Log In
Prydz Bay, Ingrid Christensen Coast, Princess Elizabeth Land, East Antarctica, Antarcticai
| Regional Level Types | |
|---|---|
| Prydz Bay | Bay |
| Ingrid Christensen Coast | Coast |
| Princess Elizabeth Land | Sector |
| East Antarctica | Region |
| Antarctica | Continent |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
69° South , 75° East
Latitude & Longitude (decimal):
Type:
Prydz Bay is a deep embayment of Antarctica between the Lars Christensen Coast and Ingrid Christensen Coast. The Bay is at the downstream end of a giant glacial drainage system that originates in the East Antarctic interior. The Lambert Glacier flows from Lambert Graben into the Amery Ice Shelf on the south-west side of Prydz Bay. Other major glaciers drain into the southern end of the Amery Ice Shelf at 73° S where the marine part of the system starts at the modern grounding zone.
The Amery Ice Shelf extends about 550 km north of the Lambert Glacier grounding zone and occupies a valley between 80–200 km wide. Depths to the bed beneath the Amery Ice Shelf are poorly known in detail but it is clearly over-deepened, reaching around -2500 m MSL close to the grounding zone. The Amery Ice Shelf occupies a very large U-shaped valley with exposed nunataks along the flanks reaching 1500 m in elevation and total relief as high as 3000 m.
Seaward of the Amery Ice Shelf, Prydz Bay shows bathymetry typical of glaciated margins with deeper water near the coast with a broad topographic basin, the Amery Depression that is around -700 m MSL along the front of the Amery Ice Shelf. The Amery Depression shoals gently to outer shelf banks around 100–200 m deep. The shelf break is at around 400–500 m. The western side of Prydz Bay features a broad trough crossing from the inner shelf to the shelf edge, Prydz Channel. It is around 100 km wide and is 500 m deep at the shelf break. It is a typical example of a cross-shelf glacial trough that occupies 40.2% of the area of the Antarctic continental shelf and that is formed by fast-flowing ice streams.
During the late Neogene, the Lambert Glacier–Amery Ice Shelf drainage system flowed across Prydz Bay in an ice stream that reached the shelf edge and built a trough mouth fan on the upper continental slope. The fan consists mostly of debris-flow deposits derived from the melting out of subglacial debris at the grounding line at the continental shelf edge. Ocean Drilling Program Site 1167 indicates that thick debris flow intervals are separated by thin mudstone horizons deposited when the ice had retreated from the shelf edge. The bulk of the trough mouth fan was deposited prior to ~780,000 years ago with as few as three debris flow intervals deposited since then.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities47 valid minerals. 3 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Armalcolite | 4.CB.15 | MgTi4+2O5 |
| ⓘ | Pseudorutile | 4.CB.25 | Fe3+2Ti4+3O9 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite ? | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Chopinite (TL) | 8.AB.15 | Mg3(PO4)2 |
| ⓘ | Chladniite var. Stornesite-(Y) (TL) | 8.AC.50 | Na3CaMg11(PO4)9 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Mélonjosephite | 8.BG.10 | CaFe2+Fe3+(PO4)2(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Tassieite (TL) | 8.CF.05 | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| ⓘ | Souzalite ? | 8.DC.45 | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| ⓘ | Jahnsite-(CaFeMg) | 8.DH.15 | {Ca}{Fe2+}{Mg2}{Fe3+2}(PO4)4(OH)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Grandidierite | 9.AJ.05 | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Boralsilite (TL) | 9.BD.30 | Al16B6O30(Si2O7) |
| ⓘ | Werdingite | 9.BD.35 | (Mg,Fe)2Al14Si4B4O37 |
| ⓘ | Kornerupine | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Prismatine | 9.BJ.50 | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ | 'Wagnerite-Ma5bc' | - | Mg2(PO4)F |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Mélonjosephite | CaFe2+Fe3+(PO4)2(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| H | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| H | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| B | ⓘ Boralsilite | Al16B6O30(Si2O7) |
| B | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| C | Carbon | |
| C | ⓘ Graphite | C |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Armalcolite | MgTi24+O5 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Mélonjosephite | CaFe2+Fe3+(PO4)2(OH) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Pseudorutile | Fe23+Ti34+O9 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Boralsilite | Al16B6O30(Si2O7) |
| O | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Chladniite var. Stornesite-(Y) | Na3CaMg11(PO4)9 |
| O | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| O | ⓘ Chopinite | Mg3(PO4)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| O | ⓘ Wagnerite-Ma5bc | Mg2(PO4)F |
| O | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| F | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Wagnerite-Ma5bc | Mg2(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Chladniite var. Stornesite-(Y) | Na3CaMg11(PO4)9 |
| Na | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| Mg | Magnesium | |
| Mg | ⓘ Armalcolite | MgTi24+O5 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Mg | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| Mg | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Mg | ⓘ Chladniite var. Stornesite-(Y) | Na3CaMg11(PO4)9 |
| Mg | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| Mg | ⓘ Chopinite | Mg3(PO4)2 |
| Mg | ⓘ Wagnerite-Ma5bc | Mg2(PO4)F |
| Mg | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| Al | ⓘ Boralsilite | Al16B6O30(Si2O7) |
| Al | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Boralsilite | Al16B6O30(Si2O7) |
| Si | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Mélonjosephite | CaFe2+Fe3+(PO4)2(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Chladniite var. Stornesite-(Y) | Na3CaMg11(PO4)9 |
| P | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| P | ⓘ Chopinite | Mg3(PO4)2 |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| P | ⓘ Wagnerite-Ma5bc | Mg2(PO4)F |
| P | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| S | Sulfur | |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Mélonjosephite | CaFe2+Fe3+(PO4)2(OH) |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Chladniite var. Stornesite-(Y) | Na3CaMg11(PO4)9 |
| Ca | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Armalcolite | MgTi24+O5 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pseudorutile | Fe23+Ti34+O9 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Grandidierite | (Mg,Fe2+)(Al,Fe3+)3(SiO4)(BO3)O2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Mélonjosephite | CaFe2+Fe3+(PO4)2(OH) |
| Fe | ⓘ Pseudorutile | Fe23+Ti34+O9 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Souzalite | (Mg,Fe2+)3(Al,Fe3+)4(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Werdingite | (Mg,Fe)2Al14Si4B4O37 |
| Fe | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Fe | ⓘ Tassieite | (Na,◻)Ca2(Mg,Fe2+,Fe3+)2(Fe2+,Mg)2(Fe3+,Mg)2(PO4)6 · 2H2O |
| Fe | ⓘ Jahnsite-(CaFeMg) | {Ca}{Fe2+}{Mg2}{Fe23+}(PO4)4(OH)2 · 8H2O |
| Sr | Strontium | |
| Sr | ⓘ Celestine | SrSO4 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Prydz_Bay |
|---|---|
| Wikidata ID: | Q156116 |
Localities in this Region
- East Antarctica
- Princess Elizabeth Land
- Ingrid Christensen Coast
- Princess Elizabeth Land
- East Antarctica
- Princess Elizabeth Land
- Ingrid Christensen Coast
- Prydz Bay
- Larsemann Hills
- Broknes Peninsula
- Striped Island
- Lied promontory
- McCarthy Point
- Seal Cove
- Stornes Peninsula
- Broknes Peninsula
- Larsemann Hills
- Prydz Bay
- Ingrid Christensen Coast
- Princess Elizabeth Land
Other Regions, Features and Areas containing this locality
Antarctic PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Larsemann Hills, Prydz Bay, Ingrid Christensen Coast, Princess Elizabeth Land, East Antarctica, Antarctica