Log In
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
Canton de Redange, Luxembourg
German:
Redingen, Luxemburg
Italian:
Redange, Lussemburgo
Russian:
Реданж , Люксембург
Simplified Chinese:
雷当日, 卢森堡
Spanish:
Cantón de Redange, Luxemburgo
Alemannic:
Kanton Réiden
Basque:
Redange-sur-Attert
Bavarian:
Kanton Redingen
Belarusian:
Рэданж-сюр-Атэрт, Люксембург
Belarusian (Tarashkevitsa):
Рэданж-сюр-Атэрт
Catalan:
Redange, Luxemburg
Cebuano:
Canton de Redange
Czech:
Redange, Lucembursko
Danish:
Redange, Luxembourg
Dutch:
Redange, Luxemburg
Esperanto:
Kantono Redange / Redingen
Estonian:
Redange, Luxembourg
Farsi/Persian:
ردانژ, لوکزامبورگ
Indonesian:
Kanton Redange, Luksemburg
Interlingue:
Redange
Japanese:
ルダンジュ, ルクセンブルク
Korean:
레당주, 룩셈부르크
Limburgian:
Redange
Lithuanian:
Redanžo kantonas, Liuksemburgas
Low Saxon/Low German:
Gemeen Redingen
Luxembourgish:
Réiden
Malay:
Redange
Minnan / Hokkien-Taiwanese:
Redange
Northern Frisian:
Redingen
Norwegian:
Redingen, Luxembourg
Polish:
Redange, Luksemburg
Portuguese:
Redange, Luxemburgo
Romanian:
Redingen, Luxemburg
Scots:
Redange
Slovak:
Redange, Luxembursko
Swedish:
Redange , Luxemburg
Turkish:
Redange kantonu, Lüksemburg
Ukrainian:
Реданж, Люксембург
Vietnamese:
Redange , Luxembourg
Welsh:
Redange-sur-Attert, Lwcsembwrg
Redange is a canton in the west of Luxembourg. The capital is Redange, otherwise known as Redange-sur-Attert.
Redange Canton consists of the following ten communes: Beckerich, Ell, Grosbous, Préizerdaul, Rambrouch, Redange, Saeul, Useldange, Vichten, and Wahl.
Redange Canton consists of the following ten communes: Beckerich, Ell, Grosbous, Préizerdaul, Rambrouch, Redange, Saeul, Useldange, Vichten, and Wahl.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities21 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aragonite Formula: CaCO3 Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS, Ion Microprobe |
| ⓘ Baryte Formula: BaSO4 Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Galena Formula: PbS Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS, Ion Microprobe |
| ⓘ Goethite Formula: Fe3+O(OH) Habit: stalagmitic encrustations on pebbles |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS, Ion Microprobe |
| ⓘ Marcasite Formula: FeS2 Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Monazite-(Nd) Formula: Nd(PO4) References: MnhnL collectionIdentified by Simon Philippo: XRD, Ion Microprobe, ICP-MS |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Carnelian Formula: SiO2 Localities: Description: Listed as "cornalite". |
| ⓘ Rutile Formula: TiO2 References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS, Ion Microprobe |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Sphalerite Formula: ZnS Locality: Obermartelingen slate mine, Obermartelingen, Martelange, Rambrouch, Canton Redange, Luxembourg References: MnhnL collectionIdentified by Simon Philippo: Visual Identification, XRD, ICP-MS |
| ⓘ Zircon Formula: Zr(SiO4) References: MnhnL collectionIdentified by Simon Philippo: XRD, SEM-EDS, Ion Microprobe |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(Nd) | 8.AD.50 | Nd(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Unclassified | |||
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(Nd) | Nd(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(Nd) | Nd(PO4) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Monazite-(Nd) | Nd(PO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Redange_(canton) |
|---|---|
| Wikidata ID: | Q687100 |
| GeoNames ID: | 2960161 |
Localities in this Region
- Canton Redange
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
- Ardennes MountainsMountain Range
- Rhenish MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Adolphe-Wilhelm shaft, Rombach, Martelange, Rambrouch, Canton Redange, Luxembourg