Log In
Bad Harzburg, Goslar District, Lower Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Bad Harzburg | Town |
| Goslar District | District |
| Lower Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Bad Harzburg | 22,954 (2015) |
Other Languages:
French:
Bad Harzburg, Goslar, Basse-Saxe, Allemagne
German:
Bad Harzburg, Landkreis Goslar, Niedersachsen, Deutschland
Italian:
Bad Harzburg, circondario di Goslar, Bassa Sassonia, Germania
Low Saxon/Low German:
Bad Harzborch, Landkreis Gosler, Neddersassen, Düütschland
Russian:
Бад-Гарцбург, Гослар, Нижняя Саксония, Германия
Simplified Chinese:
巴德哈尔茨堡, 戈斯拉尔县, 下萨克森, 德国
Spanish:
Bad Harzburg, Distrito de Goslar, Baja Sajonia, Alemania
Afrikaans:
Bad Harzburg, Nedersakse, Duitsland
Anglo-Saxon:
Bæþ Heartesburg, Niðerseaxland, Þēodscland
Arabic:
باد هاغزبورغ, جوسلار , سكسونيا السفلى, ألمانيا
Aragonese:
Bad Harzburg, Baixa Saxonia, Alemanya
Aromanian:
Bad Harzburg, Ghermãnia
Asturian:
Bad Harzburg, Baxa Saxonia, Alemaña
Basque:
Bad Harzburg, Saxonia Beherea, Alemania
Bavarian:
Bad Harzburg, Niedasaxn, Deitschland
Breton:
Bad Harzburg, Saks-Izel, Alamagn
Bulgarian:
Бад Харцбург, Долна Саксония, Германия
Catalan:
Bad Harzburg, Baixa Saxònia, Alemanya
Cebuano:
Bad Harzburg, Landkreis Goslar, Lower Saxony, Alemanya
Corsican:
Bad Harzburg, Germania
Croatian:
Bad Harzburg, Donja Saska, Njemačka
Czech:
Bad Harzburg, Zemský okres Goslar, Dolní Sasko, Německo
Danish:
Bad Harzburg, Landkreis Goslar, Niedersachsen, Tyskland
Dutch:
Bad Harzburg, Landkreis Goslar, Nedersaksen, Duitsland
Dutch Low Saxon:
Bad Harzburg, Nedersaksen, Duutslaand
Esperanto:
Bad Harzburg, Distrikto Goslar, Malsupra Saksio, Germanio
Estonian:
Bad Harzburg, Goslari kreis, Alam-Saksi, Saksamaa
Farsi/Persian:
باد هارزبورگ, گوسلار , نیدرزاکسن, آلمان
Finnish:
Bad Harzburg, Ala-Saksi, Saksa
Franco-Provençal:
Bad Harzburg, Alemagne
Friulian:
Bad Harzburg, Gjermanie
Galician:
Bad Harzburg, Baixa Saxonia, Alemaña
Greek:
Μπαντ Χάρτσμπουργκ, Γκόσλαρ, Κάτω Σαξονία, Γερμανία
Hebrew:
באד הרצבורג, מחוז גוסלאר, סקסוניה התחתונה, גרמניה
Hungarian:
Bad Harzburg, Alsó-Szászország, Németország
Icelandic:
Bad Harzburg, Neðra-Saxland, Þýskaland
Ido:
Bad Harzburg, Infra-Saxonia, Germania
Indonesian:
Bad Harzburg, Goslar, Niedersachsen, Jerman
Interlingua:
Bad Harzburg, Basse Saxonia, Germania
Interlingue:
Bad Harzburg, Subdistrict Goslar, Infra Saxonia, Germania
Irish Gaelic:
Bad Harzburg, An tSacsain Íochtarach, An Ghearmáin
Japanese:
バート・ハルツブルク, ゴスラー郡, ニーダーザクセン州, ドイツ
Kazakh (Cyrillic Script):
Бад-Гарцбург, Гослар, Төменгі Саксония, Германия
Kongo:
Bad Harzburg, Niedersachsen, Alemanyi
Kyrgyz:
Бад-Гарцбург, Германия
Latin:
Hartsburgum, Circulus Goslariensis, Saxonia Inferior, Germania
Ligurian:
Bad Harzburg, Bassa Sasònia, Germania
Limburgian:
Bad Harzburg, Nedersakse, Duitsland
Luxembourgish:
Bad Harzburg, Niddersachsen, Däitschland
Macedonian:
Бад Харцбург, Гослар, Долна Саксонија, Германија
Malagasy:
Bad Harzburg, Alemaina
Malay:
Bad Harzburg, Goslar, Sachsen Hilir, Jerman
Minangkabau:
Bad Harzburg, Jerman
Narom:
Bad Harzburg, Allemangne
Neapolitan:
Bad Harzburg, Germania
Norwegian:
Bad Harzburg, Niedersachsen, Tyskland
Norwegian (Nynorsk):
Bad Harzburg, Niedersachsen, Tyskland
Occitan:
Bad Harzburg, Bassa Saxònia, Alemanha
Picard:
Bad Harzburg, Alemanne
Piedmontese:
Bad Harzburg, Bassa Sassònia, Almagna
Polish:
Bad Harzburg, Powiat Goslar, Dolna Saksonia, Niemcy
Portuguese:
Bad Harzburg, Goslar, Baixa Saxônia, Alemanha
Romanian:
Bad Harzburg, Districtul Goslar, Saxonia Inferioară, Germania
Romansh:
Bad Harzburg, Saxonia Inferiura, Germania
Sardinian:
Bad Harzburg, Germania
Scots:
Bad Harzburg, Lawer Saxony, Germany
Scottish Gaelic:
Bad Harzburg, Sagsainn Ìosail, A' Ghearmailt
Serbian:
Бад Харцбург, Доња Саксонија, Њемачка
Serbo-Croatian:
Bad Harzburg, Donja Saska, Njemačka
Sicilian:
Bad Harzburg, Girmania
Slovak:
Bad Harzburg, Dolné Sasko, Nemecko
Slovenian:
Bad Harzburg, Spodnja Saška, Nemčija
South Azerbaijani:
باد هارتسبورق, نیدرزاکسن, آلمان
Swahili:
Bad Harzburg, Saksonia Chini, Ujerumani
Swedish:
Bad Harzburg, Landkreis Goslar, Niedersachsen, Tyskland
Tatar:
Бад-Һарсбург, Түбән Саксония, Алмания
Traditional Chinese:
巴德哈爾茨堡, 下薩克遜, 德國
Turkish:
Bad Harzburg, Aşağı Saksonya, Almanya
Ukrainian:
Бад-Гарцбург, Гослар, Нижня Саксонія, Німеччина
Uzbek (Latin Script):
Bad Harzburg, Goslar, Quyi Saksoniya, Germaniya
Venetian:
Bad Harzburg, Sassonia Bassa, Germania
Vietnamese:
Bad Harzburg, Goslar, Niedersachsen, Đức
Volapük:
Bad Harzburg, Dona-Saxän, Deutän
Walloon:
Bad Harzburg, Almagne
Waray:
Bad Harzburg, Goslar, Niedersachsen, Alemanya
Welsh:
Bad Harzburg, Niedersachsen, Yr Almaen
West Flemish:
Bad Harzburg, Nedersaksen, Duutsland
Wolof:
Bad Harzburg, Almaañ
Zulu:
Bad Harzburg, IJalimani
From Wikipedia:
"Bad Harzburg ([…] Eastphalian: Bad Harzborch) is a spa town in central Germany, in the Goslar district of Lower Saxony. It lies on the northern edge of the Harz mountains and is a recognised saltwater spa and climatic health resort.
Bad Harzburg is situated at the northern foot of the Harz mountain range, on the edge of the Harz National Park. To the east of the borough is the boundary between the states of Lower Saxony and Saxony-Anhalt, the former Inner German Border. The small Radau river, a tributary to the Oker, has its source in the Harz mountains and flows through the town. Nearby are the towns of Goslar to the west, Vienenburg to the north, Braunlage to the south and Ilsenburg and Osterwieck in the east.
Bad Harzburg is rich in natural resources such as gabbro, chalk, gravel, and oolithic iron ore (former Hansa Pit), all of which are or were mined in today's city's area."
"Bad Harzburg ([…] Eastphalian: Bad Harzborch) is a spa town in central Germany, in the Goslar district of Lower Saxony. It lies on the northern edge of the Harz mountains and is a recognised saltwater spa and climatic health resort.
Bad Harzburg is situated at the northern foot of the Harz mountain range, on the edge of the Harz National Park. To the east of the borough is the boundary between the states of Lower Saxony and Saxony-Anhalt, the former Inner German Border. The small Radau river, a tributary to the Oker, has its source in the Harz mountains and flows through the town. Nearby are the towns of Goslar to the west, Vienenburg to the north, Braunlage to the south and Ilsenburg and Osterwieck in the east.
Bad Harzburg is rich in natural resources such as gabbro, chalk, gravel, and oolithic iron ore (former Hansa Pit), all of which are or were mined in today's city's area."
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities139 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Adamite Formula: Zn2(AsO4)(OH) |
| ⓘ Adamite var. Copper-bearing Adamite Formula: (Zn,Cu)2AsO4OH |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Alloclasite Formula: Co1-xFexAsS |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Bytownite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Anorthite var. Labradorite Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arfvedsonite Formula: NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ 'Axinite Group' |
| ⓘ Axinite-(Mn) Formula: Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ 'Biotite var. Titanium-bearing Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Brucite Formula: Mg(OH)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Calzirtite Formula: Ca2Zr5Ti2O16 Description: Yellowish-brown grains up to 0.1 mm from blue calcite of large calc-silicate rock xenolith (Große Kalksilikatfelsscholle). References: |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ Chamosite var. Brunsvigite Formula: (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ 'Chlorite Group' |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Leuchtenbergite Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Pennine Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Epistilbite ? Formula: CaAl2Si6O16 · 5H2O Description: doubtful, no analysis published |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Forsterite Formula: Mg2(SiO4) |
| ⓘ Gadolinite-(Ce) Formula: (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ Galena Formula: PbS |
| ⓘ Gedrite Formula: ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ Gehlenite Formula: Ca2Al[AlSiO7] |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ 'Gmelinite Subgroup' |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grossular var. Hibschite Formula: Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Heterogenite Formula: Co3+O(OH) |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ 'K Feldspar' |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 |
| ⓘ Formula: Ca3Zr2(SiO4)(AlO4)2 Locality: Gabbro Quarry, Radau valley, Bad Harzburg, Goslar District, Lower Saxony, Germany - erroneously reported Description: Only as non-dominant solid-solution component in schorlomitic garnet |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Lazarenkoite Formula: (Ca,Fe2+)Fe3+As3+3O7 · 3H2O |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Ludwigite Formula: Mg2Fe3+(BO3)O2 Description: Black grains up to 0.5 mm from blue calcite of large calc-silicate rock xenolith (Große Kalksilikatfelsscholle). References: |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Manganite Formula: Mn3+O(OH) |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mesolite Formula: Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Periclase Formula: MgO |
| ⓘ Perovskite Formula: CaTiO3 Description: Reddish-brown grains up to 0.1 mm from blue calcite of large calc-silicate rock xenolith (Große Kalksilikatfelsscholle). References: |
| ⓘ 'Perrierite Subgroup' Description: Needle-like crystal up to several mm length in graphic granite veins. Single-xtl XRD gave lattice parameters of perrierite subgroup (U. Kolitsch): a = 1.373 nm, b = 0.564 nm, c = 1.181 nm, β = 113.9°. Many crystal are metamict. Composition by EPMA (D. Harries) is consistent with perrierite subgroup, material is Al- and Si-rich and possibly partially hydrated due to radiation damage. Might be an Al analogue of perrierite-(Ce), but better knowledge of crystal chemistry is needed. References: |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ 'Phillipsite Subgroup' Formula: (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ Pigeonite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Pitticite Formula: (Fe, AsO4, H2O) (?) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 Localities: |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 Description: Grain from blue calcite of calc-silicate rock xenolith (Große Kalksilikatfelsscholle). References: |
| ⓘ 'Pyrosmalite Group' Description: Forms veinlets in contactmetamorphic rocks associated with rhodonite occurences, found 2012. Powder XRD pattern is closer to schallerite than to pyrosmalite-(Mn), but SEM-EDS does not show the presence of As. SEM-EDX shows Mn, Si, Cl, O. This is likely an As-free, schallerite-like polytype of pyrosmalite-(Mn). |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Radau valley, Bad Harzburg, Goslar District, Lower Saxony, Germany Rabenklippe, Bad Harzburg, Goslar District, Lower Saxony, Germany Tatern quarry (Norit quarry; Radauberg quarry), Radau valley, Bad Harzburg, Goslar District, Lower Saxony, Germany Gabbro Quarry, Radau valley, Bad Harzburg, Goslar District, Lower Saxony, Germany Riekensglück prospect, Schmalenberg cliff, Bad Harzburg, Goslar District, Lower Saxony, Germany |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Rucklidgeite Formula: PbBi2Te4 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schorlomite Formula: Ca3Ti2(SiO4)(Fe3+O4)2 |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ 'Serpentine Subgroup var. Bastite' Formula: D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 Habit: rounded transparent aggregates, rare icositetrahedra with diagonal striations Colour: reddish-brown |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stibarsen Formula: AsSb |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Titanite Formula: CaTi(SiO4)O Habit: indistinct crystals up to 0.5mm with striations Colour: light blue, light yellowish-brown |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Verdelite' |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Tsumoite Formula: BiTe |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Yarrowite Formula: Cu9S8 |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Yarrowite | 2.CA.05d | Cu9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Tsumoite | 2.DC.05 | BiTe |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Alloclasite | 2.EB.10b | Co1-xFexAsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Rucklidgeite | 2.GC.40c | PbBi2Te4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Periclase | 4.AB.25 | MgO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Perovskite | 4.CC.30 | CaTiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Calzirtite | 4.DL.10 | Ca2Zr5Ti2O16 |
| ⓘ | Manganite | 4.FD.15 | Mn3+O(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | Lazarenkoite | 4.JC.10 | (Ca,Fe2+)Fe3+As3+3O7 · 3H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 6 - Borates | |||
| ⓘ | Ludwigite | 6.AB.30 | Mg2Fe3+(BO3)O2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Copper-bearing Adamite | 8.BB.30 | (Zn,Cu)2AsO4OH |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Pitticite | 8.DB.05 | (Fe, AsO4, H2O) (?) |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | var. Hibschite | 9.AD.25 | Ca3Al2(SiO4)3-x(OH)4x |
| ⓘ | Kimzeyite ? | 9.AD.25 | Ca3Zr2(SiO4)(AlO4)2 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Schorlomite | 9.AD.25 | Ca3Ti2(SiO4)(Fe3+O4)2 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Gadolinite-(Ce) | 9.AJ.20 | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| ⓘ | Gehlenite | 9.BB.10 | Ca2Al[AlSiO7] |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Axinite-(Mn) | 9.BD.20 | Ca2Mn2+Al2BSi4O15(OH) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Pigeonite | 9.DA.10 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Gedrite | 9.DD.05 | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Pennine | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Chamosite var. Brunsvigite | 9.EC.55 | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| ⓘ | Clinochlore var. Leuchtenbergite | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Bytownite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | var. Labradorite | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Mesolite | 9.GA.05 | Na2Ca2Si9Al6O30 · 8H2O |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Epistilbite ? | 9.GD.45 | CaAl2Si6O16 · 5H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Gmelinite Subgroup' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Phillipsite Subgroup' | - | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Serpentine Subgroup var. Bastite' | - | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Biotite var. Titanium-bearing Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Axinite Group' | - | |
| ⓘ | 'Pyrosmalite Group' | - | |
| ⓘ | 'Perrierite Subgroup' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Lazarenkoite | (Ca,Fe2+)Fe3+As33+O7 · 3H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| H | ⓘ Manganite | Mn3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| H | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| H | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| H | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Be | Beryllium | |
| Be | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| B | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | |
| C | Carbon | |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calzirtite | Ca2Zr5Ti2O16 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| O | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Lazarenkoite | (Ca,Fe2+)Fe3+As33+O7 · 3H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| O | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| O | ⓘ Manganite | Mn3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Periclase | MgO |
| O | ⓘ Perovskite | CaTiO3 |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| O | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Tourmaline var. Verdelite | |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Periclase | MgO |
| Mg | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Mg | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Al | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Al | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Si | ⓘ Gedrite | ◻Mg2(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Si | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Si | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Si | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Clinochlore var. Pennine | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Clinochlore var. Leuchtenbergite | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Alloclasite | Co1-xFexAsS |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Yarrowite | Cu9S8 |
| Cl | Chlorine | |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Anorthite var. Bytownite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Calzirtite | Ca2Zr5Ti2O16 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epistilbite | CaAl2Si6O16 · 5H2O |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Gehlenite | Ca2Al[AlSiO7] |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Grossular var. Hibschite | Ca3Al2(SiO4)3-x(OH)4x |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Ca | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Lazarenkoite | (Ca,Fe2+)Fe3+As33+O7 · 3H2O |
| Ca | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Ca | ⓘ Mesolite | Na2Ca2Si9Al6O30 · 8H2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Perovskite | CaTiO3 |
| Ca | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ca | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Calzirtite | Ca2Zr5Ti2O16 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Perovskite | CaTiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Mn | Manganese | |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Axinite-(Mn) | Ca2Mn2+Al2BSi4O15(OH) |
| Mn | ⓘ Manganite | Mn3+O(OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Alloclasite | Co1-xFexAsS |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Lazarenkoite | (Ca,Fe2+)Fe3+As33+O7 · 3H2O |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludwigite | Mg2Fe3+(BO3)O2 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Pigeonite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schorlomite | Ca3Ti2(SiO4)(Fe3+O4)2 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Fe | ⓘ Chamosite var. Brunsvigite | (Fe2+,Mg,Al)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Biotite var. Titanium-bearing Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Co | Cobalt | |
| Co | ⓘ Alloclasite | Co1-xFexAsS |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| Cu | Copper | |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Yarrowite | Cu9S8 |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Serpentine Subgroup var. Bastite | D3[Si2O5](OH)4 D= Mg, Fe, Ni, Mn, Al, Zn |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Alloclasite | Co1-xFexAsS |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Lazarenkoite | (Ca,Fe2+)Fe3+As33+O7 · 3H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Pitticite | (Fe, AsO4, H2O) (?) |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Stibarsen | AsSb |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Y | Yttrium | |
| Y | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Zr | Zirconium | |
| Zr | ⓘ Calzirtite | Ca2Zr5Ti2O16 |
| Zr | ⓘ Kimzeyite | Ca3Zr2(SiO4)(AlO4)2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Sb | Antimony | |
| Sb | ⓘ Stibarsen | AsSb |
| Te | Tellurium | |
| Te | ⓘ Rucklidgeite | PbBi2Te4 |
| Te | ⓘ Tsumoite | BiTe |
| Ba | Barium | |
| Ba | ⓘ Phillipsite Subgroup | (Ca0.5,K,Na,Ba0.5)4-7[Al4-7Si12-9O32] . 12H2O |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| La | Lanthanum | |
| La | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Nd | Neodymium | |
| Nd | ⓘ Gadolinite-(Ce) | (Ce,La,Nd,Y)2Fe2+Be2Si2O10 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Rucklidgeite | PbBi2Te4 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Rucklidgeite | PbBi2Te4 |
| Bi | ⓘ Tsumoite | BiTe |
Fossils
There are 112 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 112 | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 152 Ma (Jurassic) | ||||||||||||
| Oldest Fossil Listed | 165 Ma (Middle Jurassic) | ||||||||||||
| Stratigraphic Units |
| ||||||||||||
| Fossils from Region | Click here to show the list. | ||||||||||||
| Fossil Localities | Click to show 2 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Bad_Harzburg |
|---|---|
| Wikidata ID: | Q522459 |
| GeoNames ID: | 6558432 |
Localities in this Region
- Lower Saxony
- Goslar District
- Lower Saxony
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
Germany
- Harz MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Bad Harzburg, Goslar District, Lower Saxony, Germany