Log In
Okanogan County, Washington, USAi
| Regional Level Types | |
|---|---|
| Okanogan County | County |
| Washington | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
Neighbouring regions:
Type:
Other Languages:
French:
comté d'Okanogan, Washington, États-Unis
German:
Okanogan County, Washington, Vereinigte Staaten
Italian:
contea di Okanogan, Washington, Stati Uniti d'America
Russian:
Оканоган, Вашингтон, Соединённые Штаты Америки
Simplified Chinese:
奧卡諾根縣, 华盛顿州, 美国
Spanish:
Condado de Okanogan, Washington, Estados Unidos
Albanian:
Okanogan County, Uashington, Shtetet e Bashkuara të Amerikës
Arabic:
مقاطعة أوكانوغان, واشنطن, الولايات المتحدة
Basque:
Okanogan konderria , Washington
Bavarian:
Okanogan County, Washington, Vaoanigte Stootn
Bishnupriya Manipuri:
ওকানোগান কাউন্টি, ৱাশিংটন, তিলপারাষ্ট্র
Bulgarian:
Оканоган, Вашингтон, Съединени американски щати
Cebuano:
Okanogan County, Washington
Czech:
Okanogan County, Washington, Spojené státy americké
Dutch:
Okanogan County, Washington, Verenigde Staten
Esperanto:
Kantono Okanogan, Vaŝingtonio
Estonian:
Okanogani maakond, Washingtoni osariik, Ameerika Ühendriigid
Farsi/Persian:
شهرستان اوکانوگان، واشینگتن, واشینگتن, ایالات متحده آمریکا
Georgian:
ოკანოგანის ოლქი, ვაშინგტონის შტატი, ამერიკის შეერთებული შტატები
Hebrew:
מחוז אוקאנוגאן, וושינגטון, ארצות הברית
Hungarian:
Okanogan megye, Washington, Amerikai Egyesült Államok
Japanese:
オウカノガン郡, ワシントン州, アメリカ合衆国
Low Saxon/Low German:
Okanogan County, Washington, USA
Min Dong Chinese:
Okanogan Gông, Washington
Minnan / Hokkien-Taiwanese:
Okanogan Kūn
Norwegian:
Okanogan County, Washington, USA
Polish:
Hrabstwo Okanogan, Waszyngton, Stany Zjednoczone
Portuguese:
Condado de Okanogan, Washington, Estados Unidos
Romanian:
Comitatul Okanogan, Washington, Statele Unite ale Americii
Sardinian:
contea de Okanogan, Washington, Istados Unidos de Amèrica
Serbian:
Okanogan County, Вашингтон, Сједињене Америчке Државе
Serbo-Croatian:
Okanogan County, Washington, Sjedinjene Američke Države
Swedish:
Okanogan County, Washington, USA
Traditional Chinese:
奧卡諾根縣, 華盛頓州, 美國
Turkish:
Okanogan, Washington, Amerika Birleşik Devletleri
Ukrainian:
Оканоґан, Вашингтон, Сполучені Штати Америки
Urdu:
اوکاناگن کاؤنٹی، واشنگٹن, ریاست واشنگٹن, ریاستہائے متحدہ امریکا
Vietnamese:
Quận Okanogan, Washington, Chủng Quốc Hoa Kỳ
Waray:
Condado han Okanogan, Washington, Estados Unidos
Western Punjabi:
اوکانوگن کاؤنٹی, واشنگٹن, امریکہ
Note: The mining districts of this county are poorly defined, but are mainly based off of Landes (1902) and Lasmanis (1990)
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities187 valid minerals. 4 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Reported from at least 24 localities in this region. Habit: waxy coatings |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 Localities: Habit: needles and bluntly terminated prisms Colour: green to black |
| ⓘ Aenigmatite Formula: Na4[Fe2+10Ti2]O4[Si12O36] Habit: tiny grains Description: Occurs in the satellite dikes derived from the Golden Horn Granite
|
| ⓘ Agardite-(Y) Formula: YCu6(AsO4)3(OH)6 · 3H2O Habit: asicular crystals Colour: greenish blue Description: only a few specimens have been found. They are from a small pegmatite and formed from secondary sulfide alteration. |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 6 localities in this region. |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Habit: square tabular crystals Colour: black |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Colour: red |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Anatase Formula: TiO2 Colour: dark grey to black Description: Found in one area
|
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Buckhorn Mine, Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Ellenham Mtn area, Nighthawk Mining District, Okanogan County, Washington, USA Dutch John Prospect, Methow Mining District, Okanogan County, Washington, USA Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA |
| ⓘ Andradite var. Melanite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ 'Andradite-Grossular Series' |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O Localities: Habit: crusts Colour: bright green |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 References: |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 Localities: Habit: large prisms to 6cm; rock forming masses Colour: Black |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 29 localities in this region. |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F Habit: hairlike groups, broad single blades, and radial groups to 1.5" long Colour: Bronze |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ✪ Bastnäsite-(Ce) Formula: Ce(CO3)F Habit: hexagonal tablets and prisms Colour: pink, red, reddish-orange Description: crystals are uncommon and often are Bastnäsite-(Ce)/Synchysite intergrowths |
| ⓘ 'Bastnäsite Group' Formula: M(CO3)X where M = REE, Th and X = F or OH References: |
| ⓘ Beryl ? Formula: Be3Al2(Si6O18) Colour: Varity aquamarine Description: 2 crystals reported to have been found References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Biotite var. Oxybiotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 23 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 References: |
| ⓘ Brannockite Formula: K◻2Sn2Li3[Si12O30] Description: Zr-, Ti-, Hf-, Fe+Al- and Na- substitution. References: |
| ⓘ Bromargyrite Formula: AgBr |
| ⓘ Burkeite Formula: Na6(CO3)(SO4)2 References: |
| ⓘ Calaverite Formula: AuTe2 References: |
| ⓘ Calciocatapleiite Formula: CaZr(Si3O9) · 2H2O Habit: thin Disc like crystals to 2mm across Colour: milky white References: |
| ⓘ Calciohilairite (TL) Formula: CaZr[SiO3]3 · 3H2O Localities: Habit: blocky teragonal prisms Colour: bluish to chalky white |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 61 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 Localities: Hidden Treasure and Ramsey Prospect, Nespelem Mining District, Okanogan County, Washington, USA Fuller Mine, Methow Mining District, Okanogan County, Washington, USA Gold Quarry Claims, Conconully Mining District, Okanogan County, Washington, USA Goodenuf Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 Localities: Hidden Treasure and Ramsey Prospect, Nespelem Mining District, Okanogan County, Washington, USA Fuller Mine, Methow Mining District, Okanogan County, Washington, USA Gold Quarry Claims, Conconully Mining District, Okanogan County, Washington, USA Goodenuf Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 Description: Bart Cannon ID of specimens field collected by Elwin Magill around 1965. References: Bart Cannon specimens and labelsIdentification: Dealer/Collection Label |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O Habit: large crusts Colour: pale blue References: |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 16 localities in this region. |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 192 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 Habit: druses and hexagonal prisms Colour: green to golden Brown |
| ⓘ Chevkinite-(Ce) Formula: Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 Habit: rounded to flattened prisms Colour: black Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass |
| ⓘ 'Chevkinite Group' |
| ⓘ Chlorargyrite Formula: AgCl Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 8 localities in this region. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 Habit: anhedral grains References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 9 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA Jones Prospect, Chewuch Mining District, Okanogan County, Washington, USA Mazama Porphyry, Mazama Mining District, Okanogan County, Washington, USA Ohio Prospect, Oroville Mining District, Okanogan County, Washington, USA Kelsey Prospect, Oroville Mining District, Okanogan County, Washington, USA Description: this list encompasses several different environments of the Golden Horn Batholith at Washington Pass |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore ? Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore ? Formula: Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ Clinofergusonite-(Y) Formula: YNbO4 Habit: blocky to prismatic crystals Colour: tan to brown Description: Found in the border granite of Liberty Bell |
| ⓘ 'Clinoptilolite Subgroup' Formula: (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O References: |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Coquandite (TL) Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) Type Locality: |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Habit: knots of anhedral cordierite Description: in schist References: |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O Localities: Ruby deposit, Palmer Mountain Mining District, Okanogan County, Washington, USA Ruby Mine, Nighthawk Mining District, Okanogan County, Washington, USA Moncosilgo Prospect, Oroville Mining District, Okanogan County, Washington, USA Last Chance Mine, Ruby Hill, Conconully Mining District, Okanogan County, Washington, USA |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 Habit: granular masses Colour: white to pink References: |
| ⓘ Elpidite Formula: Na2ZrSi6O15 · 3H2O |
| ⓘ Elpidite var. Calcium-bearing Elpidite Formula: (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 33 localities in this region. |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Localities: Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Wannacut Lake, Wannacut Lake Mining District, Okanogan County, Washington, USA Poison Lake, Wannacut Lake Mining District, Okanogan County, Washington, USA Bitter Lake, Oroville Mining District, Okanogan County, Washington, USA Okanogan County, Washington, USA |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ Fayalite Formula: Fe2+2(SiO4) References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' |
| ⓘ 'Fergusonite' |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 References: |
| ⓘ Ferro-richterite Formula: Na(CaNa)Fe2+5(Si8O22)(OH)2 References: |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 15 localities in this region. |
| ⓘ ' Formula: (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F Locality: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA - erroneously reported |
| ⓘ 'Gadolinite' |
| ⓘ Gadolinite-(Ce) Formula: (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Habit: squarish and diamond shaped prisms Colour: clear to white |
| ⓘ 'Gagarinite' |
| ⓘ Gagarinite-(Y) Formula: NaCaYF6 Habit: elongated Prisms Colour: colorless, white to pale pink |
| ⓘ Galena Formula: PbS Localities: Reported from at least 135 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Galenobismutite Formula: PbBi2S4 References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 25 localities in this region. |
| ⓘ 'Garnierite' |
| ⓘ Gaylussite Formula: Na2Ca(CO3)2 · 5H2O References: |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S |
| ⓘ 'Genthite' |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Habit: pseudomorphs Colour: brown to black Description: Commonly found as pseudomorphs after arfedsonite and siderite. One Cavity that produced pseudomorphs after Zektzerite has been found. |
| ⓘ Graphite Formula: C Localities: Hoot Owl Deposit, Park City Mining District, Okanogan County, Washington, USA Tonasket Graphite Occurrence, Oroville Mining District, Okanogan County, Washington, USA American Graphite Mine, Park City Mining District, Okanogan County, Washington, USA Wyandotte Mine, Nighthawk Mining District, Okanogan County, Washington, USA ? (more information) |
| ⓘ Greenalite Formula: (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Minnie Mine, Methow Mining District, Okanogan County, Washington, USA Okanogan County, Washington, USA Bitter Lake, Oroville Mining District, Okanogan County, Washington, USA Poison Lake, Wannacut Lake Mining District, Okanogan County, Washington, USA Lenton Flat, Nighthawk Mining District, Okanogan County, Washington, USA |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl References: |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 Localities: Washington Pass, Golden Horn Batholith, Okanogan County, Washington, USA Kruger Mountain, Oroville Mining District, Okanogan County, Washington, USA Salmon Creek Area, Conconully Mining District, Okanogan County, Washington, USA Ellenham Mtn area, Nighthawk Mining District, Okanogan County, Washington, USA |
| ⓘ Hastingsite var. Alkali-ferrohastingsite Formula: {Na}{Ca2}{Fe2+4Fe3+}(Al2Si6O22)(OH)2 References: |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hedleyite Formula: Bi7Te3 |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 15 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hexahydrite Formula: Mg(H2O)6(SO4) |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydromagnesite Formula: Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ 'Joséite' Formula: Bi4TeS2 |
| ⓘ Joséite-A Formula: Bi4TeS2 |
| ⓘ Joséite-B Formula: Bi4Te2S |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O References: |
| ⓘ 'Limonite' Localities: Reported from at least 32 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Löllingite Formula: FeAs2 Habit: blebs and crude crystals Colour: metalic silvery white |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 37 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 46 localities in this region. |
| ⓘ 'Manganese Oxides' Localities: Moneymaker Prospect, Park City Mining District, Okanogan County, Washington, USA Bonanza Claim, Park City Mining District, Okanogan County, Washington, USA Home Run Prospect, Nespelem Mining District, Okanogan County, Washington, USA Modoc Prospect, Nespelem Mining District, Okanogan County, Washington, USA Goodenuf Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 |
| ⓘ 'Mica Group' Localities: Reported from at least 9 localities in this region. |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl References: |
| ⓘ Minnesotaite Formula: Fe2+3Si4O10(OH)2 |
| ⓘ Mirabilite Formula: Na2SO4 · 10H2O |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 46 localities in this region. |
| ⓘ Molybdite Formula: MoO3 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Habit: tabular crystals Colour: orange to brown |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mordenite Formula: (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Mariposite Formula: K(Al,Cr)2(Al,Si)4O10(OH)2 |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 20 localities in this region. |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Localities: Reported from at least 70 localities in this region. |
| ⓘ Native Platinum Formula: Pt Localities: Okanogan Prospect, Malott Mining District, Okanogan County, Washington, USA Similkameen River Placers, Oroville Mining District, Okanogan County, Washington, USA Slate Creek Placer, Oroville Mining District, Okanogan County, Washington, USA Riverside placer, Conconully Mining District, Okanogan County, Washington, USA |
| ⓘ Native Silver Formula: Ag Localities: Reported from at least 14 localities in this region. |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Natron Formula: Na2CO3 · 10H2O References: |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) |
| ⓘ Okanoganite-(Y) (TL) Formula: (Na,Ca)3(Y,Ce)12Si6B2O27F14 Localities: Habit: tetrahedra Colour: white to reddish orange |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 References: |
| ⓘ Opal Formula: SiO2 · nH2O References: |
| ⓘ Opal var. Hyalite Formula: SiO2 · nH2O Description: Thin crusts, with bright green fluorescence under SW UV, on microcline crystals. References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Petzite Formula: Ag3AuTe2 References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Habit: crusts Description: Found as an alteration product on lollingite References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Polylithionite Formula: KLi2Al(Si4O10)(F,OH)2 Habit: rounded platey crystals to crystaline aggregates. Colour: colorless to silvery white |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 References: |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: Reported from at least 14 localities in this region. |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 248 localities in this region. |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n References: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 44 localities in this region. |
| ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite Formula: (Fe,Ni)7S8 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 259 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: Eli Hess CollectionIdentified by Aidan Cerenzie: Visual Identification, Dealer/Collection Label |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rutilated Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Pogue Flat Mine, Okanogan County, Washington, USA Anchor Claims, Nespelem Mining District, Okanogan County, Washington, USA Silver Cliff Mine, Nespelem Mining District, Okanogan County, Washington, USA Apache Mine, Nespelem Mining District, Okanogan County, Washington, USA St. Paul Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Riebeckite Formula: ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 37 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Habit: crusts Description: Found as crusts on altered lollingite crystals |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siderite var. Sphärosiderite Formula: FeCO3 References: Aidan Cerenzie CollectionIdentified by Aidan Cerenzie: Visual Identification |
| ⓘ Sogdianite Formula: K◻2Zr2Li3[Si12O30] Habit: massive Colour: purple-pink Description: intergrowths with zektzeite
|
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 102 localities in this region. |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stephanite Formula: Ag5SbS4 Localities: Reported from at least 16 localities in this region. |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Stilpnomelane Formula: K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ Stilpnomelane var. Ekmanite Formula: K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Stützite ? Formula: Ag5-xTe3, x = 0.24-0.36 References: |
| ⓘ Sulphotsumoite Formula: Bi3Te2S |
| ⓘ Sylvanite ? Formula: AgAuTe4 |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F References: |
| ⓘ 'Synchysite Group' References: |
| ⓘ Synchysite-(Y) Formula: CaY(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Mount Kobau Area, Okanogan County, Washington, USA Copper World Extension Mine, Palmer Mountain Mining District, Okanogan County, Washington, USA Eureka Prospect, Park City Mining District, Okanogan County, Washington, USA Johnson Creek Mine, Conconully Mining District, Okanogan County, Washington, USA |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 41 localities in this region. |
| ⓘ Thalénite-(Y) Formula: Y3Si3O10F |
| ⓘ Thénardite Formula: Na2SO4 References: |
| ⓘ Thermonatrite Formula: Na2CO3 · H2O References: |
| ⓘ Thorianite Formula: ThO2 References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Trona Formula: Na3H(CO3)2 · 2H2O References: |
| ⓘ Tsumoite Formula: BiTe |
| ⓘ Tungstite Formula: WO3 · H2O |
| ⓘ Valentinite Formula: Sb2O3 Description: Bart Cannon ID of specimens field collected by Elwin Magill around 1965. References: Bart Cannon specimens and labelsIdentification: Dealer/Collection Label |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 Localities: Hidden Treasure and Ramsey Prospect, Nespelem Mining District, Okanogan County, Washington, USA Evening Prospect, Nespelem Mining District, Okanogan County, Washington, USA Controller and Red Bird Prospect, Nespelem Mining District, Okanogan County, Washington, USA Great Western Mine, Nespelem Mining District, Okanogan County, Washington, USA Rebecca Prospect, Nespelem Mining District, Okanogan County, Washington, USA |
| ⓘ 'Wolframite Group' Localities: Whistler Lode, Chewuch Mining District, Okanogan County, Washington, USA Wolframite Tungsten Claims, Chewuch Mining District, Okanogan County, Washington, USA Last Chance Prospect, Chewuch Mining District, Okanogan County, Washington, USA Hatfield Mine, Chewuch Mining District, Okanogan County, Washington, USA |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) Habit: rounded stick like crystals Description: found only a few cavities in one pegmatite. |
| ⓘ Xenotime-(Y) Formula: Y(PO4) References: |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zaratite Formula: Ni3(CO3)(OH)4 · 4H2O ? |
| ✪ Zektzerite (TL) Formula: LiNaZrSi6O15 Type Locality: Habit: pseudohexagonal to tabular orthorombic crsytals Colour: colorless, white, pink, orange-tan References: Dunn, Pete J., Rouse, Roland C., Cannon, Bart, Nelen, Joseph A. (1977) Zektzerite, a new lithium sodium zirconium silicate related to tuhualite and the osumilite group. American Mineralogist, 62 (5-6) 416-420 |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Habit: tetragonal prisms, bipyrmidal crystals. Colour: grey-green, yellow to orange-red |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Buckhorn Mine, Southwest Zone and Gold Bowl (Crown Jewel) Zone, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA Abernathy Prospect, Twisp Mining District, Okanogan County, Washington, USA Tunk Creek, Okanogan County, Washington, USA Roosevelt Mine, Buckhorn Mountain, Myer Creek Mining District, Okanogan County, Washington, USA ? (more information) |
| ⓘ Zoisite var. Thulite Formula: (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Platinum | 1.AF.10 | Pt |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Stützite ? | 2.BA.65 | Ag5-xTe3, x = 0.24-0.36 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | var. Nickel-bearing Pyrrhotite | 2.CC.10 | (Fe,Ni)7S8 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Hedleyite | 2.DC.05 | Bi7Te3 |
| ⓘ | 'Joséite' | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-A | 2.DC.05 | Bi4TeS2 |
| ⓘ | Joséite-B | 2.DC.05 | Bi4Te2S |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Sulphotsumoite | 2.DC.05 | Bi3Te2S |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Sylvanite ? | 2.EA.05 | AgAuTe4 |
| ⓘ | Calaverite | 2.EA.10 | AuTe2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| Group 3 - Halides | |||
| ⓘ | Bromargyrite | 3.AA.15 | AgBr |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Gagarinite-(Y) | 3.AB.35 | NaCaYF6 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rutilated Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | var. Hyalite | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Clinofergusonite-(Y) | 4.DG.10 | YNbO4 |
| ⓘ | 'Fluorplumbopyrochlore' ? | 4.DH.15 | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Thorianite | 4.DL.05 | ThO2 |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | var. Sphärosiderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Synchysite-(Y) | 5.BD.20c | CaY(CO3)2F |
| ⓘ | Thermonatrite | 5.CB.05 | Na2CO3 · H2O |
| ⓘ | Natron | 5.CB.10 | Na2CO3 · 10H2O |
| ⓘ | Trona | 5.CB.15 | Na3H(CO3)2 · 2H2O |
| ⓘ | Gaylussite | 5.CB.35 | Na2Ca(CO3)2 · 5H2O |
| ⓘ | Hydromagnesite | 5.DA.05 | Mg5(CO3)4(OH)2 · 4H2O |
| ⓘ | Zaratite | 5.DA.15 | Ni3(CO3)(OH)4 · 4H2O ? |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Thénardite | 7.AD.25 | Na2SO4 |
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Burkeite | 7.BD.25 | Na6(CO3)(SO4)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Hexahydrite | 7.CB.25 | Mg(H2O)6(SO4) |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Mirabilite | 7.CD.10 | Na2SO4 · 10H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Coquandite (TL) | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Agardite-(Y) | 8.DL.15 | YCu6(AsO4)3(OH)6 · 3H2O |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andradite var. Melanite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Gadolinite-(Ce) | 9.AJ.20 | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Okanoganite-(Y) (TL) | 9.AJ.35 | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Thalénite-(Y) | 9.BJ.20 | Y3Si3O10F |
| ⓘ | Calciocatapleiite | 9.CA.15 | CaZr(Si3O9) · 2H2O |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Beryl ? | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Brannockite | 9.CM.05 | K◻2Sn2Li3[Si12O30] |
| ⓘ | Sogdianite | 9.CM.05 | K◻2Zr2Li3[Si12O30] |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Hastingsite var. Alkali-ferrohastingsite | 9.DE.15 | {Na}{Ca2}{Fe2+4Fe3+}(Al2Si6O22)(OH)2 |
| ⓘ | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 | |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Ferro-richterite | 9.DE.20 | Na(CaNa)Fe2+5(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Elpidite | 9.DG.65 | Na2ZrSi6O15 · 3H2O |
| ⓘ | var. Calcium-bearing Elpidite | 9.DG.65 | (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ | Aenigmatite | 9.DH.40 | Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Calciohilairite (TL) | 9.DM.10 | CaZr[SiO3]3 · 3H2O |
| ⓘ | Zektzerite (TL) | 9.DN.05 | LiNaZrSi6O15 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Minnesotaite | 9.EC.05 | Fe2+3Si4O10(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Mariposite | 9.EC.15 | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore ? | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore ? | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | var. Ekmanite | 9.EG.40 | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Mordenite | 9.GD.35 | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clinoptilolite Subgroup' | - | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Andradite-Grossular Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Garnierite' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Genthite' | - | |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Biotite var. Oxybiotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Synchysite Group' | - | |
| ⓘ | 'Chevkinite Group' | - | |
| ⓘ | 'Bastnäsite Group' | - | M(CO3)X where M = REE, Th and X = F or OH |
| ⓘ | 'Gagarinite' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| H | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| H | ⓘ Mirabilite | Na2SO4 · 10H2O |
| H | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natron | Na2CO3 · 10H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thermonatrite | Na2CO3 · H2O |
| H | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| H | ⓘ Tungstite | WO3 · H2O |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| H | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| H | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Li | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Li | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Li | ⓘ Zektzerite | LiNaZrSi6O15 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| B | Boron | |
| B | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Natron | Na2CO3 · 10H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| C | ⓘ Thermonatrite | Na2CO3 · H2O |
| C | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| C | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| C | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| C | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| O | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| O | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Clinofergusonite-(Y) | YNbO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| O | ⓘ Mirabilite | Na2SO4 · 10H2O |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natron | Na2CO3 · 10H2O |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Thalénite-(Y) | Y3Si3O10F |
| O | ⓘ Thénardite | Na2SO4 |
| O | ⓘ Thermonatrite | Na2CO3 · H2O |
| O | ⓘ Thorianite | ThO2 |
| O | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| O | ⓘ Zektzerite | LiNaZrSi6O15 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| O | ⓘ Andradite var. Melanite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Andradite-Grossular Series | |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| O | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| O | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| O | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gagarinite-(Y) | NaCaYF6 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| F | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| F | ⓘ Thalénite-(Y) | Y3Si3O10F |
| F | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| F | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Na | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| Na | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Na | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Na | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Mirabilite | Na2SO4 · 10H2O |
| Na | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natron | Na2CO3 · 10H2O |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Thénardite | Na2SO4 |
| Na | ⓘ Thermonatrite | Na2CO3 · H2O |
| Na | ⓘ Trona | Na3H(CO3)2 · 2H2O |
| Na | ⓘ Zektzerite | LiNaZrSi6O15 |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Na | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| Mg | ⓘ Hydromagnesite | Mg5(CO3)4(OH)2 · 4H2O |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Al | ⓘ Andradite-Grossular Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Al | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Si | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Si | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Si | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Rutilated Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Si | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zektzerite | LiNaZrSi6O15 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Si | ⓘ Andradite var. Melanite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Andradite-Grossular Series | |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Opal var. Hyalite | SiO2 · nH2O |
| Si | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Burkeite | Na6(CO3)(SO4)2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Covellite | CuS |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hexahydrite | Mg(H2O)6(SO4) |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Joséite | Bi4TeS2 |
| S | ⓘ Joséite-A | Bi4TeS2 |
| S | ⓘ Joséite-B | Bi4Te2S |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mirabilite | Na2SO4 · 10H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Sulphotsumoite | Bi3Te2S |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thénardite | Na2SO4 |
| S | ⓘ Yarrowite | Cu9S8 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| K | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| K | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Ca | ⓘ Clinoptilolite Subgroup | (Na/Ca/K)3-6[Al6-7Si29-30O72] · 20H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Ca | ⓘ Gaylussite | Na2Ca(CO3)2 · 5H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Mordenite | (Na2,Ca,K2)4(Al8Si40)O96 · 28H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| Ca | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Andradite var. Melanite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Andradite-Grossular Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Ca | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Ti | Titanium | |
| Ti | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Muscovite var. Mariposite | K(Al,Cr)2(Al,Si)4O10(OH)2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Zoisite var. Thulite | (Ca2)(Al,Mn3+)3(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Fe | ⓘ Hastingsite var. Alkali-ferrohastingsite | {Na}{Ca2}{Fe42+Fe3+}(Al2Si6O22)(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Ferro-richterite | Na(CaNa)Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Minnesotaite | Fe32+Si4O10(OH)2 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Siderite var. Sphärosiderite | FeCO3 |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Stilpnomelane var. Ekmanite | K4(Fe2+,Mn)48[Si64Al8]O1664(OH)52 · nH2O |
| Fe | ⓘ Andradite var. Melanite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Andradite-Grossular Series | |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Fe | ⓘ Biotite var. Oxybiotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Zaratite | Ni3(CO3)(OH)4 · 4H2O ? |
| Ni | ⓘ Pyrrhotite var. Nickel-bearing Pyrrhotite | (Fe,Ni)7S8 |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Zn | Zinc | |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Br | Bromine | |
| Br | ⓘ Bromargyrite | AgBr |
| Y | Yttrium | |
| Y | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Y | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Y | ⓘ Synchysite-(Y) | CaY(CO3)2F |
| Y | ⓘ Thalénite-(Y) | Y3Si3O10F |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Zr | Zirconium | |
| Zr | ⓘ Calciohilairite | CaZr[SiO3]3 · 3H2O |
| Zr | ⓘ Calciocatapleiite | CaZr(Si3O9) · 2H2O |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Sogdianite | K◻2Zr2Li3[Si12O30] |
| Zr | ⓘ Zektzerite | LiNaZrSi6O15 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Clinofergusonite-(Y) | YNbO4 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Bromargyrite | AgBr |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Brannockite | K◻2Sn2Li3[Si12O30] |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Te | Tellurium | |
| Te | ⓘ Calaverite | AuTe2 |
| Te | ⓘ Hedleyite | Bi7Te3 |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Joséite | Bi4TeS2 |
| Te | ⓘ Joséite-A | Bi4TeS2 |
| Te | ⓘ Joséite-B | Bi4Te2S |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Te | ⓘ Stützite | Ag5-xTe3, x = 0.24-0.36 |
| Te | ⓘ Sulphotsumoite | Bi3Te2S |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Te | ⓘ Tsumoite | BiTe |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| La | Lanthanum | |
| La | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Pt | Platinum | |
| Pt | ⓘ Native Platinum | Pt |
| Au | Gold | |
| Au | ⓘ Calaverite | AuTe2 |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Hedleyite | Bi7Te3 |
| Bi | ⓘ Joséite | Bi4TeS2 |
| Bi | ⓘ Joséite-A | Bi4TeS2 |
| Bi | ⓘ Joséite-B | Bi4Te2S |
| Bi | ⓘ Pilsenite | Bi4Te3 |
| Bi | ⓘ Sulphotsumoite | Bi3Te2S |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Tsumoite | BiTe |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorianite | ThO2 |
| Th | ⓘ Bastnäsite Group | M(CO3)X where M = REE, Th and X = F or OH |
| Th | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Fluorplumbopyrochlore | (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F |
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 41.3 Ma (Eocene) | ||||||
| Oldest Fossil Listed | 47.8 Ma (Eocene) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Okanogan_County,_Washington |
|---|---|
| Wikidata ID: | Q483958 |
| GeoNames ID: | 5805553 |
Localities in this Region
- Washington
- Okanogan County
- Arizona
- Barber Mountain
- Brown Lake Prospect
- Calumet Claim
- Cathinn Creek Valley Cordierite Occurrence
- Chewuch Mining District
- Chief Jo Mine
- Conconully Mining District
- Corson Prospect
- Crawfish Lake Area
- Evans Lake
- Gold Ridge Prospect
- Golden Horn Batholith
- Hidden Lakes Mining District
- Hopkins Placer
- Lucky Knock Mine
- Malott Mining District
- Manuel Prospect
- Mazama Mining District
- Methow Mining District
- Mount Kobau Area
- Murray Placer
- Myer Creek Mining District
- Okanogan County
- Washington
- Okanogan County
- Nespelem gemstone
- Nespelem Mining District
- Nespelem Silica Co.
- Nighthawk Mining District
- Okanogan River Placers
- Oroville Brick Yard
- Oroville Mining District
- Palmer Mountain Mining District
- Palmer Prospect
- Park City Mining District
- Pogue Flat Mine
- Prince Prospect
- Pthomigan Prospect
- Radar Mountain Roadcuts
- Russia Prospect
- St. John Lake
- Stirling Claim
- Tonasket Chromium Prospect
- Tonasket Meionite Occurrence
- Tonasket Mining District
- Tunk Creek
- Twisp Mining District
- Wannacut Lake Mining District
- Wauconda Mining District
- Okanogan County
Other Regions, Features and Areas that Intersect
North AmericaContinent
- Cascade RangeMountain Range
- Columbia MountainsMountain Range
North America PlateTectonic Plate
- Cascade ArcVolcanic Arc
- Franciscan DomainDomain
- Kootenay ArcDomain
- MethowAccretionary Complex
- Okanagan TerraneOphiolite Complex
- Okanogan DomainDomain
- Pend Oreille DomainDomain
- QuesnelliaVolcanic Arc
- Western Quesnellia DomainDomain
USA
- Washington
- Okanogan County
- Pasayten WildernessWilderness Area
- Whatcom County
- Pasayten WildernessWilderness Area
- Okanogan County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Okanogan County, Washington, USA