Log In
Mbolwe Hill, Mkushi River area, Mkushi, Mkushi District, Central Province, Zambiai
| Regional Level Types | |
|---|---|
| Mbolwe Hill | Hill |
| Mkushi River area | Area |
| Mkushi | - not defined - |
| Mkushi District | District |
| Central Province | Province |
| Zambia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
14° 4' 59'' South , 29° 49' 59'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mkushi | 12,306 (2012) | 69.9km |
Pegmatite cutting alkalic granite and syenite.
Young segregation of Mn-arfvedsonite pegmatoids cutting foliated alkali granite (gneisses) and syenite.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arfvedsonite Formula: [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 Description: Manganoan arfvedsonite |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ 'Chevkinite Group' |
| ⓘ Hejtmanite (TL) Formula: Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 Type Locality: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Ilmenite var. Manganese-bearing Ilmenite Formula: (Fe,Mn)2+TiO3 |
| ⓘ 'Ilmenite-Pyrophanite Series' |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | var. Manganese-bearing Ilmenite | 4.CB.05 | (Fe,Mn)2+TiO3 |
| Group 9 - Silicates | |||
| ⓘ | Hejtmanite (TL) | 9.BE.55 | Ba2Mn2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Arfvedsonite | 9.DE.25 | [Na][Na2][Fe2+4Fe3+]Si8O22(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Ilmenite-Pyrophanite Series' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Chevkinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| H | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| C | Carbon | |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilmenite-Pyrophanite Series | |
| O | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Si | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Ilmenite-Pyrophanite Series | |
| Ti | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Mn | ⓘ Ilmenite-Pyrophanite Series | |
| Mn | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arfvedsonite | [Na][Na2][Fe42+Fe3+]Si8O22(OH)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilmenite-Pyrophanite Series | |
| Fe | ⓘ Ilmenite var. Manganese-bearing Ilmenite | (Fe,Mn)2+TiO3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ba | Barium | |
| Ba | ⓘ Hejtmanite | Ba2Mn42+Ti2(Si2O7)2O2(OH)2F2 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
Other Regions, Features and Areas containing this locality
AfricaContinent
- East African Rift System (EARS)Zone (Tectonic)
African PlateTectonic Plate
- Irumide BeltOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Mbolwe Hill, Mkushi River area, Mkushi, Mkushi District, Central Province, Zambia