Log In
Liskeard Mining District, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Liskeard Mining District | Mining District |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Museums in region:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities138 valid minerals. 2 (TL) - type locality of valid minerals. 4 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Agardite-(Y) Formula: YCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ 'Alunite Group' Formula: A0.5-1 B3[SO4]2(OH)6 References: |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 Localities: Cheesewring Quarry, Minions, Linkinhorne, Cornwall, England, UK Looe Mills Hill Quarry, Looe Mills, Liskeard, Cornwall, England, UK Craddock Moor Mine, Craddock Moor, St Cleer, Cornwall, England, UK South Caradon Mine, Caradon Hill, St Cleer, Cornwall, England, UK Killham Mine (Pensilva Tin Mine; Wheal Coryton), St Neot, Cornwall, England, UK Habit: bipyramidal crystals (p {111}, with small c {001}) Colour: black or tarnished |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ 'Andrewsite' |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Flos Ferri Formula: CaCO3 References: |
| ⓘ Argentojarosite Formula: AgFe3+3(SO4)2(OH)6 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Asbestos' |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Barbosalite Formula: Fe2+Fe3+2(PO4)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Herodsfoot Mine (North Herodsfoot Mine), Lanreath, Cornwall, England, UK Wheal Wrey, Wrey and Ludcott United Mines, St Ive, Cornwall, England, UK Wheal Mary Ann, Menheniot, Cornwall, England, UK Wheal Trelawny (incl. Wheal Honey), Menheniot, Cornwall, England, UK West Wheal Mary Ann (West Mary Ann Mine), Roseland, Menheniot, Cornwall, England, UK |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 Locality: Treburland Manganese Mine (Treburland manganese deposits), Altarnun, Cornwall, England, UK References: |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: Habit: rhombic, hexagonal, or oblong tabular plates, usually 2-3mm in length by about 0.3mm thick, but also as large as 11mm in length by 0.8mm thick Colour: colourless, brown (stained by iron oxide) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: |
| ✪ Bournonite Formula: PbCuSbS3 Habit: Crystals to 11cm, cogwheels to 6cm Colour: gray Description: Crystals on quartz, 2.25 inches References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Bustamite Formula: CaMn2+(Si2O6) |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 9 localities in this region. |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 30 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 Localities: Herodsfoot Mine (North Herodsfoot Mine), Lanreath, Cornwall, England, UK Wheal Wrey, Wrey and Ludcott United Mines, St Ive, Cornwall, England, UK Wheal Mary Ann, Menheniot, Cornwall, England, UK Wheal Trelawny (incl. Wheal Honey), Menheniot, Cornwall, England, UK Penhawger Mine, Menheniot, Cornwall, England, UK |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Reported from at least 9 localities in this region. |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O Localities: Phoenix United Mine, Minions, Linkinhorne, Cornwall, England, UK Marke Valley Mine, Upton Cross, Linkinhorne, Cornwall, England, UK Craddock Moor Mine, Craddock Moor, St Cleer, Cornwall, England, UK West Caradon Mine, Crow's Nest, St Cleer, Cornwall, England, UK Gonamena Mine, St Cleer, Cornwall, England, UK |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Chalcosiderite (TL) Formula: CuFe3+6(PO4)4(OH)8 · 4H2O Localities: |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ Chamosite var. Daphnite Formula: (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 21 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Clay minerals' |
| ⓘ 'Coeruleolactite' |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O Localities: Reported from at least 7 localities in this region. |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cuprite var. Tile ore Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ Formula: CaB2Si2O8 Locality: Cheesewring Quarry, Minions, Linkinhorne, Cornwall, England, UK - erroneously reported Description: Kingsbury specimen |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O References: |
| ⓘ Formula: NaAl(AsO4)F Locality: Cheesewring Quarry, Minions, Linkinhorne, Cornwall, England, UK - erroneously reported Description: given to BM by A.Kingsbury - should be considered suspect |
| ⓘ Erythrite ? Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Faustite Formula: ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ 'Feldspar Group' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 22 localities in this region. |
| ⓘ Galena Formula: PbS Localities: Reported from at least 19 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Formula: Be3Zn4(SiO4)3S Locality: Treburland Manganese Mine (Treburland manganese deposits), Altarnun, Cornwall, England, UK - erroneously reported References: Kingsbury, Arthur W. G. (1961) Beryllium minerals in Cornwall and Devon: helvine, genthelvite, and danalite. Mineralogical Magazine and Journal of the Mineralogical Society, 32 (255) 921-940 doi:10.1180/minmag.1961.032.255.01 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Herodsfoot Mine (North Herodsfoot Mine), Lanreath, Cornwall, England, UK Wheal Wrey, Wrey and Ludcott United Mines, St Ive, Cornwall, England, UK Wheal Mary Ann, Menheniot, Cornwall, England, UK Wheal Trelawny (incl. Wheal Honey), Menheniot, Cornwall, England, UK Killham Mine (Pensilva Tin Mine; Wheal Coryton), St Neot, Cornwall, England, UK |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hentschelite Formula: CuFe3+2(PO4)2(OH)2 |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Jeanbandyite Formula: Fe3+xFe2+1-xSn(OH)6-xOx References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: South Phoenix Mine, Minions, Linkinhorne, Cornwall, England, UK South Caradon Mine, Caradon Hill, St Cleer, Cornwall, England, UK Gonamena Mine, St Cleer, Cornwall, England, UK Wheal Phoenix, Phoenix United Mine, Minions, Linkinhorne, Cornwall, England, UK Gazeland China Clay Works, St Neot, Cornwall, England, UK |
| ⓘ Kidwellite Formula: NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| ⓘ 'Köttigite-Parasymplesite Series' ? Description: Specimen EDAX at Man University. Outcome was that specimen was probably Köttigite-Parasymplsite References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ 'Lepidolite' |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) |
| ⓘ 'Limonite' Localities: Reported from at least 11 localities in this region. |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Liskeardite (TL) Formula: [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O Type Locality: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Locality: Cheesewring Quarry, Minions, Linkinhorne, Cornwall, England, UK - erroneously reported Description: Found by A. W. G. Kingsbury (1951-2) and given to BM(NH) |
| ⓘ Millerite Formula: NiS References: |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 7 localities in this region. |
| ⓘ Native Silver Formula: Ag References: |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O References: P D Trebilcock collectionIdentified by Peter Trebilcock: Visual Identification |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Habit: adularia-habit, sometimes showing baveno-twinning, Carlsbad twins |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl References: |
| ⓘ 'Planerite-Turquoise Series' Description: Originally reported to be coeruleolactite. All purported coeruleolactite examined by the authors of the 1998 report (Foord, E.E. & Taggart, J.E.) were largely Planerite, or Occasionally turquoise. Published analysis indicates that the vacany in the 'A' site is between 0.51-0.54 atom fraction, the balance in Cu-0.40 and Zn-0.06 to 0.09. It is suggested by this analysis that the turquoise structure likely cannot accomodate Ca in the 'A' site. |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Psilomelane' |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 31 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: Wheal Ludcott, Wrey and Ludcott United Mines, St Ive, Cornwall, England, UK Wheal Mary Ann, Menheniot, Cornwall, England, UK Wheal Trelawny (incl. Wheal Honey), Menheniot, Cornwall, England, UK Penhawger Mine, Menheniot, Cornwall, England, UK Herodsfoot Mine (North Herodsfoot Mine), Lanreath, Cornwall, England, UK ? (more information) |
| ⓘ Pyrosmalite-(Fe) Formula: Fe2+8Si6O15(OH,Cl)10 |
| ⓘ Pyrostilpnite Formula: Ag3SbS3 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 37 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Description: Many labeled specimens may be rashleighite |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ 'Soapstone' ? Description: Soapstone has been reported as occurring here by Phillips (1823), but Collins (1892) lists it with a question mark. |
| ⓘ Spangolite Formula: Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 15 localities in this region. |
| ⓘ Stephanite Formula: Ag5SbS4 References: |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Tenorite Formula: CuO Localities: Reported from at least 6 localities in this region. |
| ⓘ Tephroite Formula: Mn2+2SiO4 Locality: Treburland Manganese Mine (Treburland manganese deposits), Altarnun, Cornwall, England, UK |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Habit: Tetrahedrons to 2cm Colour: coated with chalcopyrite |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O Localities: Habit: square tables with bevelled edges and bipyramidal crystals without basal plane Colour: dark green |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 11 localities in this region. Colour: greenish Description: "Larger (milarite) prisms (< 8 mm) in vugs in a tourmaline vein" were reportedly found by A.W.G. Kingsbury (1951-2) and donated to the BM(NH)." |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Turquoise Formula: CuAl6(PO4)4(OH)8 · 4H2O Localities: |
| ⓘ Turquoise var. Rashleighite Formula: Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Waylandite Formula: BiAl3(PO4)2(OH)6 References: |
| ⓘ 'Wolframite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Woodwardite Formula: Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Habit: Bipyramiddle Colour: Pale brown |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | var. Tile ore | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Jeanbandyite | 4.FC.15 | Fe3+xFe2+1-xSn(OH)6-xOx |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Flos Ferri | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Spangolite | 7.DD.15 | Cu6Al(SO4)(OH)12Cl · 3H2O |
| ⓘ | Woodwardite | 7.DD.35 | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Barbosalite | 8.BB.40 | Fe2+Fe3+2(PO4)2(OH)2 |
| ⓘ | Hentschelite | 8.BB.40 | CuFe3+2(PO4)2(OH)2 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Durangite ? | 8.BH.10 | NaAl(AsO4)F |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Waylandite | 8.BL.13 | BiAl3(PO4)2(OH)6 |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Erythrite ? | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Chalcosiderite (TL) | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | 'Coeruleolactite' | 8.DD.15 | |
| ⓘ | Faustite | 8.DD.15 | ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | Turquoise var. Rashleighite | 8.DD.15 | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| ⓘ | 8.DD.15 | CuAl6(PO4)4(OH)8 · 4H2O | |
| ⓘ | Liskeardite (TL) | 8.DF.10 | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Kidwellite | 8.DK.20 | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| ⓘ | Agardite-(Y) | 8.DL.15 | YCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite ? | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bustamite | 9.DG.05 | CaMn2+(Si2O6) |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | var. Daphnite | 9.EC.55 | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Pyrosmalite-(Fe) | 9.EE.10 | Fe2+8Si6O15(OH,Cl)10 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Danburite ? | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Genthelvite ? | 9.FB.10 | Be3Zn4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Andrewsite' | - | |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Clay minerals' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Köttigite-Parasymplesite Series' ? | - | |
| ⓘ | 'Soapstone' ? | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Planerite-Turquoise Series' | - | |
| ⓘ | 'Alunite Group' | - | A0.5-1 B3[SO4]2(OH)6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| H | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Liskeardite | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| H | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Köttigite-Parasymplesite Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Planerite-Turquoise Series | |
| H | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Be | ⓘ Phenakite | Be2SiO4 |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Bustamite | CaMn2+(Si2O6) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Durangite | NaAl(AsO4)F |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Liskeardite | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Tephroite | Mn22+SiO4 |
| O | ⓘ Cuprite var. Tile ore | Cu2O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| O | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| O | ⓘ Köttigite-Parasymplesite Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Planerite-Turquoise Series | |
| O | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Durangite | NaAl(AsO4)F |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Durangite | NaAl(AsO4)F |
| Na | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Durangite | NaAl(AsO4)F |
| Al | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Liskeardite | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| Al | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Planerite-Turquoise Series | |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Bustamite | CaMn2+(Si2O6) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Tephroite | Mn22+SiO4 |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| P | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Planerite-Turquoise Series | |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Alunite Group | A0.5-1 B3[SO4]2(OH)6 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Bustamite | CaMn2+(Si2O6) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Aragonite var. Flos Ferri | CaCO3 |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Bustamite | CaMn2+(Si2O6) |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tephroite | Mn22+SiO4 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Barbosalite | Fe2+Fe23+(PO4)2(OH)2 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| Fe | ⓘ Kidwellite | NaFe3+9+x(PO4)6(OH)11 · 3H2O, x = 0.33 |
| Fe | ⓘ Liskeardite | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Köttigite-Parasymplesite Series | |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Ni | Nickel | |
| Ni | ⓘ Millerite | NiS |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Hentschelite | CuFe23+(PO4)2(OH)2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Turquoise var. Rashleighite | Cu(Al,Fe)6(PO4)4(OH)8 · 5H2O |
| Cu | ⓘ Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Cuprite var. Tile ore | Cu2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Turquoise | CuAl6(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Woodwardite | Cu1-xAlx(OH)2(SO4)x/2 · nH2O |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Planerite-Turquoise Series | |
| Zn | Zinc | |
| Zn | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Köttigite-Parasymplesite Series | |
| As | Arsenic | |
| As | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Durangite | NaAl(AsO4)F |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Liskeardite | [(Al,Fe)32(AsO4)18(OH)42(H2O)22] · 52H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Köttigite-Parasymplesite Series | |
| Y | Yttrium | |
| Y | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Waylandite | BiAl3(PO4)2(OH)6 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- England
- Cornwall
- Altarnun
- ⭔Broadoak
- ⭔Dobwalls and Trewidland
- Duloe
- Lanreath
- ⭔Linkinhorne
- ⭔Liskeard
- ⭔Menheniot
- ⭔North Hill
- ⭔St Cleer
- Cornwall
- England
- Cornwall
- St Cleer
- ⭔St Ive
- St Keyne
- ⭔St Neot
- Warleggan
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
UK
- England
- Devon and Cornwall metalliferous mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
Phoenix United Mine, Minions, Linkinhorne, Cornwall, England, UK