Log In
Emerald deposit, Leckbachgraben, Nasenkopf mountain, Bramberg am Wildkogel, Zell am See District, Salzburg, Austriai
| Regional Level Types | |
|---|---|
| Emerald deposit | Deposit |
| Leckbachgraben | Gully |
| Nasenkopf mountain | Mountain |
| Bramberg am Wildkogel | Municipality |
| Zell am See District | District |
| Salzburg | State |
| Austria | Country |
Emerald deposit, Leckbachgraben, Nasenkopf mountain, Habach valley, Bramberg am Wildkogel, Zell am See District, Salzburg, Austria
This page kindly sponsored by Dr. Günter Grundmann
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Latitude & Longitude (WGS84):
47° 12' 11'' North , 12° 22' 9'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mühlbach | 448 (2018) | 7.0km |
| Wenns | 191 (2018) | 7.2km |
| Bramberg am Wildkogel | 2,096 (2018) | 7.7km |
| Reitlehen | 461 (2018) | 7.9km |
| Weyer | 136 (2018) | 8.1km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Vereinigte Mineraliensammler Österreichs Landesgruppe Salzburg | Bramberg, Salzburg | 8km |
Other/historical names associated with this locality:
Leckbachrinne
Other Languages:
German:
Smaragdlagerstätte (Smaragdbergwerk; Smaragdbergbau)), Nasenkopf, Bramberg am Wildkogel, Bezirk Zell am See, Salzburg, Österreich
Layer of talc-actinolite schists with inclusions of blastomylonitic rocks (serpentinites and talc schists) and emerald-bearing biotite-chlorite schists, intercalated between scheelite-bearing banded gneisses (including Cu, Fe and Bi sulphides) and amphibolites of the Habach formation. This association of rocks trends from the Hollersbach valley in the east to the Untersulzbach valley in the west, and meanwhile emeralds were also found in its outcrops in the neighbouring valleys.
"At least some and probably most of the emerald mineralization in the Habachtal occurred from an extremely fluid-rich pegmatite-like aluminosilicate melt under supercritical conditions, at high temperatures and moderate pressures (~700 °C, 5 kbar)" (Thomas et al., 2020).
An emerald mine was first mentioned in 1797, but the deposit was probably worked much earlier. The present mine with its four adits (named A, B , C and D adit) was started in 1860, by the jeweller Samuel Goldschmiedt of Vienna. In 1896 the lease was taken over by the "Emerald Mines Ltd." of London., who worked the deposit until 1913. During the following years, the mine was intermittently worked by different owners until 1949, when it was abandoned. Since 1964, it is privately owned, but worked only sporadically. Presently (2008), it is owned by the strahler Andreas Steiner of Bramberg.
A detailed account of the history of the deposit is given by Schmetzer (2021, 2022).
In general, the emeralds are of rather low quality; specimens suited for cutting are rarely found. They usually contain inclusions of a wide variety of minerals. In fact, many of the minerals listed here were only found as inclusions in emeralds.
"At least some and probably most of the emerald mineralization in the Habachtal occurred from an extremely fluid-rich pegmatite-like aluminosilicate melt under supercritical conditions, at high temperatures and moderate pressures (~700 °C, 5 kbar)" (Thomas et al., 2020).
An emerald mine was first mentioned in 1797, but the deposit was probably worked much earlier. The present mine with its four adits (named A, B , C and D adit) was started in 1860, by the jeweller Samuel Goldschmiedt of Vienna. In 1896 the lease was taken over by the "Emerald Mines Ltd." of London., who worked the deposit until 1913. During the following years, the mine was intermittently worked by different owners until 1949, when it was abandoned. Since 1964, it is privately owned, but worked only sporadically. Presently (2008), it is owned by the strahler Andreas Steiner of Bramberg.
A detailed account of the history of the deposit is given by Schmetzer (2021, 2022).
In general, the emeralds are of rather low quality; specimens suited for cutting are rarely found. They usually contain inclusions of a wide variety of minerals. In fact, many of the minerals listed here were only found as inclusions in emeralds.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities58 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Aschamalmite | 2.JB.40b | Pb6-3xBi2+xS9 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hercynite var. Picotite | 4.BB.05 | (Fe,Mg)(Al,Cr)2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Capped Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Aeschynite-(Y) | 4.DF.05 | Y(TiNb)O6 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | var. Molybdoscheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Ferrimolybdite ? | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Gadolinite-(Ce) | 9.AJ.20 | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Actinolite var. Smaragdite | 9.DE.10 | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Oellacherite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Trilithionite | 9.EC.20 | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| ⓘ | Margarite | 9.EC.30 | CaAl2(Al2Si2O10)(OH)2 |
| ⓘ | var. Beryllium-bearing Margarite | 9.EC.30 | CaAl2((Al,Be)2Si2O10)(OH)2 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Epidote Group' | - | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| H | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| H | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Capped Quartz | SiO2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| O | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| O | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Mg | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Al | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Capped Quartz | SiO2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Si | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Stibnite | Sb2S3 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| K | ⓘ Muscovite var. Oellacherite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Margarite | CaAl2(Al2Si2O10)(OH)2 |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Ca | ⓘ Margarite var. Beryllium-bearing Margarite | CaAl2((Al,Be)2Si2O10)(OH)2 |
| Ca | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Cr | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Hercynite var. Picotite | (Fe,Mg)(Al,Cr)2O4 |
| Fe | ⓘ Actinolite var. Smaragdite | Ca2(Mg,Fe2+,Cr)5Si8O22(OH)2 |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Y | Yttrium | |
| Y | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Y | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Y) | Y(TiNb)O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Stibnite | Sb2S3 |
| La | Lanthanum | |
| La | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | Cerium | |
| Ce | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Nd | Neodymium | |
| Nd | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| Bi | Bismuth | |
| Bi | ⓘ Aschamalmite | Pb6-3xBi2+xS9 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Uraninite | UO2 |
Other Databases
| Wikipedia: | https://de.wikipedia.org/wiki/Smaragdbergwerk_Habachtal |
|---|---|
| Wikidata ID: | Q2294925 |
Localities in this Region
Other Regions, Features and Areas containing this locality
Austria
- Hohe Tauern National ParkNational Park
- Salzburg
- Zell am See District
- Bramberg am Wildkogel
- Habach valleyValley
- Bramberg am Wildkogel
- Zell am See District
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
- Hohe Tauern (High Tauern)Mountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Grundmann, G., Morteani, G. (1989) Emerald mineralization during regional metamorphism; the Habachtal (Austria) and Leydsdorp (Transvaal, South Africa) deposits. Economic Geology, 84 (7) 1835-1849 doi:10.2113/gsecongeo.84.7.1835
Groat, L.A.; Giuliani, G.; Marshall, D.D.; Turner, D. (2008) Emerald deposits and occurrences: A review. Ore Geology Reviews, 34 (1-2). 87-112 doi:10.1016/j.oregeorev.2007.09.003
[1]Nikopoulou, Maria; Karampelas, Stefanos; Hennebois, Ugo; Gruss, Pierre; Gaillou, Eloïse; Fritsch, Emmanuel; Herreweghe, Annabelle; Papadopoulou, Lambrini; Melfos, Vasilios; Kantiranis, Nikolaos; et al. (2024) Microscopic, Spectroscopic and Chemical Analysis of Emeralds from Habachtal, Austria. Minerals, 15 (1). 22 doi:10.3390/min15010022
Nikopoulou, Maria; Karampelas, Stefanos; Hennebois, Ugo; Gruss, Pierre; Gaillou, Eloïse; Fritsch, Emmanuel; Herreweghe, Annabelle; Papadopoulou, Lambrini; Melfos, Vasilios; Kantiranis, Nikolaos; et al. (2025) Correction: Nikopoulou et al. Microscopic, Spectroscopic and Chemical Analysis of Emeralds from Habachtal, Austria. Minerals 2025, 15, 22. Minerals, 15 (7). 707 doi:10.3390/min15070707
Emerald deposit, Leckbachgraben, Nasenkopf mountain, Bramberg am Wildkogel, Zell am See District, Salzburg, Austria