Log In
Kuridala, Cloncurry Shire, Queensland, Australiai
| Regional Level Types | |
|---|---|
| Kuridala | Village |
| Cloncurry Shire | Shire |
| Queensland | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Hampden; Friezland
A small former mining village, located about 30 km north of the Mount Elliott mine.
Kuridala was first known as Hampden after the mines discovered in the 1880s. Its name was changed to Friezland in 1912 and renamed Kuridala in October 1916. It should be noted that some former references use these names for the area (e.g.: Corbould ).
There were two principal copper mines in the area - the Hampden-Cloncurry Mine and the Hampden Consols Mine.
Ivanhoe Australia Ltd was carrying out geologic surveys in the region (2010).
There are gold, copper and silver deposits throughout the area and the Amethyst locality is locally distinguishable and should be shown separate to a generic Cu-Au deposit. The Amethyst collecting areas comprise two generally known "hobby" collecting area and are separate deposits.
Kuridala was first known as Hampden after the mines discovered in the 1880s. Its name was changed to Friezland in 1912 and renamed Kuridala in October 1916. It should be noted that some former references use these names for the area (e.g.: Corbould ).
There were two principal copper mines in the area - the Hampden-Cloncurry Mine and the Hampden Consols Mine.
Ivanhoe Australia Ltd was carrying out geologic surveys in the region (2010).
There are gold, copper and silver deposits throughout the area and the Amethyst locality is locally distinguishable and should be shown separate to a generic Cu-Au deposit. The Amethyst collecting areas comprise two generally known "hobby" collecting area and are separate deposits.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities81 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Sternbergite ? | 2.CB.65 | AgFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hausmannite ? | 4.BB.10 | Mn2+Mn3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Spherocobaltite | 5.AB.05 | CoCO3 |
| ⓘ | Calcite var. Iron-bearing Calcite | 5.AB.05 | (Ca,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Cuprotungstite | 7.GB.15 | Cu2(WO4)(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornetite | 8.BE.15 | Cu3(PO4)(OH)3 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Heterogenite-3R' | - | Co3+O(OH) |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| H | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Heterogenite-3R | Co3+O(OH) |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Spherocobaltite | CoCO3 |
| C | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hausmannite | Mn2+Mn23+O4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spherocobaltite | CoCO3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Heterogenite-3R | Co3+O(OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Galena | PbS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sternbergite | AgFe2S3 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hausmannite | Mn2+Mn23+O4 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Sternbergite | AgFe2S3 |
| Fe | ⓘ Calcite var. Iron-bearing Calcite | (Ca,Fe)CO3 |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Spherocobaltite | CoCO3 |
| Co | ⓘ Heterogenite-3R | Co3+O(OH) |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Cornetite | Cu3(PO4)(OH)3 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| As | Arsenic | |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Proustite | Ag3AsS3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Sternbergite | AgFe2S3 |
| Sb | Antimony | |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Cuprotungstite | Cu2(WO4)(OH)2 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| U | Uranium | |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Kuridala,_Queensland |
|---|---|
| Wikidata ID: | Q28223961 |
| GeoNames ID: | 2160941 |
Localities in this Region
Other Regions, Features and Areas that Intersect
Australia
- North Australian ElementCraton
- Queensland
- Mount Isa OrogenOrogen
- Doherty - Fig Tree Gully DomainDomain
- Kuridala-Selwyn DomainDomain
- Marimo-Staveley DomainDomain
- Mount Isa OrogenOrogen
- Queensland
- Mount Isa Orogen
- Mary Kathleen DomainDomain
- Mitakoodi DomainDomain
- Soldiers Cap DomainDomain
- Mount Isa Orogen
Australian PlateTectonic Plate
- North Australian Craton
- Mount Isa ProvinceShield
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Snake Creek, Roxmere Station, Kuridala, Cloncurry Shire, Queensland, Australia