Log In
Botallack Mine, Botallack, St Just, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Botallack Mine | Mine (Abandoned) |
| Botallack | Village |
| St Just | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Latitude & Longitude (WGS84):
50° 8' 29'' North , 5° 41' 22'' West
Latitude & Longitude (decimal):
UK National Grid Reference:
SW364334
Type:
Mine (Abandoned) - last checked 2018
Köppen climate type:
Worked under the name Botallack, the sett includes the mines Cock, Crowns, Carnyorth, Botallack, and Parknoweth. The workings commenced as a number of small mines some of which are now only represented as shafts (e.g. Wheals Bal, Tolvan, Button and Hazard).
The early history of the mines is not known but its lodes have been exploited since at least 1721. The submarine levels at Wheal Cock were being worked in 1778 when Pryce described how the miners were frightened by the rumbling of the rocks on the sea-bed above them during a storm. Joseph Carne stated in 1822 that it had been “....wrought under the sea beyond the memory of any person now living.....”
In 1858 work began on sinking the famous Boscawen Diagonal Shaft at the Crowns to provide access to the seaward extension of its lodes a third of a mile under the Atlantic. Many distinguished visitors came to Botallack to descend the shaft. Among them were the Prince and Princess of Wales (later Edward VII and Queen Alexandra) who were here on July 24th, 1865; Prince Arthur, Queen Victoria’s 12-year-old son; a party of senior officers of the Russian Navy; R. N. Ballantyne, the well-known Victorian author. None appear to have been deterred by an accident in 1863 when the wagon chain broke, sending 8 men and a boy hurtling to their deaths. These underground 'adventures' became so popular among the nobility and the leisured class that they threatened to become a hindrance to the working of the mine unless they were restricted. A charge of half a guinea was imposed on each visitor. The money was donated to a fund for the relief of widows and injured miners.
During the 1870s, as a result of a severe mining depression, Botallack began to make heavy losses, and in 1874 the Crowns section was abandoned. The adventurers struggled on for another 20 years but finally, in 1895, following the collapse of an underground dam in Wheal Cock, which flooded that section of the 112-fathom level, the mine was closed.
In 1905 a rise in the price of tin encouraged a new company to re-start Botallack. A new vertical shaft, known as Allen's Shaft, was sunk. After several disappointing years and the expenditure of a great deal of money, the enterprise was wound up and Botallack closed for a second time on March 14th, 1914.
Further exploration and a small amount of development work took place at Botallack during the 1980s through the expansion plans of Geevor Tin Mines.
An extensive history of the mine is given in "BOTALLACK", by Cyril Noall.
The coordinates given are those of Allen's Shaft.
The early history of the mines is not known but its lodes have been exploited since at least 1721. The submarine levels at Wheal Cock were being worked in 1778 when Pryce described how the miners were frightened by the rumbling of the rocks on the sea-bed above them during a storm. Joseph Carne stated in 1822 that it had been “....wrought under the sea beyond the memory of any person now living.....”
In 1858 work began on sinking the famous Boscawen Diagonal Shaft at the Crowns to provide access to the seaward extension of its lodes a third of a mile under the Atlantic. Many distinguished visitors came to Botallack to descend the shaft. Among them were the Prince and Princess of Wales (later Edward VII and Queen Alexandra) who were here on July 24th, 1865; Prince Arthur, Queen Victoria’s 12-year-old son; a party of senior officers of the Russian Navy; R. N. Ballantyne, the well-known Victorian author. None appear to have been deterred by an accident in 1863 when the wagon chain broke, sending 8 men and a boy hurtling to their deaths. These underground 'adventures' became so popular among the nobility and the leisured class that they threatened to become a hindrance to the working of the mine unless they were restricted. A charge of half a guinea was imposed on each visitor. The money was donated to a fund for the relief of widows and injured miners.
During the 1870s, as a result of a severe mining depression, Botallack began to make heavy losses, and in 1874 the Crowns section was abandoned. The adventurers struggled on for another 20 years but finally, in 1895, following the collapse of an underground dam in Wheal Cock, which flooded that section of the 112-fathom level, the mine was closed.
In 1905 a rise in the price of tin encouraged a new company to re-start Botallack. A new vertical shaft, known as Allen's Shaft, was sunk. After several disappointing years and the expenditure of a great deal of money, the enterprise was wound up and Botallack closed for a second time on March 14th, 1914.
Further exploration and a small amount of development work took place at Botallack during the 1980s through the expansion plans of Geevor Tin Mines.
An extensive history of the mine is given in "BOTALLACK", by Cyril Noall.
The coordinates given are those of Allen's Shaft.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities109 valid minerals. 1 (TL) - type locality of valid minerals. 3 erroneous literature entries.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ 'Alkali Feldspar' |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsenogoyazite Formula: SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Description: Occured as "small round spots" (Hogg, 1825) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ 'Bismuth Ochre' |
| ⓘ 'Blistered Copper' |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Botallackite (TL) Formula: Cu2(OH)3Cl Localities: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brushite Formula: Ca(PO3OH) · 2H2O |
| ⓘ Buttgenbachite Formula: Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcomenite Formula: CuSeO3 · 2H2O |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Wheal Hen, Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Hazard, Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Tolvan (Wheal Tolvaen), Botallack Mine, Botallack, St Just, Cornwall, England, UK Botallack Mine, Botallack, St Just, Cornwall, England, UK |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Clinoptilolite-Ca Formula: Ca3(Si30Al6)O72 · 20H2O References: |
| ⓘ 'Clinoptilolite-Ca-Heulandite-Ca Series' References: |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cuprite Formula: Cu2O Localities: Description: Microscopic crystals |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O References: |
| ⓘ Cuprite var. Tile ore Formula: Cu2O References: |
| ⓘ Cuprosklodowskite Formula: Cu(UO2)2(SiO3OH)2 · 6H2O Description: Occasionally found in the small dump below the footpath leading to the Crowns Shaft engine houses. References: |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O References: |
| ⓘ 'Feldspar Group' |
| ⓘ 'Ferro-sadanagaite' Formula: NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 Description: chemical composition: (Na0.59K0.43)(Ca1.99)(Mg1.32Fe2+1.90Mn2+0.03Al1.14Fe3+0.62Ti4+0.07)(Si5.24Al2.76)(O22(OH)1.6 Cl0.4) |
| ⓘ Feruvite Formula: CaFe2+3(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Fluor-uvite-Uvite Series' |
| ⓘ Galena Formula: PbS Habit: Massive References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 6 localities in this region. |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum ? Formula: CaSO4 · 2H2O Description: (not analyzed) References: |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Formula: Be3Mn2+4(SiO4)3S Locality: Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK - erroneously reported Description: Kingsbury source - provenance of specimen is in doubt.
|
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hematite var. Kidney Ore Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Parknoweth Mine (Wheal Buzza; Truthwall Mine), Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK Botallack Mine, Botallack, St Just, Cornwall, England, UK Carnyorth Mine (Nineveh Mine), Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Hen, Botallack Mine, Botallack, St Just, Cornwall, England, UK |
| ⓘ Formula: CaBe(PO4)F Locality: Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK - erroneously reported Description: Kingsbury reference. |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O References: |
| ⓘ Heulandite-K Formula: (K,Ca,Na)5(Si27Al9)O72 · 26H2O References: |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O Description: Most samples of 'heulandite' have been shown to be Clinoptilolite-Ca, with a few being Heulandite-Ca, and one being Heulandite-K. References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hydrobiotite Formula: K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O References: |
| ⓘ 'K Feldspar' |
| ⓘ Kröhnkite Formula: Na2Cu(SO4)2 · 2H2O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) Description: Reported from Skip Shaft. |
| ⓘ 'Limonite' |
| ⓘ Liroconite ? Formula: Cu2Al(AsO4)(OH)4 · 4H2O Description: Reported from Skip Shaft. |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) Localities: Description: Reported from Skip Shaft. |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As Localities: Description: Reported from Allen's Shaft. |
| ⓘ Native Bismuth Formula: Bi Localities: Description: Reported from two lodes, where it occurred in red jasper (Hogg, 1825). |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Silver Formula: Ag |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Fire Opal Formula: SiO2 · nH2O References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Paracostibite ? Formula: CoSbS Description: Confirmed on a specimen from the Kingsbury collection, which may be from another locality. |
| ⓘ Paratacamite Formula: Cu3(Cu,Zn)(OH)6Cl2 Localities: Description: Bannister, Hey, and Claringbull (1950): "It is paratacamite, not atacamite that occurs at the famous Cornish locality, Botallack mine, St. Just." |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Description: Reported from Crowns Lode (Carne, 1822) References: |
| ⓘ Phenakite ? Formula: Be2SiO4 Description: Golley and Williams (1995) quote Russell (1911), but this paper makes no mention of phenakite occurring at Wheal Cock.
Russell (1920) reports phenakite from Stamps and Jowl Zawn, at the foot of Roscommon Cliff, under Wheal Cock, but not from Wheal Cock itself. References: Russell, Arthur (1911) On the occurrence of Phenacite in Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 16 (73) 55-62 doi:10.1180/minmag.1911.016.073.08 Russell, Arthur (1920) On the occurrence of Phenacite and Scheelite at Wheal Cock, St. Just, Cornwall. Mineralogical Magazine and Journal of the Mineralogical Society, 19 (88) 19-22 doi:10.1180/minmag.1920.019.88.06 |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Posnjakite ? Formula: Cu4(SO4)(OH)6 · H2O Description: (not analyzed) References: |
| ⓘ Prehnite ? Formula: Ca2Al2Si3O10(OH)2 Description: It is not clear whether Hall refers to the cliff outcrops or Botallack Mine proper. Prehnite from the mine itself has not been reported elsewhere. |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ Pyrite Formula: FeS2 Localities: Wheal Hen, Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Tolvan (Wheal Tolvaen), Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Hazard, Botallack Mine, Botallack, St Just, Cornwall, England, UK Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK |
| ⓘ Pyrolusite Formula: Mn4+O2 References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS References: |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Carnelian Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Ferruginous Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Formula: NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Wheal Cock, Botallack Mine, Botallack, St Just, Cornwall, England, UK Parknoweth Mine (Wheal Buzza; Truthwall Mine), Botallack Mine, Botallack, St Just, Cornwall, England, UK Botallack Mine, Botallack, St Just, Cornwall, England, UK Grylls Bunny, Botallack Mine, Botallack, St Just, Cornwall, England, UK Wheal Hen, Botallack Mine, Botallack, St Just, Cornwall, England, UK |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Stilbite Subgroup' ? Formula: M6-7[Al8-9Si27-28O72] · nH2O Description: As pointed out by Russell, Hall and Collins probably refer to the cliff outcrops, since the occurrence of stilbite inside Botallack Mine is not confirmed. References: |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Talc var. Steatite Formula: Mg3(Si4O10)(OH)2 |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Wittichenite ? Formula: Cu3BiS3 Habit: Massive Description: Reported from Crowns Lode as "Cupriferous Sulphuret of Bismuth" (Carne, 1822) |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Paracostibite ? | 2.EB.10e | CoSbS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Wittichenite ? | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Botallackite (TL) | 3.DA.10b | Cu2(OH)3Cl |
| ⓘ | Paratacamite | 3.DA.10c | Cu3(Cu,Zn)(OH)6Cl2 |
| ⓘ | Buttgenbachite | 3.DA.25 | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | var. Tile ore | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Kidney Ore | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Carnelian | 4.DA.05 | SiO2 |
| ⓘ | var. Ferruginous Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Fire Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Chalcomenite | 4.JH.05 | CuSeO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Kröhnkite | 7.CC.30 | Na2Cu(SO4)2 · 2H2O |
| ⓘ | Gypsum ? | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite ? | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Herderite ? | 8.BA.10 | CaBe(PO4)F |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Arsenogoyazite | 8.BL.10 | SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Brushite | 8.CJ.50 | Ca(PO3OH) · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Liroconite ? | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite ? | 9.AA.05 | Be2SiO4 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Cuprosklodowskite | 9.AK.10 | Cu(UO2)2(SiO3OH)2 · 6H2O |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Feruvite | 9.CK.05 | CaFe2+3(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Sadanagaite ? | 9.DE.15 | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| ⓘ | 'Ferro-sadanagaite' | 9.DE.15 | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| ⓘ | Prehnite ? | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Talc var. Steatite | 9.EC.05 | Mg3(Si4O10)(OH)2 |
| ⓘ | 9.EC.05 | Mg3Si4O10(OH)2 | |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Hydrobiotite | 9.EC.60 | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Helvine ? | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Clinoptilolite-Ca | 9.GE.05 | Ca3(Si30Al6)O72 · 20H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-K | 9.GE.05 | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Alkali Feldspar' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Bismuth Ochre' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' ? | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Blistered Copper' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Clinoptilolite-Ca-Heulandite-Ca Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Botallackite | Cu2(OH)3Cl |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| H | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| H | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kröhnkite | Na2Cu(SO4)2 · 2H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Opal var. Fire Opal | SiO2 · nH2O |
| H | ⓘ Clinoptilolite-Ca | Ca3(Si30Al6)O72 · 20H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Herderite | CaBe(PO4)F |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| N | Nitrogen | |
| N | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Botallackite | Cu2(OH)3Cl |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| O | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Herderite | CaBe(PO4)F |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kröhnkite | Na2Cu(SO4)2 · 2H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Cuprite var. Tile ore | Cu2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Opal var. Fire Opal | SiO2 · nH2O |
| O | ⓘ Clinoptilolite-Ca | Ca3(Si30Al6)O72 · 20H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Quartz var. Carnelian | SiO2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Herderite | CaBe(PO4)F |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Fluor-uvite-Uvite Series | |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Kröhnkite | Na2Cu(SO4)2 · 2H2O |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Al | Aluminium | |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Clinoptilolite-Ca | Ca3(Si30Al6)O72 · 20H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Talc var. Steatite | Mg3(Si4O10)(OH)2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Opal var. Fire Opal | SiO2 · nH2O |
| Si | ⓘ Clinoptilolite-Ca | Ca3(Si30Al6)O72 · 20H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Quartz var. Carnelian | SiO2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Quartz var. Ferruginous Quartz | SiO2 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Herderite | CaBe(PO4)F |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kröhnkite | Na2Cu(SO4)2 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Paracostibite | CoSbS |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Botallackite | Cu2(OH)3Cl |
| Cl | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Brushite | Ca(PO3OH) · 2H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Herderite | CaBe(PO4)F |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Sadanagaite | NaCa2(Mg3Al2)(Si5Al3O22)(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Clinoptilolite-Ca | Ca3(Si30Al6)O72 · 20H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-K | (K,Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Clinoptilolite-Ca-Heulandite-Ca Series | |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Feruvite | CaFe32+(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydrobiotite | K(Mg,Fe2+)6((Si,Al)8O20)(OH)4 · nH2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| Fe | ⓘ Ferro-sadanagaite | NaCa2(Fe3Al2)(Al3Si5O22)(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Paracostibite | CoSbS |
| Co | ⓘ Skutterudite | CoAs3 |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Botallackite | Cu2(OH)3Cl |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Buttgenbachite | Cu19(NO3)2(OH)32Cl4 · 2H2O |
| Cu | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Kröhnkite | Na2Cu(SO4)2 · 2H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Cuprite var. Tile ore | Cu2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Zn | Zinc | |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Paratacamite | Cu3(Cu,Zn)(OH)6Cl2 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Se | Selenium | |
| Se | ⓘ Chalcomenite | CuSeO3 · 2H2O |
| Sr | Strontium | |
| Sr | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Ag | Silver | |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Paracostibite | CoSbS |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Cuprosklodowskite | Cu(UO2)2(SiO3OH)2 · 6H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Late/Upper Triassic : 231 ± 3 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Mesozoic | ||||||||||||||||||||||
| Triassic | ||||||||||||||||||||||
| Late/Upper Triassic |
| |||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Botallack_Mine |
|---|---|
| Wikidata ID: | Q894620 |
Localities in this Region
- England
- Cornwall
- St Just
- Cornwall
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
UK
- England
- Cornubian mining districtMining District
- Cornwall
- St Just Mining DistrictMining District
- ⭔St Just Mining RegionRegion
- Cornwall National LandscapeNational Landscape
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Metropolis, William C., Scalisi, I. Phillip (1985) Harvard's Mineralogical Tour of England June 23-July 4, 1984. Rocks & Minerals, 60 (1) 21-25 doi:10.1080/00357529.1985.11764363p.24
web.archive.org (2013) Botallack Crowns Mine. https://web.archive.org/web/20131031102930/http://www.cornwallinfocus.co.uk/history/crowns.php
(2013) BOTALLACK MINE—UNDER THE SEA; DESCENT AND DESCRIPTION. In Cornwall, Its Mines and Miners. Routledge. p.45-51. doi:10.4324/9780203041758-13
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyOther DatabasesLocalities in RegionOther RegionsReferences
Botallack Mine, Botallack, St Just, Cornwall, England, UK