Log In
Watson Lake mining district, Yukon, Canadai
| Regional Level Types | |
|---|---|
| Watson Lake mining district | Mining District |
| Yukon | Territory |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
Get Involved with mindat.org
Mindat.org has grown through countless contributions from mineral enthusiasts, collectors, researchers and experts around the world — people just like you.
Want to take part?
1
2
3
4
Contribute
Add photos, locality information and knowledge
Every contribution helps make mindat.org better for everyone.
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities173 valid minerals. 10 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 References: |
| ⓘ Aenigmatite Formula: Na4[Fe2+10Ti2]O4[Si12O36] References: |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Alforsite Formula: Ba5(PO4)3Cl |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O References: |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andalusite var. Chiastolite Formula: Al2(SiO4)O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 Localities: Tom deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada Wolverine deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Jason deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada ABM deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada True Blue property (Shark property), Watson Lake mining district, Yukon, Canada |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 11 localities in this region. |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F References: |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 References: |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ Bandylite Formula: Cu[B(OH)4]Cl |
| ⓘ Baryte Formula: BaSO4 Localities: Tom deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada Gun claim, Wilson Lake, Itsi Mountain, Watson Lake mining district, Yukon, Canada Birr claim, Macmillan Pass, Watson Lake mining district, Yukon, Canada ABM deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Jason deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada |
| ⓘ Barytocalcite Formula: BaCa(CO3)2 |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bavsiite (TL) Formula: Ba2V2O2[Si4O12] Type Locality: References: |
| ⓘ Bazirite Formula: BaZr(Si3O9) |
| ⓘ Beidellite ? Formula: (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O References: |
| ⓘ Benstonite Formula: Ba6Ca6Mg(CO3)13 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 6 localities in this region. |
| ⓘ Beryl var. Aquamarine References: www.truenorthgems.com (n.d.) http://www.truenorthgems.com/s/RelatedArticles.asp?ReportID=70338&_Type=Related-Articles&_Title=True-Blue-Beryl-Fact-Sheet |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Bismuthinite Formula: Bi2S3 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Bukovskýite Formula: Fe3+2(AsO4)(SO4)(OH) · 9H2O |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Calcium Amphibole Subgroup' Formula: AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ 'Calcium Amphibole Subgroup var. Hornblende' Formula: AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Cancrinite Formula: (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O References: |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Celsian Formula: Ba(Al2Si2O8) |
| ⓘ Cerchiaraite-(Al) Formula: Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl References: |
| ⓘ Cerchiaraite-(Fe) Formula: Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 21 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chamosite var. Brunsvigite Formula: (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 10 localities in this region. |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysoberyl ? Formula: BeAl2O4 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Ripidolite Formula: (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Cosalite Formula: Pb2Bi2S5 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cymrite Formula: BaAl2Si2(O,OH)8 · H2O |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Danburite Formula: CaB2Si2O8 References: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 7 localities in this region. |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Edingtonite Formula: Ba[Al2Si3O10] · 4H2O |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Esquireite Formula: BaSi6O13 · 7H2O References: |
| ⓘ Eudialyte Formula: Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 References: |
| ⓘ 'Feldspar Group' Localities: ABM deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Logtung claims (Logtung W-Mo deposit), Watson Lake mining district, Yukon, Canada Seagull Batholith, Watson Lake mining district, Yukon, Canada Wolverine deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ 'Ferberite-Hübnerite Series' References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Ferrimuirite (TL) Formula: Ba10(Ca2Fe3+2)[Si8O24]O2Cl10 Type Locality: |
| ⓘ Ferro-actinolite Formula: ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ Ferrokinoshitalite Formula: (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| ⓘ Fersmite Formula: CaNb2O6 |
| ⓘ Fluoborite Formula: Mg3(BO3)(F,OH)3 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Fluor-uvite-Uvite Series' |
| ⓘ Franckeite Formula: Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Fresnoite Formula: Ba2Ti(Si2O7)O References: |
| ⓘ Galena Formula: PbS Localities: Reported from at least 15 localities in this region. |
| ⓘ Galenobismutite Formula: PbBi2S4 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gillespite Formula: BaFe2+Si4O10 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halite Formula: NaCl References: McDonald, Mervin, Piercey, Stephen, Layne, Graham, Pigage, Lee, Piercey, Glenn (2018) Mineral Assemblages, Textures and In Situ Sulphur Isotope Geochemistry of Sulphide Mineralization from the Cyprus-Type Ice Volcanogenic Massive Sulphide (VMS) Deposit, Yukon, Canada. Minerals, 8 (11) 501 doi:10.3390/min8110501 |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 Localities: Habit: Bladed Colour: Black Description: As black bladed crystals in vugs with white scheelite. |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ 'Helvine Group' Formula: Be3M4(SiO4)3S References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 6 localities in this region. |
| ⓘ Hematite var. Specularite Formula: Fe2O3 References: McDonald, Mervin, Piercey, Stephen, Layne, Graham, Pigage, Lee, Piercey, Glenn (2018) Mineral Assemblages, Textures and In Situ Sulphur Isotope Geochemistry of Sulphide Mineralization from the Cyprus-Type Ice Volcanogenic Massive Sulphide (VMS) Deposit, Yukon, Canada. Minerals, 8 (11) 501 doi:10.3390/min8110501 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O References: |
| ⓘ Hulsite Formula: Fe2+2Fe3+O2(BO3) |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 References: |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Itsiite (TL) Formula: Ba4Ca2[Si8B4O28]◻ Localities: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Kampfite Formula: Ba12(Si11Al5)O31(CO3)8Cl5 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'K Feldspar' |
| ⓘ Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ Lapieite (TL) Formula: NiCuSbS3 Type Locality: |
| ⓘ Låvenite Formula: Na2Ca2Mn2Zr2(Si2O7)2O2F2 References: |
| ⓘ Laumontite ? Formula: CaAl2Si4O12 · 4H2O References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 10 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Malayaite Formula: CaSnO(SiO4) |
| ⓘ Marcasite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Meierite (TL) Formula: Ba44Si66Al30O192Cl25(OH)33 Type Locality: Description: Meierite occurs as equant grains up to 200 μm across, enclosed within large gillespite crystals References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2015) New minerals and nomenclature modifications approved in 2014 and 2015. Newsletter No 23. Mineralogical Magazine, 79 (1) 51-58 doi:10.1180/minmag.2015.079.1.05 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) Localities: Canada Tungsten Mine, Watson Lake mining district, Yukon, Canada Gun claim, Wilson Lake, Itsi Mountain, Watson Lake mining district, Yukon, Canada Seagull Batholith, Watson Lake mining district, Yukon, Canada Cassiar Pegmatite Area, Watson Lake mining district, Yukon, Canada Ting Creek intrusion, Watson Lake mining district, Yukon, Canada |
| ⓘ Microcline var. Hyalophane Formula: (K,Ba)[Al(Si,Al)Si2O8] References: |
| ⓘ Millerite Formula: NiS |
| ⓘ Molybdenite Formula: MoS2 Localities: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: |
| ⓘ Mosandrite-(Ce) Formula: (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 References: |
| ⓘ Muirite Formula: Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 Localities: Tom deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada ABM deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Fiddler Yukon Mine, Watson Lake mining district, Yukon, Canada Seagull Batholith, Watson Lake mining district, Yukon, Canada Jason deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Bismuth Formula: Bi Localities: |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Nepheline Formula: Na3K(Al4Si4O16) References: |
| ⓘ Nordenskiöldine Formula: CaSn4+[BO3]2 |
| ⓘ Norsethite Formula: BaMg(CO3)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Owyheeite Formula: Ag3Pb10Sb11S28 |
| ⓘ Pabstite Formula: Ba(Sn,Ti)(Si3O9) References: |
| ⓘ Paragonite ? Formula: NaAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pellyite (TL) Formula: Ba2CaFe2+2Si6O17 Type Locality: Habit: Massive, crystalline Colour: Colorless to paleyellow Fluorescence: none References: Montgomery, J. H.; Thompson, R. M.; Meagher, E. P. (1972) Pellyite: a new barium silicate mineral from the Yukon Territory. The Canadian Mineralogist, 11 (2). 444-447 Pabst, A.; Harris, J. (1984) Pellyite: new localities and new data. The Canadian Mineralogist, 22 (4). 653-658 |
| ⓘ 'Petroleum' |
| ⓘ 'Petroleum var. Bitumen' |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 References: |
| ⓘ Polydymite Formula: Ni2+Ni3+2S4 |
| ⓘ Potassic-magnesio-hastingsite Formula: KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Prehnite ? Formula: Ca2Al2Si3O10(OH)2 References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 20 localities in this region. |
| ⓘ 'Pyrobitumen' |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 19 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 25 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Raudseppite (TL) Formula: Ba2Ca7(Si3O9)2(CO3)2Cl2 Type Locality: |
| ⓘ Riebeckite Formula: ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 References: |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Ronpetersonite (TL) Formula: BaWO4 Type Locality: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanbornite Formula: BaSi2O5 References: |
| ⓘ 'Scapolite' References: |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 8 localities in this region. |
| ⓘ Scheelite var. Molybdoscheelite Formula: Ca(WO4) References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scolecite ? Formula: CaAl2Si3O10 · 3H2O References: |
| ⓘ Siderite Formula: FeCO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ Siderite var. Mg-rich Siderite Formula: (Fe,Mg)CO3 |
| ⓘ 'Smectite Group' Formula: A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sodalite Formula: Na4(Si3Al3)O12Cl References: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 20 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: Fiddler Yukon Mine, Watson Lake mining district, Yukon, Canada Logtung claims (Logtung W-Mo deposit), Watson Lake mining district, Yukon, Canada Coal River, Watson Lake mining district, Yukon, Canada MW claim, Screw Creek, Cassiar Mountains, Watson Lake mining district, Yukon, Canada ? (more information) |
| ⓘ Stannoidite ? Formula: Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 Description: Originally thought to be stannite, but had similar properties to stannoidite. |
| ⓘ Stibnite Formula: Sb2S3 Description: it is not a likely species in an alkaline intrusion (LH) References: |
| ⓘ 'Stilbite Subgroup' ? Formula: M6-7[Al8-9Si27-28O72] · nH2O References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Suzukiite Formula: BaVSi2O7 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Taramellite Formula: Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx References: Montgomery, J. H.; Thompson, R. M.; Meagher, E. P. (1972) Pellyite: a new barium silicate mineral from the Yukon Territory. The Canadian Mineralogist, 11 (2). 444-447 Alfors, John T., Pabst, Adolf (1984) Titanian taramellites in western North America. American Mineralogist, 69 (3-4) 358-373 |
| ⓘ Tazheranite Formula: (Zr,Ti,Ca)(O,◻)2 |
| ⓘ 'Tetrahedrite Group' Formula: M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite' Formula: (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ Thorite Formula: Th(SiO4) |
| ⓘ Tintinaite (TL) Formula: Pb22Cu4(Sb,Bi)30S69 Type Locality: |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Canada Tungsten Mine, Watson Lake mining district, Yukon, Canada ABM deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Logtung claims (Logtung W-Mo deposit), Watson Lake mining district, Yukon, Canada Ice deposit, Finlayson Lake Camp, Watson Lake mining district, Yukon, Canada Ting Creek intrusion, Watson Lake mining district, Yukon, Canada |
| ⓘ Titantaramellite (TL) Formula: Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx Type Locality: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Reported from at least 8 localities in this region. |
| ⓘ 'UM1984-32-S:CuPbSb' Formula: Pb2CuSb3S7 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uvarovite Formula: Ca3Cr3+2(SiO4)3 References: |
| ⓘ Variscite Formula: AlPO4 · 2H2O Description: "The variscite was collected by the Kulan family, possibly under Welcome North's flag during the late 70's. The material is difficult to cut, being brecciated vein fillings in a dark, soft matrix. We did make some small eggs, spheres and polished pieces. The material came from Barry Kulan's garage in Vancouver. The property near Itsi lakes is still under claim but I have no knowledge of more material being available. George is probably now the only source." Rod Tyson, June 2012 References: |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Vonsenite Formula: Fe2+2Fe3+(BO3)O2 |
| ⓘ Walstromite Formula: BaCa2(Si3O9) References: |
| ⓘ 'White mica' |
| ⓘ Witherite Formula: BaCO3 Localities: Trench 1, Gun claim, Wilson Lake, Itsi Mountain, Watson Lake mining district, Yukon, Canada Tom deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada Gun claim, Wilson Lake, Itsi Mountain, Watson Lake mining district, Yukon, Canada Jason deposit, Macmillan Pass, Watson Lake mining district, Yukon, Canada |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ 'Xenotime' References: personal correspondence with Giles Peatfield (see comments in description)Identification: Visual Identification |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Seagull Batholith, Watson Lake mining district, Yukon, Canada Logtung claims (Logtung W-Mo deposit), Watson Lake mining district, Yukon, Canada Tsa Da Glisza property (Regal Ridge), Watson Lake mining district, Yukon, Canada Guano Ridge (Guano prospect), True Blue property (Shark property), Watson Lake mining district, Yukon, Canada Ting Creek intrusion, Watson Lake mining district, Yukon, Canada |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite ? | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Polydymite | 2.DA.05 | Ni2+Ni3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Lapieite (TL) | 2.GA.25 | NiCuSbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Tintinaite (TL) | 2.HB.10a | Pb22Cu4(Sb,Bi)30S69 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Owyheeite | 2.HC.35 | Ag3Pb10Sb11S28 |
| ⓘ | Franckeite | 2.HF.25b | Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| ⓘ | Galenobismutite | 2.JB.25e | PbBi2S4 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| Group 3 - Halides | |||
| ⓘ | Halite | 3.AA.20 | NaCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chrysoberyl ? | 4.BA.05 | BeAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Fersmite | 4.DG.05 | CaNb2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Tazheranite | 4.DL.10 | (Zr,Ti,Ca)(O,◻)2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite var. Mg-rich Siderite | 5.AB.05 | (Fe,Mg)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Norsethite | 5.AB.30 | BaMg(CO3)2 |
| ⓘ | Barytocalcite | 5.AB.45 | BaCa(CO3)2 |
| ⓘ | Benstonite | 5.AB.55 | Ba6Ca6Mg(CO3)13 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| Group 6 - Borates | |||
| ⓘ | Nordenskiöldine | 6.AA.15 | CaSn4+[BO3]2 |
| ⓘ | Vonsenite | 6.AB.30 | Fe2+2Fe3+(BO3)O2 |
| ⓘ | Hulsite | 6.AB.45 | Fe2+2Fe3+O2(BO3) |
| ⓘ | Fluoborite | 6.AB.50 | Mg3(BO3)(F,OH)3 |
| ⓘ | Bandylite | 6.AC.35 | Cu[B(OH)4]Cl |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | var. Molybdoscheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Ronpetersonite (TL) | 7.GA.05 | BaWO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Alforsite | 8.BN.05 | Ba5(PO4)3Cl |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Bukovskýite | 8.DB.40 | Fe3+2(AsO4)(SO4)(OH) · 9H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr3+2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | var. Chiastolite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Malayaite | 9.AG.15 | CaSnO(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Fresnoite | 9.BE.15 | Ba2Ti(Si2O7)O |
| ⓘ | Låvenite | 9.BE.17 | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| ⓘ | Mosandrite-(Ce) | 9.BE.20 | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Raudseppite (TL) | 9.CA. | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| ⓘ | Bazirite | 9.CA.05 | BaZr(Si3O9) |
| ⓘ | Pabstite | 9.CA.05 | Ba(Sn,Ti)(Si3O9) |
| ⓘ | Walstromite | 9.CA.25 | BaCa2(Si3O9) |
| ⓘ | Taramellite | 9.CE.20 | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ | Titantaramellite (TL) | 9.CE.20 | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ | Cerchiaraite-(Al) | 9.CF.25 | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Cerchiaraite-(Fe) | 9.CF.25 | Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Itsiite (TL) | 9.CH.05 | Ba4Ca2[Si8B4O28]◻ |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muirite | 9.CN.05 | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| ⓘ | Ferrimuirite (TL) | 9.CN.05 | Ba10(Ca2Fe3+2)[Si8O24]O2Cl10 |
| ⓘ | Eudialyte | 9.CO.10 | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Potassic-magnesio-hastingsite | 9.DE.15 | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Bavsiite (TL) | 9.DH. | Ba2V2O2[Si4O12] |
| ⓘ | Suzukiite | 9.DH.15 | BaVSi2O7 |
| ⓘ | Aenigmatite | 9.DH.40 | Na4[Fe2+10Ti2]O4[Si12O36] |
| ⓘ | Pellyite (TL) | 9.DO.10 | Ba2CaFe2+2Si6O17 |
| ⓘ | Prehnite ? | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Esquireite | 9.DP.50 | BaSi6O13 · 7H2O |
| ⓘ | Gillespite | 9.EA.05 | BaFe2+Si4O10 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite ? | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Ferrokinoshitalite | 9.EC.35 | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| ⓘ | Beidellite ? | 9.EC.40 | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Chamosite var. Brunsvigite | 9.EC.55 | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Sanbornite | 9.EF.10 | BaSi2O5 |
| ⓘ | Cymrite | 9.EG.05 | BaAl2Si2(O,OH)8 · H2O |
| ⓘ | Kampfite | 9.EG.20 | Ba12(Si11Al5)O31(CO3)8Cl5 |
| ⓘ | Nepheline | 9.FA.05 | Na3K(Al4Si4O16) |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| ⓘ | Microcline var. Hyalophane | 9.FA.30 | (K,Ba)[Al(Si,Al)Si2O8] |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Cancrinite | 9.FB.05 | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| ⓘ | Scolecite ? | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Edingtonite | 9.GA.15 | Ba[Al2Si3O10] · 4H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite ? | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Meierite (TL) | 9.GF.60 | Ba44Si66Al30O192Cl25(OH)33 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Stilbite Subgroup' ? | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Fluor-uvite-Uvite Series' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Ferberite-Hübnerite Series' | - | |
| ⓘ | 'Smectite Group' | - | A0.3D2-3[T4O10]Z2 · nH2O |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Pyrobitumen' | - | |
| ⓘ | 'Helvine Group' | - | Be3M4(SiO4)3S |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'White mica' | - | |
| ⓘ | 'UM1984-32-S:CuPbSb' | - | Pb2CuSb3S7 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bandylite | Cu[B(OH)4]Cl |
| H | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| H | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mosandrite-(Ce) | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Fluor-uvite-Uvite Series | |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| H | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| H | ⓘ Esquireite | BaSi6O13 · 7H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Helvine Group | Be3M4(SiO4)3S |
| B | Boron | |
| B | ⓘ Bandylite | Cu[B(OH)4]Cl |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| B | ⓘ Hulsite | Fe22+Fe3+O2(BO3) |
| B | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| B | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Fluor-uvite-Uvite Series | |
| B | ⓘ Vonsenite | Fe22+Fe3+(BO3)O2 |
| B | ⓘ Itsiite | Ba4Ca2[Si8B4O28]◻ |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Barytocalcite | BaCa(CO3)2 |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Norsethite | BaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| C | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| C | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alforsite | Ba5(PO4)3Cl |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Barytocalcite | BaCa(CO3)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Bandylite | Cu[B(OH)4]Cl |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bazirite | BaZr(Si3O9) |
| O | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Fersmite | CaNb2O6 |
| O | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| O | ⓘ Gillespite | BaFe2+Si4O10 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Hulsite | Fe22+Fe3+O2(BO3) |
| O | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Malayaite | CaSnO(SiO4) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mosandrite-(Ce) | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| O | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nepheline | Na3K(Al4Si4O16) |
| O | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| O | ⓘ Norsethite | BaMg(CO3)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanbornite | BaSi2O5 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Suzukiite | BaVSi2O7 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| O | ⓘ Tazheranite | (Zr,Ti,Ca)(O,◻)2 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| O | ⓘ Fluor-uvite-Uvite Series | |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vonsenite | Fe22+Fe3+(BO3)O2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Walstromite | BaCa2(Si3O9) |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Ferberite-Hübnerite Series | |
| O | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| O | ⓘ Smectite Group | A0.3D2-3[T4O10]Z2 · nH2O |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| O | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Helvine Group | Be3M4(SiO4)3S |
| O | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Itsiite | Ba4Ca2[Si8B4O28]◻ |
| O | ⓘ Bavsiite | Ba2V2O2[Si4O12] |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| O | ⓘ Esquireite | BaSi6O13 · 7H2O |
| O | ⓘ Ronpetersonite | BaWO4 |
| O | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| O | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Fluor-uvite-Uvite Series | |
| F | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Na | ⓘ Halite | NaCl |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| Na | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Norsethite | BaMg(CO3)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mg | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mg | ⓘ Fluor-uvite-Uvite Series | |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Mg | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| Mg | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Fluor-uvite-Uvite Series | |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Al | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Al | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Bazirite | BaZr(Si3O9) |
| Si | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Andalusite var. Chiastolite | Al2(SiO4)O |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Si | ⓘ Gillespite | BaFe2+Si4O10 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| Si | ⓘ Malayaite | CaSnO(SiO4) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Mosandrite-(Ce) | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| Si | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nepheline | Na3K(Al4Si4O16) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Sanbornite | BaSi2O5 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Suzukiite | BaVSi2O7 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Si | ⓘ Fluor-uvite-Uvite Series | |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Walstromite | BaCa2(Si3O9) |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Helvine Group | Be3M4(SiO4)3S |
| Si | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Itsiite | Ba4Ca2[Si8B4O28]◻ |
| Si | ⓘ Bavsiite | Ba2V2O2[Si4O12] |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| Si | ⓘ Esquireite | BaSi6O13 · 7H2O |
| Si | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| Si | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| P | Phosphorus | |
| P | ⓘ Alforsite | Ba5(PO4)3Cl |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| S | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Galenobismutite | PbBi2S4 |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lapieite | NiCuSbS3 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Polydymite | Ni2+Ni23+S4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Helvine Group | Be3M4(SiO4)3S |
| S | ⓘ UM1984-32-S:CuPbSb | Pb2CuSb3S7 |
| Cl | Chlorine | |
| Cl | ⓘ Alforsite | Ba5(PO4)3Cl |
| Cl | ⓘ Bandylite | Cu[B(OH)4]Cl |
| Cl | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Cl | ⓘ Halite | NaCl |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Cl | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Cl | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Cl | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Cl | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| Cl | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Cl | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Cl | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| Cl | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| Cl | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Nepheline | Na3K(Al4Si4O16) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ca | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cancrinite | (Na,Ca,◻)8(Al6Si6O24)(CO3,SO4)2 · 2H2O |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Fersmite | CaNb2O6 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| Ca | ⓘ Malayaite | CaSnO(SiO4) |
| Ca | ⓘ Mosandrite-(Ce) | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| Ca | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Ca | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| Ca | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Tazheranite | (Zr,Ti,Ca)(O,◻)2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Ca | ⓘ Fluor-uvite-Uvite Series | |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Walstromite | BaCa2(Si3O9) |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ca | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Itsiite | Ba4Ca2[Si8B4O28]◻ |
| Ca | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| Ca | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| Ti | Titanium | |
| Ti | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Mosandrite-(Ce) | (Ca3REE)[(H2O)2Ca0.5◻0.5]Ti(Si2O7)2(OH)2(H2O)2 |
| Ti | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Ti | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ti | ⓘ Tazheranite | (Zr,Ti,Ca)(O,◻)2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| V | Vanadium | |
| V | ⓘ Suzukiite | BaVSi2O7 |
| V | ⓘ Bavsiite | Ba2V2O2[Si4O12] |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Uvarovite | Ca3Cr23+(SiO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mn | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| Mn | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Ferberite-Hübnerite Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aenigmatite | Na4[Fe102+Ti2]O4[Si12O36] |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Fe | ⓘ Gillespite | BaFe2+Si4O10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Hulsite | Fe22+Fe3+O2(BO3) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Fe | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Fe | ⓘ Vonsenite | Fe22+Fe3+(BO3)O2 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Fe | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Ferberite-Hübnerite Series | |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Siderite var. Mg-rich Siderite | (Fe,Mg)CO3 |
| Fe | ⓘ Potassic-magnesio-hastingsite | KCa2(Mg4Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Fe | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Lapieite | NiCuSbS3 |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Polydymite | Ni2+Ni23+S4 |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bandylite | Cu[B(OH)4]Cl |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Lapieite | NiCuSbS3 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ UM1984-32-S:CuPbSb | Pb2CuSb3S7 |
| Zn | Zinc | |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Bukovskýite | Fe23+(AsO4)(SO4)(OH) · 9H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Bazirite | BaZr(Si3O9) |
| Zr | ⓘ Eudialyte | Na15Ca6Fe3Zr3Si(Si25O73)(O,OH,H2O)3(Cl,OH)2 |
| Zr | ⓘ Låvenite | Na2Ca2Mn2Zr2(Si2O7)2O2F2 |
| Zr | ⓘ Tazheranite | (Zr,Ti,Ca)(O,◻)2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Fersmite | CaNb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sn | ⓘ Malayaite | CaSnO(SiO4) |
| Sn | ⓘ Nordenskiöldine | CaSn4+[BO3]2 |
| Sn | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Lapieite | NiCuSbS3 |
| Sb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Sb | ⓘ UM1984-32-S:CuPbSb | Pb2CuSb3S7 |
| Ba | Barium | |
| Ba | ⓘ Alforsite | Ba5(PO4)3Cl |
| Ba | ⓘ Barytocalcite | BaCa(CO3)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Bazirite | BaZr(Si3O9) |
| Ba | ⓘ Benstonite | Ba6Ca6Mg(CO3)13 |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Cymrite | BaAl2Si2(O,OH)8 · H2O |
| Ba | ⓘ Edingtonite | Ba[Al2Si3O10] · 4H2O |
| Ba | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ba | ⓘ Gillespite | BaFe2+Si4O10 |
| Ba | ⓘ Microcline var. Hyalophane | (K,Ba)[Al(Si,Al)Si2O8] |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | ⓘ Muirite | Ba10(Ca2Mn2+Ti)[Si8O24]O2Cl10 |
| Ba | ⓘ Norsethite | BaMg(CO3)2 |
| Ba | ⓘ Pabstite | Ba(Sn,Ti)(Si3O9) |
| Ba | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ba | ⓘ Sanbornite | BaSi2O5 |
| Ba | ⓘ Suzukiite | BaVSi2O7 |
| Ba | ⓘ Taramellite | Ba4(Fe3+,Ti,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ba | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ba | ⓘ Walstromite | BaCa2(Si3O9) |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Ferrokinoshitalite | (Ba,K)(Fe2+,Mg)3(Al2Si2O10)(OH,F)2 |
| Ba | ⓘ Kampfite | Ba12(Si11Al5)O31(CO3)8Cl5 |
| Ba | ⓘ Cerchiaraite-(Al) | Ba4Al4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Itsiite | Ba4Ca2[Si8B4O28]◻ |
| Ba | ⓘ Bavsiite | Ba2V2O2[Si4O12] |
| Ba | ⓘ Meierite | Ba44Si66Al30O192Cl25(OH)33 |
| Ba | ⓘ Esquireite | BaSi6O13 · 7H2O |
| Ba | ⓘ Ronpetersonite | BaWO4 |
| Ba | ⓘ Ferrimuirite | Ba10(Ca2Fe23+)[Si8O24]O2Cl10 |
| Ba | ⓘ Raudseppite | Ba2Ca7(Si3O9)2(CO3)2Cl2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Ferberite-Hübnerite Series | |
| W | ⓘ Scheelite var. Molybdoscheelite | Ca(WO4) |
| W | ⓘ Ronpetersonite | BaWO4 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Galenobismutite | PbBi2S4 |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Pb | ⓘ UM1984-32-S:CuPbSb | Pb2CuSb3S7 |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Galenobismutite | PbBi2S4 |
| Bi | ⓘ Tintinaite | Pb22Cu4(Sb,Bi)30S69 |
| Th | Thorium | |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Fossils
There are 58 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 58 | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 101 Ma (Late/Upper Cretaceous) | ||||||||||||
| Oldest Fossil Listed | 520 Ma (Cambrian) | ||||||||||||
| Stratigraphic Units |
| ||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||
| Fossil Localities | Click to show 9 fossil localities |
Localities in this Region
- Yukon
- Watson Lake mining district
- Itsi Mountain
- Itsy Mountains
- JC tin skarn deposit
- Ketza River Mine
- Logtung claims (Logtung W-Mo deposit)
- Macmillan Pass
- Mindy prospect
- Mount Hundare Mine
- Seagull Batholith
- St Cyr Range
- Ting Creek intrusion
- Tintina
- Tintina Ag-Pb-Zn deposit
- True Blue property (Shark property)
- Tsa Da Glisza property (Regal Ridge)
- Watson Lake
- Watson Lake mining district
Other Regions, Features and Areas that Intersect
North AmericaContinent
- Rocky MountainsMountain Range
North America PlateTectonic Plate
- Cassiar TerranePassive Margin
- Liard basinBasin
- Selwyn basinBasin
- Slide MountainOceanic Back-arc Basin
- West Canadian-Alberta basinBasin
- Yukon-TananaVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Fiddler Yukon Mine, Watson Lake mining district, Yukon, Canada