Log In
Canton Wiltz, Luxembourgi
| Regional Level Types | |
|---|---|
| Canton Wiltz | Canton |
| Luxembourg | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Wiltz | 4,816 (2017) |
| Eschdorf | 433 (2017) |
| Heiderscheid | 424 (2017) |
| Boulaide | 396 (2017) |
| Harlange | 378 (2017) |
| Esch-sur-Sûre | 333 (2017) |
Other Languages:
French:
canton de Wiltz, Luxembourg
German:
Kanton Wiltz, Luxemburg
Italian:
cantone di Wiltz, Lussemburgo
Russian:
Вильц, Люксембург
Simplified Chinese:
维尔茨县, 卢森堡
Spanish:
Cantón de Wiltz, Luxemburgo
Alemannic:
Kanton Wolz
Bavarian:
Kanton Wiltz
Catalan:
Cantó de Wiltz, Luxemburg
Cebuano:
Canton de Wiltz
Czech:
Kanton Wiltz, Lucembursko
Danish:
Wiltz, Luxembourg
Dutch:
Kanton Wiltz, Luxemburg
Esperanto:
Kantono Wiltz
Farsi/Persian:
ویلتز , لوکزامبورگ
Indonesian:
Kanton Wiltz, Luksemburg
Korean:
빌츠 주, 룩셈부르크
Limburgian:
Wiltz
Lithuanian:
Vilco kantonas, Liuksemburgas
Low Saxon/Low German:
Kanton Wiltz
Luxembourgish:
Kanton Wolz
Minnan / Hokkien-Taiwanese:
Wiltz
Northern Frisian:
Wiltz
Norwegian:
Wiltz, Luxembourg
Polish:
Kanton Wiltz, Luksemburg
Portuguese:
Wiltz, Luxemburgo
Romanian:
Wiltz, Luxemburg
Slovak:
Wiltz, Luxembursko
Swedish:
Wiltz , Luxemburg
Turkish:
Wiltz kantonu, Lüksemburg
Ukrainian:
Вільц, Люксембург
Urdu:
ولتز
Vietnamese:
Wiltz, Luxembourg
Wiltz is a canton in northwestern Luxembourg. Its capital is the city of Wiltz. It covers an area of 264.55 km².
Wiltz Canton consists of the following seven communes: Boulaide, Esch-sur-Sûre, Goesdorf, Kiischpelt, Lac de la Haute-Sûre, Wiltz, and Winseler.
Wiltz Canton consists of the following seven communes: Boulaide, Esch-sur-Sûre, Goesdorf, Kiischpelt, Lac de la Haute-Sûre, Wiltz, and Winseler.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 Description: See, however, remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Azurite ? Formula: Cu3(CO3)2(OH)2 Description:
|
| ⓘ Berthierite Formula: FeSb2S4 References: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ Brandholzite Formula: MgSb2(OH)12 · 6H2O References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cervantite ? Formula: Sb3+Sb5+O4 Description: See remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50 |
| ⓘ Cetineite Formula: (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Chalcostibite Formula: CuSbS2 References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Description: Fe-variety (see http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50)
References: |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Cualstibite Formula: Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ Delafossite ? Formula: Cu+Fe3+O2 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Gahnite ? Formula: ZnAl2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Galena Formula: PbS |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gibbsite ? Formula: Al(OH)3 Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ 'Limonite' |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 References: |
| ⓘ Native Antimony Formula: Sb References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Peretaite Formula: Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| ⓘ Plagionite Formula: Pb5Sb8S17 References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Ramsbeckite ? Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schafarzikite Formula: Fe2+Sb3+2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed in Philippo & Hatert 2018 (p36) - analysed by Meisser (Lausanne) and By Philippo (Luxembourg) on a second sample
|
| ⓘ Senarmontite Formula: Sb2O3 References: |
| ⓘ Siderite Formula: FeCO3 Description: eds and xrd analysis (see Philippo & Hatert 2018) References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: |
| ⓘ Stibnite Formula: Sb2S3 References: |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed by eds, wds and xrd analysis in Philippo & Hatert 2018
|
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ 'Wad' |
| ⓘ Zinkenite Formula: Pb9Sb22S42 References: |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Cetineite | 2.MA.05 | (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Delafossite ? | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite ? | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Cervantite ? | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Cualstibite | 4.FB.10 | Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Gibbsite ? | 4.FE.10 | Al(OH)3 |
| ⓘ | Brandholzite | 4.FH.05 | MgSb2(OH)12 · 6H2O |
| ⓘ | Schafarzikite | 4.JA.20 | Fe2+Sb3+2O4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite ? | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Ramsbeckite ? | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Peretaite | 7.DF.45 | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| Na | Sodium | |
| Na | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Al | Aluminium | |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Ni | Nickel | |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Ba | Barium | |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Fossils
There are 3 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 3 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 393 Ma (Early/Lower Devonian) | ||||||
| Oldest Fossil Listed | 419 Ma (Early/Lower Devonian) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Wiltz_(canton) |
|---|---|
| Wikidata ID: | Q550021 |
| GeoNames ID: | 2959975 |
Localities in this Region
- Canton Wiltz
- Canton Wiltz
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
- Ardennes MountainsMountain Range
- Rhenish MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourg