Log In
Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Barrus farm pegmatite localities | Pegmatite |
| Goshen | Town |
| Hampshire County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 28' 7'' North , 72° 50' 11'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Goshen | 937 (2017) | 4.4km |
| Cummington | 995 (2017) | 4.8km |
| Ashfield | 1,831 (2017) | 7.5km |
| Chesterfield | 1,222 (2017) | 8.6km |
| Hawley | 342 (2017) | 11.2km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Northern Berkshire Mineral Club | North Adams, Massachusetts | 34km |
| Connecticut Valley Mineral Club | Springfield, Massachusetts | 46km |
Other/historical names associated with this locality:
Weeks farm
Granite pegmatite. Berkshire pegmatite field. (This list also covers Rood Ledge, Taylor Ledge, Manning Ledge, and Lilly Pond Ledges, which are located in the same general area.)
Type location for goshenite (C. U. Shepard, 1844), now a colorless or white variety of beryl. Originally, goshenite was cloudy pale pink beryl, but the scarcity of pink beryl at the locality resulted in the name being transfered to the ordinary white beryl that was reasonably available at the locality.
Granite pegmatite occurs as scattered boulders to five meters in maximum dimension. Although there are bedrock occurrences of granite pegmatite in the area, the tourmaline and cleavelandite boulders can not be traced to a particular dike. Elijah Weeks [b. August 23, 1764] owned the farm 1784-1789. Elijah sold the farm to his brother-in-law, Cyrus Stearns, in 1789. The tourmaline and other interesting minerals including tourmaline were discovered by or before 1811, when mining of the pegmatite boulders began by Dr. David Hunt of Northampton and Colonel George Gibbs of Newport, RI. After Elijah Weeks' father died in 1817, Elijah Weeks moved to Scipio, New York. In 1819, Gibbs' wrote about the locality and gave credit to "Mr. Weeks of New York" for being the discoverer of the locality. In 1823, Cyrus Stearns sold the farm to Levi Barrus. The farm sold back and forth to various people and Levi Barrus until 1845 and then Levi lived on the farm continuously until his death in 1877. Alvan Barrus, his son, inherited the farm. Although the locality was originally called the Weeks Farm, the subsequent owners, the Barrus family owned the land for such an extended period of time that the Weeks connection was all but forgotten.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
16 valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ 'Almandine-Spessartine Series' Colour: orange, pink, red References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 References: |
| ⓘ Cookeite ? Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ 'Cymatolite' |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'Lepidolite' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Formula: Be2SiO4 Description: Erroneously reported = beryl variety goshenite. |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Habit: massive; grains to several inches across (Shaub & Schenck, 1954) Colour: colorless Description: Benjamin discovered pollucite here in the spring of 1940; more was found in 1946 (Shaub & Schenck, 1954). |
| ⓘ 'Psilomelane' |
| ⓘ Formula: Mn4+O2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spodumene Formula: LiAlSi2O6 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z References: |
| ⓘ 'Tourmaline var. Indicolite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Verdelite' Formula: A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ Zircon Formula: Zr(SiO4) Colour: brown Fluorescence: none Description: Mildly radioactive. References: |
| ⓘ Zircon var. Cyrtolite Formula: Zr[(SiO4),(OH)4] Colour: brown Fluorescence: none Description: Mildly radioactive. References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Phenakite ? | 9.AA.05 | Be2SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | var. Cyrtolite | 9.AD.30 | Zr[(SiO4),(OH)4] |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Cookeite ? | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Tourmaline var. Indicolite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Cymatolite' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Tourmaline var. Indicolite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Almandine-Spessartine Series | |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Almandine-Spessartine Series | |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| K | Potassium | |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Almandine-Spessartine Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Almandine-Spessartine Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zircon var. Cyrtolite | Zr[(SiO4),(OH)4] |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Piedmontia DomainDomain
- Taconic ArcVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Barrus farm pegmatite localities, Goshen, Hampshire County, Massachusetts, USA