y) Formula: (Y,Ce)4Fe2+(Si2O7)2F2 (?) References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ 'Scapolite' References: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Scheelite var. Molybdoscheelite Formula: Ca(WO4) References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Colour: Dark brown Description: massiv piece of coarse spessartine with 8 mm thick vein of fergusonite. Size of specimen 80*80*80 mm |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 Description: Given in original references as pleonaste. |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O References: |
| ⓘ Svabite Formula: Ca5(AsO4)3F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tengerite-(Y) Formula: Y2(CO3)3 · 2-3H2O |
| ⓘ Thalénite-(Y) Formula: Y3Si3O10F References: Škoda, Radek, Plášil, Jakub, Jonsson, Erik, Čopjaková, Renata, Langhof, Jörgen, Galiová, Michaela Vašinová (2015) Redefinition of thalénite-(Y) and discreditation of fluorthalénite-(Y): A re-investigation of type material from the Österby pegmatite, Dalarna, Sweden, and from additional localities. Mineralogical Magazine, 79 (4) 965-983 doi:10.1180/minmag.2015.079.4.07 |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Thorite var. Orangite Formula: Th(SiO4) |
| ⓘ Thorite var. Thorogummite Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Thortveitite Formula: Sc2Si2O7 Habit: long prismatic < 5 cm Colour: green to dark green Description: Found in Ruoutevare no 1 quarry (Langhof 1996).
Found inbetween flakes of biotite or in plagiclase. |
| ⓘ Titanite Formula: CaTiO(SiO4) References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wölsendorfite Formula: Pb7(UO2)14O19(OH)4 · 12H2O |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite var. Bravoite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | 2.EB.05a | FeS2 | |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | 'var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Bixbyite-(Mn) | 4.CB.10 | Mn3+2O3 |
| ⓘ | Magnesiohögbomite-2N2S (TL) | 4.CB.20 | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Ferrihollandite | 4.DK. | Ba(Mn4+6Fe3+2)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | Ce4+O2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Wölsendorfite | 4.GB.30 | Pb7(UO2)14O19(OH)4 · 12H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Tengerite-(Y) | 5.CC.10 | Y2(CO3)3 · 2-3H2O |
| ⓘ | Lokkaite-(Y) | 5.CC.15 | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Powellite var. Tungsten-powellite | 7.GA.05 | Ca(Mo,W)O4 |
| ⓘ | Scheelite var. Molybdoscheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite var. Orangite | 9.AD.30 | Th(SiO4) |
| ⓘ | 9.AD.30 | Th(SiO4) | |
| ⓘ | var. Thorogummite | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Viridine | 9.AF.10 | (Al,Mn3+)2SiO4O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Thortveitite | 9.BC.05 | Sc2Si2O7 |
| ⓘ | Clinozoisite ? | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Y) | 9.BG.05b | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Thalénite-(Y) | 9.BJ.20 | Y3Si3O10F |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Alurgite | 9.EC.15 | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Rowlandite-(Y) | 9.HG.20 | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Unclassified | |||
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Högbomite Group' ? | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| C | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerianite-(Ce) | Ce4+O2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Thorite var. Orangite | Th(SiO4) |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Svabite | Ca5(AsO4)3F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| O | ⓘ Thalénite-(Y) | Y3Si3O10F |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Thortveitite | Sc2Si2O7 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Powellite var. Tungsten-powellite | Ca(Mo,W)O4 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| O | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| F | ⓘ Svabite | Ca5(AsO4)3F |
| F | ⓘ Thalénite-(Y) | Y3Si3O10F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Thorite var. Orangite | Th(SiO4) |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Thortveitite | Sc2Si2O7 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| K | Potassium | |
| K | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Ca | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Powellite var. Tungsten-powellite | Ca(Mo,W)O4 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Sc | Scandium | |
| Sc | ⓘ Thortveitite | Sc2Si2O7 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ti | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mn | Manganese | |
| Mn | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Mn | ⓘ Bixbyite-(Mn) | Mn23+O3 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Mn | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Magnesiohögbomite-2N2S | [(Mg,Fe2+)3[Al7(Ti,Fe3+)]O15(OH)]2 |
| Fe | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Ni | Nickel | |
| Ni | ⓘ Pyrite var. Bravoite | (Fe,Ni)S2 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Svabite | Ca5(AsO4)3F |
| Y | Yttrium | |
| Y | ⓘ Allanite-(Y) | (CaY)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Y | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Y | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Y | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
| Y | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Powellite var. Tungsten-powellite | Ca(Mo,W)O4 |
| Ag | Silver | |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Ferrihollandite | Ba(Mn64+Fe23+)O16 |
| Ce | Cerium | |
| Ce | ⓘ Cerianite-(Ce) | Ce4+O2 |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nd | Neodymium | |
| Nd | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Gd | Gadolinium | |
| Gd | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Dy | Dysprosium | |
| Dy | ⓘ Lokkaite-(Y) | Ca(Y,Gd,Nd,Dy)4(CO3)7 · 9H2O |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Powellite var. Tungsten-powellite | Ca(Mo,W)O4 |
| W | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Orangite | Th(SiO4) |
| Th | ⓘ Thorite | Th(SiO4) |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| U | ⓘ Wölsendorfite | Pb7(UO2)14O19(OH)4 · 12H2O |
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 |
|---|---|
| Youngest Fossil Listed | 520 Ma (Cambrian) |
| Oldest Fossil Listed | 530 Ma (Cambrian) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Jokkmokk_Municipality |
|---|---|
| Wikidata ID: | Q512048 |
| GeoNames ID: | 2702996 |
Localities in this Region
- Norrbotten County
- Norrbotten County
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Central Finland Arc ComplexVolcanic Arc
- CaledonidesOrogenic Belt
EuropeContinent
Sweden
- Norrbotten County
- Jokkmokk
- Ultevis Nature ReserveConservation Reserve
- Jokkmokk
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Flakaberget, Jokkmokk, Norrbotten County, Sweden