Log In
Aqaba Governorate, Jordani
| Regional Level Types | |
|---|---|
| Aqaba Governorate | Governorate |
| Jordan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Aqaba | 95,048 (2009) |
| Al Quwayrah | 7,372 (2015) |
| Tala Bay | 2,000 (2015) |
| Ramm | 200 (2017) |
Other Languages:
French:
Aqaba, Jordan
German:
Aqaba, Jordan
Italian:
governatorato di Aqaba, Giordania
Russian:
Акаба, Иордания
Simplified Chinese:
亞喀巴省, 约旦
Spanish:
Gobernación de Aqaba, Jordania
Arabic:
العقبة, الأردن
Armenian:
Ակաբայի մարզ, Հորդանան
Basque:
Aqaba Gobernazioa, Jordania
Belarusian (Tarashkevitsa):
Акаба, Ярданія
Bengali:
আকাবা গভর্নোরেট, জর্দান
Cebuano:
Aqaba, Hordanya
Czech:
Akaba, Jordán
Danish:
Aqaba Governorate, Jordan
Dutch:
Akaba, Jordanië
Esperanto:
Akabo, Jordanio
Farsi/Persian:
استان عقبه, اردن
Finnish:
Al 'Aqabah, Jordan
Greek:
Ακάμπα Γκοβερνοράτε, Ιορδανία
Gujarati:
ઍકાબા ગવર્નરેટ, જૉર્ડન
Hebrew:
עקבה, ירדן
Hindi:
अकाबा गवर्नरेट, जॉर्डन
Hungarian:
Akaba kormányzóság, Jordánia
Indonesian:
Aqaba Governorate, Yordania
Japanese:
アカバ県, ヨルダン
Kannada:
ಅಖಾಬಾ ಗವರ್ನೇಟ್, ಜೋರ್ಡಾನ್
Korean:
아카바 주, 요르단
Latvian:
Akabas muhāfaza, Jordānija
Limburgian:
Aqaba , Jordanië
Lithuanian:
Akabos muchafaza, Jordanija
Malay:
Aqaba Governorate, Jordan
Marathi:
अकाबा गव्हर्नोरेट, जॉर्डन
Norwegian:
Aqaba Givernorate, Jordan
Norwegian (Nynorsk):
Akaba guvernement, Jordan
Polish:
Akaba, Jordania
Portuguese:
Acaba , Jordânia
Romanian:
Guvernoratul Aqaba, Iordania
Scots:
Aqaba Govrenorate, Jordan
Sinhalese:
අකබා පළාත, ජෝර්දානය
Swedish:
Akaba, Jordan
Tamil:
அகிஆபா கோவெர்னோரேட், யோர்தான்
Telugu:
అకాబా గవర్నరేట్, జోర్డాన్
Thai:
เขตผู้ว่าราชการแอคะบา, จอร์แดน
Turkish:
Akabe , Ürdün
Ukrainian:
Муніципалітет Акаба, Йорданія
Urdu:
محافظہ عقبہ, اردن
Vietnamese:
Tỉnh Aqaba, Jordan
Welsh:
Ardal Lywodraethol Aqaba, Iorddonen
Western Punjabi:
ضلع عقبہ, اردن
Aqaba (Arabic: العقبة al-ʻAqabah) is one of the governorates of Jordan, located south of Amman, capital of Jordan.
Its capital is Aqaba.
It is the fourth-largest governorate in Jordan by area and is ranked 10th by population.
Aqaba, the port at the Red Sea, plays an important role in the economic life of Jordan.
Two of Jordan's top three tourist destinations lie in Aqaba Governorate: Wadi Rum and the port city of Aqaba.
The port is Jordan's most important import/export hub.
The industrial port lies about 15 km to the south from the beaches and the Aqaba city center.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities25 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ 'Alkali Feldspar' |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Crednerite Formula: Cu+Mn3+O2 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Halite Formula: NaCl |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Spertiniite Formula: Cu(OH)2 |
| ⓘ Tenorite Formula: CuO References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ 'Wad' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Crednerite | 4.AB.05 | Cu+Mn3+O2 |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Plancheite | 9.DB.35 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Crednerite | Cu+Mn3+O2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| V | Vanadium | |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Mn | Manganese | |
| Mn | ⓘ Crednerite | Cu+Mn3+O2 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Crednerite | Cu+Mn3+O2 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Zn | Zinc | |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
Fossils
There are 49 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 49 | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 0.01 Ma (Pleistocene) | ||||||||||||
| Oldest Fossil Listed | 101 Ma (Late/Upper Cretaceous) | ||||||||||||
| Stratigraphic Units |
| ||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||
| Fossil Localities | Click to show 3 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Aqaba_Governorate |
|---|---|
| Wikidata ID: | Q260796 |
| GeoNames ID: | 443122 |
Localities in this Region
- Aqaba Governorate
Other Regions, Features and Areas that Intersect
Arabian PlateTectonic Plate
- Arabian-Nubian ShieldShield
- Arabian ShieldShield
- Arabian PlatformBasin
- Elat-Dead Sea basinBasin
- Tabuk basinBasin
AsiaContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Copper mines, Wadi Arabah, Aqaba Qasabah District, Aqaba Governorate, Jordan