Florence Mine (Florence Lead Silver Mine), Ripsey Hill area, Ripsey Mining District, Tortilla Mountains, Pinal County, Arizona, USAi
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 0' 24'' North , 110° 57' 26'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kearny | 2,038 (2017) | 7.1km |
| Hayden | 650 (2017) | 16.0km |
| Dudleyville | 959 (2011) | 17.3km |
| Winkelman | 346 (2017) | 17.5km |
| Cactus Forest | 594 (2011) | 34.2km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Gila County Gem & Mineral Society | Miami, Arizona | 44km |
A former surface and underground Pb-Ag-Cu-Au-Mo-Cr-Zn mine located in sec. 12, T5S, R13E, about ½ mile E of Ripsey Hill, 2 miles W of Hackberry Mine and about 5½ miles SW of Kearny, on state land. Owned by Edward O. Ryden.
Mineralization is a sheared fault zone between Escabrosa Limestone and quartzite (granitic conglomerate of the San Manuel formation). Alteration is from sphalerite and galena. There were 3 stages of wulfenite formation with different chromium contents.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
18 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Galena Formula: PbS References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Hemihedrite (TL) Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 Type Locality: Colour: Bright orange to henna-brown to nearly black Description: Occurs in an oxidized zone of lead-bearing veins that cut strongly brecciated Precambrian limestone intruded by an altered latite porphyry and Precambrian quartzite containing a diabase dike. |
| ⓘ 'Limonite' References: |
| ⓘ 'Manganese Oxides' References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl References: |
| ⓘ Minium Formula: Pb3O4 References: |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 References: |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S References: |
| ⓘ Vauquelinite Formula: Pb2Cu(CrO4)(PO4)(OH) Description: Occurs in an oxide mineral assemblage that replaced galena-sphalerite, pyrite & tennantite along a sheared & mineralized fault zone separating limestone & quartzite. References: |
| ⓘ Willemite Formula: Zn2SiO4 References: |
| ⓘ Wulfenite Formula: Pb(MoO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Vauquelinite | 7.FC.05 | Pb2Cu(CrO4)(PO4)(OH) |
| ⓘ | Hemihedrite (TL) | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Mg | Magnesium | |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | Silicon | |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| P | Phosphorus | |
| P | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Cr | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| As | Arsenic | |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Vauquelinite | Pb2Cu(CrO4)(PO4)(OH) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
Other Databases
| Link to USGS MRDS: | 10037113 |
|---|
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Southern Basin and RangeWide Rift
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Florence Mine, Ripsey Hill area, Ripsey Mining District, Tortilla Mountains, Pinal County, Arizona, USA