Buer, Vesterøya, Sandefjord, Vestfold, Norwayi
| Regional Level Types | |
|---|---|
| Buer | Road Cutting |
| Vesterøya | Peninsula |
| Sandefjord | Municipality |
| Vestfold | County |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
59° 5' 51'' North , 10° 15' 44'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sandefjord | 42,654 (2017) | 4.5km |
| Tjøme | 4,663 (2018) | 7.6km |
| Larvik | 23,113 (2018) | 13.9km |
| Stokke | 2,618 (2017) | 14.0km |
| Årøysund | 2,052 (2018) | 14.6km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Fredrikstad og Omegn Geologiforening | Kråkerøy | 39km |
| Vestfold Geologiforening | Holmestrand | 41km |
Other Languages:
Norwegian:
Veiskjæring (sykkelsti) Buer, Vesterøya, Sandefjord kommune, Vestfold, Norge
A roadcut exposing a larvikite-pegmatite dyke. The minerals were collected in 1987 during a construction of a bicycle-pedestrian path.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
40 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Aenigmatite Formula: Na4[Fe2+10Ti2]O4[Si12O36] References: |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Arfvedsonite ? Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Description: Mentioned in Larsen & Raade (1997) without any more details on identification. Reported with a ? In Berge et al (2020). Identity needs to be confirmed. |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Catapleiite Formula: Na2Zr(Si3O9) · 2H2O Habit: plates 2-4 mm across Colour: pale reddish brown Description: embedded in feldspar |
| ⓘ 'Chlorite Group' |
| ⓘ Elpidite Formula: Na2ZrSi6O15 · 3H2O |
| ⓘ Epididymite Formula: Na2Be2Si6O15 · H2O |
| ⓘ 'Eudialyte Group' Formula: [N(1)N(2)N(3)N(4)N(5)]3[M(1.1)M(1.2)]3[M(2.1)M(2.2)M(2.3)]3-6[M(3)M(4)]Z3[Si24O72]Θ4X(1)X(2) |
| ⓘ Ferrokentbrooksite ? Formula: Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O Description: A potassian heulandite-Ca |
| ⓘ Heulandite-K Formula: (K,Ca,Na)5(Si27Al9)O72 · 26H2O Description: AS thin zones in potassian Heulandite-Ca |
| ⓘ Hochelagaite ? Formula: (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O References: |
| ⓘ ' Formula: [H3O]+2CaFe2+7Ti2[Si4O12]2O2(OH)4O Description: Described as "a murmanite-like mineral" (murmanittliknende mineral) in Engvoldsen et al (1991) |
| ⓘ Katophorite Formula: {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Polylithionite Formula: KLi2Al(Si4O10)(F,OH)2 References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Siderite Formula: FeCO3 References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Sveinbergeite (TL) Formula: (H2O)2[Ca(H2O)](Fe2+6Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2010) New minerals and nomenclature modifications approved in 2010, CNMNC Newsletter No 5. Mineralogical Magazine, 74 (5) 859-862 doi:10.1180/s0026461x00056887 Khomyakov, A. P., Cámara, F., Sokolova, E., Abdu, Y., Hawthorne, F. C. (2011) Sveinbergeite, Ca(Fe2+6 Fe3+)Ti2(Si4O12)2O2(OH)5(H2O)4, a new astrophyllite-group mineral from the Larvik Plutonic Complex, Oslo Region, Norway: description and crystal structure. Mineralogical Magazine, 75 (5) 2687-2702 doi:10.1180/minmag.2011.075.5.2687 |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
[N(1)N(2)N(3)N(4)N(5)]3[M(1.1)M(1.2)]3[M(2.1)M(2.2)M(2.3)]3-6[M(3)M(4)]Z3[Si24O72]Θ4X(1)X(2)ⓘ 'Eudialyte Group'
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Hochelagaite ? | 4.FM.15 | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Catapleiite | 9.CA.15 | Na2Zr(Si3O9) · 2H2O |
| ⓘ | Ferrokentbrooksite ? | 9.CO.10 | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | 'Hydroastrophyllite' ? | 9.DC.05 | [H3O]+2CaFe2+7Ti2[Si4O12]2O2(OH)4O |
| ⓘ | Sveinbergeite (TL) | 9.DC.05 | (H2O)2[Ca(H2O)](Fe2+6Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| ⓘ | Katophorite | 9.DE.20 | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| ⓘ | Arfvedsonite ? | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Epididymite | 9.DG.55 | Na2Be2Si6O15 · H2O |
| ⓘ | Elpidite | 9.DG.65 | Na2ZrSi6O15 · 3H2O |
| ⓘ | Aenigmatite | 9.DH.40 | Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-K | 9.GE.05 | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Eudialyte Group' | - | [N(1)N(2)N(3)N(4)N(5)]3[M(1.1)M(1.2)]3[M(2.1)M(2.2)M(2.3)]3-6[M(3)M(4)]Z3[Si24O72]Θ4X(1)X(2) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| H | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| H | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| H | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| Li | Lithium | |
| Li | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| C | Carbon | |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| O | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| O | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| O | ⓘ Eudialyte Group | [N(1)N(2)N(3)N(4)N(5)]3[M(1.1)M(1.2)]3[M(2.1)M(2.2)M(2.3)]3-6[M(3)M(4)]Z3[Si24O72]Θ4X(1)X(2) |
| O | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Na | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Na | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Si | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Si | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Si | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Si | ⓘ Eudialyte Group | [N(1)N(2)N(3)N(4)N(5)]3[M(1.1)M(1.2)]3[M(2.1)M(2.2)M(2.3)]3-6[M(3)M(4)]Z3[Si24O72]Θ4X(1)X(2) |
| Si | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Ca | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Ca | ⓘ Katophorite | {Na}{CaNa}{Mg4Al}[(AlSi7)O22](OH)2 |
| Ca | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| Ti | Titanium | |
| Ti | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Ti | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| Mn | Manganese | |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Fe | ⓘ Sveinbergeite | (H2O)2[Ca(H2O)](Fe62+Fe3+)Ti2[Si4O12]2O2(OH)4[(OH)(H2O)] |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Sr | Strontium | |
| Sr | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Zr | Zirconium | |
| Zr | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Nb | Niobium | |
| Nb | ⓘ Hochelagaite | (Ca,Na,Sr)(Nb,Ti,Si,Al)4O11 · 8H2O |
| Nb | ⓘ Ferrokentbrooksite | Na15Ca6(Fe,Mn)3Zr3NbSi25O73(O,OH,H2O)3Cl2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
EuropeContinent
Norway
- Oslo Volcanic ProvinceVolcanic Province
- ⭔Vestfold og Telemark (2020-2023)County
ScandinaviaRegion
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Engvoldsen, Tom, Andersen, Frode, Berge, Svein A., Burvald, Ingulv (1991) Pegmatittmineraler fra Larvik ringkompleks [Pegmatite minerals from the Larvik ring complex], in Mineraler fra Larvikittområdet. STEIN. Nordisk magasin for populær geologi, 18 (1) 15-71
Larsen, Alf Olav, Raade, Gunnar (1997) Pyroksener fra Oslofeltets syenittpegmatitter [Pyroxenes from the syenite pegmatites of the Oslo Region]. Norsk Bergverksmuseum Skrift, 12. 16-21
Larsen, Alf Olav (2001) Chemical composition of catapleiites from the syenite pegmatites in the Larvik plutonic complex, Norway. Norsk Bergverksmuseum Skrift, 18. 5-9 with an analysis of catapleiite from Buer
Berge, Svein Arne, Andersen, Frode (2002) Mineralforekomster i Sandefjordområdet [Mineral localities in the Sandefjord area]. Norsk Bergverksmuseum Skrift, 20. 50-59
Nordrum, Fred Steinar, Larsen, Alf Olav, Erambert, Muriel (2003) Minerals of the heulandite series in Norway - a progress report. Norsk Bergverksmuseum Skrift, 25. 51-62
Nordrum, Fred Steinar, Larsen, Alf Olav, Erambert, Muriel (2006) Minerals of the heulandite- and axinite series in Norway- additional data. Norsk Bergverksmuseum Skrift, 33. 27-34 with analysis of heulandite-Ca with zones of heulandite-K from Buer
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2010) New minerals and nomenclature modifications approved in 2010, CNMNC Newsletter No 5. Mineralogical Magazine, 74 (5) 859-862 doi:10.1180/s0026461x00056887
Berge, Svein Arne, Larsen, Knut Edvard, Andersen, Frode (2011) Buer, Vesterøya, Sandefjord- en typelokalitet for et nytt mineral [Buer, Vesterøya, Sandefjord - a type locality for a new mineral]. Norsk Bergverksmuseum Skrift, 46. 49-56
Khomyakov, A. P., Cámara, F., Sokolova, E., Abdu, Y., Hawthorne, F. C. (2011) Sveinbergeite, Ca(Fe2+6 Fe3+)Ti2(Si4O12)2O2(OH)5(H2O)4, a new astrophyllite-group mineral from the Larvik Plutonic Complex, Oslo Region, Norway: description and crystal structure. Mineralogical Magazine, 75 (5) 2687-2702 doi:10.1180/minmag.2011.075.5.2687




Buer, Vesterøya, Sandefjord, Vestfold, Norway