Log In
Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Francei
| Regional Level Types | |
|---|---|
| Aix-en-Provence | Arrondissement |
| Bouches-du-Rhône | Department |
| Provence-Alpes-Côte d'Azur | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Aix-en-Provence | 146,821 (2018) |
| Salon-de-Provence | 41,397 (2016) |
| Gardanne | 21,140 (2016) |
| Les Pennes-Mirabeau | 19,871 (2016) |
| Bouc-Bel-Air | 13,184 (2016) |
| Trets | 9,734 (2016) |
Other Languages:
French:
Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, France
German:
Arrondissement Aix-en-Provence, Département Bouches-du-Rhône, Provence-Alpes-Côte d’Azur, Frankreich
Italian:
arrondissement di Aix-en-Provence, Bocche del Rodano, Provenza-Alpi-Costa Azzurra, Francia
Russian:
Экс-ан-Прованс, Буш-дю-Рон, Прованс-Альпы-Лазурный Берег, Франция
Simplified Chinese:
普罗旺斯地区艾克斯区, 罗讷河口省, 普罗旺斯-阿尔卑斯-蓝色海岸, 法国
Spanish:
Distrito de Aix-en-Provence, Bocas del Ródano, Provenza-Alpes-Costa Azul, Francia
Albanian:
Qarku Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Franca
Arabic:
آكس أون بروفانس, بوش دو رون, إقليم ألب كوت دازور, فرنسا
Aragonese:
Destrito d'Ais de Provença, Bocas d'o Roine, Provenza-Alpes-Costa Azul, Francia
Armenian:
Էկս ան Պրովանս, Բուշ-դյու-Ռոն, Պրովանս-Ալպեր-Լազուր ափ, Ֆրանսիա
Azeri:
Eks-an-Provans , Buş-dü-Ron, Provans-Alp-Kot d'Azur, Fransa
Basque:
Aix-en-Provenceko barrutia, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Frantzia
Breton:
arondisamant Ais de Provença, Genoù-ar-Ron, Provañs-Alpoù-Aod an Azur, Bro-C'hall
Catalan:
Districte d'Ais de Provença, Boques del Roine, Provença-Alps-Costa Blava, França
Cebuano:
Arrondissement d'Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Pransiya
Czech:
Arrondissement Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Francie
Dutch:
Arrondissement Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Frankrijk
Farsi/Persian:
بخش اکس-آن, بوش دو رون, پروانس-آلپ-کوت دازور, فرانسه
Greek:
διαμέρισμα της Αιξ-αν-Προβάνς, Μπους-ντυ-Ρον, Προβηγκία-Άλπεις-Κυανή Ακτή, Γαλλία
Indonesian:
Arondisemen Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Perancis
Irish Gaelic:
Arrondissement Aix-en-Provence, Provence-Alpes-Côte d'Azur, An Fhrainc
Japanese:
エクス＝アン＝プロヴァンス郡, ブーシュ＝デュ＝ローヌ県, プロヴァンス＝アルプ＝コート・ダジュール, フランス
Lithuanian:
Provanso Eksas, Ronos delta, Provansas-Alpės-Žydrasis Krantas, Prancūzija
Luxembourgish:
Arrondissement Aix-en-Provence, Departement Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Frankräich
Minnan / Hokkien-Taiwanese:
Aix-en-Provence Kūn, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Hoat-kok
Occitan:
Ais de Provença, Bocas de Ròse, Provença-Aups-Còsta d'Azur, França
Polish:
Okręg Aix-en-Provence, Delta Rodanu, Prowansja-Alpy-Lazurowe Wybrzeże, Francja
Romanian:
Arondismentul Aix-en-Provence, Bouches-du-Rhône, Provența-Alpi-Coasta de Azur, Franța
Slovak:
Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d’Azur, Francúzsko
Tatar:
Экс-ан-Прованс , Франция
Turkish:
Aix-en-Provence , Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Fransa
Venetian:
arrondissement d'Aix-en-Provence, Provensa-Alpi-Costa Azura, Fransa
Vietnamese:
Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, Pháp
The arrondissement of Aix-en-Provence is an arrondissement of France in the Bouches-du-Rhône department in the Provence-Alpes-Côte d'Azur region. It has 48 communes.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities49 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Awaruite Formula: Ni3Fe |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Cuprorhodsite Formula: (Cu1+0.5Fe3+0.5)Rh3+2S4 Description: With bornite, inclusions in Pt3Fe. |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Galena Formula: PbS |
| ⓘ 'Glass' Description: Rich in K2O, poor in TiO2, of shoshonitic-type.
Inclusions in isoferroplatinum grains. |
| ⓘ Glaucophane Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ Heazlewoodite Formula: Ni3S2 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Isoferroplatinum Formula: Pt3Fe References: |
| ⓘ Isomertieite Formula: Pd11Sb2As2 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Leucoxene' |
| ⓘ 'Limonite' |
| ⓘ Litharge Formula: PbO |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Iridium Formula: (Ir,Os,Ru) |
| ⓘ Native Iridium var. Osmiridium Formula: (Ir,Os,Ru) |
| ⓘ Native Osmium Formula: (Os,Ir,Ru) References: |
| ⓘ Native Osmium var. Iridosmine Formula: (Os,Ir) |
| ⓘ Native Ruthenium Formula: (Ru,Ir) |
| ⓘ Nisnite ? Formula: Ni3Sn References: |
| ⓘ Pumpellyite-(Mg) Formula: Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutheniridosmine Formula: (Ir,Os,Ru) |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Shandite Formula: Ni3Pb2S2 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Tetra-auricupride Formula: AuCu |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'UM1990-01-As:CuPdPt' Formula: (Pt,Pd)17Cu8As3 References: |
| ⓘ 'UM1990-14-E:AuCuPt' Formula: Cu5(Pt,Au)6 References: |
| ⓘ 'UM1990-15-E:CuPdPt' Formula: (Pt,Pd)2Cu3 References: |
| ⓘ 'UM1990-20-E:NiPtSn' Formula: (Ni,Pt)Sn References: |
| ⓘ 'UM1990-40-S:CuFePdPtRh' Formula: (Pd,Cu,Rh,Pt,Fe)3S2 References: |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Tetra-auricupride | 1.AA.10b | AuCu |
| ⓘ | Awaruite | 1.AE.20 | Ni3Fe |
| ⓘ | Nisnite ? | 1.AE.35 | Ni3Sn |
| ⓘ | Native Osmium | 1.AF.05 | (Os,Ir,Ru) |
| ⓘ | Rutheniridosmine | 1.AF.05 | (Ir,Os,Ru) |
| ⓘ | Native Ruthenium | 1.AF.05 | (Ru,Ir) |
| ⓘ | Native Osmium var. Iridosmine | 1.AF.05 | (Os,Ir) |
| ⓘ | Native Iridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | var. Osmiridium | 1.AF.10 | (Ir,Os,Ru) |
| ⓘ | Isoferroplatinum | 1.AG.35 | Pt3Fe |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Isomertieite | 2.AC.15a | Pd11Sb2As2 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Heazlewoodite | 2.BB.05 | Ni3S2 |
| ⓘ | Shandite | 2.BE.15 | Ni3Pb2S2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Cuprorhodsite | 2.DA.05 | (Cu1+0.5Fe3+0.5)Rh3+2S4 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Litharge | 4.AC.20 | PbO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Mg) | 9.BG.20 | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Glaucophane | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Glass' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'UM1990-01-As:CuPdPt' | - | (Pt,Pd)17Cu8As3 |
| ⓘ | 'UM1990-14-E:AuCuPt' | - | Cu5(Pt,Au)6 |
| ⓘ | 'UM1990-15-E:CuPdPt' | - | (Pt,Pd)2Cu3 |
| ⓘ | 'UM1990-40-S:CuFePdPtRh' | - | (Pd,Cu,Rh,Pt,Fe)3S2 |
| ⓘ | 'UM1990-20-E:NiPtSn' | - | (Ni,Pt)Sn |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Litharge | PbO |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Mg | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cuprorhodsite | (Cu1+0.5Fe3+0.5)Rh23+S4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Heazlewoodite | Ni3S2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Shandite | Ni3Pb2S2 |
| S | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Pumpellyite-(Mg) | Ca2MgAl2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | Iron | |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Awaruite | Ni3Fe |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cuprorhodsite | (Cu1+0.5Fe3+0.5)Rh23+S4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Isoferroplatinum | Pt3Fe |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| Ni | Nickel | |
| Ni | ⓘ Awaruite | Ni3Fe |
| Ni | ⓘ Heazlewoodite | Ni3S2 |
| Ni | ⓘ Shandite | Ni3Pb2S2 |
| Ni | ⓘ Nisnite | Ni3Sn |
| Ni | ⓘ UM1990-20-E:NiPtSn | (Ni,Pt)Sn |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Cuprorhodsite | (Cu1+0.5Fe3+0.5)Rh23+S4 |
| Cu | ⓘ Tetra-auricupride | AuCu |
| Cu | ⓘ UM1990-01-As:CuPdPt | (Pt,Pd)17Cu8As3 |
| Cu | ⓘ UM1990-14-E:AuCuPt | Cu5(Pt,Au)6 |
| Cu | ⓘ UM1990-15-E:CuPdPt | (Pt,Pd)2Cu3 |
| Cu | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| As | Arsenic | |
| As | ⓘ Isomertieite | Pd11Sb2As2 |
| As | ⓘ UM1990-01-As:CuPdPt | (Pt,Pd)17Cu8As3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ru | Ruthenium | |
| Ru | ⓘ Native Iridium | (Ir,Os,Ru) |
| Ru | ⓘ Native Osmium | (Os,Ir,Ru) |
| Ru | ⓘ Rutheniridosmine | (Ir,Os,Ru) |
| Ru | ⓘ Native Ruthenium | (Ru,Ir) |
| Ru | ⓘ Native Iridium var. Osmiridium | (Ir,Os,Ru) |
| Rh | Rhodium | |
| Rh | ⓘ Cuprorhodsite | (Cu1+0.5Fe3+0.5)Rh23+S4 |
| Rh | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| Pd | Palladium | |
| Pd | ⓘ Isomertieite | Pd11Sb2As2 |
| Pd | ⓘ UM1990-01-As:CuPdPt | (Pt,Pd)17Cu8As3 |
| Pd | ⓘ UM1990-15-E:CuPdPt | (Pt,Pd)2Cu3 |
| Pd | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Nisnite | Ni3Sn |
| Sn | ⓘ UM1990-20-E:NiPtSn | (Ni,Pt)Sn |
| Sb | Antimony | |
| Sb | ⓘ Isomertieite | Pd11Sb2As2 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Os | Osmium | |
| Os | ⓘ Native Iridium | (Ir,Os,Ru) |
| Os | ⓘ Native Osmium | (Os,Ir,Ru) |
| Os | ⓘ Rutheniridosmine | (Ir,Os,Ru) |
| Os | ⓘ Native Iridium var. Osmiridium | (Ir,Os,Ru) |
| Os | ⓘ Native Osmium var. Iridosmine | (Os,Ir) |
| Ir | Iridium | |
| Ir | ⓘ Native Iridium | (Ir,Os,Ru) |
| Ir | ⓘ Native Osmium | (Os,Ir,Ru) |
| Ir | ⓘ Rutheniridosmine | (Ir,Os,Ru) |
| Ir | ⓘ Native Ruthenium | (Ru,Ir) |
| Ir | ⓘ Native Iridium var. Osmiridium | (Ir,Os,Ru) |
| Ir | ⓘ Native Osmium var. Iridosmine | (Os,Ir) |
| Pt | Platinum | |
| Pt | ⓘ Isoferroplatinum | Pt3Fe |
| Pt | ⓘ UM1990-01-As:CuPdPt | (Pt,Pd)17Cu8As3 |
| Pt | ⓘ UM1990-14-E:AuCuPt | Cu5(Pt,Au)6 |
| Pt | ⓘ UM1990-15-E:CuPdPt | (Pt,Pd)2Cu3 |
| Pt | ⓘ UM1990-40-S:CuFePdPtRh | (Pd,Cu,Rh,Pt,Fe)3S2 |
| Pt | ⓘ UM1990-20-E:NiPtSn | (Ni,Pt)Sn |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Tetra-auricupride | AuCu |
| Au | ⓘ UM1990-14-E:AuCuPt | Cu5(Pt,Au)6 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Litharge | PbO |
| Pb | ⓘ Shandite | Ni3Pb2S2 |
Fossils
There are 835 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 835 |
|---|---|
| Youngest Fossil Listed | 0.13 Ma (Pleistocene) |
| Oldest Fossil Listed | 201 Ma (Early Jurassic) |
| Stratigraphic Units | Click here to view 6 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 46 fossil localities |
- Provence-Alpes-Côte d'Azur
- Bouches-du-Rhône
- Aix-en-Provence
- Late/Upper Cretaceous🐚 1 km north-northeast of Rousset
- Cenozoic🐚 Aix-en-Provence
- Cenozoic🐚 Aix-en-Provence
- Cenozoic🐚 Aix-en-Provence
- Miocene🐚 Aix-en-Provence
- Late/Upper Cretaceous🐚 Arc River
- Late/Upper Cretaceous🐚 Bastien
- Late/Upper Cretaceous🐚 between Pas-des-Lanciers and Les Pennes
- Early/Lower Cretaceous🐚 Calissanne
- Late/Upper Cretaceous🐚 Genty
- Late/Upper Cretaceous🐚 Hôtel des Roches Rouges
- Early/Lower Cretaceous🐚 L'Enfourna biostrome
- Paleocene🐚 La Baraque
- Late/Upper Cretaceous🐚 La Boucharde
- Late/Upper Cretaceous🐚 La Cairanne
- Late/Upper Cretaceous🐚 La Cardeline 1
- Early Jurassic🐚 La Cride tracksite
- Miocene🐚 La Denise
- Late/Upper Cretaceous🐚 La Grande Pugère
- Pleistocene🐚 La grotte de l'Escale bed H
- Late/Upper Cretaceous🐚 La Neuve
- Late/Upper Cretaceous🐚 Le Rousset
- Late/Upper Cretaceous🐚 Le Tholonet
- Aix-en-Provence
- Bouches-du-Rhône
- Provence-Alpes-Côte d'Azur
- Bouches-du-Rhône
- Aix-en-Provence
- Late/Upper Cretaceous🐚 Les Bastidons
- Cenozoic🐚 Les Figons
- Cenozoic🐚 Les Milles
- Late/Upper Cretaceous🐚 Les Pennes-Mirabeau
- Late/Upper Cretaceous🐚 Maupague-Saint Ser
- Eocene🐚 Palette
- Miocene🐚 Puyricard locality
- Late/Upper Cretaceous🐚 Quartier des Prés
- Late/Upper Cretaceous🐚 Roquehautes
- Late/Upper Cretaceous🐚 Roquehautes-Grand Creux A
- Late/Upper Cretaceous🐚 Roques Hautes
- Late/Upper Cretaceous🐚 Roques-Hautes
- Late/Upper Cretaceous🐚 Rousset-sur-Arc
- Late/Upper Cretaceous🐚 Rousset-Village
- Late/Upper Cretaceous🐚 Saint Ser
- Paleocene🐚 Saint-Antonin
- Late/Upper Cretaceous🐚 Saint-Estève-Janson
- Late/Upper Cretaceous🐚 Saint-Hilaire
- Late/Upper Cretaceous🐚 Velaux
- Miocene🐚 Venelles
- Late/Upper Cretaceous🐚 Ventabren
- Fuveau
- Aix-en-Provence
- Bouches-du-Rhône
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Arrondissement_of_Aix-en-Provence |
|---|---|
| Wikidata ID: | Q700364 |
| GeoNames ID: | 3038353 |
Localities in this Region
- Provence-Alpes-Côte d'Azur
- Bouches-du-Rhône
- Aix-en-Provence
- ⭔Cabriès
- ⭔Fuveau
- Gardanne
- Hély d'Oissel pit
- Meyreuil
- Meyreuil
- ⭔Peyrolles-en-Provence
- ⭔Salon-de-Provence
- Trets
- Aix-en-Provence
- Bouches-du-Rhône
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Trets Mines, Trets, Aix-en-Provence, Bouches-du-Rhône, Provence-Alpes-Côte d'Azur, France