Log In
Northern Copper Belt, Carajás mineral province, Pará, Brazili
| Regional Level Types | |
|---|---|
| Northern Copper Belt | Belt |
| Carajás mineral province | Mineral Province |
| Pará | State |
| Brazil | Country |
This page is currently not sponsored. Click here to sponsor this page.
In the Northern Copper Belt (NCB), two major shear zones are present, namely, the Cinzento Shear Zone (CSZ) and the Carajás Shear Zone (KSZ), both predominantly trending WNW–ESE. The CSZ occupies a large part of the area and extends over 130 km. It hosts some of the best-known Neoarchean IOCG-type deposits, including Salobo, the largest deposit in the region (1,133.4 Mt @ 0.62 % Cu and 0.35 g/t Au). Other substantial deposits along the CSZ include Furnas (500 Mt @ 0.6 % Cu and 0.28 g/t Au; Dreher et al., 2018), Paulo Afonso (200 Mt @ 1 % Cu), and GT-46. Meanwhile, deposits such as Pojuca, Gameleira, and Grota Funda are structurally controlled by the KSZ and, together with the Paulo Afonso deposit, comprise an estimated resource of 1.5 billion tons of copper with a cut-off grade of 0.5 %. Five Archean–Paleoproterozoic lithostratigraphic associations occur in the NCB. This includes gneissic rocks from the Mesoarchean basement grouped generically as the Xingu Complex; Neoarchean metavolcanosedimentary sequences of the Itacaiúnas Supergroup; Neoarchean intrusive rocks, such as the Igarapé Gelado Metagranite and unmappable dikes of Velho Salobo-type granites; Paleoproterozoic sedimentary rocks of the Águas Claras Formation; and Paleoproterozoic granitic intrusions, represented by the Cigano and Pojuca granites.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities59 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Siegenite | 2.DA.05 | CoNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Cattierite | 2.EB.05a | CoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Cobaltarthurite | 8.DC.15 | CoFe3+2(AsO4)2(OH)2 · 4H2O |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Ferrosilite | 9.DA.05 | Fe2+2Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Greenalite | 9.ED.15 | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Calcic garnet' | - | Ca3X3+2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| H | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Cobaltarthurite | CoFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+SiO4 |
| O | ⓘ Ferrosilite | Fe22+Si2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| O | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Cobaltarthurite | CoFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Calcic garnet | Ca3X23+(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Anthophyllite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+SiO4 |
| Si | ⓘ Ferrosilite | Fe22+Si2O6 |
| Si | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Si | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Calcic garnet | Ca3X23+(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Cattierite | CoS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Siegenite | CoNi2S4 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Calcic garnet | Ca3X23+(SiO4)3 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+SiO4 |
| Fe | ⓘ Ferrosilite | Fe22+Si2O6 |
| Fe | ⓘ Greenalite | (Fe2+,Fe3+)2-3Si2O5(OH)4 |
| Fe | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Pyrosmalite-(Fe)-Pyrosmalite-(Mn) Series | |
| Fe | ⓘ Cobaltarthurite | CoFe23+(AsO4)2(OH)2 · 4H2O |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cattierite | CoS2 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Siegenite | CoNi2S4 |
| Co | ⓘ Cobaltarthurite | CoFe23+(AsO4)2(OH)2 · 4H2O |
| Ni | Nickel | |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Siegenite | CoNi2S4 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Cobaltarthurite | CoFe23+(AsO4)2(OH)2 · 4H2O |
| Y | Yttrium | |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Ce | Cerium | |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Neoarchean : 2628 Ma to 2553 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | ||||||||||
| Archean | ||||||||||
| Neoarchean |
| |||||||||
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
Other Regions, Features and Areas that Intersect
Brazil
- Pará
- Carajás mineral provinceMineral Province
South America PlateTectonic Plate
- Amazonian CratonCraton
- Central Amazonian BeltShield
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyFossilsLocalities in RegionOther RegionsReferences
Salobo Mine, Marabá, Pará, Brazil