Log In
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
French:
Comté de Västmanland, Suède
German:
Västmanlands län, Schweden
Italian:
Contea di Västmanland, Svezia
Russian:
Вестманланд, Швеция
Simplified Chinese:
西曼兰省, 瑞典
Spanish:
Provincia de Västmanland, Suecia
Swedish:
Västmanlands län, Sverige
Arabic:
مقاطعة فستمانلاند, السويد
Asturian:
Provincia de Västmanland, Suecia
Basque:
Västmanlandeko konderria, Suedia
Belarusian:
Вестманланд, Швецыя
Belarusian (Tarashkevitsa):
Вэстманлянд, Швэцыя
Bosnian:
Kotar Västmanland, Švedska
Bulgarian:
Вестманланд, Швеция
Catalan:
Comtat de Västmanland, Suècia
Cebuano:
Västmanlands län, Suwesya
Cornish:
Konteth Västmanland, Swedherwyk
Croatian:
Županija Västmanland, Švedska
Czech:
Västmanland, Švédsko
Danish:
Västmanlands län, Sverige
Dutch:
Västmanlands län, Zweden
Esperanto:
Västmanlands län, Svedio
Estonian:
Västmanlandi lään, Rootsi
Faroese:
Västmanlands län, Svøríki
Farsi/Persian:
شهرستان وستمانلاند, سوئد
Finnish:
Västmanlandin lääni, Ruotsi
Galician:
Condado de Västmanland, Suecia
Hindi:
वेस्तमानलान्द लैन, स्वीडन
Hungarian:
Västmanland megye, Svédország
Indonesian:
Daerah Västmanland, Swedia
Japanese:
ヴェストマンランド県, スウェーデン
Korean:
베스트만란드주, 스웨덴
Latin:
Vestmanniae Comitatus, Suecia
Latvian:
Vestmanlandes lēne, Zviedrija
Limburgian:
Västmanlands län, Zwede
Lithuanian:
Vestmanlandas, Švedija
Low Saxon/Low German:
Lehn Västmanland, Sweden
Macedonian:
Вестманланд, Шведска
Malay:
Daerah Västmanland, Sweden
Northern Sami:
Västmanlándda leatna, Ruoŧŧa
Norwegian:
Västmanlands län, Sverige
Norwegian (Nynorsk):
Västmanlands län, Sverige
Polish:
Västmanland, Szwecja
Portuguese:
Västmanland, Suécia
Romanian:
Västmanlands län, Suedia
Scots:
Västmanland Coonty, Swaden
Scottish Gaelic:
Västmanlands län, An t-Suain
Serbian:
Вестманланд, Шведска
Serbo-Croatian:
Västmanland, Švedska
Swahili:
Västmanlands län, Uswidi
Turkish:
Västmanland ili, İsveç
Ukrainian:
Вестманланд, Швеція
Urdu:
ویستمانلاند کاؤنٹی, سویڈن
Vietnamese:
Västmanland, Thụy Điển
Volapük:
Västmanläniän, Svedän
Waray:
Condado han Västmanland, Suwesya
West Frisian:
Västmanlands län, Sweden
Västmanland County (Swedish: Västmanlands län) is a county or län in central Sweden. It borders the counties of Södermanland, Örebro, Gävleborg, Dalarna and Uppsala. The county also has a stretch of shoreline towards Mälaren (Sweden's third largest lake).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities232 valid minerals. 22 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 29 localities in this region. |
| ⓘ 'Actinolite-Tremolite Series' |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Aegirine-augite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Aegirine-augite var. Urbanite Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ Akatoreite Formula: Mn2+9Al2Si8O24(OH)8 |
| ⓘ Alabandite Formula: MnS |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 18 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Reported from at least 16 localities in this region. |
| ⓘ Allargentum Formula: (Ag1-xSbx) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Localities: Reported from at least 9 localities in this region. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Clinoamphibole' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Andalusite Formula: Al2(SiO4)O Localities: Reported from at least 6 localities in this region. |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Andradite var. Bredbergite Formula: (Ca,Mg)3Fe2(SiO4)3 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Anthophyllite Formula: ◻Mg2Mg5(Si8O22)(OH)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ 'Apatite Group' Description: johnbaumite-svabite series |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Åsgruvanite-(Ce) (TL) Formula: Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 Localities: |
| ⓘ Arrheniusite-(Ce) (TL) Formula: CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 Type Locality: References: Miyawaki, Ritsuro, Hatert, Frédéric, Pasero, Marco, Mills, Stuart J. (2020) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) – Newsletter 53. European Journal of Mineralogy, 32 (1) 209-213 doi:10.5194/ejm-32-209-2020 Holtstam, Dan; Bindi, Luca; Bonazzi, Paola; Förster, Hans-Jürgen; Andersson, Ulf B. (2021) Arrheniusite-(Ce), CaMg[(Ce7Y3)Ca5](SiO4)3(Si3B3O18)(AsO4)(BO3)F11, a New Member of the Vicanite Group, from the Östanmossa Mine, Norberg, Sweden. The Canadian Mineralogist, 59 (1). 177-189 doi:10.3749/canmin.2000045 |
| ⓘ Arseniopleite Formula: NaCaMnMn2(AsO4)3 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 7 localities in this region. |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F Localities: Reported from at least 6 localities in this region. |
| ⓘ Bastnäsite-(Ce) (TL) Formula: Ce(CO3)F Localities: Reported from at least 18 localities in this region. |
| ⓘ Bastnäsite-(La) Formula: La(CO3)F Localities: Description: Cannot be distinguished from bastnäsite-(Ce) without chemical analysis.
As alteration of fluocerite |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Biotite var. Manganophyllite' Formula: K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Brandtite ? Formula: Ca2Mn2+(AsO4)2 · 2H2O |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Breithauptite Formula: NiSb |
| ⓘ Britholite-(Ce) Formula: (Ce,Ca)5(SiO4)3OH |
| ⓘ 'Britholite Group' Formula: (REE,Ca)5[(Si,P)O4]3X |
| ⓘ Britholite-(Y) Formula: (Y,Ca)5(SiO4)3OH |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 18 localities in this region. |
| ⓘ Calderite Formula: Mn2+3Fe3+2(SiO4)3 References: |
| ⓘ 'Carbonate' |
| ⓘ Carrollite Formula: CuCo2S4 |
| ⓘ Celadonite Formula: K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ Cerianite-(Ce) Formula: Ce4+O2 |
| ⓘ 'Cerite' |
| ⓘ Cerite-(CeCa) (TL) Formula: (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 Localities: Reported from at least 11 localities in this region. |
| ⓘ Cerussite Formula: PbCO3 Description: Cerrusite was found as translucent white to pale brownish twin crystals of 0.5 by 1 cm in size together with small galena crystals in a vug in Kallmora Silver mine. |
| ⓘ Chalcoalumite Formula: CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ Chalcocite Formula: Cu2S Localities: Nya Bastnäs deposit, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Risberg ore field, Norberg, Västmanland County, Sweden Ås mine, Getback ore field, Norberg, Västmanland County, Sweden Bond mine, Risberg ore field, Norberg, Västmanland County, Sweden Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 34 localities in this region. |
| ⓘ 'Chlorite Group' Localities: Reported from at least 10 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Leuchtenbergite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clino-ferro-suenoite Formula: ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 Colour: orange Description: Clinohumite (and chondrodite?) is quite common in the ophicalcite where it occurs as small orange aggregates together with calcite and serpentine, sometimes also together with fluorite. |
| ⓘ 'Clinopyroxene Subgroup' Localities: Bronäs mine, Sala, Sala Municipality, Västmanland County, Sweden Unga Assersorskan Mine, Norberg, Västmanland County, Sweden Fredriksgruvan 1, Norberg, Västmanland County, Sweden Sala Silver Mine, Sala, Sala Municipality, Västmanland County, Sweden Grindgruvan 1, Saladamm Ore field, Sala Municipality, Västmanland County, Sweden |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS Localities: Reported from at least 8 localities in this region. |
| ⓘ Cobaltkieserite (TL) Formula: CoSO4 · H2O Type Locality: |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Coronadite Group' Description: Black balls together with yellow-orange garnets.
EDS analysis gave (Pb0.8Ba0.1Ca0.06)Mn8As0.2 => points to coronadite, another EDS analysis gave (Ba0.68Ca0.11)Mn8 which points to hollandite (Nysten & Lorin 2016)
|
| ⓘ Costibite Formula: CoSbS |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Delhuyarite-(Ce) (TL) Formula: Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 Localities: |
| ⓘ Diaphorite Formula: Ag3Pb2Sb3S8 |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Reported from at least 18 localities in this region. |
| ⓘ Diopside var. Salite (FRL) Formula: CaMgSi2O6 Localities: |
| ⓘ Diopside var. Schefferite Formula: (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| ⓘ Dissakisite-(Ce) Formula: (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ Dollaseite-(Ce) (TL) Formula: (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) Localities: Reported from at least 9 localities in this region. Habit: massive Colour: Brown Description: The composition of the various grains and crystals of allanite group minerals are of an intermediate composition between dissakisite-(Ce), dollaseite-(Ce) and allanite-(Ce). Jansson (2001) distinguishes between dissakisite-(Ce) and dollaseite-(Ce) based on paragenesis. Small, anhedral grains and masses embedded in tremolite and larger tabular crystals embedded in calcite lenses within the tremolite are considered to be dissakisite-(Ce), whereas the material embedded in the dolomite marble associated with norbergite and magnetite is considered to be dollaseite-(Ce). The analytical basis for this distinction is quite slim.
|
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 16 localities in this region. |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Enstatite Formula: Mg2Si2O6 Locality: Norberg, Västmanland County, Sweden |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 14 localities in this region. |
| ⓘ 'Epidote Group' Formula: (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) |
| ⓘ Eugenite Formula: Ag11Hg2 |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Fayalite-Tephroite Series' |
| ⓘ 'Fayalite-Tephroite Series var. Knebelite' Formula: from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ 'Feldspar Group' Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferberite var. Reinite Formula: FeWO4 |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ 'Ferriallanite' |
| ⓘ Ferriallanite-(Ce) Formula: (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Ferriperbøeite-(Ce) (TL) Formula: CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 Localities: |
| ⓘ Ferripyrophyllite Formula: Fe3+Si2O5(OH) |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluoborite (TL) Formula: Mg3(BO3)(F,OH)3 Type Locality: References: |
| ⓘ Fluocerite-(Ce) Formula: CeF3 |
| ⓘ Fluocerite-(La) Formula: LaF3 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorbritholite-(Ce) Formula: (Ce,Ca)5(SiO4)3F Localities: Malmkärra Mine, Norberg, Västmanland County, Sweden Östanmossa mine, Röberg ore field, Norberg, Västmanland County, Sweden Johanna mine, Norberg, Västmanland County, Sweden Södra Hackspikgruvan, Smörberg ore field, Norberg, Västmanland County, Sweden Stålklockan mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Description: large masses weighing several kilograms each have been collected. |
| ⓘ Fluorbritholite-(Nd) (TL) Formula: Ca2Nd3(SiO4)3F Localities: Type Locality: Malmkärra Mine, Norberg, Västmanland County, Sweden |
| ⓘ Fluorbritholite-(Y) Formula: (Y,Ca)5(SiO4)3F |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Freieslebenite Formula: AgPbSbS3 References: |
| ⓘ 'Gadolinite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Gadolinite-(Ce) Formula: (Ce,La,Nd,Y)2Fe2+Be2Si2O10 Localities: Reported from at least 6 localities in this region. Habit: microscopic granular Colour: green |
| ⓘ Gadolinite-(Nd) (TL) Formula: Nd2Fe2+Be2O2(SiO4)2 Localities: Type Locality: Malmkärra Mine, Norberg, Västmanland County, Sweden |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Localities: Reported from at least 7 localities in this region. |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 8 localities in this region. |
| ⓘ Galena var. Silver-bearing Galena Formula: PbS with Ag |
| ⓘ Ganophyllite Formula: (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 24 localities in this region. |
| ⓘ Gatelite-(Ce) Formula: CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| ⓘ 'Gatelite Group' |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Geocronite (TL) Formula: Pb14Sb6S23 Localities: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grunerite Formula: ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ Gudmundite (TL) Formula: FeSbS Localities: Type Locality: Gudmundstorp, Sala Municipality, Västmanland County, Sweden Description: Found in calcite veins in skarn with galena, sphalerite, pyrite and boulangerite. Arsenopyrite is present in the skarn but not in the veins.
|
| ⓘ Gustavite Formula: AgPbBi3S6 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Haapalaite Formula: (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| ⓘ 'Håleniusite' |
| ⓘ Håleniusite-(Ce) Formula: (Ce,La)OF |
| ⓘ Håleniusite-(La) (TL) Formula: (La,Ce)OF Localities: |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 24 localities in this region. |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Hisingerite (TL) Formula: Fe3+2(Si2O5)(OH)4 · 2H2O Localities: Type Locality: Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden |
| ⓘ 'Hjelmite' |
| ⓘ Hodrušite Formula: Cu8Bi12S22 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 Localities: Reported from at least 12 localities in this region. |
| ⓘ Humite Formula: Mg7(SiO4)3F2 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Humite Group' |
| ⓘ 'Humite Subgroup' Formula: n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 Description: A humite mineral is found in the skarn near the contact with dolomite. |
| ⓘ 'Hydroxylbastnäsite' References: Taddei, A.; Holtstam, D.; Jonsson, E.; Förster, H.-J.; Andersson, S. S.; Appelt, O.; Bindi, L. (2025) Exploring the unusual occurrence, chemistry, and structural topology of Åsgruvanite-(Ce), Ce₁₆Ca₅Al(SiO₄)₆(AsO₃)₈(CO₃)₂Cl₃(ClF₃)(OH)₂, a new rare earth element (REE) mineral from Västmanland, Sweden. European Journal of Mineralogy, 37 (6). 937-951 doi:10.5194/ejm-37-937-2025 |
| ⓘ Hydroxylbastnäsite-(Ce) Formula: Ce(CO3)(OH) References: Taddei, A.; Holtstam, D.; Jonsson, E.; Förster, H.-J.; Andersson, S. S.; Appelt, O.; Bindi, L. (2025) Exploring the unusual occurrence, chemistry, and structural topology of Åsgruvanite-(Ce), Ce₁₆Ca₅Al(SiO₄)₆(AsO₃)₈(CO₃)₂Cl₃(ClF₃)(OH)₂, a new rare earth element (REE) mineral from Västmanland, Sweden. European Journal of Mineralogy, 37 (6). 937-951 doi:10.5194/ejm-37-937-2025 |
| ⓘ Ikunolite Formula: Bi4S3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Johnbaumite Formula: Ca5(AsO4)3(OH) |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Kupčíkite Formula: Cu3.4Fe0.6Bi5S10 |
| ⓘ Laitakarite Formula: Bi4(Se,S)3 |
| ⓘ Lanthanite-(Ce) Formula: Ce2(CO3)3 · 8H2O |
| ⓘ Lanthanite-(La) ? Formula: La2(CO3)3 · 8H2O Description: Lanthanite was first described from References: |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Linnaeite (TL) Formula: Co2+Co3+2S4 Localities: |
| ⓘ Lizardite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Löllingite Formula: FeAs2 References: Andersson, Stefan S.; Jonsson, Erik; Sadeghi, Martiya (2024) A synthesis of the REE-Fe-polymetallic mineral system of the REE-line, Bergslagen, Sweden: New mineralogical and textural-paragenetic constraints. Ore Geology Reviews, 174. 106275 doi:10.1016/j.oregeorev.2024.106275 Taddei, A.; Holtstam, D.; Jonsson, E.; Förster, H.-J.; Andersson, S. S.; Appelt, O.; Bindi, L. (2025) Exploring the unusual occurrence, chemistry, and structural topology of Åsgruvanite-(Ce), Ce₁₆Ca₅Al(SiO₄)₆(AsO₃)₈(CO₃)₂Cl₃(ClF₃)(OH)₂, a new rare earth element (REE) mineral from Västmanland, Sweden. European Journal of Mineralogy, 37 (6). 937-951 doi:10.5194/ejm-37-937-2025 |
| ⓘ Luanheite Formula: Ag3Hg |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesiorowlandite-(Y) Formula: Y4(Mg,Fe)(Si2O7)2F2 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 37 localities in this region. |
| ⓘ Magnetite var. Titanium-bearing Magnetite Formula: Fe2+(Fe3+,Ti)2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Risberg ore field, Norberg, Västmanland County, Sweden Sala Silver Mine, Sala, Sala Municipality, Västmanland County, Sweden St Görans Mine, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Per's Copper Mine, Sala Municipality, Västmanland County, Sweden Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Manganohörnesite ? Formula: Mn2+3(AsO4)2 · 8H2O References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl |
| ⓘ Massicot Formula: PbO |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 26 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Moschellandsbergite Formula: Ag2Hg3 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Antimony (TL) Formula: Sb Localities: |
| ⓘ Native Bismuth Formula: Bi Localities: Gamla Bastnäs deposit, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Johanna mine, Norberg, Västmanland County, Sweden Stripåsen Mine, Häste ore field, Norberg, Västmanland County, Sweden Stålklockan mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden |
| ⓘ Native Copper Formula: Cu Localities: Reported from at least 6 localities in this region. |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Gold var. Electrum Formula: (Au,Ag) |
| ⓘ Native Mercury Formula: Hg |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Native Silver var. Kongsbergite Formula: (Ag,Hg) |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Neotocite Formula: (Mn,Fe)SiO3 · H2O (?) |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Norbergite (TL) Formula: Mg3(SiO4)F2 Localities: Reported from at least 8 localities in this region. Colour: pink, white, purplish Description: NOrbergite occurs as massive occurs in massive pink (purplish) to white aggregates and is associated with tremolite and an epidote group minerals. Only massive aggregates have been found Östanmossa iron mine |
| ⓘ 'Olivine Group' Formula: M2SiO4 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ Paraschachnerite Formula: Ag3Hg2 |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Perbøeite-(Ce) Formula: CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ Percleveite-(Ce) (TL) Formula: Ce2Si2O7 Localities: |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 Locality: Norberg, Västmanland County, Sweden |
| ⓘ Pilsenite Formula: Bi4Te3 |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 24 localities in this region. |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 27 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 References: |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] Localities: Reported from at least 6 localities in this region. |
| ⓘ Richterite Formula: Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z Description: Described as a calcioromeite References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ Sarkinite Formula: Mn2+2(AsO4)(OH) References: |
| ⓘ 'Scapolite' |
| ⓘ Schachnerite Formula: Ag1.1Hg0.9 |
| ⓘ Scheelite Formula: Ca(WO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 Localities: Reported from at least 8 localities in this region. |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Smolyaninovite Formula: Co3Fe3+2(AsO4)4 · 11H2O |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 11 localities in this region. |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Svabite ? Formula: Ca5(AsO4)3F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F Localities: Reported from at least 6 localities in this region. |
| ⓘ Szaibélyite Formula: MgBO2(OH) |
| ⓘ Taipingite-(CeCa) Formula: (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 17 localities in this region. |
| ⓘ 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ Tavagnascoite Formula: Bi4O4(SO4)(OH)2 |
| ⓘ Tephroite Formula: Mn2+2(SiO4) |
| ⓘ Tetradymite Formula: Bi2Te2S Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Tetradymite Group' |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ 'Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite' Formula: Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Titanite Formula: CaTiO(SiO4) Localities: Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Risberg ore field, Norberg, Västmanland County, Sweden Ås mine, Getback ore field, Norberg, Västmanland County, Sweden Bond mine, Risberg ore field, Norberg, Västmanland County, Sweden Sala Silver Mine, Sala, Sala Municipality, Västmanland County, Sweden |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Törnebohmite' |
| ⓘ Törnebohmite-(Ce) (TL) Formula: Ce2Al(SiO4)2(OH) Localities: Reported from at least 10 localities in this region. Description: First described as Törnebohmite. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z Localities: Sjögruvan, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Bronäs mine, Sala, Sala Municipality, Västmanland County, Sweden Käringbricka, Västerfärnebo, Sala Municipality, Västmanland County, Sweden Häste ore field, Norberg, Västmanland County, Sweden Malmkärra Mine, Norberg, Västmanland County, Sweden |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Reported from at least 33 localities in this region. |
| ⓘ Twinnite Formula: Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ Ulfanderssonite-(Ce) (TL) Formula: (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 Localities: Type Locality: Malmkärra Mine, Norberg, Västmanland County, Sweden |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ 'UM2007-35-SiO:AlCaFFeMgREE' Formula: Ca(Ce,La)3Al2Fe2+2(Si2O7)(SiO4)3(OH)2F |
| ⓘ 'UM2007-36-SiO:AlCaFFeMgREE' Formula: (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ 'UM2007-38-SiO:ClFFeHMgREE' Formula: (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| ⓘ 'UM2007-39-SiO:ClFHMgREE' Formula: (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| ⓘ 'UM2007-40-SiO:FMgREE' Formula: (Y,Ce,Nd)4MgSi4O14F2 |
| ⓘ 'Unnamed (Fe3+-analogue of Gatelite-(Ce))' Formula: CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Västmanlandite-(Ce) (TL) Formula: CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 Localities: Malmkärra Mine, Norberg, Västmanland County, Sweden Stålklockan mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Old Morberg ore field, Norberg, Västmanland County, Sweden Johanna mine, Norberg, Västmanland County, Sweden Södra Hackspikgruvan, Smörberg ore field, Norberg, Västmanland County, Sweden Type Locality: Malmkärra Mine, Norberg, Västmanland County, Sweden |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ 'Wolframite Group' |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: Nya Bastnäs deposit, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Gamla Bastnäs deposit, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Storgruvan, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Källfall Mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Old Morberg ore field, Norberg, Västmanland County, Sweden |
| ⓘ Zippeite Formula: K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Gamla Bastnäs deposit, Bastnäs Mines, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Stripåsen Mine, Häste ore field, Norberg, Västmanland County, Sweden Källfall Mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden Västra Långgruvorna mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Zoisite var. Thulite ? Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold var. Electrum | 1.AA.05 | (Au,Ag) |
| ⓘ | 1.AA.05 | Au | |
| ⓘ | Native Silver var. Kongsbergite | 1.AA.05 | (Ag,Hg) |
| ⓘ | 1.AA.05 | Ag | |
| ⓘ | Native Mercury | 1.AD.05 | Hg |
| ⓘ | Paraschachnerite | 1.AD.15a | Ag3Hg2 |
| ⓘ | Schachnerite | 1.AD.15a | Ag1.1Hg0.9 |
| ⓘ | Luanheite | 1.AD.15b | Ag3Hg |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Moschellandsbergite | 1.AD.15d | Ag2Hg3 |
| ⓘ | Native Antimony (TL) | 1.CA.05 | Sb |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Allargentum | 2.AA.30 | (Ag1-xSbx) |
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Breithauptite | 2.CC.05 | NiSb |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite (TL) | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Ikunolite | 2.DC.05 | Bi4S3 |
| ⓘ | Laitakarite | 2.DC.05 | Bi4(Se,S)3 |
| ⓘ | Pilsenite | 2.DC.05 | Bi4Te3 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Costibite | 2.EB.10d | CoSbS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite (TL) | 2.EB.20 | FeSbS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Haapalaite | 2.FD.30 | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Mercury-bearing Tetrahedrite' | 2.GB.05 | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Twinnite | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Kupčíkite | 2.JA.10b | Cu3.4Fe0.6Bi5S10 |
| ⓘ | Hodrušite | 2.JA.10c | Cu8Bi12S22 |
| ⓘ | Diaphorite | 2.JB.05 | Ag3Pb2Sb3S8 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Geocronite (TL) | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Gustavite | 2.JB.40a | AgPbBi3S6 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Fluocerite-(Ce) | 3.AC.15 | CeF3 |
| ⓘ | Fluocerite-(La) | 3.AC.15 | LaF3 |
| ⓘ | Håleniusite-(Ce) | 3.DE. | (Ce,La)OF |
| ⓘ | Håleniusite-(La) (TL) | 3.DE.05 | (La,Ce)OF |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Magnetite var. Titanium-bearing Magnetite | 4.BB.05 | Fe2+(Fe3+,Ti)2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | var. Reinite | 4.DB.30 | FeWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | Ce4+O2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bastnäsite-(Ce) (TL) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Bastnäsite-(La) | 5.BD.20a | La(CO3)F |
| ⓘ | Hydroxylbastnäsite-(Ce) | 5.BD.20a | Ce(CO3)(OH) |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Lanthanite-(Ce) | 5.CC.25 | Ce2(CO3)3 · 8H2O |
| ⓘ | Lanthanite-(La) ? | 5.CC.25 | La2(CO3)3 · 8H2O |
| Group 6 - Borates | |||
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| ⓘ | Fluoborite (TL) | 6.AB.50 | Mg3(BO3)(F,OH)3 |
| ⓘ | Szaibélyite | 6.BA.15 | MgBO2(OH) |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Tavagnascoite | 7.BB.35 | Bi4O4(SO4)(OH)2 |
| ⓘ | Cobaltkieserite (TL) | 7.CB.05 | CoSO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Chalcoalumite | 7.DD.75 | CuAl4(SO4)(OH)12 · 3H2O |
| ⓘ | Zippeite | 7.EC.05 | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Arseniopleite | 8.AC.10 | NaCaMnMn2(AsO4)3 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Sarkinite | 8.BB.15 | Mn2+2(AsO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Johnbaumite | 8.BN.05 | Ca5(AsO4)3(OH) |
| ⓘ | Svabite ? | 8.BN.05 | Ca5(AsO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Manganohörnesite ? | 8.CE.40 | Mn2+3(AsO4)2 · 8H2O |
| ⓘ | Brandtite ? | 8.CG.10 | Ca2Mn2+(AsO4)2 · 2H2O |
| ⓘ | Smolyaninovite | 8.CH.55 | Co3Fe3+2(AsO4)4 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Tephroite | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Andradite var. Bredbergite | 9.AD.25 | (Ca,Mg)3Fe2(SiO4)3 |
| ⓘ | Calderite | 9.AD.25 | Mn2+3Fe3+2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Norbergite (TL) | 9.AF.40 | Mg3(SiO4)F2 |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Humite | 9.AF.50 | Mg7(SiO4)3F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Taipingite-(CeCa) | 9.AG.12 | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Cerite-(CeCa) (TL) | 9.AG.20 | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| ⓘ | Törnebohmite-(Ce) (TL) | 9.AG.45 | Ce2Al(SiO4)2(OH) |
| ⓘ | Ulfanderssonite-(Ce) (TL) | 9.AG.52 | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| ⓘ | Fluorbritholite-(Nd) (TL) | 9.AH. | Ca2Nd3(SiO4)3F |
| ⓘ | Britholite-(Ce) | 9.AH.25 | (Ce,Ca)5(SiO4)3OH |
| ⓘ | Britholite-(Y) | 9.AH.25 | (Y,Ca)5(SiO4)3OH |
| ⓘ | Fluorbritholite-(Ce) | 9.AH.25 | (Ce,Ca)5(SiO4)3F |
| ⓘ | Fluorbritholite-(Y) | 9.AH.25 | (Y,Ca)5(SiO4)3F |
| ⓘ | Arrheniusite-(Ce) (TL) | 9.AJ. | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| ⓘ | Gadolinite-(Ce) | 9.AJ.20 | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Gadolinite-(Nd) (TL) | 9.AJ.20 | Nd2Fe2+Be2O2(SiO4)2 |
| ⓘ | Percleveite-(Ce) (TL) | 9.BC.35 | Ce2Si2O7 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Delhuyarite-(Ce) (TL) | 9.BE. | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Magnesiorowlandite-(Y) | 9.BE.90 | Y4(Mg,Fe)(Si2O7)2F2 |
| ⓘ | Dollaseite-(Ce) (TL) | 9.BG.05 | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Dissakisite-(Ce) | 9.BG.05b | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| ⓘ | Ferriallanite-(Ce) | 9.BG.05b | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite ? | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Gatelite-(Ce) | 9.BG.50 | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Perbøeite-(Ce) | 9.BG.50 | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Ferriperbøeite-(Ce) (TL) | 9.BG.50 | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Västmanlandite-(Ce) (TL) | 9.BG.55 | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| ⓘ | Akatoreite | 9.BH.15 | Mn2+9Al2Si8O24(OH)8 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Diopside var. Schefferite | 9.DA.15 | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| ⓘ | var. Salite (TL) | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Aegirine-augite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | var. Urbanite | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Anthophyllite | 9.DD.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Clino-ferro-suenoite | 9.DE.10 | ◻Mn2+2(Fe2+5)(Si8O22)(OH)2 |
| ⓘ | Richterite | 9.DE.20 | Na(CaNa)Mg5(Si8O22)(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Ferripyrophyllite | 9.EC.10 | Fe3+Si2O5(OH) |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Celadonite | 9.EC.15 | K(MgFe3+◻)(Si4O10)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Leuchtenbergite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Hisingerite (TL) | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Lizardite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe)SiO3 · H2O (?) |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Ganophyllite | 9.EG.30 | (K,Na)xMn2+6(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Åsgruvanite-(Ce) (TL) | 9.FB. | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Biotite var. Manganophyllite' | - | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Cerite' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Actinolite-Tremolite Series' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Fayalite-Tephroite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Fayalite-Tephroite Series var. Knebelite' | - | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Humite Group' | - | |
| ⓘ | 'Olivine Group' | - | M2SiO4 |
| ⓘ | 'Coronadite Group' | - | |
| ⓘ | 'Tetradymite Group' | - | |
| ⓘ | 'Hjelmite' | - | |
| ⓘ | 'UM2007-35-SiO:AlCaFFeMgREE' | - | Ca(Ce,La)3Al2Fe2+2(Si2O7)(SiO4)3(OH)2F |
| ⓘ | 'Britholite Group' | - | (REE,Ca)5[(Si,P)O4]3X |
| ⓘ | 'Törnebohmite' | - | |
| ⓘ | 'Apatite Group' | - | |
| ⓘ | 'Hydroxylbastnäsite' | - | |
| ⓘ | 'Ferriallanite' | - | |
| ⓘ | 'UM2007-39-SiO:ClFHMgREE' | - | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| ⓘ | 'UM2007-40-SiO:FMgREE' | - | (Y,Ce,Nd)4MgSi4O14F2 |
| ⓘ | 'UM2007-36-SiO:AlCaFFeMgREE' | - | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | 'Humite Subgroup' | - | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Epidote Group' | - | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Carbonate' | - | |
| ⓘ | 'Gatelite Group' | - | |
| ⓘ | 'UM2007-38-SiO:ClFFeHMgREE' | - | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| ⓘ | 'Unnamed (Fe3+-analogue of Gatelite-(Ce))' | - | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | 'Amphibole Supergroup var. Clinoamphibole' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Håleniusite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Akatoreite | Mn92+Al2Si8O24(OH)8 |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| H | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| H | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| H | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| H | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| H | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| H | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| H | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| H | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| H | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| H | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| H | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| H | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Szaibélyite | MgBO2(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| H | ⓘ Actinolite-Tremolite Series | |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| H | ⓘ Cobaltkieserite | CoSO4 · H2O |
| H | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| H | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| H | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ Humite Subgroup | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| H | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| H | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| H | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| H | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| H | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| H | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| H | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| H | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| Be | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Be | ⓘ Phenakite | Be2SiO4 |
| Be | ⓘ Gadolinite-(Nd) | Nd2Fe2+Be2O2(SiO4)2 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Szaibélyite | MgBO2(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite-(La) | La(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| C | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| C | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Akatoreite | Mn92+Al2Si8O24(OH)8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| O | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite-(La) | La(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Andradite var. Bredbergite | (Ca,Mg)3Fe2(SiO4)3 |
| O | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| O | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| O | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| O | ⓘ Cerianite-(Ce) | Ce4+O2 |
| O | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| O | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Humite | Mg7(SiO4)3F2 |
| O | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| O | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Massicot | PbO |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| O | ⓘ Norbergite | Mg3(SiO4)F2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phenakite | Be2SiO4 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Svabite | Ca5(AsO4)3F |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Szaibélyite | MgBO2(OH) |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| O | ⓘ Actinolite-Tremolite Series | |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Fayalite-Tephroite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Diopside var. Salite | CaMgSi2O6 |
| O | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Percleveite-(Ce) | Ce2Si2O7 |
| O | ⓘ Håleniusite-(La) | (La,Ce)OF |
| O | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| O | ⓘ Cobaltkieserite | CoSO4 · H2O |
| O | ⓘ Ferberite var. Reinite | FeWO4 |
| O | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Olivine Group | M2SiO4 |
| O | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| O | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| O | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| O | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| O | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| O | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| O | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Humite Subgroup | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| O | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| O | ⓘ Gadolinite-(Nd) | Nd2Fe2+Be2O2(SiO4)2 |
| O | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| O | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| O | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| O | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| O | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| O | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| O | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| O | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Håleniusite-(Ce) | (Ce,La)OF |
| O | ⓘ Fluorbritholite-(Nd) | Ca2Nd3(SiO4)3F |
| O | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| F | Fluorine | |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite-(La) | La(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| F | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| F | ⓘ Fluocerite-(Ce) | CeF3 |
| F | ⓘ Fluocerite-(La) | LaF3 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Humite | Mg7(SiO4)3F2 |
| F | ⓘ Norbergite | Mg3(SiO4)F2 |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Svabite | Ca5(AsO4)3F |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Håleniusite-(La) | (La,Ce)OF |
| F | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| F | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| F | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| F | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| F | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| F | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| F | ⓘ Humite Subgroup | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| F | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| F | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| F | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| F | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| F | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Håleniusite-(Ce) | (Ce,La)OF |
| F | ⓘ Fluorbritholite-(Nd) | Ca2Nd3(SiO4)3F |
| F | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Andradite var. Bredbergite | (Ca,Mg)3Fe2(SiO4)3 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Mg | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| Mg | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Fluoborite | Mg3(BO3)(F,OH)3 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| Mg | ⓘ Humite | Mg7(SiO4)3F2 |
| Mg | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Norbergite | Mg3(SiO4)F2 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Szaibélyite | MgBO2(OH) |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Actinolite-Tremolite Series | |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Diopside var. Salite | CaMgSi2O6 |
| Mg | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Mg | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| Mg | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| Mg | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| Mg | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| Mg | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Mg | ⓘ Humite Subgroup | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| Mg | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| Mg | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| Mg | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| Mg | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| Mg | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Mg | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Akatoreite | Mn92+Al2Si8O24(OH)8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| Al | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Al | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Al | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Al | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Akatoreite | Mn92+Al2Si8O24(OH)8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Si | ⓘ Anthophyllite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Andradite var. Bredbergite | (Ca,Mg)3Fe2(SiO4)3 |
| Si | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Si | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Si | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Si | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| Si | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Si | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Humite | Mg7(SiO4)3F2 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lizardite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Si | ⓘ Norbergite | Mg3(SiO4)F2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phenakite | Be2SiO4 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Si | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Actinolite-Tremolite Series | |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Fayalite-Tephroite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Diopside var. Salite | CaMgSi2O6 |
| Si | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Percleveite-(Ce) | Ce2Si2O7 |
| Si | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Si | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Olivine Group | M2SiO4 |
| Si | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Si | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Si | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Si | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| Si | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| Si | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| Si | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Humite Subgroup | n[Mg2(SiO4)] · Mg(OH,F)2 with n = 1, 2, 3, or 4 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote Group | (A12+A22+)(M13+M23+M33+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Gadolinite-(Nd) | Nd2Fe2+Be2O2(SiO4)2 |
| Si | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| Si | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| Si | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Si | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| Si | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| Si | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Si | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Fluorbritholite-(Nd) | Ca2Nd3(SiO4)3F |
| Si | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| P | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Costibite | CoSbS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gustavite | AgPbBi3S6 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| S | ⓘ Hodrušite | Cu8Bi12S22 |
| S | ⓘ Ikunolite | Bi4S3 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Laitakarite | Bi4(Se,S)3 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Wittichenite | Cu3BiS3 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| S | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| S | ⓘ Cobaltkieserite | CoSO4 · H2O |
| S | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| S | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| Cl | Chlorine | |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| Cl | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| Cl | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| Cl | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Cl | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| K | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| K | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Ca | ⓘ Andradite var. Bredbergite | (Ca,Mg)3Fe2(SiO4)3 |
| Ca | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Ca | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Richterite | Na(CaNa)Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Actinolite-Tremolite Series | |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Diopside var. Salite | CaMgSi2O6 |
| Ca | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Ca | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Ca | ⓘ Britholite Group | (REE,Ca)5[(Si,P)O4]3X |
| Ca | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Ca | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| Ca | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| Ca | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| Ca | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| Ca | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Ca | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Ca | ⓘ Fluorbritholite-(Nd) | Ca2Nd3(SiO4)3F |
| Ca | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Ti | ⓘ Amphibole Supergroup var. Clinoamphibole | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Akatoreite | Mn92+Al2Si8O24(OH)8 |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Mn | ⓘ Ganophyllite | (K,Na)xMn62+(Si,Al)10O24(OH)4 · nH2O (x = 1-2; n = 7-11) |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Mn | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| Mn | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Fayalite-Tephroite Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Mn | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Andradite var. Bredbergite | (Ca,Mg)3Fe2(SiO4)3 |
| Fe | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Fe | ⓘ Celadonite | K(MgFe3+◻)(Si4O10)(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferripyrophyllite | Fe3+Si2O5(OH) |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Biotite var. Manganophyllite | K(Fe,Mg,Mn)3AlSi3O10(OH)2 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Diopside var. Schefferite | (Ca,Mn)(Mg,Fe,Mn)Si2O6 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Magnetite var. Titanium-bearing Magnetite | Fe2+(Fe3+,Ti)2O4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| Fe | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Fe | ⓘ Actinolite-Tremolite Series | |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Fayalite-Tephroite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | ⓘ Aegirine-augite var. Urbanite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Fe | ⓘ Ferberite var. Reinite | FeWO4 |
| Fe | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Fe | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Fe | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| Fe | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Fe | ⓘ Gadolinite-(Nd) | Nd2Fe2+Be2O2(SiO4)2 |
| Fe | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| Fe | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Fe | ⓘ Clino-ferro-suenoite | ◻Mn22+(Fe52+)(Si8O22)(OH)2 |
| Fe | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Fe | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Costibite | CoSbS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| Co | ⓘ Cobaltkieserite | CoSO4 · H2O |
| Ni | Nickel | |
| Ni | ⓘ Breithauptite | NiSb |
| Ni | ⓘ Haapalaite | (Fe2+,Ni)2(Mg,Fe2+)1.61S2(OH)3.22 |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcoalumite | CuAl4(SO4)(OH)12 · 3H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Hodrušite | Cu8Bi12S22 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Cu | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniopleite | NaCaMnMn2(AsO4)3 |
| As | ⓘ Brandtite | Ca2Mn2+(AsO4)2 · 2H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Johnbaumite | Ca5(AsO4)3(OH) |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Manganohörnesite | Mn32+(AsO4)2 · 8H2O |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Sarkinite | Mn22+(AsO4)(OH) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Svabite | Ca5(AsO4)3F |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| As | ⓘ Smolyaninovite | Co3Fe23+(AsO4)4 · 11H2O |
| As | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| As | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Se | Selenium | |
| Se | ⓘ Laitakarite | Bi4(Se,S)3 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
| Y | ⓘ Magnesiorowlandite-(Y) | Y4(Mg,Fe)(Si2O7)2F2 |
| Y | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| Y | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Allargentum | (Ag1-xSbx) |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Gustavite | AgPbBi3S6 |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Ag | ⓘ Luanheite | Ag3Hg |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Moschellandsbergite | Ag2Hg3 |
| Ag | ⓘ Paraschachnerite | Ag3Hg2 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sb | Antimony | |
| Sb | ⓘ Allargentum | (Ag1-xSbx) |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Breithauptite | NiSb |
| Sb | ⓘ Costibite | CoSbS |
| Sb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Te | ⓘ Pilsenite | Bi4Te3 |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| La | Lanthanum | |
| La | ⓘ Bastnäsite-(La) | La(CO3)F |
| La | ⓘ Fluocerite-(La) | LaF3 |
| La | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| La | ⓘ Lanthanite-(La) | La2(CO3)3 · 8H2O |
| La | ⓘ Håleniusite-(La) | (La,Ce)OF |
| La | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| La | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| La | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| La | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| La | ⓘ Håleniusite-(Ce) | (Ce,La)OF |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Britholite-(Ce) | (Ce,Ca)5(SiO4)3OH |
| Ce | ⓘ Cerianite-(Ce) | Ce4+O2 |
| Ce | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| Ce | ⓘ Dissakisite-(Ce) | (CaCe)(AlAlMg)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Dollaseite-(Ce) | (CaCe)(MgAlMg)F[Si2O7][SiO4](OH) |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Fluocerite-(Ce) | CeF3 |
| Ce | ⓘ Fluorbritholite-(Ce) | (Ce,Ca)5(SiO4)3F |
| Ce | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | ⓘ Hydroxylbastnäsite-(Ce) | Ce(CO3)(OH) |
| Ce | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
| Ce | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Percleveite-(Ce) | Ce2Si2O7 |
| Ce | ⓘ Håleniusite-(La) | (La,Ce)OF |
| Ce | ⓘ Västmanlandite-(Ce) | CaCe3(MgAl2Mg)[Si2O7][SiO4]3F(OH)2 |
| Ce | ⓘ Gatelite-(Ce) | CaCe3(AlAl2Mg)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ UM2007-35-SiO:AlCaFFeMgREE | Ca(Ce,La)3Al2Fe22+(Si2O7)(SiO4)3(OH)2F |
| Ce | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ UM2007-39-SiO:ClFHMgREE | (Ce,La,Ca)9Mg(SiO4)3(SiO3OH)4(Cl,F,OH)3 · nH2O(?) |
| Ce | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| Ce | ⓘ UM2007-36-SiO:AlCaFFeMgREE | (Ce,La)3CaAl2(Fe3+,Al)(Mg,Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| Ce | ⓘ Ulfanderssonite-(Ce) | (Ce15Ca)Σ16Mg2(SiO4)10(SiO3OH)(OH,F)5Cl3 |
| Ce | ⓘ Ferriperbøeite-(Ce) | CaCe3(Fe3+Al2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ Taipingite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3[SiO3(OH)]4F3 |
| Ce | ⓘ Arrheniusite-(Ce) | CaMg[(Ce7Y3)Ca5](SiO4)4(Si2B3AsO18)(BO3)F11 |
| Ce | ⓘ UM2007-38-SiO:ClFFeHMgREE | (Ce,La,Ca)9(Fe,Mg)(SiO4)3[SiO3(OH)]4(F,Cl,OH)3 · nH2O (?) |
| Ce | ⓘ Unnamed (Fe3+-analogue of Gatelite-(Ce)) | CaCe3(Fe3+Al2Mg)[Si2O7][SiO4]3O(OH)2 |
| Ce | ⓘ Håleniusite-(Ce) | (Ce,La)OF |
| Ce | ⓘ Åsgruvanite-(Ce) | Ce16Ca5Al(SiO4)6(AsO3)8(CO3)2Cl4F3(OH)2 |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Nd | ⓘ UM2007-40-SiO:FMgREE | (Y,Ce,Nd)4MgSi4O14F2 |
| Nd | ⓘ Gadolinite-(Nd) | Nd2Fe2+Be2O2(SiO4)2 |
| Nd | ⓘ Fluorbritholite-(Nd) | Ca2Nd3(SiO4)3F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Ferberite var. Reinite | FeWO4 |
| W | ⓘ Delhuyarite-(Ce) | Ce4Mg(Fe3+,W)3◻(Si2O7)2O6(OH)2 |
| Au | Gold | |
| Au | ⓘ Native Gold var. Electrum | (Au,Ag) |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Native Silver var. Kongsbergite | (Ag,Hg) |
| Hg | ⓘ Luanheite | Ag3Hg |
| Hg | ⓘ Native Mercury | Hg |
| Hg | ⓘ Moschellandsbergite | Ag2Hg3 |
| Hg | ⓘ Paraschachnerite | Ag3Hg2 |
| Hg | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Hg | ⓘ Tetrahedrite Subgroup var. Mercury-bearing Tetrahedrite | Cu6[Cu4(Zn,Fe,Hg)2]Sb4S13 |
| Tl | Thallium | |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | Lead | |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Diaphorite | Ag3Pb2Sb3S8 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Gustavite | AgPbBi3S6 |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Gustavite | AgPbBi3S6 |
| Bi | ⓘ Hodrušite | Cu8Bi12S22 |
| Bi | ⓘ Ikunolite | Bi4S3 |
| Bi | ⓘ Laitakarite | Bi4(Se,S)3 |
| Bi | ⓘ Pilsenite | Bi4Te3 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Kupčíkite | Cu3.4Fe0.6Bi5S10 |
| Bi | ⓘ Tavagnascoite | Bi4O4(SO4)(OH)2 |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Zippeite | K3(UO2)4(SO4)2O3(OH) · 3H2O |
Fossils
There are 17 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 17 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 450 Ma (Late/Upper Ordovician) | ||||||
| Oldest Fossil Listed | 461 Ma (Middle Ordovician) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/V%C3%A4stmanland_County |
|---|---|
| Wikidata ID: | Q105075 |
| GeoNames ID: | 2664179 |
Localities in this Region
- Västmanland County
- ⭔Arboga
- ⭔Fagersta
- ⭔Hallstahammar
- ⭔Köping
- ⭔Kungsör
- ⭔Norberg
- ⭔Bålsjö mines
- ⭔Bojmosse ore field
- Elisabetgruvorna mine
- ⭔Eskilsback ore field
- Fredriksgruvan 1
- ⭔Getback ore field
- Hästbäck mine
- Häste ore field
- Johanna mine
- Johannisberg mine
- Kallmora Silver Mine
- ⭔Kallmorberg ore field
- ⭔Kärrgruvan
- Klackberg ore field
- ⭔Kolningsberg ore field
- Korsstensgruvorna mine
- Lång mine
- Lilla Kallmoragruvorna mine
- Malmkärra Mine
- ⭔Mimer ore field
- ⭔Norrberg ore field
- ⭔Old Morberg ore field
- ⭔Ragvald ore field
- Risberg ore field
- Röberg ore field
- Västmanland County
- Norberg
- ⭔Sala Municipality
- ⭔Skinnskatteberg
- Kockgruvan
- Riddarhyttan
- Bäckegruvan
- Bastnäs Mines
- Copper smelter
- Gräsbergs Ore Field
- Hans Urbansson mine field
- Högforsgruvorna mine
- Höggruvorna mine
- Källfall Mine
- ⭔Korphytte ore field
- Lerklockan railway siding
- ⭔Myrback ore field
- Öster mine
- Pellegruvan
- Persgruvan
- Persgruvorna deposit
- Sjögruvan
- Skärsjön mine
- Stålklockan mine
- Storgruvan
- Svavelberget mine
- Tallgruvorna mine
- Västra Långgruvorna mine
- Stora Stripa
- ⭔Surahammar
- ⭔Västerås
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Bergslagen-LivoniaShield
- Transscandinavian Igneous BeltMagmatic Province
EuropeContinent
Sweden
- Bergslagen mining districtMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Öster mine, Riddarhyttan, Skinnskatteberg, Västmanland County, Sweden