Log In
Timmins, Cochrane District, Ontario, Canadai
| Regional Level Types | |
|---|---|
| Timmins | City |
| Cochrane District | District |
| Ontario | Province |
| Canada | Country |
This page is currently not sponsored. Click here to sponsor this page.
For the sake of simplicity, Timmins area is defined as anything within 40km of the center of the City of Timmins (corner of Pine Street and Highway 101).
The Timmins-Porcupine mining camp is the world’s largest Archean orogenic gold camp, having produced > 2,190 metric tons Au (70.5 Moz) between 1906 and 2019. The gold deposits of the camp are distributed over ∼ 50 km of strike length along the Porcupine-Destor fault zone. This includes the world-class Hollinger-McIntyre and Dome deposits, which represent archetypal examples of large orogenic quartz-carbonate gold systems. The Dome deposit, where the ore is centered on a folded unconformity between Tisdale volcanic rocks and Timiskaming sedimentary units, also illustrates the spatial relationship between large gold deposits and a regional unconformity. Ore-forming hydrothermal activity in the camp spanned a prolonged period of time, as illustrated by early-stage, low-grade ankerite veins formed between ca. 2690 and 2674 Ma. This was prior to or very early relative to the development of the regional unconformity and sedimentation of the Timiskaming assemblage, and subsequent main-stage gold deposition. The bulk of the gold in the district was deposited syn- to late-main phase of shortening (D3) from about 2660 to 2640 ± 10 Ma. The early carbonatization represents a significant early-stage hydrothermal event in the formation of large structurally controlled gold deposits such as Dome and illustrates the protracted nature of the large-scale CO2-rich metasomatism occurring before and during gold deposition.
Ores mainly consist of networks of steeply to moderately dipping fault-fill quartz-carbonate ± tourmaline ± pyrite veins and associated extensional, variably deformed, shallowly to moderately dipping arrays of sigmoidal veins hosted in highly carbonatized and sericitized rocks that formed during main regional shortening (D3). In contrast, at the Timmins West mine, the Thunder Creek and 144 GAP deposits are early- to syn-Timiskaming intrusion-associated deposits that slightly predate or overlap the main phase of D3 horizontal shortening in which the associated intrusions mainly played a passive role as an older mechanical and chemical trap rock.
The formation of the gold deposits of the Timmins-Porcupine camp is due to several key factors. The PDfz represents a deeply rooted first-order structure and tapped auriferous metamorphic fluids and melts from the upper mantle-lower crust. The fault zone has channeled large volumes of auriferous H2O-CO2-rich fluids to the upper crust late in the evolution of the belt. Several of the gold deposits of the camp are spatially associated with the regional Timiskaming unconformity. The current level of erosion is deep enough to expose the unconformity and to maximize the chance of discovering the quartz-carbonate style of orogenic deposits or the associated hydrothermal footprint, but also allowed for preservation of at least part of the gold deposits that are mainly hosted in the highly reactive Fe-rich basalt of the Tisdale assemblage. Additional key factors include the presence of komatiitic and/or basaltic komatiite flows, competent pre- and syn-Timiskaming subalkaline and alkaline intrusions that predate the main phase of shortening, and the occurrence of a flexure in the trace of the PDfz that may have further facilitated and focused the ore-forming fluid up flow in the most endowed part of the camp. The complex structural and rheological discontinuities, competency contrasts, and early-stage folds with associated fracture and fault networks in the camp provided highly favorable ground-preparation conditions.
The Timmins-Porcupine mining camp is the world’s largest Archean orogenic gold camp, having produced > 2,190 metric tons Au (70.5 Moz) between 1906 and 2019. The gold deposits of the camp are distributed over ∼ 50 km of strike length along the Porcupine-Destor fault zone. This includes the world-class Hollinger-McIntyre and Dome deposits, which represent archetypal examples of large orogenic quartz-carbonate gold systems. The Dome deposit, where the ore is centered on a folded unconformity between Tisdale volcanic rocks and Timiskaming sedimentary units, also illustrates the spatial relationship between large gold deposits and a regional unconformity. Ore-forming hydrothermal activity in the camp spanned a prolonged period of time, as illustrated by early-stage, low-grade ankerite veins formed between ca. 2690 and 2674 Ma. This was prior to or very early relative to the development of the regional unconformity and sedimentation of the Timiskaming assemblage, and subsequent main-stage gold deposition. The bulk of the gold in the district was deposited syn- to late-main phase of shortening (D3) from about 2660 to 2640 ± 10 Ma. The early carbonatization represents a significant early-stage hydrothermal event in the formation of large structurally controlled gold deposits such as Dome and illustrates the protracted nature of the large-scale CO2-rich metasomatism occurring before and during gold deposition.
Ores mainly consist of networks of steeply to moderately dipping fault-fill quartz-carbonate ± tourmaline ± pyrite veins and associated extensional, variably deformed, shallowly to moderately dipping arrays of sigmoidal veins hosted in highly carbonatized and sericitized rocks that formed during main regional shortening (D3). In contrast, at the Timmins West mine, the Thunder Creek and 144 GAP deposits are early- to syn-Timiskaming intrusion-associated deposits that slightly predate or overlap the main phase of D3 horizontal shortening in which the associated intrusions mainly played a passive role as an older mechanical and chemical trap rock.
The formation of the gold deposits of the Timmins-Porcupine camp is due to several key factors. The PDfz represents a deeply rooted first-order structure and tapped auriferous metamorphic fluids and melts from the upper mantle-lower crust. The fault zone has channeled large volumes of auriferous H2O-CO2-rich fluids to the upper crust late in the evolution of the belt. Several of the gold deposits of the camp are spatially associated with the regional Timiskaming unconformity. The current level of erosion is deep enough to expose the unconformity and to maximize the chance of discovering the quartz-carbonate style of orogenic deposits or the associated hydrothermal footprint, but also allowed for preservation of at least part of the gold deposits that are mainly hosted in the highly reactive Fe-rich basalt of the Tisdale assemblage. Additional key factors include the presence of komatiitic and/or basaltic komatiite flows, competent pre- and syn-Timiskaming subalkaline and alkaline intrusions that predate the main phase of shortening, and the occurrence of a flexure in the trace of the PDfz that may have further facilitated and focused the ore-forming fluid up flow in the most endowed part of the camp. The complex structural and rheological discontinuities, competency contrasts, and early-stage folds with associated fracture and fault networks in the camp provided highly favorable ground-preparation conditions.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities110 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Allargentum ? | 2.AA.30 | (Ag1-xSbx) |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Eucairite | 2.BA.50 | AgCuSe |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Fischesserite | 2.BA.75 | Ag3AuSe2 |
| ⓘ | Petzite | 2.BA.75 | Ag3AuTe2 |
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Klockmannite | 2.CA.05b | CuSe |
| ⓘ | Coloradoite | 2.CB.05a | HgTe |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Roquesite | 2.CB.10a | CuInS2 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannoidite | 2.CB.15c | Cu+6Cu2+2(Fe2+,Zn)3Sn2S12 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Kiddcreekite (TL) | 2.CB.35a | Cu6SnWS8 |
| ⓘ | Vinciennite | 2.CB.35a | Cu+7Cu2+3Fe2+2Fe3+2Sn(As,Sb)S16 |
| ⓘ | Cadmoselite | 2.CB.45 | CdSe |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Fletcherite | 2.DA.05 | CuNi2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Laitakarite | 2.DC.05 | Bi4(Se,S)3 |
| ⓘ | Tellurobismuthite | 2.DC.05 | Bi2Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Sylvanite | 2.EA.05 | AgAuTe4 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Cattierite | 2.EB.05a | CoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Vaesite | 2.EB.05a | NiS2 |
| ⓘ | Pyrite var. Nickel-bearing Pyrite | 2.EB.05a | (Fe,Ni)S2 |
| ⓘ | var. Cobalt-bearing Pyrite | 2.EB.05a | (Fe,Co)S2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Pyrostilpnite | 2.GA.10 | Ag3SbS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Aleksite | 2.GC.40a | PbBi2Te2S2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Bohdanowiczite | 2.JA.20 | AgBiSe2 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Junoite | 2.JB.25a | Cu2Pb3Bi8(S,Se)16 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Magnesite var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Pyroaurite | 5.DA.50 | Mg6Fe3+2(OH)16[CO3] · 4H2O |
| ⓘ | Stichtite | 5.DA.50 | Mg6Cr3+2(OH)16[CO3] · 4H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Grossular var. Hibschite | 9.AD.25 | Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite ? | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻Na2(Fe2+3Fe3+2)Si8O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite var. Daphnite | 9.EC.55 | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| ⓘ | Clinochlore var. Ripidolite | 9.EC.55 | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | 'Clinochrysotile' | 9.ED. | Mg3(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Stilpnomelane | 9.EG.40 | K4Fe2+48[Si64Al8]O164(OH)52 · nH2O |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Asbestos' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Chromite-Magnesiochromite Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'var. Picrolite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Tetrahedrite Group' | - | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| H | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| H | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| H | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| H | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| O | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| O | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Chromite-Magnesiochromite Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Chromite-Magnesiochromite Series | |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mg | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Al | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinochrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
| Si | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Si | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Aleksite | PbBi2Te2S2 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Cattierite | CoS2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Fletcherite | CuNi2S4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Kiddcreekite | Cu6SnWS8 |
| S | ⓘ Laitakarite | Bi4(Se,S)3 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrostilpnite | Ag3SbS3 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Roquesite | CuInS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Vaesite | NiS2 |
| S | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| S | ⓘ Pyrite var. Nickel-bearing Pyrite | (Fe,Ni)S2 |
| S | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| S | ⓘ Tetrahedrite Group | M2(A6)M1(B4 C2)X3(D4)S1(Y12)S2(Z) |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Stichtite | Mg6Cr23+(OH)16[CO3] · 4H2O |
| Cr | ⓘ Chromite-Magnesiochromite Series | |
| Mn | Manganese | |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Chamosite var. Daphnite | (Fe,Mg)5Al(Si,Al)4O10(OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Pyroaurite | Mg6Fe23+(OH)16[CO3] · 4H2O |
| Fe | ⓘ Riebeckite | ◻Na2(Fe32+Fe23+)Si8O22(OH)2 |
| Fe | ⓘ Clinochlore var. Ripidolite | (Mg,Fe,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Fe | ⓘ Stilpnomelane | K4Fe482+[Si64Al8]O164(OH)52 · nH2O |
| Fe | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Chromite-Magnesiochromite Series | |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Fe | ⓘ Pyrite var. Nickel-bearing Pyrite | (Fe,Ni)S2 |
| Fe | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Fe | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cattierite | CoS2 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Pyrite var. Cobalt-bearing Pyrite | (Fe,Co)S2 |
| Ni | Nickel | |
| Ni | ⓘ Fletcherite | CuNi2S4 |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Vaesite | NiS2 |
| Ni | ⓘ Pyrite var. Nickel-bearing Pyrite | (Fe,Ni)S2 |
| Ni | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Eucairite | AgCuSe |
| Cu | ⓘ Fletcherite | CuNi2S4 |
| Cu | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Kiddcreekite | Cu6SnWS8 |
| Cu | ⓘ Klockmannite | CuSe |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Roquesite | CuInS2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | ⓘ Serpentine Subgroup var. Picrolite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Se | Selenium | |
| Se | ⓘ Bohdanowiczite | AgBiSe2 |
| Se | ⓘ Cadmoselite | CdSe |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Eucairite | AgCuSe |
| Se | ⓘ Fischesserite | Ag3AuSe2 |
| Se | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Se | ⓘ Klockmannite | CuSe |
| Se | ⓘ Laitakarite | Bi4(Se,S)3 |
| Se | ⓘ Naumannite | Ag2Se |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Allargentum | (Ag1-xSbx) |
| Ag | ⓘ Bohdanowiczite | AgBiSe2 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eucairite | AgCuSe |
| Ag | ⓘ Fischesserite | Ag3AuSe2 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Petzite | Ag3AuTe2 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Pyrostilpnite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Sylvanite | AgAuTe4 |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Cd | Cadmium | |
| Cd | ⓘ Cadmoselite | CdSe |
| In | Indium | |
| In | ⓘ Roquesite | CuInS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Kiddcreekite | Cu6SnWS8 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Stannoidite | Cu6+Cu22+(Fe2+,Zn)3Sn2S12 |
| Sn | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Sb | Antimony | |
| Sb | ⓘ Allargentum | (Ag1-xSbx) |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Pyrostilpnite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Vinciennite | Cu7+Cu32+Fe22+Fe23+Sn(As,Sb)S16 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Te | Tellurium | |
| Te | ⓘ Aleksite | PbBi2Te2S2 |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Coloradoite | HgTe |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Petzite | Ag3AuTe2 |
| Te | ⓘ Sylvanite | AgAuTe4 |
| Te | ⓘ Tellurobismuthite | Bi2Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Kiddcreekite | Cu6SnWS8 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstenite | WS2 |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Fischesserite | Ag3AuSe2 |
| Au | ⓘ Native Gold | Au |
| Au | ⓘ Petzite | Ag3AuTe2 |
| Au | ⓘ Sylvanite | AgAuTe4 |
| Hg | Mercury | |
| Hg | ⓘ Coloradoite | HgTe |
| Pb | Lead | |
| Pb | ⓘ Aleksite | PbBi2Te2S2 |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Bi | Bismuth | |
| Bi | ⓘ Aleksite | PbBi2Te2S2 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bohdanowiczite | AgBiSe2 |
| Bi | ⓘ Junoite | Cu2Pb3Bi8(S,Se)16 |
| Bi | ⓘ Laitakarite | Bi4(Se,S)3 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Tellurobismuthite | Bi2Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Ontario
- Ontario
Other Regions, Features and Areas that Intersect
Canada
- Ontario
- Cochrane District
- Timmins
- Porcupine mining districtMining District
- Timmins
- Cochrane District
North AmericaContinent
North America PlateTectonic Plate
- Superior Craton
- Wawa-Abitibi TerraneCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
[1]Behnia, Pouran; Mokhtari, Ahmad Reza; Harris, Jeff; Simmons, Jack M.; Ayer, John; Naghizadeh, Mostafa (2026) Influence of training data confidence on random forest–based gold mineral prospectivity models in the Timmins Region, Canada. Ore Geology Reviews, 191. 107211 doi:10.1016/j.oregeorev.2026.107211
Timmins, Cochrane District, Ontario, Canada