Log In
Zimná Voda uranium occurrence, Prakovce, Gelnica District, Košice Region, Slovakiai
| Regional Level Types | |
|---|---|
| Zimná Voda uranium occurrence | Occurrence |
| Prakovce | Municipality |
| Gelnica District | District |
| Košice Region | Region |
| Slovakia | Country |
Zimná Voda uranium occurrence, Carpathian Mountains, Europe
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 46' 0'' North , 20° 54' 48'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Medzev | 3,667 (2012) | 7.5km |
| Gelnica | 6,404 (2016) | 10.1km |
| Krompachy | 8,812 (2012) | 16.7km |
| Moldava nad Bodvou | 9,525 (2012) | 18.1km |
| Kavečany | 1,287 (2017) | 21.4km |
Other/historical names associated with this locality:
Zimná Voda REE-U-Au vein
Name(s) in local language(s):
Zimná Voda, Prakovce, okres Gelnica, Košický Kraj, Slovenská Republika
Quartz vein with U-Au mineralization was found in two 500 m long outcrops in distance of 300 m south of Prakovce village in Zimná Voda valley, 250 and 500 m north of Tri Studne hill. Surrounding rocks are chlorite-sericite phylite with quartzite lenses of the Bystrý Potok Formation. Uranium minerals and gold are disseminated in brownish quartz and they are visible with naked eye in some places.
The REE minerals at this site are locally gadolinium-dominant, which is very rare in the nature.
The hydrothermal REE–U–Au vein mineralisation at the Zimná Voda occurrence is hosted in the Lower Palaeozoic metamorphic rocks of the Bystrý Potok Formation, a part of the Gelnica Group in the Gemeric tectonic unit of the Western Carpathians, which is part of the Alpine-Carpathian Mountain belt. Two quartz veins (Western and Eastern) containing REE, U and Au mineralisation were found in the area. Xenotime-(Gd) was found in the Western vein. The vein is hosted in fine-grained micaceous phyllites interbedded with fine-grained quartzites. It has an E–W strike, total length of ∼90 m with an average dip of 65° to the S, and conforms to the schistosity of the host rocks. The thickness of the vein ranges from 3 to 30 cm. Along the contact, the rocks are intensively argillitised, and locally silicified, and impregnated by pyrite. Supergene alteration of pyritised rocks caused their limonitisation.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
47 valid minerals. 2 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Tetrahedrite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)Sb4S12S |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Tintinaite | 2.HB.10a | Pb22Cu4(Sb,Bi)30S69 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Brannerite | 4.DH.05 | UTi2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Gd) (TL) | 8.AD. | Gd(PO4) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Xenotime-(Gd) (TL) | 8.AD.35 | Gd(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Monazite-(Nd) | 8.AD.50 | Nd(PO4) |
| ⓘ | Monazite-(Sm) | 8.AD.50 | Sm(PO4) |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Stibiosegnitite | 8.BL.10 | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Kahlerite | 8.EB.05 | Fe(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Nováčekite | 8.EB.05 | Mg(UO2)2(AsO4)2 · 10H2O |
| ⓘ | Threadgoldite | 8.EB.20 | Al(UO2)2(PO4)2(OH) · 8H2O |
| ⓘ | Chistyakovaite | 8.EB.20 | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| ⓘ | Arsenuranospathite | 8.EB.25 | Al(UO2)2(AsO4)2F · 20H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Hingganite-(Y) | 9.AJ.20 | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Haiweeite | 9.AK.25 | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| H | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| H | ⓘ Kahlerite | Fe(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Threadgoldite | Al(UO2)2(PO4)2(OH) · 8H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| H | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Be | Beryllium | |
| Be | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| B | Boron | |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| O | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| O | ⓘ Kahlerite | Fe(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Monazite-(Nd) | Nd(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Threadgoldite | Al(UO2)2(PO4)2(OH) · 8H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Monazite-(Sm) | Sm(PO4) |
| O | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| O | ⓘ Monazite-(Gd) | Gd(PO4) |
| O | ⓘ Xenotime-(Gd) | Gd(PO4) |
| O | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| F | Fluorine | |
| F | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mg | Magnesium | |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| Al | Aluminium | |
| Al | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Threadgoldite | Al(UO2)2(PO4)2(OH) · 8H2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| Si | Silicon | |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Si | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Monazite-(Nd) | Nd(PO4) |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Threadgoldite | Al(UO2)2(PO4)2(OH) · 8H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Monazite-(Sm) | Sm(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Monazite-(Gd) | Gd(PO4) |
| P | ⓘ Xenotime-(Gd) | Gd(PO4) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| S | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| Ca | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Fe | ⓘ Kahlerite | Fe(UO2)2(AsO4)2 · 12H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Fe | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Cu | Copper | |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Cu | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Kahlerite | Fe(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| As | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
| As | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Hingganite-(Y) | (Y,REE,Ca)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sb | Antimony | |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Sb | ⓘ Tetrahedrite-(Fe) | Cu6(Cu4Fe22+)Sb4S12S |
| Sb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Monazite-(Nd) | Nd(PO4) |
| Sm | Samarium | |
| Sm | ⓘ Monazite-(Sm) | Sm(PO4) |
| Gd | Gadolinium | |
| Gd | ⓘ Monazite-(Gd) | Gd(PO4) |
| Gd | ⓘ Xenotime-(Gd) | Gd(PO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Pb | ⓘ Stibiosegnitite | Pb(Fe3+2.5Sb5+0.5)(AsO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Bi | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| U | Uranium | |
| U | ⓘ Arsenuranospathite | Al(UO2)2(AsO4)2F · 20H2O |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Haiweeite | Ca(UO2)2[Si5O12(OH)2] · 6H2O |
| U | ⓘ Kahlerite | Fe(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Threadgoldite | Al(UO2)2(PO4)2(OH) · 8H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Chistyakovaite | Al(UO2)2(AsO4)2(F,OH) · 6.5H2O |
| U | ⓘ Nováčekite | Mg(UO2)2(AsO4)2 · 10H2O |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Ondrejka, Martin, Uher, Pavel, Ferenc, Štefan, Milovská, Stanislava, Mikuš, Tomáš, Molnárová, Alexandra, Škoda, Radek, Kopáčik, Richard, Bačík, Peter (2023) Gadolinium-dominant monazite and xenotime: Selective hydrothermal enrichment of middle REE during low-temperature alteration of uraninite, brannerite, and fluorapatite (the Zimná Voda REE-U-Au quartz vein, Western Carpathians, Slovakia) American Mineralogist, 108 (4) Mineralogical Society of America. 754-768 doi:10.2138/am-2022-8418
[1]Ondrejka, Martin, Bačík, Peter, Majzlan, Juraj, Uher, Pavel, Ferenc, Štefan, Mikuš, Tomáš (2024) Xenotime-(Gd), a new Gd-dominant mineral of the xenotime group from the Zimná Voda REE–U–Au quartz vein, Prakovce, Western Carpathians, Slovakia. Mineralogical Magazine, 88 (5). 613-622 doi:10.1180/mgm.2024.62
Zimná Voda uranium occurrence, Prakovce, Gelnica District, Košice Region, Slovakia