Log In
Yinnietharra, Upper Gascoyne Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Yinnietharra | Station (farming) |
| Upper Gascoyne Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
24° 39' 21'' South , 116° 9' 51'' East
Latitude & Longitude (decimal):
Type:
Station (farming) - last checked 2020
Köppen climate type:
Other/historical names associated with this locality:
Yinnietharra Station; Yinnetharra Station
A large cattle station approximately 204,341 hectares (2,043 sq.km) with some complex Precambrian high-grade metamorphic rocks, including pegmatites, corundum and tourmaline deposits.
This pegmatite and mineral deposit field is 165 kilometres by dirt road from Carnarvon. While most are on Yinnietharra Station, some of the outlying deposits are found on neighbouring Mt Phillip, Eudamulla, Bidgemia, and Mooloo Downs Stations. There are around twenty major named sites for minerals in the region, although the total list would be far longer. A four-wheel-drive vehicle is essential, as well as being self-sufficient, as the region is arid, lacks fresh water, and is remote.
Mining for muscovite used in the electrical industry occurred on Yinnietharra station at several sites between 1922 and 1946, beryl and columbite from 1942 to 1965, and gem specimen mining after this till around 1990. Minor rare earth, uranium bearing and lithium minerals are present but have never been mined to any extent. No mining on the field has been large scale.
The Gascoyne Complex is a deformed Archaean basement, with younger sediments deposited on top of it. It was deformed by the collision of the Yilgarn and Pilbara Cratons. These rocks were metamorphosed to gneisses, schists and migmatites, forming slightly younger granites that intruded into the sequence. The rocks were subject to 630-770 degrees Celsius, and 650-950 MPa pressure. Mineral deposits are widespread but many of the most important tourmaline deposits are centred around the Morrissey Hill area, which forms two north-west trending fields of muscovite and migmatitised schist, within the Morrissey Metamorphic Suite. The pegmatites are simple beryl-columbite class pegmatites.
In Fetherston, J.M., Stocklmayer, S.M., Stocklmayer, V.C. (2017) Gemstones of Western Australia, second edition. Geological Survey of Western Australia, Mineral Resources Bulletin 25, 356 pages, it is reported that:
"At the Yinnetharra North deposit, 1.5 km to the north of the Yinnetharra dravite openpit, schorl or black tourmaline was originally reported. In more recent years, it has been established that all tourmaline in this area is black dravite, with an MgO content of 9.85%. The Yinnetharra North deposit, on former mineral claim MC09/215, is in a black phlogopite schist containing large, euhedral black dravite rhombohedra, many with double terminations and internal zoning visible in thin section. Maximum crystal size is recorded as 60 mm in diameter and 23 cm in length".
This pegmatite and mineral deposit field is 165 kilometres by dirt road from Carnarvon. While most are on Yinnietharra Station, some of the outlying deposits are found on neighbouring Mt Phillip, Eudamulla, Bidgemia, and Mooloo Downs Stations. There are around twenty major named sites for minerals in the region, although the total list would be far longer. A four-wheel-drive vehicle is essential, as well as being self-sufficient, as the region is arid, lacks fresh water, and is remote.
Mining for muscovite used in the electrical industry occurred on Yinnietharra station at several sites between 1922 and 1946, beryl and columbite from 1942 to 1965, and gem specimen mining after this till around 1990. Minor rare earth, uranium bearing and lithium minerals are present but have never been mined to any extent. No mining on the field has been large scale.
The Gascoyne Complex is a deformed Archaean basement, with younger sediments deposited on top of it. It was deformed by the collision of the Yilgarn and Pilbara Cratons. These rocks were metamorphosed to gneisses, schists and migmatites, forming slightly younger granites that intruded into the sequence. The rocks were subject to 630-770 degrees Celsius, and 650-950 MPa pressure. Mineral deposits are widespread but many of the most important tourmaline deposits are centred around the Morrissey Hill area, which forms two north-west trending fields of muscovite and migmatitised schist, within the Morrissey Metamorphic Suite. The pegmatites are simple beryl-columbite class pegmatites.
In Fetherston, J.M., Stocklmayer, S.M., Stocklmayer, V.C. (2017) Gemstones of Western Australia, second edition. Geological Survey of Western Australia, Mineral Resources Bulletin 25, 356 pages, it is reported that:
"At the Yinnetharra North deposit, 1.5 km to the north of the Yinnetharra dravite openpit, schorl or black tourmaline was originally reported. In more recent years, it has been established that all tourmaline in this area is black dravite, with an MgO content of 9.85%. The Yinnetharra North deposit, on former mineral claim MC09/215, is in a black phlogopite schist containing large, euhedral black dravite rhombohedra, many with double terminations and internal zoning visible in thin section. Maximum crystal size is recorded as 60 mm in diameter and 23 cm in length".
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities63 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Tanteuxenite-(Y) | 4.DG.05 | Y(Ta,Nb,Ti)2(O,OH)6 |
| ⓘ | Liandratite ? | 4.DH.35 | U(Nb,Ta)2O8 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triphylite var. Ferrisicklerite | 8.AB.10 | Li1-x(Fe3+xFe2+1-x)PO4 |
| ⓘ | 8.AB.10 | LiFe2+PO4 | |
| ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| ⓘ | Clinobisvanite (TL) | 8.AD.65 | Bi(VO4) |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Leucophosphite | 8.DH.10 | KFe3+2(PO4)2(OH) · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr3+2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Povondraite ? | 9.CK.05 | NaFe3+3(Mg2Fe3+4)(Si6O18)(BO3)3(OH)3O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Trilithionite | 9.EC.20 | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bismutoferrite | 9.ED.25 | Fe3+2Bi(SiO4)2(OH) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tapiolite' | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Li | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinobisvanite | Bi(VO4) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| O | ⓘ Liandratite | U(Nb,Ta)2O8 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| P | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| V | Vanadium | |
| V | ⓘ Clinobisvanite | Bi(VO4) |
| Cr | Chromium | |
| Cr | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Triphylite var. Ferrisicklerite | Li1-x(Fex3+Fe2+1-x)PO4 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Leucophosphite | KFe23+(PO4)2(OH) · 2H2O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Povondraite | NaFe33+(Mg2Fe43+)(Si6O18)(BO3)3(OH)3O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Orpiment | As2S3 |
| Y | Yttrium | |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Liandratite | U(Nb,Ta)2O8 |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | ⓘ Tanteuxenite-(Y) | Y(Ta,Nb,Ti)2(O,OH)6 |
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Clinobisvanite | Bi(VO4) |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Liandratite | U(Nb,Ta)2O8 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Localities in this Region
- Western Australia
- Upper Gascoyne Shire
- Yinnietharra
- April pegmatite
- Arthur River pegmatites
- Beryl Well
- Bidgemia Mine
- Bismuth Hill (The Cairn)
- Cairn Mining Centre
- Camel Hill pegmatites
- Caravan pegmatite (Jade pegmatite 2)
- Cork Tree Bore
- Deposit B mica pegmatite
- Deposit C mica pegmatite
- Deposit D mica pegmatite (Yinnietharra Mica; Commonwealth Mica; Government Mica)
- Gascoyne Beryl
- Injinu Hills Rose Quartz Mine (Jackson Well; Chalby Chalby prospect)
- Jade Pegmatite
- Jade Pegmatite 2
- Kempton Brothers Beryl Mine
- MC 43H mica pegmatite
- Mica King East pegmatite
- Yinnietharra
- Upper Gascoyne Shire
- Western Australia
- Upper Gascoyne Shire
- Yinnietharra
- Mica King pegmatite
- Mica King South pegmatite
- Mica King Underwoods Mine
- Mica Queen East
- Mineral Claim 790 Pegmatite
- Minnie Springs prospect
- Morrisey
- Morrisey Hill
- Morrisey Hill Mine
- Mortimer Hills uranium bearing pegmatite
- Moss Mine
- Nardoo Creek 1
- Nardoo Creek 3
- Nardoo Creek 4
- Nardoo Creek 5
- Nardoo Hill (Beryl Hill)
- Nardoo Hill pegmatite
- Nardoo Well pegmatites
- New Well pegmatites
- North Morrissey Hill pegmatite group
- Old Mica Queen Mine
- Perseverance Well
- Roe & Hassel 2
- Roe and Hassell
- South Nardoo 1
- Thirty One Creek
- Thirty Three River
- Thompson Mine
- Ti Tree Well
- Tomkap tourmaline mines (Soklich)
- Wabli Creek pegmatites
- Yinnietharra
- Upper Gascoyne Shire
Other Regions, Features and Areas containing this locality
Australia
- Western Australia
- Gascoyne ProvinceGeologic Province
- Warakurna Large Igneous ProvinceGeologic Province
- West Australian ElementCraton
Australian PlateTectonic Plate
- West Australian Craton
- Capricorn OrogenOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Roe and Hassell, Yinnietharra, Upper Gascoyne Shire, Western Australia, Australia