Log In
Ardennes Mountains, Europei
| Regional Level Types | |
|---|---|
| Ardennes Mountains | Mountain Range |
| Europe | Continent |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Charleville-Mézières | 52,415 (2018) |
| Arlon | 26,179 (2008) |
| Bastogne | 14,395 (2013) |
| Hirson | 11,133 (2016) |
| Saint-Vith | 9,135 (2012) |
| Bertrix | 8,063 (2012) |
Museums in region:
Other/historical names associated with this locality:
Ardennes Forest; Forest of Ardennes
A region of extensive forests, rough terrain, rolling hills and ridges. Geologically, the range is a western extension of the Eifel, and both were raised during the Givetian age of the Devonian (382.7 to 387.7 million years ago).
The Ardennes are located primarily in Belgium and Luxembourg, but stretch also into Germany and France (lending its name to the Ardennes department and the former Champagne-Ardenne region) and geologically into the Eifel.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities219 valid minerals. 6 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Description: Acanthite occurs as fibrous radiating tufts of black crystals less than 100 µm in size, deposited on dendrites of native silver. The X-ray powder pattern is similar to that of synthetic acanthite (JCPDS 14-72). Qualitative chemical analysis confirms the presence of major Ag and S, together with minor Cu, Zn, and Cl. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 12 localities in this region. Description: associated with quartz, malachite, and/or ardennite |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Altaite Formula: PbTe |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 13 localities in this region. Colour: red, orange, yellow, brown, green, black |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 9 localities in this region. Habit: prismatic Colour: pale green Description: alters to muscovite (Corin, 1929) or kaolinite, sericite and/or pyrophyllite (Theunissen, 1970) |
| ⓘ Andalusite var. Viridine Formula: (Al,Mn3+)2SiO4O |
| ⓘ Anglesite Formula: PbSO4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Anilite Formula: Cu7S4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 12 localities in this region. Colour: light purple Description: Associated with ardennite |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Ardennite' Description: "Ardennite was discovered at Salmchâteau, associated with apatite and albite, in a quartz vein more or less parallel to the stratification of the weakly metamorphic manganiferous phyllites of the Ottré Formation." (Hatert et al., 2002) |
| ⓘ Ardennite-(As) (TL) Formula: Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 Localities: Reported from at least 9 localities in this region. Description: The specimens are typically massive cream colored quartz that have in it non freestanding prismatic, tan radiating bundles up to 4cm of non terminated crystals. |
| ⓘ Ardennite-(V) Formula: Mn2+4Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenoflorencite-(Ce) Formula: CeAl3(AsO4)2(OH)6 |
| ⓘ Arsenogoyazite Formula: SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 6 localities in this region. |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Lienne valley, Liège, Wallonia, Belgium La Roche road cut, La-Roche-en-Ardenne, Luxembourg, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Val-de-Poix, Hatrival, Saint-Hubert, Luxembourg, Wallonia, Belgium Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourg ? (more information) |
| ⓘ Balkanite ? Formula: Cu9Ag5HgS8 |
| ⓘ Balyakinite Formula: Cu(TeO3) Localities: Habit: millimetre-sized specks and prismatic crystals up to 30µm Colour: bluish-green Description: Associated with teineite. |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O Description: Lefevre & Hatert (2003): "Other crystals [of pharmacosiderite] have been identified on the graulichite-(Ce) aggregates. Qualitative chemical analysis of these crystals has shown an enrichment in Ba compared to K, indicating that they would probably consist of bariopharmacosiderite."
Hatert et al. (2003): "It is noteworthy that Lefèvre (2001) described barium-pharmacosiderite, BaFe3+8(AsO4)6(OH)8.14H2O, in very close association with the new mineral species [graulichite-(Ce)]." |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Habit: spherical aggregates consisting of rosettes of extremely thin polygonal crystals on adularia Colour: white to beige to yellow Description: intermixed with synchisite-(Ce) |
| ⓘ 'Bastonite' Formula: near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O Localities: Habit: lamellae up to a few centimetres Description: "The most interesting geological site for biotite is the ensemble of veins in the Bastogne region, where the lamellae can be up to a few centimetres in length. Here, the mineral was baptised "bastonite". Already mentioned by A. Dumont (in Buttgenbach, 1947), it is considered to be an altered biotite. The chemical analysis was done by Klement (1888) and according to Corin (1930), some lamellae are reportedly titaniferous. The morphological and especially the optical characteristics of "bastonite" lead to its assimilation to biotite, a fact already suspected by J. Gosselet (Prinz, 1909). Therefore, the term "bastonite" should be abandoned." (Hatert et al., 2002) |
| ⓘ Berthierite Formula: FeSb2S4 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Habit: prismatic Colour: colourless to light green Description: intimately associated with malachite and vein quartz |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Bindheimite' Formula: Pb2Sb2O6O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Bogdanovite ? Formula: (Au,Te,Pb)3(Cu,Fe) |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Brandholzite Formula: MgSb2(OH)12 · 6H2O References: |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 Localities: Habit: fine-grained Colour: Creamy grey with a hint of brown in polished sections |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O Localities: Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (east), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Regné, Bihain, Vielsalm, Luxembourg, Wallonia, Belgium Hébronval, Bihain, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mine dumps, Bihain, Vielsalm, Luxembourg, Wallonia, Belgium Habit: spherules with fibroradiating structure and matte or spikey surface Colour: brown |
| ⓘ Calcioancylite-(Ce) Formula: (Ce,Ca,Sr)CO3(OH,H2O) Habit: tiny acute dipyramidal crystals |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 17 localities in this region. |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 Habit: acicular Colour: carmine-red Description: carmine-red acicular crystals, usually grouped in bundles |
| ⓘ Carpholite Formula: Mn2+Al2(Si2O6)(OH)4 Locality: Lienne valley, Liège, Wallonia, Belgium Description: Contains trace amounts of arsenic, fluor, and titanium and is sometimes enriched in vanadium when associated with ardennite (Theye et al., 1996). |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Localities: Reported from at least 8 localities in this region. Habit: combinations of {110} {100} {130} {010} {021} {011} {012} with (110) twin. Other crystals, mainly composed of the rectangular prism {001} {100} {010} and elongated according to [001] show the two twins (110) and (310) (Cesàro, 1897) |
| ⓘ Cervantite ? Formula: Sb3+Sb5+O4 Description: See remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50 |
| ⓘ Cetineite Formula: (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O References: |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 7 localities in this region. Habit: lamellar grains Description: Associated with malachite. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Habit: pseudohexagonal tablets up to 1mm, flattened parallel to the perfect cleavage plane (0001) Colour: turquoise blue with pearly lustre Description: Apart from the major elements, qualitative chemical analysis has shown low V, P, Cl, Ca and U contents (Hatert et al., 1998). The arsenic would originate from the alteration of arsenopyrite which also occurs in the deposit. References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Chalcostibite Formula: CuSbS2 References: |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O)10(OH)8 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 22 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ 'Clay minerals' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Localities: Reported from at least 12 localities in this region. |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 Locality: Lienne valley, Liège, Wallonia, Belgium |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Habit: fibroradiating spherules or aggregates up to 200µm. Colour: deep blue Description: Associated with brochantite and langite. |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Covellite Formula: CuS Localities: Reported from at least 9 localities in this region. |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 Localities: Reported from at least 9 localities in this region. |
| ⓘ Cualstibite Formula: Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 9 localities in this region. Habit: octahedra showing {110} and {112} facets Description: Associated with malachite, native copper and quartz (Buttgenbach, 1921). |
| ⓘ Danielsite ? Formula: (Cu,Ag)14HgS8 |
| ⓘ Davreuxite Formula: MnAl6Si4O17(OH)2 Localities: |
| ⓘ Dawsonite Formula: NaAlCO3(OH)2 Habit: fibroradiated spherulites and globules up to 1-2mm (Van Tassel, 1962) Colour: white References: |
| ⓘ Delafossite Formula: Cu+Fe3+O2 Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourg ? (more information) Habit: fibroradiated globules with metallic reflections on broken surfaces Colour: black Description: ID confirmed by XRD and qualitative chemical analysis. Associated with goethite, chalcopyrite and malachite. |
| ⓘ Denningite ? Formula: (Mn2+,Ca,Zn)Te4+2O5 |
| ⓘ Diaspore Formula: AlO(OH) |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Digenite Formula: Cu9S5 Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Lienne valley, Liège, Wallonia, Belgium Fléssen, Stolzembourg, Putscheid, Canton Vianden, Luxembourg Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Djurleite Formula: Cu31S16 Localities: Colour: black |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Faustite Formula: ZnAl6(PO4)4(OH)8 · 4H2O Habit: spheres Colour: grey to white Description: Beside Zn and Al only minor Cu, Fe and Ni could be determined (semiquantitatively). |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Habit: tufts of acicular crystals up to 250µm Colour: yellow Description: "Van Tassel (1983) describes a mineral growing as tufts of yellow acicular crystals of up to 250µm, associated with molybdenite from Cahay (Vielsalm). This could be ferrimolybdite. It has been identified, with certain reservations, by XRD and qualitative chemical analysis." (Hatert et al., 2002) |
| ⓘ 'Florencite' |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 Localities: Reported from at least 6 localities in this region. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Reported from at least 10 localities in this region. |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 21 localities in this region. Habit: octahedra (often modified by {101}), rarely cubes |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gibbsite ? Formula: Al(OH)3 Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ 'Glauconite' Formula: K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 20 localities in this region. |
| ⓘ Gonnardite Formula: (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ Graemite Formula: Cu[TeO3] · H2O |
| ⓘ Graphite Formula: C |
| ⓘ Graulichite-(Ce) (TL) Formula: CeFe3+3(AsO4)2(OH)6 Type Locality: Habit: 80 to 150 µm spherical aggregates of rhombohedral crystals 50 to 80μm in length Colour: light-green to brownish, resinous lustre References: Hatert, Frédéric, Lefèvre, Pierre, Pasero, Marco, Fransolet, André -Mathieu (2003) Graulichite-(Ce), a new arsenate mineral from the Stavelot Massif, Belgium. European Journal of Mineralogy, 15 (4) 733-739 doi:10.1127/0935-1221/2003/0015-0733 Dillen, R., Dehove, J., Detaille, J. (2004) Graulichiet-Ce), een nieuw mineraal ontdekt in België [Graulichiet-Ce), a new mineral discovered in Belgium]. Geonieuws, 29 (06) 134-148 |
| ⓘ Gravegliaite Formula: Mn2+SO3 · 3H2O |
| ⓘ Groutite Formula: Mn3+O(OH) Locality: Lienne valley, Liège, Wallonia, Belgium |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 10 localities in this region. |
| ⓘ Halite Formula: NaCl Description: Microinclusions in quartz. |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 30 localities in this region. |
| ⓘ Hematite var. Martite Formula: Fe2O3 Localities: Habit: octahedra |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 Localities: Habit: very thin needles up to 2mm Description: Hollandite Sr-end member up to 60% associated with braunite. |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hydroniumjarosite Formula: (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ice Formula: H2O |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kanonaite Formula: Mn3+Al(SiO4)O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 Habit: tiny steep rhombohedra Fluorescence: beige to light pale green |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 Locality: Lienne valley, Liège, Wallonia, Belgium Habit: primitive rhombohedra Colour: pale pink Description: Microprobe analysis (Schreyer et al., 1986) shows highly elevated levels of MgO. |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 6 localities in this region. Habit: lamellae (flattened according to {001} and elongated according to [100]) Colour: blue Description: Associated with copper sulfides in quartz veins |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Leucoxene' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (east), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ 'Limonite' Localities: Reported from at least 8 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lithiophorite Formula: (Al,Li)MnO2(OH)2 Localities: Reported from at least 6 localities in this region. Habit: Small masses associated with wavellite or quartz Colour: dark grey to black Description: Microprobe analysis has shown, apart from Al and Mn, low contents of Co, Cu, Zn and Ni. According to Mélon et al. (1976), Laspeyre may have analysed a mixture of cryptomelane and lithiophorite (due to the relatively high K2O content). |
| ⓘ Luxembourgite (TL) Formula: AgCuPbBi4Se8 Type Locality: |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 12 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Malhmoodite Formula: FeZr(PO4)2 · 4H2O |
| ⓘ 'Manganese Oxides' Localities: Reported from at least 7 localities in this region. |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Melonite Formula: NiTe2 |
| ⓘ Melonite var. Palladium-bearing Melonite ? Formula: (Ni,Pd)Te2 |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl Localities: Habit: acicular crystals up to 300µm, often in fibroradiating groups Colour: colourless to whitish Description: Associated with arsenopyrite. Contains trace amounts of Fe and Ca. |
| ⓘ Mogánite Formula: SiO2 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdite Formula: MoO3 References: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montanite Formula: Bi2(TeO6) · nH2O |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Montroydite ? Formula: HgO |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Muscovite var. Alurgite Formula: K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 Localities: Habit: lamellae Colour: greenish (dichroic) Description: erroneously identified as cupriferous pyrophyllite by e.g. Dewalque (1894) |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Habit: flakes |
| ⓘ Nahcolite Formula: NaHCO3 Description: Microinclusions in quartz. |
| ⓘ Native Antimony Formula: Sb References: |
| ⓘ Native Copper Formula: Cu Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Stolzembourg Copper Mine, Stolzembourg, Putscheid, Canton Vianden, Luxembourg Lienne valley, Liège, Wallonia, Belgium Copper-tellurium mineralization, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 16 localities in this region. Habit: tiny lamellae in quartz veins and pseudocoticule |
| ⓘ Native Silver Formula: Ag Description: Dendritic aggregates up to 4-5mm associated with altered galena and acanthite. The aggregates are formed by entangled crystals among which two forms are observed: the cube {100} and the rhombododecahedron {110}. The identification of this mineral has been confirmed by chemical analysis which shows Ag with minor Cu, Zn, I, and Cl. The two last elements are probably related to the presence of halides such as iodargyrite, AgI, or chlorargyrite, AgCl. References: |
| ⓘ Native Sulphur Formula: S8 Localities: Colour: colourless to yellowish Description: Originating from the alteration of sulfides associated with the quartz veins. |
| ⓘ Native Tellurium Formula: Te |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Nsutite Formula: (Mn4+,Mn2+)(O,OH)2 Localities: Habit: botryoidal masses with concentric structure Colour: black |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) Habit: prismatic, elongated according to the c axis showing {110} and {101} Colour: pale olive green |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Ottrélite Formula: Mn2+Al2O(SiO4)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 Localities: Description: intimately associated with muscovite |
| ⓘ Paratellurite Formula: TeO2 |
| ⓘ Peretaite Formula: Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Habit: coatings consisting of cubic or tetrahedral microcrystals up to 100µm showing {100} and {111} Colour: yellowish, pale green, brownish Description: Associated with arsenopyrite. Chemical analysis shows the presence of low quantities of Al replacing Fe3+. |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Localities: Description: associated with spessartine and kutnohorite. Contains close to 4% Ce2O3 (Hatert et al., 2002). |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Plagionite Formula: Pb5Sb8S17 References: |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O Localities: Habit: crusts composed of fibrous aggregates Colour: light blue Description: In a phyllite-like green rock with abundant chloritoid |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Reported from at least 6 localities in this region. Colour: dark green |
| ⓘ Pumpellyite-(Al) (TL) Formula: Ca2AlAl2[Si2O6OH][SiO4](OH)2O Type Locality: |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 31 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Reported from at least 8 localities in this region. Habit: thick or elongated hexagonal prisms which are sometimes hollow or striated with white bands perpendicular to the elongation and fibrous masses Colour: white, yellow, olive to malachite green Description: Sometimes as pseudomorphs after cerussite. |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 Localities: Reported from at least 12 localities in this region. Habit: lamellar Colour: yellowish to greenish-white |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 54 localities in this region. Colour: white, smoky, violet |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Carnelian Formula: SiO2 Localities: Description: Listed as "cornalite". |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Eisenkiesel Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: Habit: Very nice Dauphiné law twins are common.
|
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Ramsbeckite ? Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Ramsdellite Formula: Mn4+O2 References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, SEM-EDS |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O References: |
| ⓘ Rhabdophane-(Ce) Formula: Ce(PO4) · 0.6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Lienne valley, Liège, Wallonia, Belgium Coticule mines (west), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Ardennite-quartz veins, Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium Habit: spar-like masses Colour: pink |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 References: |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 20 localities in this region. Habit: acicular, most often 2-3mm but up to 1cm in quartz |
| ⓘ Rutile var. Sagenite (of Saussure) Formula: TiO2 References: |
| ⓘ 'Saussurite' |
| ⓘ 'Scapolite' Description: Saussurite. |
| ⓘ Schafarzikite Formula: Fe2+Sb3+2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed in Philippo & Hatert 2018 (p36) - analysed by Meisser (Lausanne) and By Philippo (Luxembourg) on a second sample
|
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Senarmontite Formula: Sb2O3 References: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Smithsonite Formula: ZnCO3 References: |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Localities: Reported from at least 16 localities in this region. |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 16 localities in this region. |
| ⓘ Spinel ? Formula: MgAl2O4 References: |
| ⓘ Stavelotite-(La) (TL) Formula: (La,Nd,Ca)3Mn2+3Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 Type Locality: |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: |
| ⓘ Stibnite Formula: Sb2S3 References: |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ Strengite Formula: FePO4 · 2H2O References: |
| ⓘ Strontiomelane Formula: Sr(Mn4+6Mn3+2)O16 Habit: thin acicular crystals up to 2mm Description: Associated with braunite and/or kanonaite. Microprobe analysis shows the replacement of Ba by Sr of up to 60%, resulting in the mineral strontiomelane. References: Schreyer, Werner, Fransolet, André-Mathieu, Bernhardt, Heinz-Jürgen (2001) Hollandite–strontiomelane solid solutions coexisting with kanonaite and braunite in late quartz veins of the Stavelot Massif, Ardennes, Belgium. Contributions to Mineralogy and Petrology, 141 (5) 560-571 doi:10.1007/s004100100260 |
| ⓘ Sudoite Formula: Mg2Al3(AlSi3O10)(OH)8 Localities: |
| ⓘ Sursassite Formula: Mn2+2Al3(SiO4)(Si2O7)(OH)3 Locality: Lienne valley, Liège, Wallonia, Belgium |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F Description: intermixed with bastnäsite-(Ce) References: |
| ⓘ Teineite Formula: Cu2+(Te4+O3) · 2H2O Localities: Habit: millimeter-sized isolated crystals; polycrystalline aggregates up to 2.5mm; lamellae and "veneer"; glassy lustre; SEM analysis shows complex crystal faces Colour: azure blue Description: Intimately associated with covellite, hematite, and malachite |
| ⓘ Tellurobismuthite Formula: Bi2Te3 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Locality: Lienne valley, Liège, Wallonia, Belgium |
| ⓘ Tenorite Formula: CuO |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 12 localities in this region. Colour: colourless Description: in ardennite and vein quartz |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed by eds, wds and xrd analysis in Philippo & Hatert 2018
|
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Localities: Habit: multifaceted crystals up to 1-2mm; crusts coating cracks in quartz; globules resembling rosebuds Colour: blue-green |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ Vantasselite (TL) Formula: Al4(PO4)3(OH)3 · 9H2O Type Locality: Habit: rosettes of thin tabular crystals; comb-shaped aggregates consisting of stacked fan-shaped lamellae (flattened according to {001}, elongated according to [100] and ending in {120} faces) Colour: white |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Volborthite Formula: Cu3(V2O7)(OH)2 · 2H2O |
| ⓘ 'Wad' |
| ⓘ Wardite Formula: NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ Wavellite Formula: Al3(PO4)2(OH)3 · 5H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Habit: usually as combinations of {101} and {112}, sometimes with less developed {104} facets; sometimes more elongated crystals, composed of very steep quadroctahedra with curved faces Colour: white, caramel brown, greasy lustre Description: Qualitative chemical analyses show (apart from Pb and Mo as major elements) non-negligible amounts of Fe and Cu. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: Old quarry, La Haie forest, Bertrix, Luxembourg, Wallonia, Belgium Thier des Carrières, Cahay, Vielsalm, Luxembourg, Wallonia, Belgium Sur les Roches quarry, Bastogne, Luxembourg, Wallonia, Belgium La Haie forest, Bertrix, Luxembourg, Wallonia, Belgium Coticule mines (east), Salmchâteau, Vielsalm, Luxembourg, Wallonia, Belgium |
| ⓘ Zemannite ? Formula: Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| ⓘ Zinkenite Formula: Pb9Sb22S42 References: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Description: Saussurite. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| ⓘ | Native Tellurium | 1.CC.10 | Te |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Anilite | 2.BA.10 | Cu7S4 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Bogdanovite ? | 2.BA.80 | (Au,Te,Pb)3(Cu,Fe) |
| ⓘ | Balkanite ? | 2.BD.15 | Cu9Ag5HgS8 |
| ⓘ | Danielsite ? | 2.BD.15 | (Cu,Ag)14HgS8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Melonite | 2.EA.20 | NiTe2 |
| ⓘ | var. Palladium-bearing Melonite ? | 2.EA.20 | (Ni,Pd)Te2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Luxembourgite (TL) | 2.HB.20e | AgCuPbBi4Se8 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Cetineite | 2.MA.05 | (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Ice | 4.AA.05 | H2O |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Delafossite | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Montroydite ? | 4.AC.15 | HgO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel ? | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Martite | 4.CB.05 | Fe2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Eisenkiesel | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Mogánite | 4.DA.20 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Rutile var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | Nsutite | 4.DB.15c | (Mn4+,Mn2+)(O,OH)2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Paratellurite | 4.DE.25 | TeO2 |
| ⓘ | Cervantite ? | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | 'Bindheimite' | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Strontiomelane | 4.DK.05a | Sr(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Cualstibite | 4.FB.10 | Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Groutite | 4.FD.10 | Mn3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Gibbsite ? | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Lithiophorite | 4.FE.25 | (Al,Li)MnO2(OH)2 |
| ⓘ | Brandholzite | 4.FH.05 | MgSb2(OH)12 · 6H2O |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Schafarzikite | 4.JA.20 | Fe2+Sb3+2O4 |
| ⓘ | Gravegliaite | 4.JE.05 | Mn2+SO3 · 3H2O |
| ⓘ | Balyakinite | 4.JK.15 | Cu(TeO3) |
| ⓘ | Denningite ? | 4.JK.30 | (Mn2+,Ca,Zn)Te4+2O5 |
| ⓘ | Zemannite ? | 4.JM.05 | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| ⓘ | Graemite | 4.JM.15 | Cu[TeO3] · H2O |
| ⓘ | Teineite | 4.JM.20 | Cu2+(Te4+O3) · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Nahcolite | 5.AA.15 | NaHCO3 |
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| ⓘ | Dolomite var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Dawsonite | 5.BB.10 | NaAlCO3(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Calcioancylite-(Ce) | 5.DC.05 | (Ce,Ca,Sr)CO3(OH,H2O) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Hydroniumjarosite | 7.BC.10 | (H3O)Fe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Montanite | 7.CD.60 | Bi2(TeO6) · nH2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Ramsbeckite ? | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Peretaite | 7.DF.45 | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Arsenogoyazite | 8.BL.10 | SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Arsenoflorencite-(Ce) | 8.BL.13 | CeAl3(AsO4)2(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Graulichite-(Ce) (TL) | 8.BL.13 | CeFe3+3(AsO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Malhmoodite | 8.CE.75 | FeZr(PO4)2 · 4H2O |
| ⓘ | Rhabdophane-(Ce) | 8.CJ.45 | Ce(PO4) · 0.6H2O |
| ⓘ | Vantasselite (TL) | 8.DC.37 | Al4(PO4)3(OH)3 · 9H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| ⓘ | Faustite | 8.DD.15 | ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Wardite | 8.DL.10 | NaAl3(PO4)2(OH)4 · 2H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ | Volborthite | 8.FD.05 | Cu3(V2O7)(OH)2 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kanonaite | 9.AF.10 | Mn3+Al(SiO4)O |
| ⓘ | Andalusite var. Viridine | 9.AF.10 | (Al,Mn3+)2SiO4O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Ottrélite | 9.AF.85 | Mn2+Al2O(SiO4)(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Stavelotite-(La) (TL) | 9.BE.87 | (La,Nd,Ca)3Mn2+3Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| ⓘ | Davreuxite | 9.BF.15 | MnAl6Si4O17(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Sursassite | 9.BG.15 | Mn2+2Al3(SiO4)(Si2O7)(OH)3 |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Pumpellyite-(Al) (TL) | 9.BG.20 | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| ⓘ | Ardennite-(As) (TL) | 9.BJ.40 | Mn2+4Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Ardennite-(V) | 9.BJ.40 | Mn2+4Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Carpholite | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Alurgite | 9.EC.15 | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| ⓘ | var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O)10(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Sudoite | 9.EC.55 | Mg2Al3(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Albite var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Gonnardite | 9.GA.05 | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Bastonite' | - | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Glauconite' | - | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Florencite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Saussurite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Ardennite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| H | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| H | ⓘ Dawsonite | NaAlCO3(OH)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| H | ⓘ Graemite | Cu[TeO3] · H2O |
| H | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| H | ⓘ Groutite | Mn3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ice | H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montanite | Bi2(TeO6) · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nahcolite | NaHCO3 |
| H | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| H | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| H | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| H | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| H | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| H | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dawsonite | NaAlCO3(OH)2 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Nahcolite | NaHCO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Balyakinite | Cu(TeO3) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| O | ⓘ Dawsonite | NaAlCO3(OH)2 |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Denningite | (Mn2+,Ca,Zn)Te24+O5 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| O | ⓘ Graemite | Cu[TeO3] · H2O |
| O | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| O | ⓘ Groutite | Mn3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ice | H2O |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Hematite var. Martite | Fe2O3 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mogánite | SiO2 |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montanite | Bi2(TeO6) · nH2O |
| O | ⓘ Montroydite | HgO |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nahcolite | NaHCO3 |
| O | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paratellurite | TeO2 |
| O | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| O | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| O | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| O | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Quartz var. Eisenkiesel | SiO2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| O | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| O | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| O | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Na | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Na | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Nahcolite | NaHCO3 |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mg | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Mg | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Al | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Al | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Al | ⓘ Dawsonite | NaAlCO3(OH)2 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Al | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Al | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Al | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Si | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Mogánite | SiO2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Sudoite | Mg2Al3(AlSi3O10)(OH)8 |
| Si | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Quartz var. Eisenkiesel | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Si | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Si | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| P | Phosphorus | |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Vantasselite | Al4(PO4)3(OH)3 · 9H2O |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Wardite | NaAl3(PO4)2(OH)4 · 2H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anilite | Cu7S4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Balkanite | Cu9Ag5HgS8 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| K | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Denningite | (Mn2+,Ca,Zn)Te24+O5 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Gonnardite | (Na,Ca)2(Si,Al)5O10 · 3H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Pumpellyite-(Al) | Ca2AlAl2[Si2O6OH][SiO4](OH)2O |
| Ca | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| V | Vanadium | |
| V | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| V | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Muscovite var. Alurgite | K(Al,Mn3+)2(AlSi3O10)(OH)2 |
| Mn | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Davreuxite | MnAl6Si4O17(OH)2 |
| Mn | ⓘ Denningite | (Mn2+,Ca,Zn)Te24+O5 |
| Mn | ⓘ Gravegliaite | Mn2+SO3 · 3H2O |
| Mn | ⓘ Groutite | Mn3+O(OH) |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Kanonaite | Mn3+Al(SiO4)O |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Lithiophorite | (Al,Li)MnO2(OH)2 |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Nsutite | (Mn4+,Mn2+)(O,OH)2 |
| Mn | ⓘ Ottrélite | Mn2+Al2O(SiO4)(OH)2 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Sursassite | Mn22+Al3(SiO4)(Si2O7)(OH)3 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| Mn | ⓘ Andalusite var. Viridine | (Al,Mn3+)2SiO4O |
| Mn | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Mn | ⓘ Ardennite-(V) | Mn42+Al4(AlMg)(VO4)(SiO4)2(Si3O10)(OH)6 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Bastonite | near K3(Mg,Fe,Fe,Al)5.5(Si,Al)8O22(OH)4 · 1.5H2O |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Glauconite | K0.60-0.85(Fe3+,Mg,Al)2(Si,Al)4O10](OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydroniumjarosite | (H3O)Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Hematite var. Martite | Fe2O3 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Fe | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Fe | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Melonite | NiTe2 |
| Ni | ⓘ Ullmannite | NiSbS |
| Ni | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Cu | Copper | |
| Cu | ⓘ Anilite | Cu7S4 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Balkanite | Cu9Ag5HgS8 |
| Cu | ⓘ Balyakinite | Cu(TeO3) |
| Cu | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Graemite | Cu[TeO3] · H2O |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Volborthite | Cu3(V2O7)(OH)2 · 2H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Cu | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Denningite | (Mn2+,Ca,Zn)Te24+O5 |
| Zn | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| As | Arsenic | |
| As | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Ardennite-(As) | Mn42+Al4(AlMg)(AsO4)(SiO4)2(Si3O10)(OH)6 |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Se | Selenium | |
| Se | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Sr | Strontium | |
| Sr | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Sr | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Sr | ⓘ Strontiomelane | Sr(Mn64+Mn23+)O16 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Malhmoodite | FeZr(PO4)2 · 4H2O |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Pd | Palladium | |
| Pd | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Balkanite | Cu9Ag5HgS8 |
| Ag | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Balyakinite | Cu(TeO3) |
| Te | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Te | ⓘ Denningite | (Mn2+,Ca,Zn)Te24+O5 |
| Te | ⓘ Graemite | Cu[TeO3] · H2O |
| Te | ⓘ Melonite | NiTe2 |
| Te | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Te | ⓘ Paratellurite | TeO2 |
| Te | ⓘ Teineite | Cu2+(Te4+O3) · 2H2O |
| Te | ⓘ Native Tellurium | Te |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Zemannite | Mg0.5ZnFe3+(Te4+O3)3 · 4.5H2O |
| Te | ⓘ Melonite var. Palladium-bearing Melonite | (Ni,Pd)Te2 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Ce | Cerium | |
| Ce | ⓘ Arsenoflorencite-(Ce) | CeAl3(AsO4)2(OH)6 |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Rhabdophane-(Ce) | Ce(PO4) · 0.6H2O |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Graulichite-(Ce) | CeFe33+(AsO4)2(OH)6 |
| Nd | Neodymium | |
| Nd | ⓘ Stavelotite-(La) | (La,Nd,Ca)3Mn32+Cu(Mn3+,Fe3+,Mn4+)26(Si2O7)6O30 |
| Au | Gold | |
| Au | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Balkanite | Cu9Ag5HgS8 |
| Hg | ⓘ Danielsite | (Cu,Ag)14HgS8 |
| Hg | ⓘ Montroydite | HgO |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Bogdanovite | (Au,Te,Pb)3(Cu,Fe) |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| Bi | Bismuth | |
| Bi | ⓘ Montanite | Bi2(TeO6) · nH2O |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Luxembourgite | AgCuPbBi4Se8 |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Fossils
There are 29 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 255 |
|---|---|
| Youngest Fossil Listed | 66.0 Ma (Late/Upper Cretaceous) |
| Oldest Fossil Listed | 419 Ma (Early/Lower Devonian) |
| Stratigraphic Units | Click here to view 17 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 29 fossil localities |
- Wallonia
- Liège
- Luxembourg
- Devonian🐚 Affleurment du Bois le Pretre
- Mesozoic🐚 Attert
- Early Jurassic🐚 Bonnert
- Early Jurassic🐚 Cote Rouge
- Late/Upper Devonian🐚 Evieux
- Early Jurassic🐚 Fouches
- Mesozoic🐚 Habay-la-Vieille
- Jurassic🐚 Halanzy
- Mesozoic🐚 HLV-3
- Early Jurassic🐚 Railway trench north of Muno station
- Mesozoic🐚 S-1
- Early Jurassic🐚 Stockem
- Early Jurassic🐚 Stockem Temnodontosaurus
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Ardennes |
|---|---|
| Wikidata ID: | Q151985 |
Localities in this Region
- Wallonia
- Hainaut
- Momignies
- Liège
- Amel
- Burg-Reuland
- Lienne valley
- Lierneux
- Sankt-Vith
- Trois-Ponts
- Luxembourg
- Arlon
- Bastogne
- Arloncourt quarry
- Longvilly
- ⭔Lutrebois
- Mardasson
- ⭔Marvie
- Sur les Roches quarry
- Bertrix
- Bouillon
- Fauvillers
- Gouvy
- Bovigny
- Herbeumont
- Houffalize
- Nadrin
- ⭔Pisserotte
- ⭔Rifontaine
- La-Roche-en-Ardenne
- Libin
- Ochamps
- Libramont-Chevigny
- Bras
- ⭔Croix-la-Ramée
- Moircy
- Ourt
- Prèsseux
- Saint-Pierre
- ⭔Sainte-Marie-Chevigny
- ⭔Séviscourt
- Martelange
- Messancy
- Wolkrange
- Neufchâteau
- Paliseul
- Opont
- ⭔Our
- Opont
- Saint-Hubert
- Hatrival
- Sainte-Ode
- Hainaut
- Wallonia
- Luxembourg
- Tenneville
- Vaux-sur-Sûre
- Vielsalm
- ⭔Bêche
- Bihain
- ⭔Burtonville
- ⭔Cahay
- Grand-Halleux
- ⭔La Comté
- ⭔Neuville
- Petit-Thier
- ⭔Salmchâteau
- Thier du Mont
- Vielsalm roadcut
- Namur
- Couvin
- Gedinne
- Willerzie
- Vresse-sur-Semois
- Alle
- Luxembourg
- Grand Est
- Ardennes
- Bogny-sur-meuse
- Charleville-Mézières
- Bogny-sur-Meuse
- Joigny-sur-Meuse
- Monthermé
- Nouzonville
- Ardennes
- Canton Clervaux
- Parc Hosingen
- Consthum
- Hosingen
- Troisvierges
- Wincrange
- Parc Hosingen
- Canton Diekirch
- Mertzig
- Canton Redange
- Préizerdaul
- Rambrouch
- Redange-sur-Attert
- Canton Vianden
- Canton Wiltz
- Goesdorf
- Kiischpelt
- Winseler
Other Regions, Features and Areas that Intersect
Belgium
- Wallonia
- Liège
- Lienne valleyRiver Valley
- Luxembourg
- Libramont-Chevigny
- Serpont massifMassif
- Libramont-Chevigny
- Liège
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
Europe
- Rhenish MassifMassif
- Rocroi MassifMassif
- Stavelot MassifMassif
Germany/Belgium
- Eifel MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourg