Log In
Stazzema, Lucca Province, Tuscany, Italyi
| Regional Level Types | |
|---|---|
| Stazzema | Commune |
| Lucca Province | Province |
| Tuscany | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Neighbouring regions:
Type:
Other Languages:
French:
Stazzema, Province de Lucques, Toscane, Italie
German:
Stazzema, Provinz Lucca, Toskana, Italien
Italian:
Stazzema, Provincia di Lucca, Toscana, Italia
Russian:
Стаццема, Провинция Лукка, Тоскана, Италия
Simplified Chinese:
斯塔泽马, 盧卡省, 托斯卡纳, 意大利
Spanish:
Stazzema, Provincia de Lucca, Toscana, Italia
Armenian:
Ստացեմա, Լուկա, Տոսկանա, Իտալիա
Basque:
Stazzema, Luccako probintzia, Toskana, Italia
Belarusian:
Стаццэма, правінцыя Лука, Таскана, Італія
Bulgarian:
Стацема, Лука, Тоскана, Италия
Catalan:
Stazzema, província de Lucca, Toscana, Itàlia
Cebuano:
Stazzema, Provincia di Lucca, Toscana, Italya
Central Bikol:
Stazzema, Provincia nin Lucca, Tuscany, Italya
Dutch:
Stazzema, Lucca, Toscane, Italië
Esperanto:
Stazzema, Provinco Luko, Toskanio, Italio
Farsi/Persian:
استاتسما, استان لوکا, توسکانی, ایتالیا
Hungarian:
Stazzema, Lucca megye, Toszkána, Olaszország
Japanese:
スタッツェーマ, ルッカ県, トスカーナ州, イタリア
Kazakh (Cyrillic Script):
Стаццема, Тоскана, Италия
Korean:
스타체마, 루카현, 토스카나주, 이탈리아
Latin:
Stathiema, Provincia Lucensis (Provincia Lucae), Tuscia, Italia
Lombard:
Stazzema, Pruvincia de Lucca, Toscana, Italia
Malay:
Stazzema, Wilayah Lucca, Tuscany, Itali
Neapolitan:
Stazzema, Toscana, Italia
Norwegian:
Stazzema, Lucca, Toscana, Italia
Piedmontese:
Stazzema, Provincia ëd Luca, Toscan-a, Italia
Polish:
Stazzema, Lukka , Toskania, Włochy
Portuguese:
Stazzema, Lucca, Toscana, Itália
Romanian:
Stazzema, Provincia Lucca, Toscana, Italia
Serbian:
Стацема, Лука, Тоскана, Италија
Serbo-Croatian:
Stazzema, Lucca, Toskana, Italija
Sicilian:
Stazzema, Pruvincia di Lucca, Tuscana, Italia
South Azerbaijani:
استاتسما, توسکانی, ایتالیا
Tagalog:
Stazzema, Lucca, Tuscany, Italya
Tarantino:
Stazzema, Provinge de Lucca, Toscana, Itaglie
Ukrainian:
Стаццема, Лукка , Тоскана, Італія
Uzbek (Latin Script):
Stazzema, Lucca, Italiya
Vietnamese:
Stazzema, Lucca, Toscana, Ý
Volapük:
Stazzema, Litaliyän
Waray:
Stazzema, Lucca, Toscana, Italya
Stazzema is a comune (municipality) in the Province of Lucca in the Italian region of Tuscany, located about 80 kilometres (ca. 50 mi) northwest of Florence and about 25 km (ca. 16 mi) northwest of Lucca.
Stazzema borders the following municipalities: Camaiore, Careggine, Massa, Molazzana, Pescaglia, Pietrasanta, Seravezza, Vagli Sotto, and Vergemoli.
Stazzema is composed of 17 hamlets (frazioni): Arni, Cardoso, Farnocchia, Gallena, La Culla, Levigliani, Mulina, Palagnana, Pomezzana, Pontestazzemese, Pruno, Retignano, Ruosina, Sant'Anna, Stazzema, Terrinca, and Volegno. Despite the municipal name, the town hall is not located in Stazzema, but in the nearby hamlet of Pontestazzemese.
Stazzema borders the following municipalities: Camaiore, Careggine, Massa, Molazzana, Pescaglia, Pietrasanta, Seravezza, Vagli Sotto, and Vergemoli.
Stazzema is composed of 17 hamlets (frazioni): Arni, Cardoso, Farnocchia, Gallena, La Culla, Levigliani, Mulina, Palagnana, Pomezzana, Pontestazzemese, Pruno, Retignano, Ruosina, Sant'Anna, Stazzema, Terrinca, and Volegno. Despite the municipal name, the town hall is not located in Stazzema, but in the nearby hamlet of Pontestazzemese.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities173 valid minerals. 29 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Habit: prismatic xls |
| ⓘ Aktashite Formula: Cu6Hg3As4S12 References: Biagioni, Cristian, Bonaccorsi, Elena, Moëlo, Yves, Orlandi, Paolo (2014) Mercury-arsenic sulfosalts from Apuan Alps (Tuscany, Italy) I. Routhierite, (Cu0.8Ag0.2)Hg2Tl(As1.4Sb0.6)Σ=2S6, from Monte Arsiccio mine: occurrence and crystal structure. European Journal of Mineralogy, 26 (1) 163-170 doi:10.1127/0935-1221/2013/0025-2320 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Allanite-(La) (TL) Formula: (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) Type Locality: Habit: prismatic Colour: black Description: xls up to 5 mm. Type V-1 veins. |
| ⓘ Alum-(K) Formula: KAl(SO4)2 · 12H2O |
| ⓘ Alunogen Formula: Al2(SO4)3 · 17H2O |
| ⓘ Anatase Formula: TiO2 Localities: Habit: bypiramidal, tabular Colour: brown, red, honey-yellow, blue, black Description: xls up to 3 mm. Type V-1 and V-3 veins. |
| ⓘ 'Andorite' Formula: AgPbSb3S6 |
| ⓘ Andreadiniite (TL) Formula: CuHgAg7Pb7Sb24S48 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2014) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC), CNMNC Newsletter No. 22. Mineralogical Magazine, 78 (5) 1241-1248 doi:10.1180/minmag.2014.078.5.10 Biagioni, Cristian, Moëlo, Yves, Orlandi, Paolo, Paar, Werner H. (2018) Lead-antimony sulfosalts from Tuscany (Italy) XXIII. Andreadiniite, CuAg7HgPb7Sb24S48, a new oversubstituted (Cu,Hg)-rich member of the andorite homeotypic series from the Monte Arsiccio mine, Apuan Alps. European Journal of Mineralogy, 30 (5) 1021-1035 doi:10.1127/ejm/2018/0030-2765 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Localities: Habit: tabular Colour: colorless, white, pink Description: Xls up to 15 mm |
| ✪ Apuanite (TL) Formula: Fe2+Fe3+4Sb3+4O12S Type Locality: Habit: prismatic, characterized by the forms {001}, {110}, {112} and {114}. Colour: black Description: In the past, it was rather common in the Sala del Castello. Today, it is very difficult to find samples of this phase.
Type V-1 veins.
The mineral occurs disseminated as aggregates of crude microcrystals filling fractures in cavities in dolomite. Some of these aggregates exceed 5 cm in diameter References: Mellini, Marcello, Merlino, Stefano, Orlandi, Paolo (1979) Versiliaite and apuanite, two new minerals from the Apuan Alps, Italy. American Mineralogist, 64 (11-12) 1230-1234 |
| ⓘ Aragonite Formula: CaCO3 Localities: Reported from at least 8 localities in this region. Habit: prismatic Colour: colorless, white Description: It was found in the alteration zone of a pyrite concentration. |
| ⓘ Argentopentlandite Formula: Ag(Fe,Ni)8S8 Description: Micrograins included in chalcopyrite |
| ⓘ Arsenmarcobaldiite (TL) Formula: Pb12(As3.2Sb2.8)Σ6S21 Type Locality: References: Hålenius, U., Hatert, F., Pasero, M., Mills, S. J. (2016) New minerals and nomenclature modifications approved in 2016, CNMNC Newsletter No. 33. Mineralogical Magazine, 80 (6) 1135-1144 doi:10.1180/minmag.2016.080.085 Biagioni, Cristian; Moëlo, Yves; Merlino, Stefano; Pasero, Marco; Paar, Werner H.; Vezzoni, Simone; Zaccarini, Federica (2019) Arsenmarcobaldiite, Pb12(As3.2Sb2.8)Σ=6S21, a new N = 3.5 jordanite homologue from the Sant’Anna tectonic window, Apuan Alps (Tuscany, Italy). European Journal of Mineralogy, 31 (5-6). 1067-1077 doi:10.1127/ejm/2019/0031-2888 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Habit: prismatic, deeply striated Colour: gray Description: It is included in marble. |
| ⓘ Arsiccioite (TL) Formula: AgHg2Tl(As,Sb)2S6 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2013) New minerals and nomenclature modifications approved in 2013. CNMNC Newsletter No.17. Mineralogical Magazine, 77 (7) 2997-3005 doi:10.1180/minmag.2013.077.7.09 Biagioni, C., Bonaccorsi, E., Moëlo, Y., Orlandi, P., Bindi, L., D’Orazio, M., Vezzoni, S. (2014) Mercury-arsenic sulfosalts from the Apuan Alps (Tuscany, Italy) II. Arsiccioite, AgHg2TlAs2S6, a new mineral from the Monte Arsiccio mine: occurrence, crystal structure and crystal chemistry of the routhierite isotypic series. Mineralogical Magazine, 78 (1) 101-117 doi:10.1180/minmag.2014.078.1.08 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 Habit: crusts or lamellar xls Colour: green-blue Description: It is a product of the alteration of Cu sulfosalts, like bournonite. |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Habit: prismatic, tabular xls Colour: blue |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 8 localities in this region. Habit: prismatic Colour: colorless, white, green Description: xls up to 5 cm.
It is present in all types of occurrences. |
| ⓘ Benstonite Formula: Ba6Ca6Mg(CO3)13 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Habit: prismatic xls Colour: blue, green Description: Type V-1 and V-2 veins. |
| ⓘ Beryl var. Aquamarine Localities: Habit: prismatic Colour: blue Description: Type V-1 veins. It is also present in type V-2 veins, associated with hematite and quartz. |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) Localities: Habit: prismatic Colour: green Description: Type V-1 veins. |
| ⓘ Bianchiniite (TL) Formula: Ba2(TiV)(As2O5)2OF Type Locality: |
| ⓘ Bohuslavite (TL) Formula: Fe3+4(PO4)3(SO4)(OH) · nH2O Type Locality: Description: Type locality References: Mauro, Daniela; Biagioni, Cristian; Bonaccorsi, Elena; Hålenius, Ulf; Pasero, Marco; Skogby, Henrik; Zaccarini, Federica; Sejkora, Jiří; Plášil, Jakub; Kampf, Anthony R.; et al. (2019) Bohuslavite, Fe43+(PO4)3(SO4)(OH)(H2O)10·nH2O, a new hydrated iron phosphate-sulfate. European Journal of Mineralogy, 31 (5-6). 1033-1046 doi:10.1127/ejm/2019/0031-2892 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Boscardinite (TL) Formula: TlPb4(Sb7As2)S18 Type Locality: Description: TL added References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011. CNMNC Newsletter No 9. Mineralogical Magazine, 75 (4) 2535-2540 doi:10.1180/minmag.2011.075.4.2535 Orlandi, P., Biagioni, C., Bonaccorsi, E., Moëlo, Y., Paar, W. H. (2012) Lead-antimony sulfosalts from Tuscany (Italy) XII. Boscardinite, TlPb4(Sb7As2)Σ9S18, a new mineral species from the Monte Arsiccio mine: Occurrence and crystal structure. The Canadian Mineralogist, 50 (2) 235-251 doi:10.3749/canmin.50.2.235 Biagioni, Cristian, Bonaccorsi, Elena, Moëlo, Yves, Orlandi, Paolo (2014) Mercury-arsenic sulfosalts from Apuan Alps (Tuscany, Italy) I. Routhierite, (Cu0.8Ag0.2)Hg2Tl(As1.4Sb0.6)Σ=2S6, from Monte Arsiccio mine: occurrence and crystal structure. European Journal of Mineralogy, 26 (1) 163-170 doi:10.1127/0935-1221/2013/0025-2320 |
| ✪ Bottinoite (TL) Formula: Ni2+Sb5+2(OH)12 · 6H2O Type Locality: Habit: bladed xls Colour: blue-green Description: It was identified by Bonazzi et al. (1992) on specimens from a secondary level between Redola and Paoli. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: Habit: Acicular Colour: dark grey Description: This is one of the most famous Bottino minerals and it is called also "plumosite". It forms feltry masses of very thin and delicate xls. In the past it was described as jamesonite, eteromorphite, boulangerite, zinkenite or meneghinite but recent studies have proved that Bottino's plumosite is always boulangerite (Garavelli et al., 1957; Orlandi et al., 2002). It is possible to find acicular xls up to 15 cm or in fibrous compact masses. |
| ⓘ Bournonite Formula: PbCuSbS3 Localities: Habit: prismatic, striated // elongation. Colour: black Description: Type V-1 veins and F-1 fractures. |
| ⓘ Brandholzite Formula: MgSb2(OH)12 · 6H2O |
| ⓘ Brannerite ? Formula: UTi2O6 Habit: prismatic xls Colour: black Description: XRD show that this mineral is amorphous, even after heating up to 900°C. EDS analysis show only the presence of U and Ti. It can be brannerite or orthobrannerite. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. |
| ✪ Calomel Formula: [Hg2]2+Cl2 Habit: tabular xls Colour: colorless Fluorescence: red |
| ⓘ Cassiterite Formula: SnO2 Description: Only identified in thin section |
| ⓘ Cerussite Formula: PbCO3 Localities: Buca della Vena Mine, Pontestazzemese, Stazzema, Lucca Province, Tuscany, Italy Monte Arsiccio Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Buca dell'Angina Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy Habit: tabular Colour: colorless, brown |
| ⓘ Chabournéite Formula: AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| ⓘ Chalcocite Formula: Cu2S Localities: Habit: masses Colour: dark gray |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 7 localities in this region. Habit: bisphenoids, pseudo-tetrahedrons, multiple twins Colour: bright golden on fractures; greenish-yellow to reddish brown on surface Description: xls up to 4 cm |
| ⓘ Chalcostibite Formula: CuSbS2 Habit: tabular, acicular Colour: brown-blackish Description: Type V-1 veins. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 Habit: earthy masses; powdery aggregates Colour: dark-green Description: Often coatinng other minerals or included in quartz xls. |
| ⓘ Chapmanite Formula: Fe3+2Sb3+(Si2O5)O3(OH) Colour: green |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 |
| ⓘ Chovanite Formula: Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| ⓘ Cinnabar Formula: HgS Localities: Colour: red, black |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Habit: micaceous Colour: green Description: Type V-1 and V-2 veins. |
| ⓘ Coloradoite Formula: HgTe |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ Coquimbite Formula: AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 Description: Only observed as bladed bronze-yellow inclusions in galena, with chalcopyrite |
| ⓘ Cuprite Formula: Cu2O Habit: cubic, rombododecahedric xls Colour: red |
| ⓘ Cymrite Formula: BaAl2Si2(O,OH)8 · H2O References: Biagioni, Cristian, Bonaccorsi, Elena, Moëlo, Yves, Orlandi, Paolo (2014) Mercury-arsenic sulfosalts from Apuan Alps (Tuscany, Italy) I. Routhierite, (Cu0.8Ag0.2)Hg2Tl(As1.4Sb0.6)Σ=2S6, from Monte Arsiccio mine: occurrence and crystal structure. European Journal of Mineralogy, 26 (1) 163-170 doi:10.1127/0935-1221/2013/0025-2320 |
| ⓘ Dadsonite Formula: Pb23Sb25S60Cl Habit: slightly flattened, acicular xls Colour: black Description: It is very similar to rouxelite. References: |
| ⓘ Derbylite Formula: Fe3+4Ti3Sb3+O13(OH) Localities: Habit: prismatic, often twinned Colour: black Description: xls up to 3 mm.
Type V-1 veins. It contains up to 10 wt% V2O3. |
| ✪ Dessauite-(Y) (TL) Formula: (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 Type Locality: Habit: pseudo-hexagonal Colour: black Description: Type V-1 veins. Only one sample found. |
| ⓘ Destinezite Formula: Fe3+2(PO4)(SO4)(OH) · 6H2O |
| ⓘ Dewitite Formula: AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| ⓘ Digenite Formula: Cu9S5 Locality: Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Description: It is an alteration product of chalcopyrite and it was observed in its fractures. |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: prismatic Colour: brown-red |
| ⓘ 'Dravite-Schorl Series' Description: Schorl-dravites to proton and alkali-deficient end-member. |
| ⓘ Enargite Formula: Cu3AsS4 Habit: prismatic xls Colour: steel gray |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epsomite Formula: MgSO4 · 7H2O |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Ferdowsiite Formula: Ag8(Sb5As3)S16 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: tabular Colour: colorless |
| ⓘ Fluorite Formula: CaF2 Localities: Habit: cubic xls Colour: colorless, green, violet, blue, pink |
| ⓘ Fluorophlogopite Formula: KMg3(Si3Al)O10F2 |
| ✪ 'Freibergite Subgroup' ? Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Habit: tetrahedral Colour: steel gray Description: xls up to 10 mm. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 8 localities in this region. Habit: cube-octahedral, rarely octahedral Colour: grey Description: xls up to 5 cm.
Usually galena has 0,3 to 0,4 wt% Ag at Bottino; sometimes are observed cubanite and pyrargyrite inclusions. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gersdorffite Formula: NiAsS Localities: Habit: cubic Colour: lead-grey Description: Type V-2 veins. |
| ⓘ Giacovazzoite (TL) Formula: K5Fe3+3O(SO4)6 · 10H2O Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Mills, Stuart J. (2019) New minerals and nomenclature modifications approved in 2019. CNMNC Newsletter 49. Mineralogical Magazine, 83 (3) 479-483 doi:10.1180/mgm.2019.35 Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2019) New minerals and nomenclature modifications approved in 2019. Mineralogical Magazine, 83 (03) 479-483 doi:10.1180/mgm.2019.35 Biagioni, Cristian; Bindi, Luca; Mauro, Daniela; Hålenius, Ulf (2019) Crystal Chemistry of Sulfates from the Apuan Alps (Tuscany, Italy). V. Scordariite, K8(Fe3+0.67□0.33)[Fe3+3O(SO4)6(H2O)3]2(H2O)11: A New Metavoltine-Related Mineral. Minerals, 9 (11). 702 doi:10.3390/min9110702 Mauro, D. (2020) Crystal-chemistry of secondary minerals of thallium-rich pyrite from the Apuan Alps (Tuscany, Italy) Plinius, 46. 64-68 Biagioni, Cristian; Bindi, Luca; Mauro, Daniela; Pasero, Marco (2020) Crystal-chemistry of sulfates from the Apuan Alps (Tuscany, Italy). IV. Giacovazzoite, K5Fe3+3O(SO4)6(H2O)9·H2O, the natural analogue of the β-Maus’s Salt and its dehydration product. Physics and Chemistry of Minerals, 47 (1). 7 doi:10.1007/s00269-019-01076-4 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Goldichite Formula: KFe(SO4)2 · 4H2O |
| ✪ Graeserite Formula: Fe3+4Ti3As3+O13(OH) |
| ✪ Grumiplucite (TL) Formula: HgBi2S4 Type Locality: Habit: very slender prismatic crystals Colour: grey-black |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Canale della Radice mines, Calcaferro, Mulina, Stazzema, Lucca Province, Tuscany, Italy Buca della Vena Mine, Pontestazzemese, Stazzema, Lucca Province, Tuscany, Italy Monte Arsiccio Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Jamborite ? Formula: Ni2+1-xCo3+x(OH)2-x(SO4)x · nH2O Habit: crusts Colour: green |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Description: Reported in the past (D'Achiardi, 1873), its presence at Bottino is definitively discredited following very recent accurate analyses. All specimens from Bottino labelled as "jamesonite" actually consist of boulangerite (Orlandi et al., 2002). |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Karelianite Formula: V3+2O3 Habit: tabular, pseudohexagonal Colour: black Description: xls size < 1 mm.
Type V-1 veins. |
| ⓘ Kermesite Formula: Sb2S2O Habit: acicular Colour: red |
| ⓘ 'K Feldspar' Localities: Habit: tabular Colour: colorless, white Description: Type V-3 veins. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Habit: tabular Colour: colorless, white Description: Type V-3 veins. |
| ⓘ Khademite Formula: Al(SO4)F · 5H2O References: Biagioni, Cristian; Bindi, Luca; Mauro, Daniela; Hålenius, Ulf (2019) Crystal Chemistry of Sulfates from the Apuan Alps (Tuscany, Italy). V. Scordariite, K8(Fe3+0.67□0.33)[Fe3+3O(SO4)6(H2O)3]2(H2O)11: A New Metavoltine-Related Mineral. Minerals, 9 (11). 702 doi:10.3390/min9110702 |
| ⓘ Krausite Formula: KFe(SO4)2 · H2O |
| ⓘ Laffittite Formula: AgHgAsS3 |
| ⓘ Lechnerite (TL) Formula: Ag10Cu4HgPb33Sb58S128 Type Locality: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ 'Limonite' |
| ⓘ Magnanelliite (TL) Formula: K3Fe3+2(SO4)4(OH)(H2O)2 Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Mills, Stuart J. (2019) New minerals and nomenclature modifications approved in 2019. CNMNC Newsletter 49. Mineralogical Magazine, 83 (3) 479-483 doi:10.1180/mgm.2019.35 Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2019) New minerals and nomenclature modifications approved in 2019. Mineralogical Magazine, 83 (03) 479-483 doi:10.1180/mgm.2019.35 Biagioni, Cristian; Bindi, Luca; Mauro, Daniela; Hålenius, Ulf (2019) Crystal Chemistry of Sulfates from the Apuan Alps (Tuscany, Italy). V. Scordariite, K8(Fe3+0.67□0.33)[Fe3+3O(SO4)6(H2O)3]2(H2O)11: A New Metavoltine-Related Mineral. Minerals, 9 (11). 702 doi:10.3390/min9110702 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Buca dell'Angina Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Canale della Radice mines, Calcaferro, Mulina, Stazzema, Lucca Province, Tuscany, Italy Buca della Vena Mine, Pontestazzemese, Stazzema, Lucca Province, Tuscany, Italy Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy |
| ⓘ Mannardite Formula: Ba(Ti4+6V3+2)O16 References: |
| ⓘ Mapiquiroite (TL) Formula: (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 Localities: |
| ⓘ Marcasite Formula: FeS2 Localities: Habit: botryoidal aggregates Colour: yellow |
| ⓘ Marrucciite (TL) Formula: Hg3Pb16Sb18S46 Type Locality: References: Orlandi, Paolo, Moëlo, Yves, Campostrini, Italo, Meerschaut, Alain (2007) Lead-antimony sulfosalts from Tuscany (Italy) IX. Marrucciite, Hg3Pb16Sb18S46, a new sulfosalt from Buca della Vena mine, Apuan Alps: Definition and crystal structure. European Journal of Mineralogy, 19 (2) 267-279 doi:10.1127/0935-1221/2007/0019-1718 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O |
| ⓘ Meneghinite (TL) Formula: Pb13CuSb7S24 Localities: Type Locality: Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy Habit: prismatic Colour: lead to steel grey Description: xls up to 5 cm. Also as curved hairs and needles similar to boulangerite; pseudos after galena have been reported |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metacinnabar var. Leviglianite Formula: (Hg,Zn)S |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ Millerite Formula: NiS Localities: Habit: acicular Colour: golden yellow Description: It is partially altered in a earthy green mineral (jamborite ?). |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl References: |
| ⓘ Molybdenite Formula: MoS2 References: |
| ✪ Monazite-(Ce) Formula: Ce(PO4) Colour: honey yellow to pink Description: Type V-3 veins. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Montroseite Formula: (V3+,Fe3+)O(OH) Habit: prismatic xls Colour: black Description: xls size < 1 mm. Type V-1 veins. It is associated with an unidentified mineral. |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Localities: Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy Buca dell'Angina Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy ? (more information) Canale del Giannino, Farnocchia, Stazzema, Lucca Province, Tuscany, Italy ? (more information) Habit: small grains Colour: yellow Description: Reported in 1935 by Dessau from the deepest parts of the mine; more recently, a few micro samples have been found in Rocca tunnel. |
| ✪ Native Mercury Formula: Hg Habit: drops |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nesquehonite Formula: MgCO3 · 3H2O |
| ⓘ Oxycalcioroméite (TL) Formula: Ca2Sb2O6O Type Locality: |
| ⓘ Parapierrotite Formula: TlSb5S8 |
| ⓘ 'Pearceite-T2ac' Formula: [Ag6As2S7][Ag9CuS4] Habit: tabular xls Description: xls size < 1 mm. |
| ⓘ Pecoraite Formula: Ni3(Si2O5)(OH)4 Description: Apple green acicular crystals pseudomorph after millerite (XRD-G). |
| ✪ Pellouxite (TL) Formula: (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 Type Locality: Habit: strongly flattened, ribbon-like xls. Colour: black Description: IMA 2001-033 References: Orlandi, Paolo, Moëlo, Yves, Meerschaut, Alain, Palvadeau, Pierre, Leone, Philippe (2004) Lead-antimony sulfosalts from Tuscany (Italy) VI. Pellouxite, ~ (Cu,Ag)2Pb21Sb23S55ClO, a new oxy-chloro-sulfosalt from Buca della Vena mine, Apuan Alps. European Journal of Mineralogy, 16 (5) 839-844 doi:10.1127/0935-1221/2004/0016-0839 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Description: Only identified as inclusions in pyrrhotite References: |
| ✪ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Habit: prismatic Colour: red |
| ✪ Pillaite (TL) Formula: Pb9Sb10S23ClO0.5 Type Locality: Habit: very slight acicular xls; striated // to the elongation Colour: lead-gray, sometimes coated by thin iridescent Description: xls up to 1 cm. References: |
| ⓘ Polhemusite ? Formula: (Zn,Hg)S Description: Costagliola et al. (1990) wrote: "The presence of a Fe-Zn-Hg sulfide whose optical and compositional (semiquantitative SEM/EDS analysis) properties are like those of polhemusite (LEONARD et al., 1978) is especially noteworthy. Further studies are being carried out to completely describe this mineral; if confirmed, it would be the first finding of polhemusite in Italy." |
| ⓘ Protochabournéite (TL) Formula: Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) ≤ x ≤ 0.34(2), 5.71(9) ≤ y ≤ 6.69(9) Localities: |
| ⓘ Proto-owyheeite (TL) Formula: Ag9Pb40Sb45S112 Type Locality: |
| ⓘ Pyradoketosite (TL) Formula: Ag3SbS3 Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2020) New mineral proposals approved in April 2020, CNMNC Newsletter 55. Mineralogical Magazine, 84 (3) 485-488 doi:10.1180/mgm.2020.39 |
| ✪ Pyrargyrite Formula: Ag3SbS3 Habit: prismatic xls Colour: dark grey with bright red reflections. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 12 localities in this region. Habit: pentagonododecahedric xls, octahedric xls Colour: yellow Description: It is present in all the occurrences. |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n Habit: octahedric xls Colour: yellow, reddish Description: xls size > 1 mm. Type V-1 veins. Orlandi & Dini (2004) describe this as a stibiobetafite without any analysis. |
| ⓘ 'Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.)' ? Formula: (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 Habit: octahedric xls Colour: yellow, reddish Description: xls size > 1 mm.
Type V-1 veins. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy Mount Corchia, Stazzema, Lucca Province, Tuscany, Italy Canale della Radice mines, Calcaferro, Mulina, Stazzema, Lucca Province, Tuscany, Italy Gallena, Stazzema, Lucca Province, Tuscany, Italy Levigliani mine, Stazzema, Lucca Province, Tuscany, Italy Habit: tabular Colour: yellow, brown Description: xls up to 3 cm. Sometimes incrusted galena cube-octahedrons; also replaced by micro pyrite xls aggregates. Strongly magnetic. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 14 localities in this region. |
| ⓘ Realgar Formula: As4S4 References: Biagioni, Cristian, Bonaccorsi, Elena, Moëlo, Yves, Orlandi, Paolo (2014) Mercury-arsenic sulfosalts from Apuan Alps (Tuscany, Italy) I. Routhierite, (Cu0.8Ag0.2)Hg2Tl(As1.4Sb0.6)Σ=2S6, from Monte Arsiccio mine: occurrence and crystal structure. European Journal of Mineralogy, 26 (1) 163-170 doi:10.1127/0935-1221/2013/0025-2320 |
| ⓘ Robinsonite Formula: Pb4Sb6S13 Localities: Habit: acicular with mirror-like non striated faces Colour: black Description: xls up to 1 cm. |
| ⓘ Römerite Formula: Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ Routhierite Formula: Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 References: Biagioni, Cristian, Bonaccorsi, Elena, Moëlo, Yves, Orlandi, Paolo (2014) Mercury-arsenic sulfosalts from Apuan Alps (Tuscany, Italy) I. Routhierite, (Cu0.8Ag0.2)Hg2Tl(As1.4Sb0.6)Σ=2S6, from Monte Arsiccio mine: occurrence and crystal structure. European Journal of Mineralogy, 26 (1) 163-170 doi:10.1127/0935-1221/2013/0025-2320 |
| ⓘ Rouxelite (TL) Formula: Cu2HgPb23Sb27S65.5 Localities: Habit: thin acicular xls Colour: pitch black Description: xls are more than 1 cm in lenght but only few micron in thickness.
IMA 2002-062. |
| ⓘ Rutile Formula: TiO2 |
| ✪ Scainiite (TL) Formula: Pb14Sb30S54O5 Type Locality: Habit: acicular, sometimes flattened xls Colour: black, with frequent bluish hues |
| ⓘ Schafarzikite Formula: Fe2+Sb3+2O4 Habit: prismatic Colour: dark brown Description: It is known only in few specimens. |
| ⓘ Scheelite Formula: Ca(WO4) Colour: yellow |
| ⓘ Scordariite (TL) Formula: K8(Fe3+0.67◻0.33)[Fe3+3O(SO4)6]2 · 14H2O Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2019) CNMNC Newsletter No 50, New minerals and nomenclature modifications approved in 2019. Mineralogical Magazine, 83 (4) 615-620 doi:10.1180/mgm.2019.46 |
| ⓘ Seligmannite ? Formula: PbCuAsS3 Description: Crystals of bournonite-seligmannite series are reported by Orlandi & Checchi (1986) but successively studies seem to show that all the samples are Sb-rich (so they are bournonites). |
| ⓘ Senarmontite Formula: Sb2O3 |
| ⓘ Serpierite Formula: Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O Habit: globular aggregates of blades Colour: sky-blue |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 8 localities in this region. Habit: lenticular, rhombohedric Colour: from pale-tan to brownish, reddish-brown, dark-brown and almost black |
| ⓘ Smythite Formula: (Fe,Ni)3+xS4 (x=0-0.3) Habit: hexagonal lamellae |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 12 localities in this region. Habit: complex, made of combinations of cube, tetrahedrons and rhombododecahedrons. Often it is twinned and elongated; rarely tabular. Colour: black Description: Sometimes it is epitactic on chalcopyrite.
xls up to 5 cm. |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) Description: It is an alteration product of stibnite. |
| ⓘ Stibivanite (TL) Formula: Sb2VO5 Localities: Habit: tabular, prismatic, acicular xls Colour: emerald green, yellow-green Description: xls up to 3-4 mm. Buca della Vena mine is the type locality for the politype stibivanite-2O, found only in one sample and indistinguishable from stibivanite-2M, also present in this locality.
Type V-1 veins. |
| ⓘ Stibnite Formula: Sb2S3 Localities: Sant'Olga tunnel, Monte Arsiccio Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Monte Arsiccio Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Bottino Mine, Stazzema, Lucca Province, Tuscany, Italy Buca della Vena Mine, Pontestazzemese, Stazzema, Lucca Province, Tuscany, Italy Levigliani mine, Stazzema, Lucca Province, Tuscany, Italy ? (more information) |
| ⓘ Stolzite Formula: Pb(WO4) Colour: yellow brown Description: Type V-2 veins. |
| ⓘ 'Targionite' (FRL) Localities: Type Locality: Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Description: Possibly impure galena or steinmannite. |
| ⓘ Tetrahedrite-(Hg) (TL) Formula: Cu6(Cu4Hg2)Sb4S12S Type Locality: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Buca della Vena Mine, Pontestazzemese, Stazzema, Lucca Province, Tuscany, Italy Argentiera di Sant'Anna Mines, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Buca dell'Angina Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Monte Arsiccio Mine, Sant'Anna di Stazzema, Stazzema, Lucca Province, Tuscany, Italy Habit: complex xls Colour: black Description: Type V-1 veins |
| ⓘ Tiemannite Formula: HgSe |
| ✪ Tintinaite Formula: Pb22Cu4(Sb,Bi)30S69 Habit: prismatic-acicular with non striated faces. It never shows a strongly acicular habit. Colour: gray |
| ⓘ Titanite Formula: CaTiO(SiO4) References: Giovanni Scapin CollectionIdentified by Giovanni Scapin: Visual Identification |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Habit: prismatic Colour: black Description: It has been determined as a member between dravite and schorlite. At Bottino tourmaline makes up to 80% in volume of tourmalinite colums; xls are always microscopic. It is also an accessory mineral of the embedding rocks. |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl Habit: prismatic Colour: red References: |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ✪ Versiliaite (TL) Formula: Fe2Fe4Sb6O16S Type Locality: Habit: prismatic Colour: black |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O Colour: green Description: Type V-2 veins References: |
| ⓘ Voltaite Formula: K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ Weddellite Formula: Ca(C2O4) · (2.5-x)H2O |
| ⓘ Zincite ? Formula: ZnO Description: Reported by A. D'Achiardi (1873) but never confirmed. |
| ⓘ Zinkenite Formula: Pb9Sb22S42 Localities: Habit: prismatic, deep striations // to elongation; acicular Colour: steel grey, sometimes with iridescent hues. Never black. |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Argentopentlandite | 2.BB.15 | Ag(Fe,Ni)8S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Tiemannite | 2.CB.05a | HgSe |
| ⓘ | Metacinnabar var. Leviglianite | 2.CB.05a | (Hg,Zn)S |
| ⓘ | Polhemusite ? | 2.CB.05c | (Zn,Hg)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Smythite | 2.CC.10 | (Fe,Ni)3+xS4 (x=0-0.3) |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Arsiccioite (TL) | 2.GA. | AgHg2Tl(As,Sb)2S6 |
| ⓘ | Pyradoketosite (TL) | 2.GA. | Ag3SbS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Aktashite | 2.GA.30 | Cu6Hg3As4S12 |
| ⓘ | Laffittite | 2.GA.35 | AgHgAsS3 |
| ⓘ | Routhierite | 2.GA.40 | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite ? | 2.GA.50 | PbCuAsS3 |
| ⓘ | 'Freibergite Subgroup' ? | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tetrahedrite-(Hg) (TL) | 2.GB.05 | Cu6(Cu4Hg2)Sb4S12S |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Meneghinite (TL) | 2.HB.05b | Pb13CuSb7S24 |
| ⓘ | Tintinaite | 2.HB.10a | Pb22Cu4(Sb,Bi)30S69 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Parapierrotite | 2.HC.05f | TlSb5S8 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Dadsonite | 2.HC.30 | Pb23Sb25S60Cl |
| ⓘ | Proto-owyheeite (TL) | 2.HC.35 | Ag9Pb40Sb45S112 |
| ⓘ | Boscardinite (TL) | 2.HD. | TlPb4(Sb7As2)S18 |
| ⓘ | Dewitite | 2.HD. | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| ⓘ | Chabournéite | 2.HD.05e | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| ⓘ | Protochabournéite (TL) | 2.HD.45 | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) <= x <= 0.34(2), 5.71(9) <= y <= 6.69(9) |
| ⓘ | Ferdowsiite | 2.JA. | Ag8(Sb5As3)S16 |
| ⓘ | Grumiplucite (TL) | 2.JA.05b | HgBi2S4 |
| ⓘ | Andreadiniite (TL) | 2.JB. | CuHgAg7Pb7Sb24S48 |
| ⓘ | Lechnerite (TL) | 2.JB. | Ag10Cu4HgPb33Sb58S128 |
| ⓘ | Rouxelite (TL) | 2.JB.25j | Cu2HgPb23Sb27S65.5 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Arsenmarcobaldiite (TL) | 2.JB.30a | Pb12(As3.2Sb2.8)Σ6S21 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Scainiite (TL) | 2.JB.35b | Pb14Sb30S54O5 |
| ⓘ | Pillaite (TL) | 2.JB.35c | Pb9Sb10S23ClO0.5 |
| ⓘ | Pellouxite (TL) | 2.JB.35d | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| ⓘ | Chovanite | 2.JB.35e | Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| ⓘ | Marrucciite (TL) | 2.JB.60 | Hg3Pb16Sb18S46 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Calomel | 3.AA.30 | [Hg2]2+Cl2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Mapiquiroite (TL) | 4.00. | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Zincite ? | 4.AB.20 | ZnO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Karelianite | 4.CB.05 | V3+2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Dessauite-(Y) (TL) | 4.CC.40 | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brannerite ? | 4.DH.05 | UTi2O6 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Oxycalcioroméite (TL) | 4.DH.20 | Ca2Sb2O6O |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Mannardite | 4.DK.05b | Ba(Ti4+6V3+2)O16 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Montroseite | 4.FD.10 | (V3+,Fe3+)O(OH) |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Bottinoite (TL) | 4.FH.05 | Ni2+Sb5+2(OH)12 · 6H2O |
| ⓘ | Brandholzite | 4.FH.05 | MgSb2(OH)12 · 6H2O |
| ⓘ | Jamborite ? | 4.FL.05 | Ni2+1-xCo3+x(OH)2-x(SO4)x · nH2O |
| ⓘ | Schafarzikite | 4.JA.20 | Fe2+Sb3+2O4 |
| ⓘ | Apuanite (TL) | 4.JA.25 | Fe2+Fe3+4Sb3+4O12S |
| ⓘ | Versiliaite (TL) | 4.JA.30 | Fe2Fe4Sb6O16S |
| ⓘ | Stibivanite (TL) | 4.JA.55 | Sb2VO5 |
| ⓘ | Derbylite | 4.JB.55 | Fe3+4Ti3Sb3+O13(OH) |
| ⓘ | Graeserite | 4.JB.55 | Fe3+4Ti3As3+O13(OH) |
| ⓘ | Bianchiniite (TL) | 4.JB.90 | Ba2(TiV)(As2O5)2OF |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Nesquehonite | 5.CA.05 | MgCO3 · 3H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Alunogen | 7.CB.45 | Al2(SO4)3 · 17H2O |
| ⓘ | Coquimbite | 7.CB.55 | AlFe3(SO4)6(H2O)12 · 6H2O |
| ⓘ | Römerite | 7.CB.75 | Fe2+Fe3+2(SO4)4 · 14H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Krausite | 7.CC.05 | KFe(SO4)2 · H2O |
| ⓘ | Alum-(K) | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Voltaite | 7.CC.25 | K2Fe2+5Fe3+3Al(SO4)12 · 18H2O |
| ⓘ | Goldichite | 7.CC.40 | KFe(SO4)2 · 4H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Khademite | 7.DB.10 | Al(SO4)F · 5H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| ⓘ | Scordariite (TL) | 7.DF.52 | K8(Fe3+0.67◻0.33)[Fe3+3O(SO4)6]2 · 14H2O |
| ⓘ | Giacovazzoite (TL) | 7.DF.55 | K5Fe3+3O(SO4)6 · 10H2O |
| ⓘ | Magnanelliite (TL) | 7.DF.57 | K3Fe3+2(SO4)4(OH)(H2O)2 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Destinezite | 8.DB.05 | Fe3+2(PO4)(SO4)(OH) · 6H2O |
| ⓘ | Bohuslavite (TL) | 8.DB.42 | Fe3+4(PO4)3(SO4)(OH) · nH2O |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(La) (TL) | 9.BG.05b | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Fluorophlogopite | 9.EC.20 | KMg3(Si3Al)O10F2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Pecoraite | 9.ED.15 | Ni3(Si2O5)(OH)4 |
| ⓘ | Chapmanite | 9.ED.25 | Fe3+2Sb3+(Si2O5)O3(OH) |
| ⓘ | Cymrite | 9.EG.05 | BaAl2Si2(O,OH)8 · H2O |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Group 10 - Organic Compounds | |||
| ⓘ | Weddellite | 10.AB.40 | Ca(C2O4) · (2.5-x)H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Pearceite-T2ac' | - | [Ag6As2S7][Ag9CuS4] |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.)' ? | - | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Dravite-Schorl Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Targionite' (TL) | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bottinoite | Ni2+Sb25+(OH)12 · 6H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| H | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| H | ⓘ Derbylite | Fe43+Ti3Sb3+O13(OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goldichite | KFe(SO4)2 · 4H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Jamborite | Ni2+1-xCox3+(OH)2-x(SO4)x · nH2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Khademite | Al(SO4)F · 5H2O |
| H | ⓘ Krausite | KFe(SO4)2 · H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nesquehonite | MgCO3 · 3H2O |
| H | ⓘ Pecoraite | Ni3(Si2O5)(OH)4 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| H | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| H | ⓘ Weddellite | Ca(C2O4) · (2.5-x)H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Destinezite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| H | ⓘ Graeserite | Fe43+Ti3As3+O13(OH) |
| H | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| H | ⓘ Dravite-Schorl Series | |
| H | ⓘ Bohuslavite | Fe43+(PO4)3(SO4)(OH) · nH2O |
| H | ⓘ Giacovazzoite | K5Fe33+O(SO4)6 · 10H2O |
| H | ⓘ Magnanelliite | K3Fe23+(SO4)4(OH)(H2O)2 |
| H | ⓘ Scordariite | K8(Fe3+0.67◻0.33)[Fe33+O(SO4)6]2 · 14H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Dravite-Schorl Series | |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Nesquehonite | MgCO3 · 3H2O |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Weddellite | Ca(C2O4) · (2.5-x)H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Apuanite | Fe2+Fe43+Sb43+O12S |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Bottinoite | Ni2+Sb25+(OH)12 · 6H2O |
| O | ⓘ Brannerite | UTi2O6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| O | ⓘ Derbylite | Fe43+Ti3Sb3+O13(OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goldichite | KFe(SO4)2 · 4H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Jamborite | Ni2+1-xCox3+(OH)2-x(SO4)x · nH2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Karelianite | V23+O3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Khademite | Al(SO4)F · 5H2O |
| O | ⓘ Krausite | KFe(SO4)2 · H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mannardite | Ba(Ti64+V23+)O16 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nesquehonite | MgCO3 · 3H2O |
| O | ⓘ Pecoraite | Ni3(Si2O5)(OH)4 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| O | ⓘ Stibivanite | Sb2VO5 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Versiliaite | Fe2Fe4Sb6O16S |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| O | ⓘ Weddellite | Ca(C2O4) · (2.5-x)H2O |
| O | ⓘ Zincite | ZnO |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Destinezite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| O | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| O | ⓘ Graeserite | Fe43+Ti3As3+O13(OH) |
| O | ⓘ Scainiite | Pb14Sb30S54O5 |
| O | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| O | ⓘ Dravite-Schorl Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Pillaite | Pb9Sb10S23ClO0.5 |
| O | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| O | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Chovanite | Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| O | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| O | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| O | ⓘ Bohuslavite | Fe43+(PO4)3(SO4)(OH) · nH2O |
| O | ⓘ Giacovazzoite | K5Fe33+O(SO4)6 · 10H2O |
| O | ⓘ Magnanelliite | K3Fe23+(SO4)4(OH)(H2O)2 |
| O | ⓘ Scordariite | K8(Fe3+0.67◻0.33)[Fe33+O(SO4)6]2 · 14H2O |
| O | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Khademite | Al(SO4)F · 5H2O |
| F | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| F | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Dravite-Schorl Series | |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Nesquehonite | MgCO3 · 3H2O |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Mg | ⓘ Dravite-Schorl Series | |
| Mg | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Al | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Khademite | Al(SO4)F · 5H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dravite-Schorl Series | |
| Al | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Pecoraite | Ni3(Si2O5)(OH)4 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Dravite-Schorl Series | |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Destinezite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Bohuslavite | Fe43+(PO4)3(SO4)(OH) · nH2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aktashite | Cu6Hg3As4S12 |
| S | ⓘ Alunogen | Al2(SO4)3 · 17H2O |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Apuanite | Fe2+Fe43+Sb43+O12S |
| S | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pearceite-T2ac | [Ag6As2S7][Ag9CuS4] |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Dadsonite | Pb23Sb25S60Cl |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goldichite | KFe(SO4)2 · 4H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Jamborite | Ni2+1-xCox3+(OH)2-x(SO4)x · nH2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Khademite | Al(SO4)F · 5H2O |
| S | ⓘ Krausite | KFe(SO4)2 · H2O |
| S | ⓘ Laffittite | AgHgAsS3 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Meneghinite | Pb13CuSb7S24 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Parapierrotite | TlSb5S8 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Polhemusite | (Zn,Hg)S |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| S | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Versiliaite | Fe2Fe4Sb6O16S |
| S | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Destinezite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| S | ⓘ Grumiplucite | HgBi2S4 |
| S | ⓘ Scainiite | Pb14Sb30S54O5 |
| S | ⓘ Pillaite | Pb9Sb10S23ClO0.5 |
| S | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| S | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
| S | ⓘ Marrucciite | Hg3Pb16Sb18S46 |
| S | ⓘ Chovanite | Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| S | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| S | ⓘ Metacinnabar var. Leviglianite | (Hg,Zn)S |
| S | ⓘ Protochabournéite | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) |
| S | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| S | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| S | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| S | ⓘ Arsenmarcobaldiite | Pb12(As3.2Sb2.8)Σ6S21 |
| S | ⓘ Bohuslavite | Fe43+(PO4)3(SO4)(OH) · nH2O |
| S | ⓘ Giacovazzoite | K5Fe33+O(SO4)6 · 10H2O |
| S | ⓘ Magnanelliite | K3Fe23+(SO4)4(OH)(H2O)2 |
| S | ⓘ Scordariite | K8(Fe3+0.67◻0.33)[Fe33+O(SO4)6]2 · 14H2O |
| S | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| S | ⓘ Pyradoketosite | Ag3SbS3 |
| S | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| S | ⓘ Proto-owyheeite | Ag9Pb40Sb45S112 |
| S | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Cl | Chlorine | |
| Cl | ⓘ Calomel | [Hg2]2+Cl2 |
| Cl | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Pillaite | Pb9Sb10S23ClO0.5 |
| Cl | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Goldichite | KFe(SO4)2 · 4H2O |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Krausite | KFe(SO4)2 · H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| K | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| K | ⓘ Fluorophlogopite | KMg3(Si3Al)O10F2 |
| K | ⓘ Giacovazzoite | K5Fe33+O(SO4)6 · 10H2O |
| K | ⓘ Magnanelliite | K3Fe23+(SO4)4(OH)(H2O)2 |
| K | ⓘ Scordariite | K8(Fe3+0.67◻0.33)[Fe33+O(SO4)6]2 · 14H2O |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Ca | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Weddellite | Ca(C2O4) · (2.5-x)H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Brannerite | UTi2O6 |
| Ti | ⓘ Derbylite | Fe43+Ti3Sb3+O13(OH) |
| Ti | ⓘ Mannardite | Ba(Ti64+V23+)O16 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Ti | ⓘ Graeserite | Fe43+Ti3As3+O13(OH) |
| Ti | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Ti | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| V | Vanadium | |
| V | ⓘ Karelianite | V23+O3 |
| V | ⓘ Mannardite | Ba(Ti64+V23+)O16 |
| V | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| V | ⓘ Stibivanite | Sb2VO5 |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| Cr | Chromium | |
| Cr | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Mn | Manganese | |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Apuanite | Fe2+Fe43+Sb43+O12S |
| Fe | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Coquimbite | AlFe3(SO4)6(H2O)12 · 6H2O |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Derbylite | Fe43+Ti3Sb3+O13(OH) |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Goldichite | KFe(SO4)2 · 4H2O |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Krausite | KFe(SO4)2 · H2O |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Montroseite | (V3+,Fe3+)O(OH) |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Römerite | Fe2+Fe23+(SO4)4 · 14H2O |
| Fe | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Versiliaite | Fe2Fe4Sb6O16S |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Voltaite | K2Fe52+Fe33+Al(SO4)12 · 18H2O |
| Fe | ⓘ Destinezite | Fe23+(PO4)(SO4)(OH) · 6H2O |
| Fe | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Fe | ⓘ Graeserite | Fe43+Ti3As3+O13(OH) |
| Fe | ⓘ Dravite-Schorl Series | |
| Fe | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Fe | ⓘ Bohuslavite | Fe43+(PO4)3(SO4)(OH) · nH2O |
| Fe | ⓘ Giacovazzoite | K5Fe33+O(SO4)6 · 10H2O |
| Fe | ⓘ Magnanelliite | K3Fe23+(SO4)4(OH)(H2O)2 |
| Fe | ⓘ Scordariite | K8(Fe3+0.67◻0.33)[Fe33+O(SO4)6]2 · 14H2O |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Jamborite | Ni2+1-xCox3+(OH)2-x(SO4)x · nH2O |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ni | ⓘ Bottinoite | Ni2+Sb25+(OH)12 · 6H2O |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Jamborite | Ni2+1-xCox3+(OH)2-x(SO4)x · nH2O |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pecoraite | Ni3(Si2O5)(OH)4 |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Smythite | (Fe,Ni)3+xS4 (x=0-0.3) |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Aktashite | Cu6Hg3As4S12 |
| Cu | ⓘ Pearceite-T2ac | [Ag6As2S7][Ag9CuS4] |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Meneghinite | Pb13CuSb7S24 |
| Cu | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Cu | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| Cu | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
| Cu | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| Cu | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Cu | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Polhemusite | (Zn,Hg)S |
| Zn | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Zn | ⓘ Serpierite | Ca(Cu2+,Zn2+)4(S6+O4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Zincite | ZnO |
| Zn | ⓘ Metacinnabar var. Leviglianite | (Hg,Zn)S |
| As | Arsenic | |
| As | ⓘ Aktashite | Cu6Hg3As4S12 |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Pearceite-T2ac | [Ag6As2S7][Ag9CuS4] |
| As | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Laffittite | AgHgAsS3 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Graeserite | Fe43+Ti3As3+O13(OH) |
| As | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| As | ⓘ Protochabournéite | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) |
| As | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| As | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| As | ⓘ Arsenmarcobaldiite | Pb12(As3.2Sb2.8)Σ6S21 |
| As | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| As | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| Se | Selenium | |
| Se | ⓘ Tiemannite | HgSe |
| Sr | Strontium | |
| Sr | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Sr | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Y | Yttrium | |
| Y | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Y | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Argentopentlandite | Ag(Fe,Ni)8S8 |
| Ag | ⓘ Pearceite-T2ac | [Ag6As2S7][Ag9CuS4] |
| Ag | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Laffittite | AgHgAsS3 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| Ag | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| Ag | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| Ag | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| Ag | ⓘ Pyradoketosite | Ag3SbS3 |
| Ag | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| Ag | ⓘ Proto-owyheeite | Ag9Pb40Sb45S112 |
| Ag | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Apuanite | Fe2+Fe43+Sb43+O12S |
| Sb | ⓘ Bottinoite | Ni2+Sb25+(OH)12 · 6H2O |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Sb | ⓘ Chapmanite | Fe23+Sb3+(Si2O5)O3(OH) |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Sb | ⓘ Derbylite | Fe43+Ti3Sb3+O13(OH) |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Parapierrotite | TlSb5S8 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Sb | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| Sb | ⓘ Stibivanite | Sb2VO5 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Versiliaite | Fe2Fe4Sb6O16S |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Scainiite | Pb14Sb30S54O5 |
| Sb | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Sb | ⓘ Pillaite | Pb9Sb10S23ClO0.5 |
| Sb | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| Sb | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
| Sb | ⓘ Marrucciite | Hg3Pb16Sb18S46 |
| Sb | ⓘ Chovanite | Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| Sb | ⓘ Oxycalcioroméite | Ca2Sb2O6O |
| Sb | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Sb | ⓘ Protochabournéite | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) |
| Sb | ⓘ Ferdowsiite | Ag8(Sb5As3)S16 |
| Sb | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| Sb | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| Sb | ⓘ Arsenmarcobaldiite | Pb12(As3.2Sb2.8)Σ6S21 |
| Sb | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Sb | ⓘ Pyradoketosite | Ag3SbS3 |
| Sb | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| Sb | ⓘ Proto-owyheeite | Ag9Pb40Sb45S112 |
| Sb | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Te | Tellurium | |
| Te | ⓘ Coloradoite | HgTe |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Mannardite | Ba(Ti64+V23+)O16 |
| Ba | ⓘ Bianchiniite | Ba2(TiV)(As2O5)2OF |
| La | Lanthanum | |
| La | ⓘ Allanite-(La) | (CaLa)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Pyrochlore Supergroup var. Stibiobetafite (of Černý et al.) | (Ca,Sb3+)2(Ti,Nb,Ta)2(O,OH)7 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Aktashite | Cu6Hg3As4S12 |
| Hg | ⓘ Calomel | [Hg2]2+Cl2 |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Coloradoite | HgTe |
| Hg | ⓘ Laffittite | AgHgAsS3 |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Polhemusite | (Zn,Hg)S |
| Hg | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Hg | ⓘ Tiemannite | HgSe |
| Hg | ⓘ Grumiplucite | HgBi2S4 |
| Hg | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
| Hg | ⓘ Marrucciite | Hg3Pb16Sb18S46 |
| Hg | ⓘ Metacinnabar var. Leviglianite | (Hg,Zn)S |
| Hg | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| Hg | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| Hg | ⓘ Tetrahedrite-(Hg) | Cu6(Cu4Hg2)Sb4S12S |
| Hg | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Tl | Thallium | |
| Tl | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Tl | ⓘ Parapierrotite | TlSb5S8 |
| Tl | ⓘ Routhierite | Tl(Cu,Ag)(Hg,Zn)2(As,Sb)2S6 |
| Tl | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Tl | ⓘ Protochabournéite | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) |
| Tl | ⓘ Arsiccioite | AgHg2Tl(As,Sb)2S6 |
| Tl | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Chabournéite | AgzTl8-x-zPb4+2xSb40-x-yAsyS68 with 0.00 < x < 0.40(9), 16.15(3)< y < 19.11(10), 0.04(4) < z < 0.11(6) |
| Pb | ⓘ Dadsonite | Pb23Sb25S60Cl |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Meneghinite | Pb13CuSb7S24 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Pb | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| Pb | ⓘ Scainiite | Pb14Sb30S54O5 |
| Pb | ⓘ Pillaite | Pb9Sb10S23ClO0.5 |
| Pb | ⓘ Pellouxite | (Cu,Ag)Pb10Sb12S27O(Cl,S)0.6 |
| Pb | ⓘ Rouxelite | Cu2HgPb23Sb27S65.5 |
| Pb | ⓘ Marrucciite | Hg3Pb16Sb18S46 |
| Pb | ⓘ Chovanite | Pb15-2xSb14+2xS36Ox (x ~ 0.2) |
| Pb | ⓘ Boscardinite | TlPb4(Sb7As2)S18 |
| Pb | ⓘ Protochabournéite | Tl4-xPb2+2xSb20-x-yAsyS34 with 0.02(2) |
| Pb | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
| Pb | ⓘ Andreadiniite | CuHgAg7Pb7Sb24S48 |
| Pb | ⓘ Arsenmarcobaldiite | Pb12(As3.2Sb2.8)Σ6S21 |
| Pb | ⓘ Dewitite | AgzTl10-x-zPb2xSb42-x-yAsyS68 |
| Pb | ⓘ Proto-owyheeite | Ag9Pb40Sb45S112 |
| Pb | ⓘ Lechnerite | Ag10Cu4HgPb33Sb58S128 |
| Bi | Bismuth | |
| Bi | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Bi | ⓘ Grumiplucite | HgBi2S4 |
| U | Uranium | |
| U | ⓘ Brannerite | UTi2O6 |
| U | ⓘ Dessauite-(Y) | (Sr,Pb)(Y,U)(Ti,Fe3+)20O38 |
| U | ⓘ Mapiquiroite | (Sr,Pb)(U,Y)Fe2(Ti,Fe3+,Cr3+)18O38 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Stazzema |
|---|---|
| Wikidata ID: | Q221277 |
| GeoNames ID: | 6540268 |
Localities in this Region
- Tuscany
- Lucca Province
- Tuscany
- Lucca Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Apennine Mountains (Apennines; Apennine Orogen)Accretionary Complex
EuropeContinent
Italy
- Tuscany
- Apuan AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Canale della Radice mines, Calcaferro, Mulina, Stazzema, Lucca Province, Tuscany, Italy