Log In
Redruth, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Redruth | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Redruth | 42,690 (2017) |
| North Country | 773 (2017) |
Other Languages:
Cornish:
Resrudh, Kernow, Pow Sows, Ruwvaneth Unys
French:
Redruth, Cornouailles, Angleterre, Royaume-Uni
German:
Redruth, Cornwall, England, Vereinigtes Königreich
Italian:
Redruth, Cornovaglia, Inghilterra, Regno Unito
Russian:
Редрат, Корнуолл, Англия, Великобритания
Simplified Chinese:
雷德魯斯, 康沃爾郡, 英格兰, 英国
Spanish:
Redruth, Cornualles, Inglaterra, Reino Unido
Basque:
Redruth, Kornualles, Ingalaterra, Erresuma Batua
Bengali:
রিডোথ, কর্নওয়াল, ইংল্যান্ড, যুক্তরাজ্য
Breton:
Resrudh, Kernev-Veur, Bro-Saoz, Rouantelezh-Unanet
Bulgarian:
Редрът, Корнуол, Англия, Обединено кралство Великобритания и Северна Ирландия
Cebuano:
Redruth, Cornwall, Inglatera, Hiniusang Gingharian
Czech:
Redruth, Cornwall, Anglie, Spojené království
Dutch:
Redruth, Cornwall, Engeland, Verenigd Koninkrijk
Farsi/Persian:
ردروث, کورنوال, انگلستان, بریتانیا
Greek:
Ρέντρουθ, Κορνουάλη, Αγγλία, Ηνωμένο Βασίλειο
Gujarati:
રેડરૂઠ, કોર્નવોલ, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Hebrew:
רדרות', קורנוול, אנגליה, הממלכה המאוחדת
Irish Gaelic:
Redruth, Corn na Breataine, Sasana, An Ríocht Aontaithe
Japanese:
ラドルード, コーンウォール, イングランド, イギリス
Kannada:
ರೆಡ್ರುತ್, ಕಾರ್ನ್ವಾಲ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
레드루스, 콘월주, 잉글랜드, 영국
Latin:
Redruth, Cornubia, Anglia, Britanniarum regnum
Lithuanian:
Redrutas, Kornvalis, Anglija, Jungtinė Karalystė
Norwegian:
Redruth, Cornwall, England, Storbritannia
Norwegian (Nynorsk):
Redruth, Cornwall, England, Storbritannia
Polish:
Redruth, Kornwalia, Anglia, Wielka Brytania
Portuguese:
Redruth, Cornualha, Inglaterra, Reino Unido
Romanian:
Redruth, Cornwall, Anglia, Regatul Unit al Marii Britanii și al Irlandei de Nord
South Azerbaijani:
ردروث, اینگیلیس, بیرلشمیش شاهلیق
Swedish:
Redruth, Cornwall, England, Storbritannien
Tamil:
ரெட்ரூத், கோர்ன்வால், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
రెడ్రుత్, కార్న్వాల్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Urdu:
ریدرود, کورنوال, انگلستان, مملکت متحدہ
Volapük:
Redruth, Cornwall, Linglän, Regän Pebalöl
Welsh:
Redruth, Cernyw, Lloegr, Y Deyrnas Unedig
Redruth is the major town at the eastern end of what is generally termed the Camborne-Redruth mining district.
Several significant mines lie within the town itself, most notably Pednandrea Mine and Wheal Sparnon.
The town of Redruth has also been plagued by scores of unrecorded mine workings that can cause problems for development.
NOTE: On old labels, "Redruth" often refers to some of the mines that are located immediately west of Redruth, but in Carn Brea or Illogan parishes, such as Carn Brea and Tincroft mines.
The civil parish centred on Redruth town.
It is surrounded on the north by Portreath CP and St Agnes CP, to the east by St Day CP and Lanner CP and to the west by Carn Brea CP and Illogan CP.
Several significant mines lie within the town itself, most notably Pednandrea Mine and Wheal Sparnon.
The town of Redruth has also been plagued by scores of unrecorded mine workings that can cause problems for development.
NOTE: On old labels, "Redruth" often refers to some of the mines that are located immediately west of Redruth, but in Carn Brea or Illogan parishes, such as Carn Brea and Tincroft mines.
The civil parish centred on Redruth town.
It is surrounded on the north by Portreath CP and St Agnes CP, to the east by St Day CP and Lanner CP and to the west by Carn Brea CP and Illogan CP.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities62 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anatase Formula: TiO2 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenolite Formula: As2O3 References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 7 localities in this region. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 29 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chamosite var. Daphnite Formula: (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ 'Chlorite Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Claudetite ? Formula: As2O3 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cuprite Formula: Cu2O Localities: |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Danalite ? Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Fluorite var. Chlorophane Formula: CaF2 References: |
| ⓘ Galena Formula: PbS Localities: Wheal Briggan, Scorrier, Redruth, Cornwall, England, UK Wheal Peevor, Redruth, Cornwall, England, UK Wheal Trefusis (incl. East Wheal Trefusis), Redruth, Cornwall, England, UK South Wheal Tolgus, Tolgus Mount, Redruth, Cornwall, England, UK Pednandrea Mine (Pedn-an-Drea Mine), Redruth, Cornwall, England, UK |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O References: |
| ⓘ 'Limonite' |
| ⓘ Liroconite Formula: Cu2Al(AsO4)(OH)4 · 4H2O Description: A specimen in the Russell collection NHM London is recorded from this mine. The Liroconite has formed on Chalcedony. |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Metatorbernite (TL) Formula: Cu(UO2)2(PO4)2 · 8H2O Type Locality: |
| ⓘ Millerite Formula: NiS References: |
| ⓘ Mimetite ? Formula: Pb5(AsO4)3Cl Description: Has been recorded as occurring here by Phillips (1823) and others, but Collins (1892) lists this with a question mark. References: |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Native Silver Formula: Ag |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ 'Petroleum' References: |
| ⓘ 'Petroleum var. Bitumen' References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 13 localities in this region. |
| ⓘ Quartz var. Agate Formula: SiO2 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Citrine Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ 'Silica' |
| ⓘ 'Silica var. Float-stone' |
| ⓘ Skutterudite Formula: CoAs3 Localities: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Tenorite Formula: CuO |
| ⓘ Titanite Formula: CaTiO(SiO4) References: |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Pednandrea Mine (Pedn-an-Drea Mine), Redruth, Cornwall, England, UK Wheal Harmony (Wheal Garden), Treleigh Wood Mine, Redruth, Cornwall, England, UK South Wheal Hawke (incl. Scorrier Wolfram Prospect), Great North Downs Mine (incl. Wheal Hawke), Scorrier, Redruth, Cornwall, England, UK Wheal Peevor, Redruth, Cornwall, England, UK Wheal Rose, Great North Downs Mine (incl. Wheal Hawke), Scorrier, Redruth, Cornwall, England, UK |
| ⓘ 'Tourmaline var. Rubellite' |
| ⓘ Tristramite Formula: (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ 'Wad' |
| ⓘ 'Wolframite Group' Localities: Reported from at least 9 localities in this region. |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite var. Chlorophane | 3.AB.25 | CaF2 |
| ⓘ | 3.AB.25 | CaF2 | |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Claudetite ? | 4.CB.45 | As2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz var. Agate | 4.DA.05 | SiO2 |
| ⓘ | var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | var. Citrine | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Mimetite ? | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Tristramite | 8.CJ.45 | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Liroconite | 8.DF.20 | Cu2Al(AsO4)(OH)4 · 4H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Metatorbernite (TL) | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Daphnite | 9.EC.55 | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Danalite ? | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Petroleum var. Bitumen' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Silica' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Silica var. Float-stone' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Be | Beryllium | |
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Tourmaline var. Rubellite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Quartz var. Agate | SiO2 |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Quartz var. Citrine | SiO2 |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorite var. Chlorophane | CaF2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Al | Aluminium | |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | Silicon | |
| Si | ⓘ Quartz var. Agate | SiO2 |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Quartz var. Citrine | SiO2 |
| Si | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| S | ⓘ Galena | PbS |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Cl | Chlorine | |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite var. Chlorophane | CaF2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Liroconite | Cu2Al(AsO4)(OH)4 · 4H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Tristramite | (Ca,U4+,Fe3+)(PO4,SO4) · 2H2O |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Redruth |
|---|---|
| Wikidata ID: | Q1010210 |
| GeoNames ID: | 7294442 |
Localities in this Region
- England
- Cornwall
- Redruth
- Buckett's Mine
- Cardrew and Prussia United Mine
- Clyjah and Wentworth Mine (Perseverance Mine)
- Copper Hill Mine
- East Carn Brea Mine
- East Wheal Basset
- East Wheal Tolgus (Redruth Consols)
- Gilberts Coombe
- North Wheal Grambler
- Parc Erissey
- Pednandrea Mine (Pedn-an-Drea Mine)
- Scorrier
- Sinns Common
- Tarewaste
- Redruth
- Cornwall
- England
- Cornwall
- Redruth
- Tarewaste
- Tolgus Group
- Tolgus Mill
- Tolgus Mount
- Treleigh Consols (New Treleigh Consols)
- Treleigh Wood Mine
- Treskerby
- Treskerby and Chance United Mine (incl. Treskerby Mine; Wheal Chance)
- West Wheal Peevor
- Wheal Boys
- Wheal Buller and Beauchamp
- Wheal Cupid
- Wheal Derrick
- Wheal Peevor
- Wheal Sparnon
- Wheal Trefula (incl. Wheal Lily)
- Wheal Trefusis (incl. East Wheal Trefusis)
- Wheal Union
- Wheal Uny
- Redruth
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornubian mining districtMining District
- Cornwall
- Camborne-Redruth and St Day Mining DistrictMining District
- St Day
- St Aubyn United Mines (Grambler and St Aubyn Mines)Group of Mines
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Redruth, Cornwall, England, UK