Vater Abraham Mine, Lauta, Marienberg, Erzgebirgskreis, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Vater Abraham Mine | Mine |
| Lauta | Suburb |
| Marienberg | City |
| Erzgebirgskreis | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 39' 48'' North , 13° 9' 12'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Marienberg | 14,383 (2015) | 1.5km |
| Großrückerswalde | 4,005 (2015) | 4.2km |
| Pobershau | 2,031 (2015) | 5.2km |
| Zöblitz | 3,134 (2015) | 5.4km |
| Wolkenstein | 4,359 (2015) | 5.8km |
Other/historical names associated with this locality:
Shaft 152; "Shaft 139"
Name(s) in local language(s):
Grube Vater Abraham ("Schacht 139"; Schacht 152), Lauta, Revier Marienberg, Erzgebirge, Sachsen, Deutschland
Note: The Vater Abraham Mine is widely considered as being identical to the SDAG Wismut shaft no. 139. However, the correct shaft no. is 152.
The actual shaft 139 is located about 150 m further north, see https://www.mindat.org/loc-127157.html
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Abernathyite Formula: K(UO2)(AsO4) · 3H2O |
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Aerugite Formula: Ni8.5(AsO4)2As5+O8 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Argentopyrite Formula: AgFe2S3 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenocrandallite Formula: CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenolamprite Formula: As |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bergenite Formula: Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ Beyerite Formula: Ca(BiO)2(CO3)2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bismutoferrite Formula: Fe3+2Bi(SiO4)2(OH) |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Bunsenite Formula: NiO |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Claudetite Formula: As2O3 References: |
| ⓘ Clausthalite Formula: PbSe |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Ettringite Formula: Ca6Al2(SO4)3(OH)12 · 26H2O |
| ⓘ Eulytine Formula: Bi4(SiO4)3 References: |
| ⓘ Ferrisymplesite Formula: Fe3+3(AsO4)2(OH)3 · 5H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Guérinite Formula: Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydrowoodwardite Formula: (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaatialaite Formula: Fe3+[AsO2(OH)2]3 · 5H2O |
| ⓘ Kettnerite Formula: CaBiCO3OF |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Lautite Formula: CuAsS |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Löllingite var. Chathamite Formula: (Fe,Ni)As2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Maucherite Formula: Ni11As8 |
| ⓘ Metauranospinite Formula: Ca(UO2)2(AsO4)2 · 8H2O |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ Millerite Formula: NiS References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Naumannite Formula: Ag2Se |
| ⓘ Neustädtelite Formula: Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Nickelskutterudite Formula: NiAs3 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Orpiment Formula: As2S3 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pararammelsbergite Formula: NiAs2 |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Pearceite Formula: [Ag6As2S7][Ag9CuS4] |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ Polybasite Formula: [Ag6Sb2S7][Ag9CuS4] |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Rauenthalite Formula: Ca3(AsO4)2 · 10H2O |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Sainfeldite Formula: Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spherocobaltite Formula: CoCO3 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Sternbergite Formula: AgFe2S3 |
| ⓘ Stibarsen Formula: AsSb |
| ⓘ Symplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ Tyuyamunite Formula: Ca(UO2)2(VO4)2 · 5-8H2O |
| ⓘ Uraninite Formula: UO2 References: |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Vaesite Formula: NiS2 |
| ⓘ 'Wolframite Group' |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Xanthoconite Formula: Ag3AsS3 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Arsenolamprite | 1.CA.10 | As |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Maucherite | 2.AB.15 | Ni11As8 |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Lautite | 2.CB.40 | CuAsS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Argentopyrite | 2.CB.65 | AgFe2S3 |
| ⓘ | Sternbergite | 2.CB.65 | AgFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Pararammelsbergite | 2.EB.10e | NiAs2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Löllingite var. Chathamite | 2.EB.15a | (Fe,Ni)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Nickelskutterudite | 2.EC.05 | NiAs3 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Xanthoconite | 2.GA.10 | Ag3AsS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pearceite | 2.GB.15 | [Ag6As2S7][Ag9CuS4] |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Bunsenite | 4.AB.25 | NiO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Claudetite | 4.CB.45 | As2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Tyuyamunite | 4.HB.25 | Ca(UO2)2(VO4)2 · 5-8H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Spherocobaltite | 5.AB.05 | CoCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Kettnerite | 5.BE.30 | CaBiCO3OF |
| ⓘ | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Hydrowoodwardite | 7.DD.35 | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| ⓘ | Ettringite | 7.DG.15 | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Aerugite | 8.BC.15 | Ni8.5(AsO4)2As5+O8 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Neustädtelite | 8.BK.10 | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Arsenocrandallite | 8.BL.10 | CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Kaatialaite | 8.CC.10 | Fe3+[AsO2(OH)2]3 · 5H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Ferrisymplesite | 8.CE.40 | Fe3+3(AsO4)2(OH)3 · 5H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Symplesite | 8.CE.45 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Sainfeldite | 8.CJ. | Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| ⓘ | Rauenthalite | 8.CJ.40 | Ca3(AsO4)2 · 10H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Guérinite | 8.CJ.75 | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metauranospinite | 8.EB.10 | Ca(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ | Abernathyite | 8.EB.15 | K(UO2)(AsO4) · 3H2O |
| ⓘ | Bergenite | 8.EC.40 | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bismutoferrite | 9.ED.25 | Fe3+2Bi(SiO4)2(OH) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Abernathyite | K(UO2)(AsO4) · 3H2O |
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| H | ⓘ Ferrisymplesite | Fe33+(AsO4)2(OH)3 · 5H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaatialaite | Fe3+[AsO2(OH)2]3 · 5H2O |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metauranospinite | Ca(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Sainfeldite | Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| H | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Kettnerite | CaBiCO3OF |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Spherocobaltite | CoCO3 |
| O | Oxygen | |
| O | ⓘ Abernathyite | K(UO2)(AsO4) · 3H2O |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aerugite | Ni8.5(AsO4)2As5+O8 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| O | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Bunsenite | NiO |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Ferrisymplesite | Fe33+(AsO4)2(OH)3 · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaatialaite | Fe3+[AsO2(OH)2]3 · 5H2O |
| O | ⓘ Kettnerite | CaBiCO3OF |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metauranospinite | Ca(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Sainfeldite | Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spherocobaltite | CoCO3 |
| O | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| O | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Kettnerite | CaBiCO3OF |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Al | Aluminium | |
| Al | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| P | Phosphorus | |
| P | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Argentopyrite | AgFe2S3 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Lautite | CuAsS |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Sternbergite | AgFe2S3 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Xanthoconite | Ag3AsS3 |
| S | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Abernathyite | K(UO2)(AsO4) · 3H2O |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Ca | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Ca | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Ettringite | Ca6Al2(SO4)3(OH)12 · 26H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kettnerite | CaBiCO3OF |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Metauranospinite | Ca(UO2)2(AsO4)2 · 8H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| Ca | ⓘ Sainfeldite | Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| Ca | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| Mn | Manganese | |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Argentopyrite | AgFe2S3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferrisymplesite | Fe33+(AsO4)2(OH)3 · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Kaatialaite | Fe3+[AsO2(OH)2]3 · 5H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Sternbergite | AgFe2S3 |
| Fe | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| Fe | ⓘ Löllingite var. Chathamite | (Fe,Ni)As2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Co | ⓘ Spherocobaltite | CoCO3 |
| Co | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| Ni | Nickel | |
| Ni | ⓘ Aerugite | Ni8.5(AsO4)2As5+O8 |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Bunsenite | NiO |
| Ni | ⓘ Maucherite | Ni11As8 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickelskutterudite | NiAs3 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pararammelsbergite | NiAs2 |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Löllingite var. Chathamite | (Fe,Ni)As2 |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lautite | CuAsS |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Abernathyite | K(UO2)(AsO4) · 3H2O |
| As | ⓘ Aerugite | Ni8.5(AsO4)2As5+O8 |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsenolamprite | As |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Ferrisymplesite | Fe33+(AsO4)2(OH)3 · 5H2O |
| As | ⓘ Guérinite | Ca6(HAsO4)3(AsO4)2 · 10.5H2O |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Kaatialaite | Fe3+[AsO2(OH)2]3 · 5H2O |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Lautite | CuAsS |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Maucherite | Ni11As8 |
| As | ⓘ Metauranospinite | Ca(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickelskutterudite | NiAs3 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Pararammelsbergite | NiAs2 |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Rauenthalite | Ca3(AsO4)2 · 10H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Sainfeldite | Ca5(AsO4)2(AsO3OH)2 · 4H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Stibarsen | AsSb |
| As | ⓘ Symplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Xanthoconite | Ag3AsS3 |
| As | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| As | ⓘ Löllingite var. Chathamite | (Fe,Ni)As2 |
| Se | Selenium | |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Naumannite | Ag2Se |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentopyrite | AgFe2S3 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Pearceite | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sternbergite | AgFe2S3 |
| Ag | ⓘ Xanthoconite | Ag3AsS3 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Bi | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Kettnerite | CaBiCO3OF |
| Bi | ⓘ Neustädtelite | Bi2Fe3+(Fe3+,Co)(AsO4)2(O,OH)4 |
| U | Uranium | |
| U | ⓘ Abernathyite | K(UO2)(AsO4) · 3H2O |
| U | ⓘ Bergenite | Ca2Ba4(UO2)9(PO4)6O6 · 16H2O |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Metauranospinite | Ca(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tyuyamunite | Ca(UO2)2(VO4)2 · 5-8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
- Bohemian MassifMassif
- Ore MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Vater Abraham Mine, Lauta, Marienberg, Erzgebirgskreis, Saxony, Germany