Ripsey Hill area, Ripsey Mining District, Tortilla Mountains, Pinal County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Ripsey Hill area | Area |
| Ripsey Mining District | Mining District |
| Tortilla Mountains | Mountain Range |
| Pinal County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
32° North , 110° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~14km
Type:
Köppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities24 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Hemihedrite (TL) | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Mg | Magnesium | |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| As | Arsenic | |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
Localities in this Region
- Arizona
- Pinal County
- Tortilla Mountains
- Pinal County
- Arizona
- Pinal County
- Tortilla Mountains
- Ripsey Mining District
- Tortilla Mountains
- Pinal County
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Southern Basin and RangeWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.







Florence Mine, Ripsey Hill area, Ripsey Mining District, Tortilla Mountains, Pinal County, Arizona, USA