Log In
Mkushi River area, Mkushi, Mkushi District, Central Province, Zambiai
| Regional Level Types | |
|---|---|
| Mkushi River area | Area |
| Mkushi | - not defined - |
| Mkushi District | District |
| Central Province | Province |
| Zambia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
13° 32' 59'' South , 29° 39' 59'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Approximately 30 km north-east of Mkushi.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities5 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Description: Manganoan arfvedsonite |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ 'Chevkinite Group' |
| ⓘ Hejtmanite (TL) Formula: Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 Type Locality: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ilmenite var. Manganese-bearing Ilmenite Formula: (Fe,Mn)2+TiO3 |
| ⓘ 'Ilmenite-Pyrophanite Series' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | var. Manganese-bearing Ilmenite | 4.CB.05 | (Fe,Mn)2+TiO3 |
| Group 9 - Silicates | |||
| ⓘ | Hejtmanite (TL) | 9.BE.55 | Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Ilmenite-Pyrophanite Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Chevkinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| C | Carbon | |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilmenite-Pyrophanite Series | |
| O | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Ilmenite-Pyrophanite Series | |
| Ti | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Mn | ⓘ Ilmenite-Pyrophanite Series | |
| Mn | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilmenite-Pyrophanite Series | |
| Fe | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ba | Barium | |
| Ba | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
Localities in this Region
- Central Province
- Mkushi District
- Mkushi
- Mkushi River area
- Mkushi
- Mkushi District
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Mbolwe Hill, Mkushi River area, Mkushi, Mkushi District, Central Province, Zambia